diff --git a/go.mod b/go.mod index 15390d276b..6afb231e97 100644 --- a/go.mod +++ b/go.mod @@ -12,12 +12,12 @@ require ( github.com/containernetworking/cni v1.1.2 github.com/containernetworking/plugins v1.2.0 github.com/containers/buildah v1.29.1-0.20230201192322-e56eb25575c7 - github.com/containers/common v0.51.1-0.20230228180151-18c4568e8ee0 + github.com/containers/common v0.51.1-0.20230316131336-0be880eaeb02 github.com/containers/conmon v2.0.20+incompatible - github.com/containers/image/v5 v5.24.3-0.20230228100948-357cacd18f3d + github.com/containers/image/v5 v5.24.3-0.20230314083015-0c6d07e02a9a github.com/containers/ocicrypt v1.1.7 github.com/containers/psgo v1.8.0 - github.com/containers/storage v1.45.5-0.20230228091016-4f0adb63ba4a + github.com/containers/storage v1.45.5-0.20230315220505-1c6287eea927 github.com/coreos/go-systemd/v22 v22.5.0 github.com/coreos/stream-metadata-go v0.4.1 github.com/cyphar/filepath-securejoin v0.2.3 @@ -42,9 +42,9 @@ require ( github.com/moby/term v0.0.0-20221120202655-abb19827d345 github.com/nxadm/tail v1.4.8 github.com/onsi/ginkgo v1.16.5 - github.com/onsi/gomega v1.27.2 + github.com/onsi/gomega v1.27.4 github.com/opencontainers/go-digest v1.0.0 - github.com/opencontainers/image-spec v1.1.0-rc2 + github.com/opencontainers/image-spec v1.1.0-rc2.0.20221005185240-3a7f492d3f1b github.com/opencontainers/runc v1.1.4 github.com/opencontainers/runtime-spec v1.1.0-rc.1 github.com/opencontainers/runtime-tools v0.9.1-0.20221107090550-2e043c6bd626 @@ -74,14 +74,14 @@ require ( require ( github.com/Azure/go-ansiterm v0.0.0-20210617225240-d185dfc1b5a1 // indirect github.com/Microsoft/go-winio v0.6.0 // indirect - github.com/Microsoft/hcsshim v0.9.7 // indirect + github.com/Microsoft/hcsshim v0.10.0-rc.7 // indirect github.com/VividCortex/ewma v1.2.0 // indirect github.com/acarl005/stripansi v0.0.0-20180116102854-5a71ef0e047d // indirect github.com/asaskevich/govalidator v0.0.0-20210307081110-f21760c49a8d // indirect github.com/chzyer/readline v1.5.1 // indirect - github.com/containerd/cgroups v1.0.4 // indirect - github.com/containerd/containerd v1.6.19 // indirect - github.com/containerd/stargz-snapshotter/estargz v0.14.1 // indirect + github.com/containerd/cgroups v1.1.0 // indirect + github.com/containerd/containerd v1.7.0 // indirect + github.com/containerd/stargz-snapshotter/estargz v0.14.3 // indirect github.com/containers/libtrust v0.0.0-20230121012942-c1716e8a8d01 // indirect github.com/coreos/go-oidc/v3 v3.5.0 // indirect github.com/coreos/go-systemd v0.0.0-20190719114852-fd7a80b32e1f // indirect @@ -109,7 +109,7 @@ require ( github.com/go-playground/validator/v10 v10.11.1 // indirect github.com/gogo/protobuf v1.3.2 // indirect github.com/golang/groupcache v0.0.0-20210331224755-41bb18bfe9da // indirect - github.com/golang/protobuf v1.5.2 // indirect + github.com/golang/protobuf v1.5.3 // indirect github.com/google/go-cmp v0.5.9 // indirect github.com/google/go-containerregistry v0.13.0 // indirect github.com/google/go-intervals v0.0.2 // indirect @@ -121,7 +121,7 @@ require ( github.com/inconshreveable/mousetrap v1.0.1 // indirect github.com/jinzhu/copier v0.3.5 // indirect github.com/josharian/intern v1.0.0 // indirect - github.com/klauspost/compress v1.16.0 // indirect + github.com/klauspost/compress v1.16.3 // indirect github.com/klauspost/pgzip v1.2.6-0.20220930104621-17e8dac29df8 // indirect github.com/kr/fs v0.1.0 // indirect github.com/leodido/go-urn v1.2.1 // indirect @@ -150,10 +150,10 @@ require ( github.com/segmentio/ksuid v1.0.4 // indirect github.com/sigstore/fulcio v1.1.0 // indirect github.com/sigstore/rekor v1.0.1 // indirect - github.com/sigstore/sigstore v1.5.2 // indirect + github.com/sigstore/sigstore v1.6.0 // indirect github.com/skratchdot/open-golang v0.0.0-20200116055534-eef842397966 // indirect github.com/stefanberger/go-pkcs11uri v0.0.0-20201008174630-78d3cae3a980 // indirect - github.com/sylabs/sif/v2 v2.10.0 // indirect + github.com/sylabs/sif/v2 v2.11.0 // indirect github.com/tchap/go-patricia/v2 v2.3.1 // indirect github.com/theupdateframework/go-tuf v0.5.2 // indirect github.com/titanous/rocacheck v0.0.0-20171023193734-afe73141d399 // indirect @@ -162,13 +162,13 @@ require ( go.mongodb.org/mongo-driver v1.11.1 // indirect go.mozilla.org/pkcs7 v0.0.0-20210826202110-33d05740a352 // indirect go.opencensus.io v0.24.0 // indirect - golang.org/x/crypto v0.6.0 // indirect - golang.org/x/exp v0.0.0-20230206171751-46f607a40771 // indirect - golang.org/x/mod v0.8.0 // indirect - golang.org/x/oauth2 v0.5.0 // indirect - golang.org/x/tools v0.6.0 // indirect + golang.org/x/crypto v0.7.0 // indirect + golang.org/x/exp v0.0.0-20230310171629-522b1b587ee0 // indirect + golang.org/x/mod v0.9.0 // indirect + golang.org/x/oauth2 v0.6.0 // indirect + golang.org/x/tools v0.7.0 // indirect google.golang.org/appengine v1.6.7 // indirect - google.golang.org/genproto v0.0.0-20230209215440-0dfe4f8abfcc // indirect + google.golang.org/genproto v0.0.0-20230306155012-7f2fa6fef1f4 // indirect google.golang.org/grpc v1.53.0 // indirect gopkg.in/go-jose/go-jose.v2 v2.6.1 // indirect gopkg.in/square/go-jose.v2 v2.6.0 // indirect diff --git a/go.sum b/go.sum index c49c5f49d0..4bdcd6d756 100644 --- a/go.sum +++ b/go.sum @@ -69,8 +69,8 @@ github.com/Microsoft/hcsshim v0.8.21/go.mod h1:+w2gRZ5ReXQhFOrvSQeNfhrYB/dg3oDwT github.com/Microsoft/hcsshim v0.8.22/go.mod h1:91uVCVzvX2QD16sMCenoxxXo6L1wJnLMX2PSufFMtF0= github.com/Microsoft/hcsshim v0.8.23/go.mod h1:4zegtUJth7lAvFyc6cH2gGQ5B3OFQim01nnU2M8jKDg= github.com/Microsoft/hcsshim v0.9.4/go.mod h1:7pLA8lDk46WKDWlVsENo92gC0XFa8rbKfyFRBqxEbCc= -github.com/Microsoft/hcsshim v0.9.7 h1:mKNHW/Xvv1aFH87Jb6ERDzXTJTLPlmzfZ28VBFD/bfg= -github.com/Microsoft/hcsshim v0.9.7/go.mod h1:7pLA8lDk46WKDWlVsENo92gC0XFa8rbKfyFRBqxEbCc= +github.com/Microsoft/hcsshim v0.10.0-rc.7 h1:HBytQPxcv8Oy4244zbQbe6hnOnx544eL5QPUqhJldz8= +github.com/Microsoft/hcsshim v0.10.0-rc.7/go.mod h1:ILuwjA+kNW+MrN/w5un7n3mTqkwsFu4Bp05/okFUZlE= github.com/Microsoft/hcsshim/test v0.0.0-20201218223536-d3e5debf77da/go.mod h1:5hlzMzRKMLyo42nCZ9oml8AdTlq/0cvIaBv6tK1RehU= github.com/Microsoft/hcsshim/test v0.0.0-20210227013316-43a75bb4edd3/go.mod h1:mw7qgWloBUl75W/gVH3cQszUg1+gUITj7D6NY7ywVnY= github.com/NYTimes/gziphandler v0.0.0-20170623195520-56545f4a5d46/go.mod h1:3wb06e3pkSAbeQ52E9H9iFoQsEEwGN64994WTCIhntQ= @@ -162,8 +162,8 @@ github.com/containerd/cgroups v0.0.0-20200710171044-318312a37340/go.mod h1:s5q4S github.com/containerd/cgroups v0.0.0-20200824123100-0b889c03f102/go.mod h1:s5q4SojHctfxANBDvMeIaIovkq29IP48TKAxnhYRxvo= github.com/containerd/cgroups v0.0.0-20210114181951-8a68de567b68/go.mod h1:ZJeTFisyysqgcCdecO57Dj79RfL0LNeGiFUqLYQRYLE= github.com/containerd/cgroups v1.0.1/go.mod h1:0SJrPIenamHDcZhEcJMNBB85rHcUsw4f25ZfBiPYRkU= -github.com/containerd/cgroups v1.0.4 h1:jN/mbWBEaz+T1pi5OFtnkQ+8qnmEbAr1Oo1FRm5B0dA= -github.com/containerd/cgroups v1.0.4/go.mod h1:nLNQtsF7Sl2HxNebu77i1R0oDlhiTG+kO4JTrUzo6IA= +github.com/containerd/cgroups v1.1.0 h1:v8rEWFl6EoqHB+swVNjVoCJE8o3jX7e8nqBGPLaDFBM= +github.com/containerd/cgroups v1.1.0/go.mod h1:6ppBcbh/NOOUU+dMKrykgaBnK9lCIBxHqJDGwsa1mIw= github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1/go.mod h1:Tj/on1eG8kiEhd0+fhSDzsPAFESxzBBvdyEgyryXffw= github.com/containerd/console v0.0.0-20181022165439-0650fd9eeb50/go.mod h1:Tj/on1eG8kiEhd0+fhSDzsPAFESxzBBvdyEgyryXffw= github.com/containerd/console v0.0.0-20191206165004-02ecf6a7291e/go.mod h1:8Pf4gM6VEbTNRIT26AyyU7hxdQU3MvAvxVI0sc00XBE= @@ -186,8 +186,8 @@ github.com/containerd/containerd v1.5.0-rc.0/go.mod h1:V/IXoMqNGgBlabz3tHD2TWDoT github.com/containerd/containerd v1.5.1/go.mod h1:0DOxVqwDy2iZvrZp2JUx/E+hS0UNTVn7dJnIOwtYR4g= github.com/containerd/containerd v1.5.7/go.mod h1:gyvv6+ugqY25TiXxcZC3L5yOeYgEw0QMhscqVp1AR9c= github.com/containerd/containerd v1.5.9/go.mod h1:fvQqCfadDGga5HZyn3j4+dx56qj2I9YwBrlSdalvJYQ= -github.com/containerd/containerd v1.6.19 h1:F0qgQPrG0P2JPgwpxWxYavrVeXAG0ezUIB9Z/4FTUAU= -github.com/containerd/containerd v1.6.19/go.mod h1:HZCDMn4v/Xl2579/MvtOC2M206i+JJ6VxFWU/NetrGY= +github.com/containerd/containerd v1.7.0 h1:G/ZQr3gMZs6ZT0qPUZ15znx5QSdQdASW11nXTLTM2Pg= +github.com/containerd/containerd v1.7.0/go.mod h1:QfR7Efgb/6X2BDpTPJRvPTYDE9rsF0FsXX9J8sIs/sc= github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y= github.com/containerd/continuity v0.0.0-20190815185530-f2a389ac0a02/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y= github.com/containerd/continuity v0.0.0-20191127005431-f65d91d395eb/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y= @@ -219,8 +219,8 @@ github.com/containerd/nri v0.1.0/go.mod h1:lmxnXF6oMkbqs39FiCt1s0R2HSMhcLel9vNL3 github.com/containerd/stargz-snapshotter/estargz v0.4.1/go.mod h1:x7Q9dg9QYb4+ELgxmo4gBUeJB0tl5dqH1Sdz0nJU1QM= github.com/containerd/stargz-snapshotter/estargz v0.9.0/go.mod h1:aE5PCyhFMwR8sbrErO5eM2GcvkyXTTJremG883D4qF0= github.com/containerd/stargz-snapshotter/estargz v0.12.0/go.mod h1:AIQ59TewBFJ4GOPEQXujcrJ/EKxh5xXZegW1rkR1P/M= -github.com/containerd/stargz-snapshotter/estargz v0.14.1 h1:n9M2GDSWM96pyipFTA0DaU+zdtzi3Iwsnj/rIHr1yFM= -github.com/containerd/stargz-snapshotter/estargz v0.14.1/go.mod h1:uPtMw6ucGJYwImjhxk/oghZmfElF/841u86wReNggNk= +github.com/containerd/stargz-snapshotter/estargz v0.14.3 h1:OqlDCK3ZVUO6C3B/5FSkDwbkEETK84kQgEeFwDC+62k= +github.com/containerd/stargz-snapshotter/estargz v0.14.3/go.mod h1:KY//uOCIkSuNAHhJogcZtrNHdKrA99/FCCRjE3HD36o= github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de/go.mod h1:PvCDdDGpgqzQIzDW1TphrGLssLDZp2GuS+X5DkEJB8o= github.com/containerd/ttrpc v0.0.0-20190828172938-92c8520ef9f8/go.mod h1:PvCDdDGpgqzQIzDW1TphrGLssLDZp2GuS+X5DkEJB8o= github.com/containerd/ttrpc v0.0.0-20191028202541-4f1b8fe65a5c/go.mod h1:LPm1u0xBw8r8NOKoOdNMeVHSawSsltak+Ihv+etqsE8= @@ -247,12 +247,12 @@ github.com/containernetworking/plugins v1.2.0 h1:SWgg3dQG1yzUo4d9iD8cwSVh1VqI+bP github.com/containernetworking/plugins v1.2.0/go.mod h1:/VjX4uHecW5vVimFa1wkG4s+r/s9qIfPdqlLF4TW8c4= github.com/containers/buildah v1.29.1-0.20230201192322-e56eb25575c7 h1:GmQhTfsGuYgGfuYWEF4Ed+rEvlSWRmxisLBL2J8rCb4= github.com/containers/buildah v1.29.1-0.20230201192322-e56eb25575c7/go.mod h1:sFvOi+WMtMtrkxx1Dn8EhF5/ddXNyC1f5LAj4ZGzjAs= -github.com/containers/common v0.51.1-0.20230228180151-18c4568e8ee0 h1:g8FmAD7WLVOlb3KmMmkyvqdGYKe6kpSMDZQRNBscn+0= -github.com/containers/common v0.51.1-0.20230228180151-18c4568e8ee0/go.mod h1:kX/fAMQUWvpQjGxA2oWfGVFDbthXotP7S6VpO0/qr/I= +github.com/containers/common v0.51.1-0.20230316131336-0be880eaeb02 h1:u8ahsfyLhCnTCbxzBuFbcQdGFx2dvz9RWMCe5yNISZ0= +github.com/containers/common v0.51.1-0.20230316131336-0be880eaeb02/go.mod h1:RyY5B1E+PsFnZOW28xgFkjce0oCAMN7c/zskaCYmAkQ= github.com/containers/conmon v2.0.20+incompatible h1:YbCVSFSCqFjjVwHTPINGdMX1F6JXHGTUje2ZYobNrkg= github.com/containers/conmon v2.0.20+incompatible/go.mod h1:hgwZ2mtuDrppv78a/cOBNiCm6O0UMWGx1mu7P00nu5I= -github.com/containers/image/v5 v5.24.3-0.20230228100948-357cacd18f3d h1:/P6P7XFNdp8FjXcPfON0Hq9gn1ic6pBkryiNCHK6Ou0= -github.com/containers/image/v5 v5.24.3-0.20230228100948-357cacd18f3d/go.mod h1:Kl2OpViBDIaYHblk9frsnOdXEsQD0E0/jYUo9qI8Ksc= +github.com/containers/image/v5 v5.24.3-0.20230314083015-0c6d07e02a9a h1:2xIif78r5x2nmdb5uhjXBZuexiDAt1c/XIXFxFhfKSk= +github.com/containers/image/v5 v5.24.3-0.20230314083015-0c6d07e02a9a/go.mod h1:9PM/hiCVTh6dt8Swi7eYKXKHIaPabHn8gtFV2YD44Mk= github.com/containers/libtrust v0.0.0-20230121012942-c1716e8a8d01 h1:Qzk5C6cYglewc+UyGf6lc8Mj2UaPTHy/iF2De0/77CA= github.com/containers/libtrust v0.0.0-20230121012942-c1716e8a8d01/go.mod h1:9rfv8iPl1ZP7aqh9YA68wnZv2NUDbXdcdPHVz0pFbPY= github.com/containers/ocicrypt v1.0.1/go.mod h1:MeJDzk1RJHv89LjsH0Sp5KTY3ZYkjXO/C+bKAeWFIrc= @@ -264,8 +264,8 @@ github.com/containers/psgo v1.8.0 h1:2loGekmGAxM9ir5OsXWEfGwFxorMPYnc6gEDsGFQvhY github.com/containers/psgo v1.8.0/go.mod h1:T8ZxnX3Ur4RvnhxFJ7t8xJ1F48RhiZB4rSrOaR/qGHc= github.com/containers/storage v1.37.0/go.mod h1:kqeJeS0b7DO2ZT1nVWs0XufrmPFbgV3c+Q/45RlH6r4= github.com/containers/storage v1.43.0/go.mod h1:uZ147thiIFGdVTjMmIw19knttQnUCl3y9zjreHrg11s= -github.com/containers/storage v1.45.5-0.20230228091016-4f0adb63ba4a h1:zuUWQFAZn9cpf0wAIegcUvDIY0Zt+tF1htplAP5q+/E= -github.com/containers/storage v1.45.5-0.20230228091016-4f0adb63ba4a/go.mod h1:Xw0wkMKKKO9HNK9cjm2mQWmpJ/44iZ973zpDmnRzP+s= +github.com/containers/storage v1.45.5-0.20230315220505-1c6287eea927 h1:VGSwgqH/hBZqlWR48MFNrpT4meMzj+fVg6SYM2uSWWA= +github.com/containers/storage v1.45.5-0.20230315220505-1c6287eea927/go.mod h1:tNwkJMFiChoEURP+ofq34pGRysOoFk/QCVrdmS1EzPI= github.com/coreos/bbolt v1.3.2/go.mod h1:iRUV2dpdMOn7Bo10OQBFzIJO9kkE559Wcmn+qkEiiKk= github.com/coreos/etcd v3.3.10+incompatible/go.mod h1:uF7uidLiAD3TWHmW31ZFd/JWoc32PjwdhPthX9715RE= github.com/coreos/go-iptables v0.4.5/go.mod h1:/mVI274lEDI2ns62jHCDnCyBF9Iwsmekav8Dbxlm1MU= @@ -525,8 +525,9 @@ github.com/golang/protobuf v1.4.1/go.mod h1:U8fpvMrcmy5pZrNK1lt4xCsGvpyWQ/VVv6QD github.com/golang/protobuf v1.4.2/go.mod h1:oDoupMAO8OvCJWAcko0GGGIgR6R6ocIYbsSw735rRwI= github.com/golang/protobuf v1.4.3/go.mod h1:oDoupMAO8OvCJWAcko0GGGIgR6R6ocIYbsSw735rRwI= github.com/golang/protobuf v1.5.0/go.mod h1:FsONVRAS9T7sI+LIUmWTfcYkHO4aIWwzhcaSAoJOfIk= -github.com/golang/protobuf v1.5.2 h1:ROPKBNFfQgOUMifHyP+KYbvpjbdoFNs+aK7DXlji0Tw= github.com/golang/protobuf v1.5.2/go.mod h1:XVQd3VNwM+JqD3oG2Ue2ip4fOMUkwXdXDdiuN0vRsmY= +github.com/golang/protobuf v1.5.3 h1:KhyjKVUg7Usr/dYsdSqoFveMYd5ko72D+zANwlG1mmg= +github.com/golang/protobuf v1.5.3/go.mod h1:XVQd3VNwM+JqD3oG2Ue2ip4fOMUkwXdXDdiuN0vRsmY= github.com/golang/snappy v0.0.1/go.mod h1:/XxbfmMg8lxefKM7IXC3fBNl/7bRcc72aCRzEWrmP2Q= github.com/google/btree v0.0.0-20180813153112-4030bb1f1f0c/go.mod h1:lNA+9X1NB3Zf8V7Ke586lFgjr2dZNuvo3lPJSGZ5JPQ= github.com/google/btree v1.0.0/go.mod h1:lNA+9X1NB3Zf8V7Ke586lFgjr2dZNuvo3lPJSGZ5JPQ= @@ -659,8 +660,8 @@ github.com/klauspost/compress v1.11.13/go.mod h1:aoV0uJVorq1K+umq18yTdKaF57EivdY github.com/klauspost/compress v1.13.6/go.mod h1:/3/Vjq9QcHkK5uEr5lBEmyoZ1iFhe47etQ6QUkpK6sk= github.com/klauspost/compress v1.15.7/go.mod h1:PhcZ0MbTNciWF3rruxRgKxI5NkcHHrHUDtV4Yw2GlzU= github.com/klauspost/compress v1.15.9/go.mod h1:PhcZ0MbTNciWF3rruxRgKxI5NkcHHrHUDtV4Yw2GlzU= -github.com/klauspost/compress v1.16.0 h1:iULayQNOReoYUe+1qtKOqw9CwJv3aNQu8ivo7lw1HU4= -github.com/klauspost/compress v1.16.0/go.mod h1:ntbaceVETuRiXiv4DpjP66DpAtAGkEQskQzEyD//IeE= +github.com/klauspost/compress v1.16.3 h1:XuJt9zzcnaz6a16/OU53ZjWp/v7/42WcR5t2a0PcNQY= +github.com/klauspost/compress v1.16.3/go.mod h1:ntbaceVETuRiXiv4DpjP66DpAtAGkEQskQzEyD//IeE= github.com/klauspost/pgzip v1.2.5/go.mod h1:Ch1tH69qFZu15pkjo5kYi6mth2Zzwzt50oCQKQE9RUs= github.com/klauspost/pgzip v1.2.6-0.20220930104621-17e8dac29df8 h1:BcxbplxjtczA1a6d3wYoa7a0WL3rq9DKBMGHeKyjEF0= github.com/klauspost/pgzip v1.2.6-0.20220930104621-17e8dac29df8/go.mod h1:Ch1tH69qFZu15pkjo5kYi6mth2Zzwzt50oCQKQE9RUs= @@ -781,7 +782,7 @@ github.com/onsi/ginkgo v1.16.4/go.mod h1:dX+/inL/fNMqNlz0e9LfyB9TswhZpCVdJM/Z6Vv github.com/onsi/ginkgo v1.16.5 h1:8xi0RTUf59SOSfEtZMvwTvXYMzG4gV23XVHOZiXNtnE= github.com/onsi/ginkgo v1.16.5/go.mod h1:+E8gABHa3K6zRBolWtd+ROzc/U5bkGt0FwiG042wbpU= github.com/onsi/ginkgo/v2 v2.1.3/go.mod h1:vw5CSIxN1JObi/U8gcbwft7ZxR2dgaR70JSE3/PpL4c= -github.com/onsi/ginkgo/v2 v2.8.4 h1:gf5mIQ8cLFieruNLAdgijHF1PYfLphKm2dxxcUtcqK0= +github.com/onsi/ginkgo/v2 v2.9.1 h1:zie5Ly042PD3bsCvsSOPvRnFwyo3rKe64TJlD6nu0mk= github.com/onsi/gomega v0.0.0-20151007035656-2152b45fa28a/go.mod h1:C1qb7wdrVGGVU+Z6iS04AVkA3Q65CEZX59MT0QO5uiA= github.com/onsi/gomega v0.0.0-20170829124025-dcabb60a477c/go.mod h1:C1qb7wdrVGGVU+Z6iS04AVkA3Q65CEZX59MT0QO5uiA= github.com/onsi/gomega v1.5.0/go.mod h1:ex+gbHU/CVuBBDIJjb2X0qEXbFg53c61hWP/1CpauHY= @@ -791,8 +792,8 @@ github.com/onsi/gomega v1.9.0/go.mod h1:Ho0h+IUsWyvy1OpqCwxlQ/21gkhVunqlU8fDGcoT github.com/onsi/gomega v1.10.1/go.mod h1:iN09h71vgCQne3DLsj+A5owkum+a2tYe+TOCB1ybHNo= github.com/onsi/gomega v1.10.3/go.mod h1:V9xEwhxec5O8UDM77eCW8vLymOMltsqPVYWrpDsH8xc= github.com/onsi/gomega v1.17.0/go.mod h1:HnhC7FXeEQY45zxNK3PPoIUhzk/80Xly9PcubAlGdZY= -github.com/onsi/gomega v1.27.2 h1:SKU0CXeKE/WVgIV1T61kSa3+IRE8Ekrv9rdXDwwTqnY= -github.com/onsi/gomega v1.27.2/go.mod h1:5mR3phAHpkAVIDkHEUBY6HGVsU+cpcEscrGPB4oPlZI= +github.com/onsi/gomega v1.27.4 h1:Z2AnStgsdSayCMDiCU42qIz+HLqEPcgiOCXjAU/w+8E= +github.com/onsi/gomega v1.27.4/go.mod h1:riYq/GJKh8hhoM01HN6Vmuy93AarCXCBGpvFDK3q3fQ= github.com/opencontainers/go-digest v0.0.0-20170106003457-a6d0ee40d420/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s= github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s= github.com/opencontainers/go-digest v1.0.0-rc1/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s= @@ -802,8 +803,8 @@ github.com/opencontainers/go-digest v1.0.0/go.mod h1:0JzlMkj0TRzQZfJkVvzbP0HBR3I github.com/opencontainers/image-spec v1.0.0/go.mod h1:BtxoFyWECRxE4U/7sNtV5W15zMzWCbyJoFRP3s7yZA0= github.com/opencontainers/image-spec v1.0.1/go.mod h1:BtxoFyWECRxE4U/7sNtV5W15zMzWCbyJoFRP3s7yZA0= github.com/opencontainers/image-spec v1.0.2/go.mod h1:BtxoFyWECRxE4U/7sNtV5W15zMzWCbyJoFRP3s7yZA0= -github.com/opencontainers/image-spec v1.1.0-rc2 h1:2zx/Stx4Wc5pIPDvIxHXvXtQFW/7XWJGmnM7r3wg034= -github.com/opencontainers/image-spec v1.1.0-rc2/go.mod h1:3OVijpioIKYWTqjiG0zfF6wvoJ4fAXGbjdZuI2NgsRQ= +github.com/opencontainers/image-spec v1.1.0-rc2.0.20221005185240-3a7f492d3f1b h1:YWuSjZCQAPM8UUBLkYUk1e+rZcvWHJmFb6i6rM44Xs8= +github.com/opencontainers/image-spec v1.1.0-rc2.0.20221005185240-3a7f492d3f1b/go.mod h1:3OVijpioIKYWTqjiG0zfF6wvoJ4fAXGbjdZuI2NgsRQ= github.com/opencontainers/runc v1.1.1-0.20220617142545-8b9452f75cbc h1:qjkUzmFsOFbQyjObybk40mRida83j5IHRaKzLGdBbEU= github.com/opencontainers/runc v1.1.1-0.20220617142545-8b9452f75cbc/go.mod h1:wUOQGsiKae6VzA/UvlCK3cO+pHk8F2VQHlIoITEfMM8= github.com/opencontainers/runtime-spec v0.1.2-0.20190507144316-5b71a03e2700/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0= @@ -911,8 +912,8 @@ github.com/sigstore/fulcio v1.1.0 h1:mzzJ05Ccu8Y2inyioklNvc8MpzlGHxu8YqNeTm0dHfU github.com/sigstore/fulcio v1.1.0/go.mod h1:zv1ZQTXZbUwQdRwajlQksc34pRas+2aZYpIZoQBNev8= github.com/sigstore/rekor v1.0.1 h1:rcESXSNkAPRWFYZel9rarspdvneET60F2ngNkadi89c= github.com/sigstore/rekor v1.0.1/go.mod h1:ecTKdZWGWqE1pl3U1m1JebQJLU/hSjD9vYHOmHQ7w4g= -github.com/sigstore/sigstore v1.5.2 h1:rvZSPJDH2ysoc8kjW9v4nv1UX3XwSA8y4x6Dk7hA0D4= -github.com/sigstore/sigstore v1.5.2/go.mod h1:wxhp9KoaOpeb1VLKILruD283KJqPSqX+3TuBByVDZ6E= +github.com/sigstore/sigstore v1.6.0 h1:0fYHVoUlPU3WM8o3U1jT9SI2lqQE68XbG+qWncXaZC8= +github.com/sigstore/sigstore v1.6.0/go.mod h1:+55pf6HZ15kf60c08W+GH95JQbAcnVyUBquQGSVdsto= github.com/sirupsen/logrus v1.0.4-0.20170822132746-89742aefa4b2/go.mod h1:pMByvHTf9Beacp5x1UXfOR9xyW/9antXMhjMPG0dEzc= github.com/sirupsen/logrus v1.0.6/go.mod h1:pMByvHTf9Beacp5x1UXfOR9xyW/9antXMhjMPG0dEzc= github.com/sirupsen/logrus v1.2.0/go.mod h1:LxeOpSwHxABJmUn/MG1IvRgCAasNZTLOkJPxbbu5VWo= @@ -968,8 +969,8 @@ github.com/stretchr/testify v1.8.0/go.mod h1:yNjHg4UonilssWZ8iaSj1OCr/vHnekPRkoO github.com/stretchr/testify v1.8.1/go.mod h1:w2LPCIKwWwSfY2zedu0+kehJoqGctiVI29o6fzry7u4= github.com/stretchr/testify v1.8.2 h1:+h33VjcLVPDHtOdpUCuF+7gSuG3yGIftsP1YvFihtJ8= github.com/stretchr/testify v1.8.2/go.mod h1:w2LPCIKwWwSfY2zedu0+kehJoqGctiVI29o6fzry7u4= -github.com/sylabs/sif/v2 v2.10.0 h1:x4H0dsWIJqC6Af+qZdDMs8bjyBM5YJfohKM9WY/Uk7c= -github.com/sylabs/sif/v2 v2.10.0/go.mod h1:cI1JzRQS0lBZtSFpKaf4nLXnPvMK/Q0dBPR7ebe2BHA= +github.com/sylabs/sif/v2 v2.11.0 h1:s1oEFZCb1TX22zT3Twb4tY0X8CVfpo9IEZfhgZzCP+4= +github.com/sylabs/sif/v2 v2.11.0/go.mod h1:i4GcKLOaT4ertznbsuf11d/G9zLEfUZa7YhrFc5L6YQ= github.com/syndtr/gocapability v0.0.0-20170704070218-db04d3cc01c8/go.mod h1:hkRG7XYTFWNJGYcbNJQlaLq0fg1yr4J4t/NcTQtrfww= github.com/syndtr/gocapability v0.0.0-20180916011248-d98352740cb2/go.mod h1:hkRG7XYTFWNJGYcbNJQlaLq0fg1yr4J4t/NcTQtrfww= github.com/syndtr/gocapability v0.0.0-20200815063812-42c35b437635 h1:kdXcSzyDtseVEc4yCz2qF8ZrQvIDBJLl4S1c3GCXmoI= @@ -1090,8 +1091,8 @@ golang.org/x/crypto v0.0.0-20210322153248-0c34fe9e7dc2/go.mod h1:T9bdIzuCu7OtxOm golang.org/x/crypto v0.0.0-20210921155107-089bfa567519/go.mod h1:GvvjBRRGRdwPK5ydBHafDWAxML/pGHZbMvKqRZ5+Abc= golang.org/x/crypto v0.0.0-20211215153901-e495a2d5b3d3/go.mod h1:IxCIyHEi3zRg3s0A5j5BB6A9Jmi73HwBIUl50j+osU4= golang.org/x/crypto v0.0.0-20220622213112-05595931fe9d/go.mod h1:IxCIyHEi3zRg3s0A5j5BB6A9Jmi73HwBIUl50j+osU4= -golang.org/x/crypto v0.6.0 h1:qfktjS5LUO+fFKeJXZ+ikTRijMmljikvG68fpMMruSc= -golang.org/x/crypto v0.6.0/go.mod h1:OFC/31mSvZgRz0V1QTNCzfAI1aIRzbiufJtkMIlEp58= +golang.org/x/crypto v0.7.0 h1:AvwMYaRytfdeVt3u6mLaxYtErKYjxA2OXjJ1HHq6t3A= +golang.org/x/crypto v0.7.0/go.mod h1:pYwdfH91IfpZVANVyUOhSIPZaFoJGxTFbZhFTx+dXZU= golang.org/x/exp v0.0.0-20190121172915-509febef88a4/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA= golang.org/x/exp v0.0.0-20190306152737-a1d7652674e8/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA= golang.org/x/exp v0.0.0-20190510132918-efd6b22b2522/go.mod h1:ZjyILWgesfNpC6sMxTJOJm9Kp84zZh5NQWvqDGG3Qr8= @@ -1102,8 +1103,8 @@ golang.org/x/exp v0.0.0-20191227195350-da58074b4299/go.mod h1:2RIsYlXP63K8oxa1u0 golang.org/x/exp v0.0.0-20200119233911-0405dc783f0a/go.mod h1:2RIsYlXP63K8oxa1u096TMicItID8zy7Y6sNkU49FU4= golang.org/x/exp v0.0.0-20200207192155-f17229e696bd/go.mod h1:J/WKrq2StrnmMY6+EHIKF9dgMWnmCNThgcyBT1FY9mM= golang.org/x/exp v0.0.0-20200224162631-6cc2880d07d6/go.mod h1:3jZMyOhIsHpP37uCMkUooju7aAi5cS1Q23tOzKc+0MU= -golang.org/x/exp v0.0.0-20230206171751-46f607a40771 h1:xP7rWLUr1e1n2xkK5YB4LI0hPEy3LJC6Wk+D4pGlOJg= -golang.org/x/exp v0.0.0-20230206171751-46f607a40771/go.mod h1:CxIveKay+FTh1D0yPZemJVgC/95VzuuOLq5Qi4xnoYc= +golang.org/x/exp v0.0.0-20230310171629-522b1b587ee0 h1:LGJsf5LRplCck6jUCH3dBL2dmycNruWNF5xugkSlfXw= +golang.org/x/exp v0.0.0-20230310171629-522b1b587ee0/go.mod h1:CxIveKay+FTh1D0yPZemJVgC/95VzuuOLq5Qi4xnoYc= golang.org/x/image v0.0.0-20190227222117-0694c2d4d067/go.mod h1:kZ7UVZpmo3dzQBMxlp+ypCbDeSB+sBbTgSJuh5dn5js= golang.org/x/image v0.0.0-20190802002840-cff245a6509b/go.mod h1:FeLwcggjj3mMvU+oOTbSwawSJRM1uh48EjtB4UJZlP0= golang.org/x/lint v0.0.0-20181026193005-c67002cb31c3/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE= @@ -1126,8 +1127,8 @@ golang.org/x/mod v0.2.0/go.mod h1:s0Qsj1ACt9ePp/hMypM3fl4fZqREWJwdYDEqhRiZZUA= golang.org/x/mod v0.3.0/go.mod h1:s0Qsj1ACt9ePp/hMypM3fl4fZqREWJwdYDEqhRiZZUA= golang.org/x/mod v0.4.2/go.mod h1:s0Qsj1ACt9ePp/hMypM3fl4fZqREWJwdYDEqhRiZZUA= golang.org/x/mod v0.6.0-dev.0.20220419223038-86c51ed26bb4/go.mod h1:jJ57K6gSWd91VN4djpZkiMVwK6gcyfeH4XE8wZrZaV4= -golang.org/x/mod v0.8.0 h1:LUYupSeNrTNCGzR/hVBk2NHZO4hXcVaW1k4Qx7rjPx8= -golang.org/x/mod v0.8.0/go.mod h1:iBbtSCu2XBx23ZKBPSOrRkjjQPZFPuis4dIYUhu/chs= +golang.org/x/mod v0.9.0 h1:KENHtAZL2y3NLMYZeHY9DW8HW8V+kQyJsY/V9JlKvCs= +golang.org/x/mod v0.9.0/go.mod h1:iBbtSCu2XBx23ZKBPSOrRkjjQPZFPuis4dIYUhu/chs= golang.org/x/net v0.0.0-20180724234803-3673e40ba225/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= golang.org/x/net v0.0.0-20180826012351-8a410e7b638d/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= golang.org/x/net v0.0.0-20180906233101-161cd47e91fd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= @@ -1185,8 +1186,8 @@ golang.org/x/oauth2 v0.0.0-20190604053449-0f29369cfe45/go.mod h1:gOpvHmFTYa4Iltr golang.org/x/oauth2 v0.0.0-20191202225959-858c2ad4c8b6/go.mod h1:gOpvHmFTYa4IltrdGE7lF6nIHvwfUNPOp7c8zoXwtLw= golang.org/x/oauth2 v0.0.0-20200107190931-bf48bf16ab8d/go.mod h1:gOpvHmFTYa4IltrdGE7lF6nIHvwfUNPOp7c8zoXwtLw= golang.org/x/oauth2 v0.3.0/go.mod h1:rQrIauxkUhJ6CuwEXwymO2/eh4xz2ZWF1nBkcxS+tGk= -golang.org/x/oauth2 v0.5.0 h1:HuArIo48skDwlrvM3sEdHXElYslAMsf3KwRkkW4MC4s= -golang.org/x/oauth2 v0.5.0/go.mod h1:9/XBHVqLaWO3/BRHs5jbpYCnOZVjj5V0ndyaAM7KB4I= +golang.org/x/oauth2 v0.6.0 h1:Lh8GPgSKBfWSwFvtuWOfeI3aAAnbXTSutYxJiOJFgIw= +golang.org/x/oauth2 v0.6.0/go.mod h1:ycmewcwgD4Rpr3eZJLSB4Kyyljb3qDh40vJ8STE5HKw= golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= golang.org/x/sync v0.0.0-20181108010431-42b317875d0f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= golang.org/x/sync v0.0.0-20181221193216-37e7f081c4d4/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= @@ -1370,8 +1371,8 @@ golang.org/x/tools v0.0.0-20201224043029-2b0845dc783e/go.mod h1:emZCQorbCU4vsT4f golang.org/x/tools v0.0.0-20210106214847-113979e3529a/go.mod h1:emZCQorbCU4vsT4fOWvOPXz4eW1wZW4PmDk9uLelYpA= golang.org/x/tools v0.1.1/go.mod h1:o0xws9oXOQQZyjljx8fwUC0k7L1pTE6eaCbjGeHmOkk= golang.org/x/tools v0.1.12/go.mod h1:hNGJHUnrk76NpqgfD5Aqm5Crs+Hm0VOH/i9J2+nxYbc= -golang.org/x/tools v0.6.0 h1:BOw41kyTf3PuCW1pVQf8+Cyg8pMlkYB1oo9iJ6D/lKM= -golang.org/x/tools v0.6.0/go.mod h1:Xwgl3UAJ/d3gWutnCtw505GrjyAbvKui8lOU390QaIU= +golang.org/x/tools v0.7.0 h1:W4OVu8VVOaIO0yzWMNdepAulS7YfoS3Zabrm8DOXXU4= +golang.org/x/tools v0.7.0/go.mod h1:4pg6aUX35JBAogB10C9AtvVL+qowtN4pT3CGSQex14s= golang.org/x/xerrors v0.0.0-20190717185122-a985d3407aa7/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0= golang.org/x/xerrors v0.0.0-20191011141410-1b5146add898/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0= golang.org/x/xerrors v0.0.0-20191204190536-9bdfabe68543/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0= @@ -1422,8 +1423,8 @@ google.golang.org/genproto v0.0.0-20200513103714-09dca8ec2884/go.mod h1:55QSHmfG google.golang.org/genproto v0.0.0-20200526211855-cb27e3aa2013/go.mod h1:NbSheEEYHJ7i3ixzK3sjbqSGDJWnxyFXZblF3eUsNvo= google.golang.org/genproto v0.0.0-20200527145253-8367513e4ece/go.mod h1:jDfRM7FcilCzHH/e9qn6dsT145K34l5v+OpcnNgKAAA= google.golang.org/genproto v0.0.0-20201110150050-8816d57aaa9a/go.mod h1:FWY/as6DDZQgahTzZj3fqbO1CbirC29ZNUFHwi0/+no= -google.golang.org/genproto v0.0.0-20230209215440-0dfe4f8abfcc h1:ijGwO+0vL2hJt5gaygqP2j6PfflOBrRot0IczKbmtio= -google.golang.org/genproto v0.0.0-20230209215440-0dfe4f8abfcc/go.mod h1:RGgjbofJ8xD9Sq1VVhDM1Vok1vRONV+rg+CjzG4SZKM= +google.golang.org/genproto v0.0.0-20230306155012-7f2fa6fef1f4 h1:DdoeryqhaXp1LtT/emMP1BRJPHHKFi5akj/nbx/zNTA= +google.golang.org/genproto v0.0.0-20230306155012-7f2fa6fef1f4/go.mod h1:NWraEVixdDnqcqQ30jipen1STv2r/n24Wb7twVTGR4s= google.golang.org/grpc v0.0.0-20160317175043-d3ddb4469d5a/go.mod h1:yo6s7OP7yaDglbqo1J04qKzAhqBH6lvTonzMVmEdcZw= google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c= google.golang.org/grpc v1.20.1/go.mod h1:10oTOabMzJvdu6/UiuZezV6QK5dSlG84ov/aaiqXj38= @@ -1544,7 +1545,7 @@ k8s.io/klog v1.0.0/go.mod h1:4Bi6QPql/J/LkTDqv7R/cd3hPo4k2DG6Ptcz060Ez5I= k8s.io/klog/v2 v2.0.0/go.mod h1:PBfzABfn139FHAV07az/IF9Wp1bkk3vpT2XSJ76fSDE= k8s.io/klog/v2 v2.2.0/go.mod h1:Od+F08eJP+W3HUb4pSrPpgp9DGU4GzlpG/TmITuYh/Y= k8s.io/klog/v2 v2.4.0/go.mod h1:Od+F08eJP+W3HUb4pSrPpgp9DGU4GzlpG/TmITuYh/Y= -k8s.io/klog/v2 v2.90.0 h1:VkTxIV/FjRXn1fgNNcKGM8cfmL1Z33ZjXRTVxKCoF5M= +k8s.io/klog/v2 v2.90.1 h1:m4bYOKall2MmOiRaR1J+We67Do7vm9KiQVlT96lnHUw= k8s.io/kube-openapi v0.0.0-20200805222855-6aeccd4b50c6/go.mod h1:UuqjUnNftUyPE5H64/qeyjQoUZhGpeFDVdxjTeEVN2o= k8s.io/kube-openapi v0.0.0-20201113171705-d219536bb9fd/go.mod h1:WOJ3KddDSol4tAGcJo0Tvi+dK12EcqSLqcWsryKMpfM= k8s.io/kubernetes v1.13.0/go.mod h1:ocZa8+6APFNC2tX1DZASIbocyYT5jHzqFVsY5aoB7Jk= diff --git a/vendor/github.com/Microsoft/go-winio/tools/mkwinsyscall/doc.go b/vendor/github.com/Microsoft/go-winio/tools/mkwinsyscall/doc.go new file mode 100644 index 0000000000..20b172ccf6 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/tools/mkwinsyscall/doc.go @@ -0,0 +1,57 @@ +/* +mkwinsyscall generates windows system call bodies + +It parses all files specified on command line containing function +prototypes (like syscall_windows.go) and prints system call bodies +to standard output. + +The prototypes are marked by lines beginning with "//sys" and read +like func declarations if //sys is replaced by func, but: + + - The parameter lists must give a name for each argument. This + includes return parameters. + + - The parameter lists must give a type for each argument: + the (x, y, z int) shorthand is not allowed. + + - If the return parameter is an error number, it must be named err. + + - If go func name needs to be different from its winapi dll name, + the winapi name could be specified at the end, after "=" sign, like + + //sys LoadLibrary(libname string) (handle uint32, err error) = LoadLibraryA + + - Each function that returns err needs to supply a condition, that + return value of winapi will be tested against to detect failure. + This would set err to windows "last-error", otherwise it will be nil. + The value can be provided at end of //sys declaration, like + + //sys LoadLibrary(libname string) (handle uint32, err error) [failretval==-1] = LoadLibraryA + + and is [failretval==0] by default. + + - If the function name ends in a "?", then the function not existing is non- + fatal, and an error will be returned instead of panicking. + +Usage: + + mkwinsyscall [flags] [path ...] + +Flags + + -output string + Output file name (standard output if omitted). + -sort + Sort DLL and function declarations (default true). + Intended to help transition from older versions of mkwinsyscall by making diffs + easier to read and understand. + -systemdll + Whether all DLLs should be loaded from the Windows system directory (default true). + -trace + Generate print statement after every syscall. + -utf16 + Encode string arguments as UTF-16 for syscalls not ending in 'A' or 'W' (default true). + -winio + Import this package ("github.com/Microsoft/go-winio"). +*/ +package main diff --git a/vendor/github.com/Microsoft/go-winio/tools/mkwinsyscall/mkwinsyscall.go b/vendor/github.com/Microsoft/go-winio/tools/mkwinsyscall/mkwinsyscall.go new file mode 100644 index 0000000000..e72be31384 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/tools/mkwinsyscall/mkwinsyscall.go @@ -0,0 +1,1014 @@ +//go:build windows + +// Copyright 2013 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package main + +import ( + "bufio" + "bytes" + "errors" + "flag" + "fmt" + "go/format" + "go/parser" + "go/token" + "io" + "log" + "os" + "path/filepath" + "runtime" + "sort" + "strconv" + "strings" + "text/template" + + "golang.org/x/sys/windows" +) + +const ( + pkgSyscall = "syscall" + pkgWindows = "windows" + + // common types. + + tBool = "bool" + tBoolPtr = "*bool" + tError = "error" + tString = "string" + + // error variable names. + + varErr = "err" + varErrNTStatus = "ntStatus" + varErrHR = "hr" +) + +var ( + filename = flag.String("output", "", "output file name (standard output if omitted)") + printTraceFlag = flag.Bool("trace", false, "generate print statement after every syscall") + systemDLL = flag.Bool("systemdll", true, "whether all DLLs should be loaded from the Windows system directory") + winio = flag.Bool("winio", false, `import this package ("github.com/Microsoft/go-winio")`) + utf16 = flag.Bool("utf16", true, "encode string arguments as UTF-16 for syscalls not ending in 'A' or 'W'") + sortdecls = flag.Bool("sort", true, "sort DLL and function declarations") +) + +func trim(s string) string { + return strings.Trim(s, " \t") +} + +func endsIn(s string, c byte) bool { + return len(s) >= 1 && s[len(s)-1] == c +} + +var packageName string + +func packagename() string { + return packageName +} + +func windowsdot() string { + if packageName == pkgWindows { + return "" + } + return pkgWindows + "." +} + +func syscalldot() string { + if packageName == pkgSyscall { + return "" + } + return pkgSyscall + "." +} + +// Param is function parameter. +type Param struct { + Name string + Type string + fn *Fn + tmpVarIdx int +} + +// tmpVar returns temp variable name that will be used to represent p during syscall. +func (p *Param) tmpVar() string { + if p.tmpVarIdx < 0 { + p.tmpVarIdx = p.fn.curTmpVarIdx + p.fn.curTmpVarIdx++ + } + return fmt.Sprintf("_p%d", p.tmpVarIdx) +} + +// BoolTmpVarCode returns source code for bool temp variable. +func (p *Param) BoolTmpVarCode() string { + const code = `var %[1]s uint32 + if %[2]s { + %[1]s = 1 + }` + return fmt.Sprintf(code, p.tmpVar(), p.Name) +} + +// BoolPointerTmpVarCode returns source code for bool temp variable. +func (p *Param) BoolPointerTmpVarCode() string { + const code = `var %[1]s uint32 + if *%[2]s { + %[1]s = 1 + }` + return fmt.Sprintf(code, p.tmpVar(), p.Name) +} + +// SliceTmpVarCode returns source code for slice temp variable. +func (p *Param) SliceTmpVarCode() string { + const code = `var %s *%s + if len(%s) > 0 { + %s = &%s[0] + }` + tmp := p.tmpVar() + return fmt.Sprintf(code, tmp, p.Type[2:], p.Name, tmp, p.Name) +} + +// StringTmpVarCode returns source code for string temp variable. +func (p *Param) StringTmpVarCode() string { + errvar := p.fn.Rets.ErrorVarName() + if errvar == "" { + errvar = "_" + } + tmp := p.tmpVar() + const code = `var %s %s + %s, %s = %s(%s)` + s := fmt.Sprintf(code, tmp, p.fn.StrconvType(), tmp, errvar, p.fn.StrconvFunc(), p.Name) + if errvar == "-" { + return s + } + const morecode = ` + if %s != nil { + return + }` + return s + fmt.Sprintf(morecode, errvar) +} + +// TmpVarCode returns source code for temp variable. +func (p *Param) TmpVarCode() string { + switch { + case p.Type == tBool: + return p.BoolTmpVarCode() + case p.Type == tBoolPtr: + return p.BoolPointerTmpVarCode() + case strings.HasPrefix(p.Type, "[]"): + return p.SliceTmpVarCode() + default: + return "" + } +} + +// TmpVarReadbackCode returns source code for reading back the temp variable into the original variable. +func (p *Param) TmpVarReadbackCode() string { + switch { + case p.Type == tBoolPtr: + return fmt.Sprintf("*%s = %s != 0", p.Name, p.tmpVar()) + default: + return "" + } +} + +// TmpVarHelperCode returns source code for helper's temp variable. +func (p *Param) TmpVarHelperCode() string { + if p.Type != "string" { + return "" + } + return p.StringTmpVarCode() +} + +// SyscallArgList returns source code fragments representing p parameter +// in syscall. Slices are translated into 2 syscall parameters: pointer to +// the first element and length. +func (p *Param) SyscallArgList() []string { + t := p.HelperType() + var s string + switch { + case t == tBoolPtr: + s = fmt.Sprintf("unsafe.Pointer(&%s)", p.tmpVar()) + case t[0] == '*': + s = fmt.Sprintf("unsafe.Pointer(%s)", p.Name) + case t == tBool: + s = p.tmpVar() + case strings.HasPrefix(t, "[]"): + return []string{ + fmt.Sprintf("uintptr(unsafe.Pointer(%s))", p.tmpVar()), + fmt.Sprintf("uintptr(len(%s))", p.Name), + } + default: + s = p.Name + } + return []string{fmt.Sprintf("uintptr(%s)", s)} +} + +// IsError determines if p parameter is used to return error. +func (p *Param) IsError() bool { + return p.Name == varErr && p.Type == tError +} + +// HelperType returns type of parameter p used in helper function. +func (p *Param) HelperType() string { + if p.Type == tString { + return p.fn.StrconvType() + } + return p.Type +} + +// join concatenates parameters ps into a string with sep separator. +// Each parameter is converted into string by applying fn to it +// before conversion. +func join(ps []*Param, fn func(*Param) string, sep string) string { + if len(ps) == 0 { + return "" + } + a := make([]string, 0) + for _, p := range ps { + a = append(a, fn(p)) + } + return strings.Join(a, sep) +} + +// Rets describes function return parameters. +type Rets struct { + Name string + Type string + ReturnsError bool + FailCond string + fnMaybeAbsent bool +} + +// ErrorVarName returns error variable name for r. +func (r *Rets) ErrorVarName() string { + if r.ReturnsError { + return varErr + } + if r.Type == tError { + return r.Name + } + return "" +} + +// ToParams converts r into slice of *Param. +func (r *Rets) ToParams() []*Param { + ps := make([]*Param, 0) + if len(r.Name) > 0 { + ps = append(ps, &Param{Name: r.Name, Type: r.Type}) + } + if r.ReturnsError { + ps = append(ps, &Param{Name: varErr, Type: tError}) + } + return ps +} + +// List returns source code of syscall return parameters. +func (r *Rets) List() string { + s := join(r.ToParams(), func(p *Param) string { return p.Name + " " + p.Type }, ", ") + if len(s) > 0 { + s = "(" + s + ")" + } else if r.fnMaybeAbsent { + s = "(err error)" + } + return s +} + +// PrintList returns source code of trace printing part correspondent +// to syscall return values. +func (r *Rets) PrintList() string { + return join(r.ToParams(), func(p *Param) string { return fmt.Sprintf(`"%s=", %s, `, p.Name, p.Name) }, `", ", `) +} + +// SetReturnValuesCode returns source code that accepts syscall return values. +func (r *Rets) SetReturnValuesCode() string { + if r.Name == "" && !r.ReturnsError { + return "" + } + retvar := "r0" + if r.Name == "" { + retvar = "r1" + } + errvar := "_" + if r.ReturnsError { + errvar = "e1" + } + return fmt.Sprintf("%s, _, %s := ", retvar, errvar) +} + +func (r *Rets) useLongHandleErrorCode(retvar string) string { + const code = `if %s { + err = errnoErr(e1) + }` + cond := retvar + " == 0" + if r.FailCond != "" { + cond = strings.Replace(r.FailCond, "failretval", retvar, 1) + } + return fmt.Sprintf(code, cond) +} + +// SetErrorCode returns source code that sets return parameters. +func (r *Rets) SetErrorCode() string { + const code = `if r0 != 0 { + %s = %sErrno(r0) + }` + const ntStatus = `if r0 != 0 { + %s = %sNTStatus(r0) + }` + const hrCode = `if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + %s = %sErrno(r0) + }` + + if r.Name == "" && !r.ReturnsError { + return "" + } + if r.Name == "" { + return r.useLongHandleErrorCode("r1") + } + if r.Type == tError { + switch r.Name { + case varErrNTStatus, strings.ToLower(varErrNTStatus): // allow ntstatus to work + return fmt.Sprintf(ntStatus, r.Name, windowsdot()) + case varErrHR: + return fmt.Sprintf(hrCode, r.Name, syscalldot()) + default: + return fmt.Sprintf(code, r.Name, syscalldot()) + } + } + + var s string + switch { + case r.Type[0] == '*': + s = fmt.Sprintf("%s = (%s)(unsafe.Pointer(r0))", r.Name, r.Type) + case r.Type == tBool: + s = fmt.Sprintf("%s = r0 != 0", r.Name) + default: + s = fmt.Sprintf("%s = %s(r0)", r.Name, r.Type) + } + if !r.ReturnsError { + return s + } + return s + "\n\t" + r.useLongHandleErrorCode(r.Name) +} + +// Fn describes syscall function. +type Fn struct { + Name string + Params []*Param + Rets *Rets + PrintTrace bool + dllname string + dllfuncname string + src string + // TODO: get rid of this field and just use parameter index instead + curTmpVarIdx int // insure tmp variables have uniq names +} + +// extractParams parses s to extract function parameters. +func extractParams(s string, f *Fn) ([]*Param, error) { + s = trim(s) + if s == "" { + return nil, nil + } + a := strings.Split(s, ",") + ps := make([]*Param, len(a)) + for i := range ps { + s2 := trim(a[i]) + b := strings.Split(s2, " ") + if len(b) != 2 { + b = strings.Split(s2, "\t") + if len(b) != 2 { + return nil, errors.New("Could not extract function parameter from \"" + s2 + "\"") + } + } + ps[i] = &Param{ + Name: trim(b[0]), + Type: trim(b[1]), + fn: f, + tmpVarIdx: -1, + } + } + return ps, nil +} + +// extractSection extracts text out of string s starting after start +// and ending just before end. found return value will indicate success, +// and prefix, body and suffix will contain correspondent parts of string s. +func extractSection(s string, start, end rune) (prefix, body, suffix string, found bool) { + s = trim(s) + if strings.HasPrefix(s, string(start)) { + // no prefix + body = s[1:] + } else { + a := strings.SplitN(s, string(start), 2) + if len(a) != 2 { + return "", "", s, false + } + prefix = a[0] + body = a[1] + } + a := strings.SplitN(body, string(end), 2) + if len(a) != 2 { + return "", "", "", false + } + return prefix, a[0], a[1], true +} + +// newFn parses string s and return created function Fn. +func newFn(s string) (*Fn, error) { + s = trim(s) + f := &Fn{ + Rets: &Rets{}, + src: s, + PrintTrace: *printTraceFlag, + } + // function name and args + prefix, body, s, found := extractSection(s, '(', ')') + if !found || prefix == "" { + return nil, errors.New("Could not extract function name and parameters from \"" + f.src + "\"") + } + f.Name = prefix + var err error + f.Params, err = extractParams(body, f) + if err != nil { + return nil, err + } + // return values + _, body, s, found = extractSection(s, '(', ')') + if found { + r, err := extractParams(body, f) + if err != nil { + return nil, err + } + switch len(r) { + case 0: + case 1: + if r[0].IsError() { + f.Rets.ReturnsError = true + } else { + f.Rets.Name = r[0].Name + f.Rets.Type = r[0].Type + } + case 2: + if !r[1].IsError() { + return nil, errors.New("Only last windows error is allowed as second return value in \"" + f.src + "\"") + } + f.Rets.ReturnsError = true + f.Rets.Name = r[0].Name + f.Rets.Type = r[0].Type + default: + return nil, errors.New("Too many return values in \"" + f.src + "\"") + } + } + // fail condition + _, body, s, found = extractSection(s, '[', ']') + if found { + f.Rets.FailCond = body + } + // dll and dll function names + s = trim(s) + if s == "" { + return f, nil + } + if !strings.HasPrefix(s, "=") { + return nil, errors.New("Could not extract dll name from \"" + f.src + "\"") + } + s = trim(s[1:]) + a := strings.Split(s, ".") + switch len(a) { + case 1: + f.dllfuncname = a[0] + case 2: + f.dllname = a[0] + f.dllfuncname = a[1] + default: + return nil, errors.New("Could not extract dll name from \"" + f.src + "\"") + } + if n := f.dllfuncname; endsIn(n, '?') { + f.dllfuncname = n[:len(n)-1] + f.Rets.fnMaybeAbsent = true + } + return f, nil +} + +// DLLName returns DLL name for function f. +func (f *Fn) DLLName() string { + if f.dllname == "" { + return "kernel32" + } + return f.dllname +} + +// DLLName returns DLL function name for function f. +func (f *Fn) DLLFuncName() string { + if f.dllfuncname == "" { + return f.Name + } + return f.dllfuncname +} + +// ParamList returns source code for function f parameters. +func (f *Fn) ParamList() string { + return join(f.Params, func(p *Param) string { return p.Name + " " + p.Type }, ", ") +} + +// HelperParamList returns source code for helper function f parameters. +func (f *Fn) HelperParamList() string { + return join(f.Params, func(p *Param) string { return p.Name + " " + p.HelperType() }, ", ") +} + +// ParamPrintList returns source code of trace printing part correspondent +// to syscall input parameters. +func (f *Fn) ParamPrintList() string { + return join(f.Params, func(p *Param) string { return fmt.Sprintf(`"%s=", %s, `, p.Name, p.Name) }, `", ", `) +} + +// ParamCount return number of syscall parameters for function f. +func (f *Fn) ParamCount() int { + n := 0 + for _, p := range f.Params { + n += len(p.SyscallArgList()) + } + return n +} + +// SyscallParamCount determines which version of Syscall/Syscall6/Syscall9/... +// to use. It returns parameter count for correspondent SyscallX function. +func (f *Fn) SyscallParamCount() int { + n := f.ParamCount() + switch { + case n <= 3: + return 3 + case n <= 6: + return 6 + case n <= 9: + return 9 + case n <= 12: + return 12 + case n <= 15: + return 15 + default: + panic("too many arguments to system call") + } +} + +// Syscall determines which SyscallX function to use for function f. +func (f *Fn) Syscall() string { + c := f.SyscallParamCount() + if c == 3 { + return syscalldot() + "Syscall" + } + return syscalldot() + "Syscall" + strconv.Itoa(c) +} + +// SyscallParamList returns source code for SyscallX parameters for function f. +func (f *Fn) SyscallParamList() string { + a := make([]string, 0) + for _, p := range f.Params { + a = append(a, p.SyscallArgList()...) + } + for len(a) < f.SyscallParamCount() { + a = append(a, "0") + } + return strings.Join(a, ", ") +} + +// HelperCallParamList returns source code of call into function f helper. +func (f *Fn) HelperCallParamList() string { + a := make([]string, 0, len(f.Params)) + for _, p := range f.Params { + s := p.Name + if p.Type == tString { + s = p.tmpVar() + } + a = append(a, s) + } + return strings.Join(a, ", ") +} + +// MaybeAbsent returns source code for handling functions that are possibly unavailable. +func (f *Fn) MaybeAbsent() string { + if !f.Rets.fnMaybeAbsent { + return "" + } + const code = `%[1]s = proc%[2]s.Find() + if %[1]s != nil { + return + }` + errorVar := f.Rets.ErrorVarName() + if errorVar == "" { + errorVar = varErr + } + return fmt.Sprintf(code, errorVar, f.DLLFuncName()) +} + +// IsUTF16 is true, if f is W (UTF-16) function and false for all A (ASCII) functions. +// Functions ending in neither will default to UTF-16, unless the `-utf16` flag is set +// to `false`. +func (f *Fn) IsUTF16() bool { + s := f.DLLFuncName() + return endsIn(s, 'W') || (*utf16 && !endsIn(s, 'A')) +} + +// StrconvFunc returns name of Go string to OS string function for f. +func (f *Fn) StrconvFunc() string { + if f.IsUTF16() { + return syscalldot() + "UTF16PtrFromString" + } + return syscalldot() + "BytePtrFromString" +} + +// StrconvType returns Go type name used for OS string for f. +func (f *Fn) StrconvType() string { + if f.IsUTF16() { + return "*uint16" + } + return "*byte" +} + +// HasStringParam is true, if f has at least one string parameter. +// Otherwise it is false. +func (f *Fn) HasStringParam() bool { + for _, p := range f.Params { + if p.Type == tString { + return true + } + } + return false +} + +// HelperName returns name of function f helper. +func (f *Fn) HelperName() string { + if !f.HasStringParam() { + return f.Name + } + return "_" + f.Name +} + +// Source files and functions. +type Source struct { + Funcs []*Fn + DLLFuncNames []*Fn + Files []string + StdLibImports []string + ExternalImports []string +} + +func (src *Source) Import(pkg string) { + src.StdLibImports = append(src.StdLibImports, pkg) + sort.Strings(src.StdLibImports) +} + +func (src *Source) ExternalImport(pkg string) { + src.ExternalImports = append(src.ExternalImports, pkg) + sort.Strings(src.ExternalImports) +} + +// ParseFiles parses files listed in fs and extracts all syscall +// functions listed in sys comments. It returns source files +// and functions collection *Source if successful. +func ParseFiles(fs []string) (*Source, error) { + src := &Source{ + Funcs: make([]*Fn, 0), + Files: make([]string, 0), + StdLibImports: []string{ + "unsafe", + }, + ExternalImports: make([]string, 0), + } + for _, file := range fs { + if err := src.ParseFile(file); err != nil { + return nil, err + } + } + src.DLLFuncNames = make([]*Fn, 0, len(src.Funcs)) + uniq := make(map[string]bool, len(src.Funcs)) + for _, fn := range src.Funcs { + name := fn.DLLFuncName() + if !uniq[name] { + src.DLLFuncNames = append(src.DLLFuncNames, fn) + uniq[name] = true + } + } + return src, nil +} + +// DLLs return dll names for a source set src. +func (src *Source) DLLs() []string { + uniq := make(map[string]bool) + r := make([]string, 0) + for _, f := range src.Funcs { + name := f.DLLName() + if _, found := uniq[name]; !found { + uniq[name] = true + r = append(r, name) + } + } + if *sortdecls { + sort.Strings(r) + } + return r +} + +// ParseFile adds additional file (or files, if path is a glob pattern) path to a source set src. +func (src *Source) ParseFile(path string) error { + file, err := os.Open(path) + if err == nil { + defer file.Close() + return src.parseFile(file) + } else if !(errors.Is(err, os.ErrNotExist) || errors.Is(err, windows.ERROR_INVALID_NAME)) { + return err + } + + paths, err := filepath.Glob(path) + if err != nil { + return err + } + + for _, path := range paths { + file, err := os.Open(path) + if err != nil { + return err + } + err = src.parseFile(file) + file.Close() + if err != nil { + return err + } + } + + return nil +} + +func (src *Source) parseFile(file *os.File) error { + s := bufio.NewScanner(file) + for s.Scan() { + t := trim(s.Text()) + if len(t) < 7 { + continue + } + if !strings.HasPrefix(t, "//sys") { + continue + } + t = t[5:] + if !(t[0] == ' ' || t[0] == '\t') { + continue + } + f, err := newFn(t[1:]) + if err != nil { + return err + } + src.Funcs = append(src.Funcs, f) + } + if err := s.Err(); err != nil { + return err + } + src.Files = append(src.Files, file.Name()) + if *sortdecls { + sort.Slice(src.Funcs, func(i, j int) bool { + fi, fj := src.Funcs[i], src.Funcs[j] + if fi.DLLName() == fj.DLLName() { + return fi.DLLFuncName() < fj.DLLFuncName() + } + return fi.DLLName() < fj.DLLName() + }) + } + + // get package name + fset := token.NewFileSet() + _, err := file.Seek(0, 0) + if err != nil { + return err + } + pkg, err := parser.ParseFile(fset, "", file, parser.PackageClauseOnly) + if err != nil { + return err + } + packageName = pkg.Name.Name + + return nil +} + +// IsStdRepo reports whether src is part of standard library. +func (src *Source) IsStdRepo() (bool, error) { + if len(src.Files) == 0 { + return false, errors.New("no input files provided") + } + abspath, err := filepath.Abs(src.Files[0]) + if err != nil { + return false, err + } + goroot := runtime.GOROOT() + if runtime.GOOS == "windows" { + abspath = strings.ToLower(abspath) + goroot = strings.ToLower(goroot) + } + sep := string(os.PathSeparator) + if !strings.HasSuffix(goroot, sep) { + goroot += sep + } + return strings.HasPrefix(abspath, goroot), nil +} + +// Generate output source file from a source set src. +func (src *Source) Generate(w io.Writer) error { + const ( + pkgStd = iota // any package in std library + pkgXSysWindows // x/sys/windows package + pkgOther + ) + isStdRepo, err := src.IsStdRepo() + if err != nil { + return err + } + var pkgtype int + switch { + case isStdRepo: + pkgtype = pkgStd + case packageName == "windows": + // TODO: this needs better logic than just using package name + pkgtype = pkgXSysWindows + default: + pkgtype = pkgOther + } + if *systemDLL { + switch pkgtype { + case pkgStd: + src.Import("internal/syscall/windows/sysdll") + case pkgXSysWindows: + default: + src.ExternalImport("golang.org/x/sys/windows") + } + } + if *winio { + src.ExternalImport("github.com/Microsoft/go-winio") + } + if packageName != "syscall" { + src.Import("syscall") + } + funcMap := template.FuncMap{ + "packagename": packagename, + "syscalldot": syscalldot, + "newlazydll": func(dll string) string { + arg := "\"" + dll + ".dll\"" + if !*systemDLL { + return syscalldot() + "NewLazyDLL(" + arg + ")" + } + if strings.HasPrefix(dll, "api_") || strings.HasPrefix(dll, "ext_") { + arg = strings.Replace(arg, "_", "-", -1) + } + switch pkgtype { + case pkgStd: + return syscalldot() + "NewLazyDLL(sysdll.Add(" + arg + "))" + case pkgXSysWindows: + return "NewLazySystemDLL(" + arg + ")" + default: + return "windows.NewLazySystemDLL(" + arg + ")" + } + }, + } + t := template.Must(template.New("main").Funcs(funcMap).Parse(srcTemplate)) + err = t.Execute(w, src) + if err != nil { + return errors.New("Failed to execute template: " + err.Error()) + } + return nil +} + +func usage() { + fmt.Fprintf(os.Stderr, "usage: mkwinsyscall [flags] [path ...]\n") + flag.PrintDefaults() + os.Exit(1) +} + +func main() { + flag.Usage = usage + flag.Parse() + if len(flag.Args()) <= 0 { + fmt.Fprintf(os.Stderr, "no files to parse provided\n") + usage() + } + + src, err := ParseFiles(flag.Args()) + if err != nil { + log.Fatal(err) + } + + var buf bytes.Buffer + if err := src.Generate(&buf); err != nil { + log.Fatal(err) + } + + data, err := format.Source(buf.Bytes()) + if err != nil { + log.Fatal(err) + } + if *filename == "" { + _, err = os.Stdout.Write(data) + } else { + //nolint:gosec // G306: code file, no need for wants 0600 + err = os.WriteFile(*filename, data, 0644) + } + if err != nil { + log.Fatal(err) + } +} + +// TODO: use println instead to print in the following template + +const srcTemplate = ` +{{define "main"}} //go:build windows + +// Code generated by 'go generate' using "github.com/Microsoft/go-winio/tools/mkwinsyscall"; DO NOT EDIT. + +package {{packagename}} + +import ( +{{range .StdLibImports}}"{{.}}" +{{end}} + +{{range .ExternalImports}}"{{.}}" +{{end}} +) + +var _ unsafe.Pointer + +// Do the interface allocations only once for common +// Errno values. +const ( + errnoERROR_IO_PENDING = 997 +) + +var ( + errERROR_IO_PENDING error = {{syscalldot}}Errno(errnoERROR_IO_PENDING) + errERROR_EINVAL error = {{syscalldot}}EINVAL +) + +// errnoErr returns common boxed Errno values, to prevent +// allocations at runtime. +func errnoErr(e {{syscalldot}}Errno) error { + switch e { + case 0: + return errERROR_EINVAL + case errnoERROR_IO_PENDING: + return errERROR_IO_PENDING + } + // TODO: add more here, after collecting data on the common + // error values see on Windows. (perhaps when running + // all.bat?) + return e +} + +var ( +{{template "dlls" .}} +{{template "funcnames" .}}) +{{range .Funcs}}{{if .HasStringParam}}{{template "helperbody" .}}{{end}}{{template "funcbody" .}}{{end}} +{{end}} + +{{/* help functions */}} + +{{define "dlls"}}{{range .DLLs}} mod{{.}} = {{newlazydll .}} +{{end}}{{end}} + +{{define "funcnames"}}{{range .DLLFuncNames}} proc{{.DLLFuncName}} = mod{{.DLLName}}.NewProc("{{.DLLFuncName}}") +{{end}}{{end}} + +{{define "helperbody"}} +func {{.Name}}({{.ParamList}}) {{template "results" .}}{ +{{template "helpertmpvars" .}} return {{.HelperName}}({{.HelperCallParamList}}) +} +{{end}} + +{{define "funcbody"}} +func {{.HelperName}}({{.HelperParamList}}) {{template "results" .}}{ +{{template "maybeabsent" .}} {{template "tmpvars" .}} {{template "syscall" .}} {{template "tmpvarsreadback" .}} +{{template "seterror" .}}{{template "printtrace" .}} return +} +{{end}} + +{{define "helpertmpvars"}}{{range .Params}}{{if .TmpVarHelperCode}} {{.TmpVarHelperCode}} +{{end}}{{end}}{{end}} + +{{define "maybeabsent"}}{{if .MaybeAbsent}}{{.MaybeAbsent}} +{{end}}{{end}} + +{{define "tmpvars"}}{{range .Params}}{{if .TmpVarCode}} {{.TmpVarCode}} +{{end}}{{end}}{{end}} + +{{define "results"}}{{if .Rets.List}}{{.Rets.List}} {{end}}{{end}} + +{{define "syscall"}}{{.Rets.SetReturnValuesCode}}{{.Syscall}}(proc{{.DLLFuncName}}.Addr(), {{.ParamCount}}, {{.SyscallParamList}}){{end}} + +{{define "tmpvarsreadback"}}{{range .Params}}{{if .TmpVarReadbackCode}} +{{.TmpVarReadbackCode}}{{end}}{{end}}{{end}} + +{{define "seterror"}}{{if .Rets.SetErrorCode}} {{.Rets.SetErrorCode}} +{{end}}{{end}} + +{{define "printtrace"}}{{if .PrintTrace}} print("SYSCALL: {{.Name}}(", {{.ParamPrintList}}") (", {{.Rets.PrintList}}")\n") +{{end}}{{end}} + +` diff --git a/vendor/github.com/Microsoft/hcsshim/.gitattributes b/vendor/github.com/Microsoft/hcsshim/.gitattributes index 94f480de94..dd0d09faac 100644 --- a/vendor/github.com/Microsoft/hcsshim/.gitattributes +++ b/vendor/github.com/Microsoft/hcsshim/.gitattributes @@ -1 +1,3 @@ -* text=auto eol=lf \ No newline at end of file +* text=auto eol=lf +vendor/** -text +test/vendor/** -text \ No newline at end of file diff --git a/vendor/github.com/Microsoft/hcsshim/.gitignore b/vendor/github.com/Microsoft/hcsshim/.gitignore index 54ed6f06c9..785972e036 100644 --- a/vendor/github.com/Microsoft/hcsshim/.gitignore +++ b/vendor/github.com/Microsoft/hcsshim/.gitignore @@ -6,6 +6,7 @@ # Ignore vscode setting files .vscode/ +.idea/ # Test binary, build with `go test -c` *.test @@ -23,16 +24,26 @@ service/pkg/ *.img *.vhd *.tar.gz +*.tar # Make stuff .rootfs-done bin/* rootfs/* +rootfs-conv/* *.o /build/ deps/* out/* -.idea/ -.vscode/ \ No newline at end of file +# test results +test/results + +# go workspace files +go.work +go.work.sum + +# keys and related artifacts +*.pem +*.cose diff --git a/vendor/github.com/Microsoft/hcsshim/.golangci.yml b/vendor/github.com/Microsoft/hcsshim/.golangci.yml index 2400e7f1e0..fdc2a385b7 100644 --- a/vendor/github.com/Microsoft/hcsshim/.golangci.yml +++ b/vendor/github.com/Microsoft/hcsshim/.golangci.yml @@ -1,23 +1,51 @@ run: timeout: 8m + tests: true + build-tags: + - admin + - functional + - integration + skip-dirs: + # paths are relative to module root + - cri-containerd/test-images linters: enable: - - stylecheck + # defaults: + # - errcheck + # - gosimple + # - govet + # - ineffassign + # - staticcheck + # - typecheck + # - unused + + - gofmt # whether code was gofmt-ed + - nolintlint # ill-formed or insufficient nolint directives + - stylecheck # golint replacement + - thelper # test helpers without t.Helper() linters-settings: stylecheck: # https://staticcheck.io/docs/checks checks: ["all"] - issues: - # This repo has a LOT of generated schema files, operating system bindings, and other things that ST1003 from stylecheck won't like - # (screaming case Windows api constants for example). There's also some structs that we *could* change the initialisms to be Go - # friendly (Id -> ID) but they're exported and it would be a breaking change. This makes it so that most new code, code that isn't - # supposed to be a pretty faithful mapping to an OS call/constants, or non-generated code still checks if we're following idioms, - # while ignoring the things that are just noise or would be more of a hassle than it'd be worth to change. exclude-rules: + # path is relative to module root, which is ./test/ + - path: cri-containerd + linters: + - stylecheck + text: "^ST1003: should not use underscores in package names$" + source: "^package cri_containerd$" + + # This repo has a LOT of generated schema files, operating system bindings, and other + # things that ST1003 from stylecheck won't like (screaming case Windows api constants for example). + # There's also some structs that we *could* change the initialisms to be Go friendly + # (Id -> ID) but they're exported and it would be a breaking change. + # This makes it so that most new code, code that isn't supposed to be a pretty faithful + # mapping to an OS call/constants, or non-generated code still checks if we're following idioms, + # while ignoring the things that are just noise or would be more of a hassle than it'd be worth to change. - path: layer.go linters: - stylecheck @@ -28,11 +56,21 @@ issues: - stylecheck Text: "ST1003:" - - path: internal\\hcs\\schema2\\ + - path: cmd\\ncproxy\\nodenetsvc\\ linters: - stylecheck Text: "ST1003:" + - path: cmd\\ncproxy_mock\\ + linters: + - stylecheck + Text: "ST1003:" + + - path: internal\\hcs\\schema2\\ + linters: + - stylecheck + - gofmt + - path: internal\\wclayer\\ linters: - stylecheck @@ -96,4 +134,4 @@ issues: - path: internal\\hcserror\\ linters: - stylecheck - Text: "ST1003:" \ No newline at end of file + Text: "ST1003:" diff --git a/vendor/github.com/Microsoft/hcsshim/Makefile b/vendor/github.com/Microsoft/hcsshim/Makefile index a8f5516cd0..742c76d848 100644 --- a/vendor/github.com/Microsoft/hcsshim/Makefile +++ b/vendor/github.com/Microsoft/hcsshim/Makefile @@ -1,4 +1,5 @@ BASE:=base.tar.gz +DEV_BUILD:=0 GO:=go GO_FLAGS:=-ldflags "-s -w" # strip Go binaries @@ -12,16 +13,31 @@ GO_FLAGS_EXTRA:= ifeq "$(GOMODVENDOR)" "1" GO_FLAGS_EXTRA += -mod=vendor endif +GO_BUILD_TAGS:= +ifneq ($(strip $(GO_BUILD_TAGS)),) +GO_FLAGS_EXTRA += -tags="$(GO_BUILD_TAGS)" +endif GO_BUILD:=CGO_ENABLED=$(CGO_ENABLED) $(GO) build $(GO_FLAGS) $(GO_FLAGS_EXTRA) SRCROOT=$(dir $(abspath $(firstword $(MAKEFILE_LIST)))) +# additional directories to search for rule prerequisites and targets +VPATH=$(SRCROOT) + +DELTA_TARGET=out/delta.tar.gz + +ifeq "$(DEV_BUILD)" "1" +DELTA_TARGET=out/delta-dev.tar.gz +endif # The link aliases for gcstools GCS_TOOLS=\ - generichook + generichook \ + install-drivers .PHONY: all always rootfs test +.DEFAULT_GOAL := all + all: out/initrd.img out/rootfs.tar.gz clean: @@ -29,21 +45,13 @@ clean: rm -rf bin deps rootfs out test: - cd $(SRCROOT) && go test -v ./internal/guest/... + cd $(SRCROOT) && $(GO) test -v ./internal/guest/... -out/delta.tar.gz: bin/init bin/vsockexec bin/cmd/gcs bin/cmd/gcstools Makefile - @mkdir -p out - rm -rf rootfs - mkdir -p rootfs/bin/ - cp bin/init rootfs/ - cp bin/vsockexec rootfs/bin/ - cp bin/cmd/gcs rootfs/bin/ - cp bin/cmd/gcstools rootfs/bin/ - for tool in $(GCS_TOOLS); do ln -s gcstools rootfs/bin/$$tool; done - git -C $(SRCROOT) rev-parse HEAD > rootfs/gcs.commit && \ - git -C $(SRCROOT) rev-parse --abbrev-ref HEAD > rootfs/gcs.branch - tar -zcf $@ -C rootfs . - rm -rf rootfs +rootfs: out/rootfs.vhd + +out/rootfs.vhd: out/rootfs.tar.gz bin/cmd/tar2ext4 + gzip -f -d ./out/rootfs.tar.gz + bin/cmd/tar2ext4 -vhd -i ./out/rootfs.tar -o $@ out/rootfs.tar.gz: out/initrd.img rm -rf rootfs-conv @@ -52,13 +60,45 @@ out/rootfs.tar.gz: out/initrd.img tar -zcf $@ -C rootfs-conv . rm -rf rootfs-conv -out/initrd.img: $(BASE) out/delta.tar.gz $(SRCROOT)/hack/catcpio.sh - $(SRCROOT)/hack/catcpio.sh "$(BASE)" out/delta.tar.gz > out/initrd.img.uncompressed +out/initrd.img: $(BASE) $(DELTA_TARGET) $(SRCROOT)/hack/catcpio.sh + $(SRCROOT)/hack/catcpio.sh "$(BASE)" $(DELTA_TARGET) > out/initrd.img.uncompressed gzip -c out/initrd.img.uncompressed > $@ rm out/initrd.img.uncompressed +# This target includes utilities which may be useful for testing purposes. +out/delta-dev.tar.gz: out/delta.tar.gz bin/internal/tools/snp-report + rm -rf rootfs-dev + mkdir rootfs-dev + tar -xzf out/delta.tar.gz -C rootfs-dev + cp bin/internal/tools/snp-report rootfs-dev/bin/ + tar -zcf $@ -C rootfs-dev . + rm -rf rootfs-dev + +out/delta.tar.gz: bin/init bin/vsockexec bin/cmd/gcs bin/cmd/gcstools bin/cmd/hooks/wait-paths Makefile + @mkdir -p out + rm -rf rootfs + mkdir -p rootfs/bin/ + mkdir -p rootfs/info/ + cp bin/init rootfs/ + cp bin/vsockexec rootfs/bin/ + cp bin/cmd/gcs rootfs/bin/ + cp bin/cmd/gcstools rootfs/bin/ + cp bin/cmd/hooks/wait-paths rootfs/bin/ + for tool in $(GCS_TOOLS); do ln -s gcstools rootfs/bin/$$tool; done + git -C $(SRCROOT) rev-parse HEAD > rootfs/info/gcs.commit && \ + git -C $(SRCROOT) rev-parse --abbrev-ref HEAD > rootfs/info/gcs.branch && \ + date --iso-8601=minute --utc > rootfs/info/tar.date + $(if $(and $(realpath $(subst .tar,.testdata.json,$(BASE))), $(shell which jq)), \ + jq -r '.IMAGE_NAME' $(subst .tar,.testdata.json,$(BASE)) 2>/dev/null > rootfs/info/image.name && \ + jq -r '.DATETIME' $(subst .tar,.testdata.json,$(BASE)) 2>/dev/null > rootfs/info/build.date) + tar -zcf $@ -C rootfs . + rm -rf rootfs + -include deps/cmd/gcs.gomake -include deps/cmd/gcstools.gomake +-include deps/cmd/hooks/wait-paths.gomake +-include deps/cmd/tar2ext4.gomake +-include deps/internal/tools/snp-report.gomake # Implicit rule for includes that define Go targets. %.gomake: $(SRCROOT)/Makefile @@ -72,8 +112,6 @@ out/initrd.img: $(BASE) out/delta.tar.gz $(SRCROOT)/hack/catcpio.sh @/bin/echo -e '-include $(@:%.gomake=%.godeps)' >> $@.new mv $@.new $@ -VPATH=$(SRCROOT) - bin/vsockexec: vsockexec/vsockexec.o vsockexec/vsock.o @mkdir -p bin $(CC) $(LDFLAGS) -o $@ $^ diff --git a/vendor/github.com/Microsoft/hcsshim/Protobuild.toml b/vendor/github.com/Microsoft/hcsshim/Protobuild.toml index ee18671aa6..471f133866 100644 --- a/vendor/github.com/Microsoft/hcsshim/Protobuild.toml +++ b/vendor/github.com/Microsoft/hcsshim/Protobuild.toml @@ -1,4 +1,4 @@ -version = "unstable" +version = "1" generator = "gogoctrd" plugins = ["grpc", "fieldpath"] @@ -14,11 +14,6 @@ plugins = ["grpc", "fieldpath"] # target package. packages = ["github.com/gogo/protobuf"] - # Paths that will be added untouched to the end of the includes. We use - # `/usr/local/include` to pickup the common install location of protobuf. - # This is the default. - after = ["/usr/local/include"] - # This section maps protobuf imports to Go packages. These will become # `-M` directives in the call to the go protobuf generator. [packages] @@ -36,6 +31,10 @@ plugins = ["grpc", "fieldpath"] prefixes = ["github.com/Microsoft/hcsshim/internal/shimdiag"] plugins = ["ttrpc"] +[[overrides]] +prefixes = ["github.com/Microsoft/hcsshim/internal/extendedtask"] +plugins = ["ttrpc"] + [[overrides]] prefixes = ["github.com/Microsoft/hcsshim/internal/computeagent"] plugins = ["ttrpc"] diff --git a/vendor/github.com/Microsoft/hcsshim/README.md b/vendor/github.com/Microsoft/hcsshim/README.md index b8ca926a9d..5a1361539b 100644 --- a/vendor/github.com/Microsoft/hcsshim/README.md +++ b/vendor/github.com/Microsoft/hcsshim/README.md @@ -75,24 +75,6 @@ certify they either authored the work themselves or otherwise have permission to more info, as well as to make sure that you can attest to the rules listed. Our CI uses the [DCO Github app](https://github.com/apps/dco) to ensure that all commits in a given PR are signed-off. -### Test Directory (Important to note) - -This project has tried to trim some dependencies from the root Go modules file that would be cumbersome to get transitively included if this -project is being vendored/used as a library. Some of these dependencies were only being used for tests, so the /test directory in this project also has -its own go.mod file where these are now included to get around this issue. Our tests rely on the code in this project to run, so the test Go modules file -has a relative path replace directive to pull in the latest hcsshim code that the tests actually touch from this project -(which is the repo itself on your disk). - -``` -replace ( - github.com/Microsoft/hcsshim => ../ -) -``` - -Because of this, for most code changes you may need to run `go mod vendor` + `go mod tidy` in the /test directory in this repository, as the -CI in this project will check if the files are out of date and will fail if this is true. - - ## Code of Conduct This project has adopted the [Microsoft Open Source Code of Conduct](https://opensource.microsoft.com/codeofconduct/). @@ -101,7 +83,7 @@ contact [opencode@microsoft.com](mailto:opencode@microsoft.com) with any additio ## Dependencies -This project requires Golang 1.9 or newer to build. +This project requires Golang 1.17 or newer to build. For system requirements to run this project, see the Microsoft docs on [Windows Container requirements](https://docs.microsoft.com/en-us/virtualization/windowscontainers/deploy-containers/system-requirements). diff --git a/vendor/github.com/Microsoft/hcsshim/SECURITY.md b/vendor/github.com/Microsoft/hcsshim/SECURITY.md new file mode 100644 index 0000000000..869fdfe2b2 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/SECURITY.md @@ -0,0 +1,41 @@ + + +## Security + +Microsoft takes the security of our software products and services seriously, which includes all source code repositories managed through our GitHub organizations, which include [Microsoft](https://github.com/Microsoft), [Azure](https://github.com/Azure), [DotNet](https://github.com/dotnet), [AspNet](https://github.com/aspnet), [Xamarin](https://github.com/xamarin), and [our GitHub organizations](https://opensource.microsoft.com/). + +If you believe you have found a security vulnerability in any Microsoft-owned repository that meets [Microsoft's definition of a security vulnerability](https://aka.ms/opensource/security/definition), please report it to us as described below. + +## Reporting Security Issues + +**Please do not report security vulnerabilities through public GitHub issues.** + +Instead, please report them to the Microsoft Security Response Center (MSRC) at [https://msrc.microsoft.com/create-report](https://aka.ms/opensource/security/create-report). + +If you prefer to submit without logging in, send email to [secure@microsoft.com](mailto:secure@microsoft.com). If possible, encrypt your message with our PGP key; please download it from the [Microsoft Security Response Center PGP Key page](https://aka.ms/opensource/security/pgpkey). + +You should receive a response within 24 hours. If for some reason you do not, please follow up via email to ensure we received your original message. Additional information can be found at [microsoft.com/msrc](https://aka.ms/opensource/security/msrc). + +Please include the requested information listed below (as much as you can provide) to help us better understand the nature and scope of the possible issue: + + * Type of issue (e.g. buffer overflow, SQL injection, cross-site scripting, etc.) + * Full paths of source file(s) related to the manifestation of the issue + * The location of the affected source code (tag/branch/commit or direct URL) + * Any special configuration required to reproduce the issue + * Step-by-step instructions to reproduce the issue + * Proof-of-concept or exploit code (if possible) + * Impact of the issue, including how an attacker might exploit the issue + +This information will help us triage your report more quickly. + +If you are reporting for a bug bounty, more complete reports can contribute to a higher bounty award. Please visit our [Microsoft Bug Bounty Program](https://aka.ms/opensource/security/bounty) page for more details about our active programs. + +## Preferred Languages + +We prefer all communications to be in English. + +## Policy + +Microsoft follows the principle of [Coordinated Vulnerability Disclosure](https://aka.ms/opensource/security/cvd). + + diff --git a/vendor/github.com/Microsoft/hcsshim/computestorage/attach.go b/vendor/github.com/Microsoft/hcsshim/computestorage/attach.go index 7f1f2823dd..54c4b3bc4a 100644 --- a/vendor/github.com/Microsoft/hcsshim/computestorage/attach.go +++ b/vendor/github.com/Microsoft/hcsshim/computestorage/attach.go @@ -1,3 +1,5 @@ +//go:build windows + package computestorage import ( @@ -17,8 +19,8 @@ import ( // // `layerData` is the parent read-only layer data. func AttachLayerStorageFilter(ctx context.Context, layerPath string, layerData LayerData) (err error) { - title := "hcsshim.AttachLayerStorageFilter" - ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + title := "hcsshim::AttachLayerStorageFilter" + ctx, span := oc.StartSpan(ctx, title) //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes( diff --git a/vendor/github.com/Microsoft/hcsshim/computestorage/destroy.go b/vendor/github.com/Microsoft/hcsshim/computestorage/destroy.go index 8e28e6c504..5058d3b55e 100644 --- a/vendor/github.com/Microsoft/hcsshim/computestorage/destroy.go +++ b/vendor/github.com/Microsoft/hcsshim/computestorage/destroy.go @@ -1,3 +1,5 @@ +//go:build windows + package computestorage import ( @@ -12,8 +14,8 @@ import ( // // `layerPath` is a path to a directory containing the layer to export. func DestroyLayer(ctx context.Context, layerPath string) (err error) { - title := "hcsshim.DestroyLayer" - ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + title := "hcsshim::DestroyLayer" + ctx, span := oc.StartSpan(ctx, title) //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes(trace.StringAttribute("layerPath", layerPath)) diff --git a/vendor/github.com/Microsoft/hcsshim/computestorage/detach.go b/vendor/github.com/Microsoft/hcsshim/computestorage/detach.go index 435473257e..daf1bfff20 100644 --- a/vendor/github.com/Microsoft/hcsshim/computestorage/detach.go +++ b/vendor/github.com/Microsoft/hcsshim/computestorage/detach.go @@ -1,3 +1,5 @@ +//go:build windows + package computestorage import ( @@ -12,8 +14,8 @@ import ( // // `layerPath` is a path to a directory containing the layer to export. func DetachLayerStorageFilter(ctx context.Context, layerPath string) (err error) { - title := "hcsshim.DetachLayerStorageFilter" - ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + title := "hcsshim::DetachLayerStorageFilter" + ctx, span := oc.StartSpan(ctx, title) //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes(trace.StringAttribute("layerPath", layerPath)) diff --git a/vendor/github.com/Microsoft/hcsshim/computestorage/export.go b/vendor/github.com/Microsoft/hcsshim/computestorage/export.go index a1b12dd129..c6370a5c9a 100644 --- a/vendor/github.com/Microsoft/hcsshim/computestorage/export.go +++ b/vendor/github.com/Microsoft/hcsshim/computestorage/export.go @@ -1,3 +1,5 @@ +//go:build windows + package computestorage import ( @@ -19,8 +21,8 @@ import ( // // `options` are the export options applied to the exported layer. func ExportLayer(ctx context.Context, layerPath, exportFolderPath string, layerData LayerData, options ExportLayerOptions) (err error) { - title := "hcsshim.ExportLayer" - ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + title := "hcsshim::ExportLayer" + ctx, span := oc.StartSpan(ctx, title) //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes( @@ -28,17 +30,17 @@ func ExportLayer(ctx context.Context, layerPath, exportFolderPath string, layerD trace.StringAttribute("exportFolderPath", exportFolderPath), ) - ldbytes, err := json.Marshal(layerData) + ldBytes, err := json.Marshal(layerData) if err != nil { return err } - obytes, err := json.Marshal(options) + oBytes, err := json.Marshal(options) if err != nil { return err } - err = hcsExportLayer(layerPath, exportFolderPath, string(ldbytes), string(obytes)) + err = hcsExportLayer(layerPath, exportFolderPath, string(ldBytes), string(oBytes)) if err != nil { return errors.Wrap(err, "failed to export layer") } diff --git a/vendor/github.com/Microsoft/hcsshim/computestorage/format.go b/vendor/github.com/Microsoft/hcsshim/computestorage/format.go index 83c0fa33f0..2140e5c9fc 100644 --- a/vendor/github.com/Microsoft/hcsshim/computestorage/format.go +++ b/vendor/github.com/Microsoft/hcsshim/computestorage/format.go @@ -1,3 +1,5 @@ +//go:build windows + package computestorage import ( @@ -5,16 +7,20 @@ import ( "github.com/Microsoft/hcsshim/internal/oc" "github.com/pkg/errors" - "go.opencensus.io/trace" "golang.org/x/sys/windows" ) // FormatWritableLayerVhd formats a virtual disk for use as a writable container layer. // // If the VHD is not mounted it will be temporarily mounted. +// +// NOTE: This API had a breaking change in the operating system after Windows Server 2019. +// On ws2019 the API expects to get passed a file handle from CreateFile for the vhd that +// the caller wants to format. On > ws2019, its expected that the caller passes a vhd handle +// that can be obtained from the virtdisk APIs. func FormatWritableLayerVhd(ctx context.Context, vhdHandle windows.Handle) (err error) { - title := "hcsshim.FormatWritableLayerVhd" - ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + title := "hcsshim::FormatWritableLayerVhd" + ctx, span := oc.StartSpan(ctx, title) //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() diff --git a/vendor/github.com/Microsoft/hcsshim/computestorage/helpers.go b/vendor/github.com/Microsoft/hcsshim/computestorage/helpers.go index 87fee452cd..c3608dcec8 100644 --- a/vendor/github.com/Microsoft/hcsshim/computestorage/helpers.go +++ b/vendor/github.com/Microsoft/hcsshim/computestorage/helpers.go @@ -1,3 +1,5 @@ +//go:build windows + package computestorage import ( @@ -6,10 +8,12 @@ import ( "path/filepath" "syscall" - "github.com/Microsoft/go-winio/pkg/security" "github.com/Microsoft/go-winio/vhd" + "github.com/Microsoft/hcsshim/internal/memory" "github.com/pkg/errors" "golang.org/x/sys/windows" + + "github.com/Microsoft/hcsshim/internal/security" ) const defaultVHDXBlockSizeInMB = 1 @@ -59,8 +63,8 @@ func SetupContainerBaseLayer(ctx context.Context, layerPath, baseVhdPath, diffVh createParams := &vhd.CreateVirtualDiskParameters{ Version: 2, Version2: vhd.CreateVersion2{ - MaximumSize: sizeInGB * 1024 * 1024 * 1024, - BlockSizeInBytes: defaultVHDXBlockSizeInMB * 1024 * 1024, + MaximumSize: sizeInGB * memory.GiB, + BlockSizeInBytes: defaultVHDXBlockSizeInMB * memory.MiB, }, } handle, err := vhd.CreateVirtualDisk(baseVhdPath, vhd.VirtualDiskAccessNone, vhd.CreateVirtualDiskFlagNone, createParams) @@ -135,8 +139,8 @@ func SetupUtilityVMBaseLayer(ctx context.Context, uvmPath, baseVhdPath, diffVhdP createParams := &vhd.CreateVirtualDiskParameters{ Version: 2, Version2: vhd.CreateVersion2{ - MaximumSize: sizeInGB * 1024 * 1024 * 1024, - BlockSizeInBytes: defaultVHDXBlockSizeInMB * 1024 * 1024, + MaximumSize: sizeInGB * memory.GiB, + BlockSizeInBytes: defaultVHDXBlockSizeInMB * memory.MiB, }, } handle, err := vhd.CreateVirtualDisk(baseVhdPath, vhd.VirtualDiskAccessNone, vhd.CreateVirtualDiskFlagNone, createParams) diff --git a/vendor/github.com/Microsoft/hcsshim/computestorage/import.go b/vendor/github.com/Microsoft/hcsshim/computestorage/import.go index 0c61dab329..e1c87416a3 100644 --- a/vendor/github.com/Microsoft/hcsshim/computestorage/import.go +++ b/vendor/github.com/Microsoft/hcsshim/computestorage/import.go @@ -1,3 +1,5 @@ +//go:build windows + package computestorage import ( @@ -19,8 +21,8 @@ import ( // // `layerData` is the parent layer data. func ImportLayer(ctx context.Context, layerPath, sourceFolderPath string, layerData LayerData) (err error) { - title := "hcsshim.ImportLayer" - ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + title := "hcsshim::ImportLayer" + ctx, span := oc.StartSpan(ctx, title) //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes( diff --git a/vendor/github.com/Microsoft/hcsshim/computestorage/initialize.go b/vendor/github.com/Microsoft/hcsshim/computestorage/initialize.go index 53ed8ea6ed..d0c6216056 100644 --- a/vendor/github.com/Microsoft/hcsshim/computestorage/initialize.go +++ b/vendor/github.com/Microsoft/hcsshim/computestorage/initialize.go @@ -1,3 +1,5 @@ +//go:build windows + package computestorage import ( @@ -16,8 +18,8 @@ import ( // // `layerData` is the parent read-only layer data. func InitializeWritableLayer(ctx context.Context, layerPath string, layerData LayerData) (err error) { - title := "hcsshim.InitializeWritableLayer" - ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + title := "hcsshim::InitializeWritableLayer" + ctx, span := oc.StartSpan(ctx, title) //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes( diff --git a/vendor/github.com/Microsoft/hcsshim/computestorage/mount.go b/vendor/github.com/Microsoft/hcsshim/computestorage/mount.go index fcdbbef814..4f4d8ebf2f 100644 --- a/vendor/github.com/Microsoft/hcsshim/computestorage/mount.go +++ b/vendor/github.com/Microsoft/hcsshim/computestorage/mount.go @@ -1,3 +1,5 @@ +//go:build windows + package computestorage import ( @@ -6,14 +8,13 @@ import ( "github.com/Microsoft/hcsshim/internal/interop" "github.com/Microsoft/hcsshim/internal/oc" "github.com/pkg/errors" - "go.opencensus.io/trace" "golang.org/x/sys/windows" ) // GetLayerVhdMountPath returns the volume path for a virtual disk of a writable container layer. func GetLayerVhdMountPath(ctx context.Context, vhdHandle windows.Handle) (path string, err error) { - title := "hcsshim.GetLayerVhdMountPath" - ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + title := "hcsshim::GetLayerVhdMountPath" + ctx, span := oc.StartSpan(ctx, title) //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() diff --git a/vendor/github.com/Microsoft/hcsshim/computestorage/setup.go b/vendor/github.com/Microsoft/hcsshim/computestorage/setup.go index 06aaf841e8..1c685aed0a 100644 --- a/vendor/github.com/Microsoft/hcsshim/computestorage/setup.go +++ b/vendor/github.com/Microsoft/hcsshim/computestorage/setup.go @@ -1,3 +1,5 @@ +//go:build windows + package computestorage import ( @@ -21,8 +23,8 @@ import ( // // `options` are the options applied while processing the layer. func SetupBaseOSLayer(ctx context.Context, layerPath string, vhdHandle windows.Handle, options OsLayerOptions) (err error) { - title := "hcsshim.SetupBaseOSLayer" - ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + title := "hcsshim::SetupBaseOSLayer" + ctx, span := oc.StartSpan(ctx, title) //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes( @@ -48,12 +50,16 @@ func SetupBaseOSLayer(ctx context.Context, layerPath string, vhdHandle windows.H // `volumePath` is the path to the volume to be used for setup. // // `options` are the options applied while processing the layer. +// +// NOTE: This API is only available on builds of Windows greater than 19645. Inside we +// check if the hosts build has the API available by using 'GetVersion' which requires +// the calling application to be manifested. https://docs.microsoft.com/en-us/windows/win32/sbscs/manifests func SetupBaseOSVolume(ctx context.Context, layerPath, volumePath string, options OsLayerOptions) (err error) { if osversion.Build() < 19645 { return errors.New("SetupBaseOSVolume is not present on builds older than 19645") } - title := "hcsshim.SetupBaseOSVolume" - ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + title := "hcsshim::SetupBaseOSVolume" + ctx, span := oc.StartSpan(ctx, title) //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes( diff --git a/vendor/github.com/Microsoft/hcsshim/computestorage/storage.go b/vendor/github.com/Microsoft/hcsshim/computestorage/storage.go index 95aff9c184..82d68cb8b1 100644 --- a/vendor/github.com/Microsoft/hcsshim/computestorage/storage.go +++ b/vendor/github.com/Microsoft/hcsshim/computestorage/storage.go @@ -7,7 +7,7 @@ import ( hcsschema "github.com/Microsoft/hcsshim/internal/hcs/schema2" ) -//go:generate go run ../mksyscall_windows.go -output zsyscall_windows.go storage.go +//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -output zsyscall_windows.go storage.go //sys hcsImportLayer(layerPath string, sourceFolderPath string, layerData string) (hr error) = computestorage.HcsImportLayer? //sys hcsExportLayer(layerPath string, exportFolderPath string, layerData string, options string) (hr error) = computestorage.HcsExportLayer? @@ -20,10 +20,13 @@ import ( //sys hcsGetLayerVhdMountPath(vhdHandle windows.Handle, mountPath **uint16) (hr error) = computestorage.HcsGetLayerVhdMountPath? //sys hcsSetupBaseOSVolume(layerPath string, volumePath string, options string) (hr error) = computestorage.HcsSetupBaseOSVolume? +type Version = hcsschema.Version +type Layer = hcsschema.Layer + // LayerData is the data used to describe parent layer information. type LayerData struct { - SchemaVersion hcsschema.Version `json:"SchemaVersion,omitempty"` - Layers []hcsschema.Layer `json:"Layers,omitempty"` + SchemaVersion Version `json:"SchemaVersion,omitempty"` + Layers []Layer `json:"Layers,omitempty"` } // ExportLayerOptions are the set of options that are used with the `computestorage.HcsExportLayer` syscall. diff --git a/vendor/github.com/Microsoft/hcsshim/computestorage/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/computestorage/zsyscall_windows.go index 4f95180674..9cf479181a 100644 --- a/vendor/github.com/Microsoft/hcsshim/computestorage/zsyscall_windows.go +++ b/vendor/github.com/Microsoft/hcsshim/computestorage/zsyscall_windows.go @@ -1,4 +1,6 @@ -// Code generated mksyscall_windows.exe DO NOT EDIT +//go:build windows + +// Code generated by 'go generate' using "github.com/Microsoft/go-winio/tools/mkwinsyscall"; DO NOT EDIT. package computestorage @@ -19,6 +21,7 @@ const ( var ( errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) + errERROR_EINVAL error = syscall.EINVAL ) // errnoErr returns common boxed Errno values, to prevent @@ -26,7 +29,7 @@ var ( func errnoErr(e syscall.Errno) error { switch e { case 0: - return nil + return errERROR_EINVAL case errnoERROR_IO_PENDING: return errERROR_IO_PENDING } @@ -39,42 +42,86 @@ func errnoErr(e syscall.Errno) error { var ( modcomputestorage = windows.NewLazySystemDLL("computestorage.dll") - procHcsImportLayer = modcomputestorage.NewProc("HcsImportLayer") - procHcsExportLayer = modcomputestorage.NewProc("HcsExportLayer") - procHcsDestoryLayer = modcomputestorage.NewProc("HcsDestoryLayer") - procHcsSetupBaseOSLayer = modcomputestorage.NewProc("HcsSetupBaseOSLayer") - procHcsInitializeWritableLayer = modcomputestorage.NewProc("HcsInitializeWritableLayer") procHcsAttachLayerStorageFilter = modcomputestorage.NewProc("HcsAttachLayerStorageFilter") + procHcsDestoryLayer = modcomputestorage.NewProc("HcsDestoryLayer") procHcsDetachLayerStorageFilter = modcomputestorage.NewProc("HcsDetachLayerStorageFilter") + procHcsExportLayer = modcomputestorage.NewProc("HcsExportLayer") procHcsFormatWritableLayerVhd = modcomputestorage.NewProc("HcsFormatWritableLayerVhd") procHcsGetLayerVhdMountPath = modcomputestorage.NewProc("HcsGetLayerVhdMountPath") + procHcsImportLayer = modcomputestorage.NewProc("HcsImportLayer") + procHcsInitializeWritableLayer = modcomputestorage.NewProc("HcsInitializeWritableLayer") + procHcsSetupBaseOSLayer = modcomputestorage.NewProc("HcsSetupBaseOSLayer") procHcsSetupBaseOSVolume = modcomputestorage.NewProc("HcsSetupBaseOSVolume") ) -func hcsImportLayer(layerPath string, sourceFolderPath string, layerData string) (hr error) { +func hcsAttachLayerStorageFilter(layerPath string, layerData string) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(layerPath) if hr != nil { return } var _p1 *uint16 - _p1, hr = syscall.UTF16PtrFromString(sourceFolderPath) + _p1, hr = syscall.UTF16PtrFromString(layerData) if hr != nil { return } - var _p2 *uint16 - _p2, hr = syscall.UTF16PtrFromString(layerData) - if hr != nil { - return - } - return _hcsImportLayer(_p0, _p1, _p2) + return _hcsAttachLayerStorageFilter(_p0, _p1) } -func _hcsImportLayer(layerPath *uint16, sourceFolderPath *uint16, layerData *uint16) (hr error) { - if hr = procHcsImportLayer.Find(); hr != nil { +func _hcsAttachLayerStorageFilter(layerPath *uint16, layerData *uint16) (hr error) { + hr = procHcsAttachLayerStorageFilter.Find() + if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsImportLayer.Addr(), 3, uintptr(unsafe.Pointer(layerPath)), uintptr(unsafe.Pointer(sourceFolderPath)), uintptr(unsafe.Pointer(layerData))) + r0, _, _ := syscall.Syscall(procHcsAttachLayerStorageFilter.Addr(), 2, uintptr(unsafe.Pointer(layerPath)), uintptr(unsafe.Pointer(layerData)), 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsDestroyLayer(layerPath string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(layerPath) + if hr != nil { + return + } + return _hcsDestroyLayer(_p0) +} + +func _hcsDestroyLayer(layerPath *uint16) (hr error) { + hr = procHcsDestoryLayer.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsDestoryLayer.Addr(), 1, uintptr(unsafe.Pointer(layerPath)), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsDetachLayerStorageFilter(layerPath string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(layerPath) + if hr != nil { + return + } + return _hcsDetachLayerStorageFilter(_p0) +} + +func _hcsDetachLayerStorageFilter(layerPath *uint16) (hr error) { + hr = procHcsDetachLayerStorageFilter.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsDetachLayerStorageFilter.Addr(), 1, uintptr(unsafe.Pointer(layerPath)), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -109,7 +156,8 @@ func hcsExportLayer(layerPath string, exportFolderPath string, layerData string, } func _hcsExportLayer(layerPath *uint16, exportFolderPath *uint16, layerData *uint16, options *uint16) (hr error) { - if hr = procHcsExportLayer.Find(); hr != nil { + hr = procHcsExportLayer.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall6(procHcsExportLayer.Addr(), 4, uintptr(unsafe.Pointer(layerPath)), uintptr(unsafe.Pointer(exportFolderPath)), uintptr(unsafe.Pointer(layerData)), uintptr(unsafe.Pointer(options)), 0, 0) @@ -122,20 +170,12 @@ func _hcsExportLayer(layerPath *uint16, exportFolderPath *uint16, layerData *uin return } -func hcsDestroyLayer(layerPath string) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(layerPath) +func hcsFormatWritableLayerVhd(handle windows.Handle) (hr error) { + hr = procHcsFormatWritableLayerVhd.Find() if hr != nil { return } - return _hcsDestroyLayer(_p0) -} - -func _hcsDestroyLayer(layerPath *uint16) (hr error) { - if hr = procHcsDestoryLayer.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsDestoryLayer.Addr(), 1, uintptr(unsafe.Pointer(layerPath)), 0, 0) + r0, _, _ := syscall.Syscall(procHcsFormatWritableLayerVhd.Addr(), 1, uintptr(handle), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -145,25 +185,46 @@ func _hcsDestroyLayer(layerPath *uint16) (hr error) { return } -func hcsSetupBaseOSLayer(layerPath string, handle windows.Handle, options string) (hr error) { +func hcsGetLayerVhdMountPath(vhdHandle windows.Handle, mountPath **uint16) (hr error) { + hr = procHcsGetLayerVhdMountPath.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsGetLayerVhdMountPath.Addr(), 2, uintptr(vhdHandle), uintptr(unsafe.Pointer(mountPath)), 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsImportLayer(layerPath string, sourceFolderPath string, layerData string) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(layerPath) if hr != nil { return } var _p1 *uint16 - _p1, hr = syscall.UTF16PtrFromString(options) + _p1, hr = syscall.UTF16PtrFromString(sourceFolderPath) if hr != nil { return } - return _hcsSetupBaseOSLayer(_p0, handle, _p1) -} - -func _hcsSetupBaseOSLayer(layerPath *uint16, handle windows.Handle, options *uint16) (hr error) { - if hr = procHcsSetupBaseOSLayer.Find(); hr != nil { + var _p2 *uint16 + _p2, hr = syscall.UTF16PtrFromString(layerData) + if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsSetupBaseOSLayer.Addr(), 3, uintptr(unsafe.Pointer(layerPath)), uintptr(handle), uintptr(unsafe.Pointer(options))) + return _hcsImportLayer(_p0, _p1, _p2) +} + +func _hcsImportLayer(layerPath *uint16, sourceFolderPath *uint16, layerData *uint16) (hr error) { + hr = procHcsImportLayer.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsImportLayer.Addr(), 3, uintptr(unsafe.Pointer(layerPath)), uintptr(unsafe.Pointer(sourceFolderPath)), uintptr(unsafe.Pointer(layerData))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -193,7 +254,8 @@ func hcsInitializeWritableLayer(writableLayerPath string, layerData string, opti } func _hcsInitializeWritableLayer(writableLayerPath *uint16, layerData *uint16, options *uint16) (hr error) { - if hr = procHcsInitializeWritableLayer.Find(); hr != nil { + hr = procHcsInitializeWritableLayer.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcsInitializeWritableLayer.Addr(), 3, uintptr(unsafe.Pointer(writableLayerPath)), uintptr(unsafe.Pointer(layerData)), uintptr(unsafe.Pointer(options))) @@ -206,76 +268,26 @@ func _hcsInitializeWritableLayer(writableLayerPath *uint16, layerData *uint16, o return } -func hcsAttachLayerStorageFilter(layerPath string, layerData string) (hr error) { +func hcsSetupBaseOSLayer(layerPath string, handle windows.Handle, options string) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(layerPath) if hr != nil { return } var _p1 *uint16 - _p1, hr = syscall.UTF16PtrFromString(layerData) + _p1, hr = syscall.UTF16PtrFromString(options) if hr != nil { return } - return _hcsAttachLayerStorageFilter(_p0, _p1) + return _hcsSetupBaseOSLayer(_p0, handle, _p1) } -func _hcsAttachLayerStorageFilter(layerPath *uint16, layerData *uint16) (hr error) { - if hr = procHcsAttachLayerStorageFilter.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsAttachLayerStorageFilter.Addr(), 2, uintptr(unsafe.Pointer(layerPath)), uintptr(unsafe.Pointer(layerData)), 0) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return -} - -func hcsDetachLayerStorageFilter(layerPath string) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(layerPath) +func _hcsSetupBaseOSLayer(layerPath *uint16, handle windows.Handle, options *uint16) (hr error) { + hr = procHcsSetupBaseOSLayer.Find() if hr != nil { return } - return _hcsDetachLayerStorageFilter(_p0) -} - -func _hcsDetachLayerStorageFilter(layerPath *uint16) (hr error) { - if hr = procHcsDetachLayerStorageFilter.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsDetachLayerStorageFilter.Addr(), 1, uintptr(unsafe.Pointer(layerPath)), 0, 0) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return -} - -func hcsFormatWritableLayerVhd(handle windows.Handle) (hr error) { - if hr = procHcsFormatWritableLayerVhd.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsFormatWritableLayerVhd.Addr(), 1, uintptr(handle), 0, 0) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return -} - -func hcsGetLayerVhdMountPath(vhdHandle windows.Handle, mountPath **uint16) (hr error) { - if hr = procHcsGetLayerVhdMountPath.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsGetLayerVhdMountPath.Addr(), 2, uintptr(vhdHandle), uintptr(unsafe.Pointer(mountPath)), 0) + r0, _, _ := syscall.Syscall(procHcsSetupBaseOSLayer.Addr(), 3, uintptr(unsafe.Pointer(layerPath)), uintptr(handle), uintptr(unsafe.Pointer(options))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -305,7 +317,8 @@ func hcsSetupBaseOSVolume(layerPath string, volumePath string, options string) ( } func _hcsSetupBaseOSVolume(layerPath *uint16, volumePath *uint16, options *uint16) (hr error) { - if hr = procHcsSetupBaseOSVolume.Find(); hr != nil { + hr = procHcsSetupBaseOSVolume.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcsSetupBaseOSVolume.Addr(), 3, uintptr(unsafe.Pointer(layerPath)), uintptr(unsafe.Pointer(volumePath)), uintptr(unsafe.Pointer(options))) diff --git a/vendor/github.com/Microsoft/hcsshim/container.go b/vendor/github.com/Microsoft/hcsshim/container.go index bfd722898e..c8f09f88b9 100644 --- a/vendor/github.com/Microsoft/hcsshim/container.go +++ b/vendor/github.com/Microsoft/hcsshim/container.go @@ -1,3 +1,5 @@ +//go:build windows + package hcsshim import ( @@ -60,7 +62,7 @@ type container struct { waitCh chan struct{} } -// createComputeSystemAdditionalJSON is read from the environment at initialisation +// createContainerAdditionalJSON is read from the environment at initialization // time. It allows an environment variable to define additional JSON which // is merged in the CreateComputeSystem call to HCS. var createContainerAdditionalJSON []byte diff --git a/vendor/github.com/Microsoft/hcsshim/errors.go b/vendor/github.com/Microsoft/hcsshim/errors.go index f367022e71..594bbfb7a8 100644 --- a/vendor/github.com/Microsoft/hcsshim/errors.go +++ b/vendor/github.com/Microsoft/hcsshim/errors.go @@ -1,3 +1,5 @@ +//go:build windows + package hcsshim import ( @@ -50,6 +52,9 @@ var ( // ErrUnexpectedValue is an error encountered when hcs returns an invalid value ErrUnexpectedValue = hcs.ErrUnexpectedValue + // ErrOperationDenied is an error when hcs attempts an operation that is explicitly denied + ErrOperationDenied = hcs.ErrOperationDenied + // ErrVmcomputeAlreadyStopped is an error encountered when a shutdown or terminate request is made on a stopped container ErrVmcomputeAlreadyStopped = hcs.ErrVmcomputeAlreadyStopped diff --git a/vendor/github.com/Microsoft/hcsshim/functional_tests.ps1 b/vendor/github.com/Microsoft/hcsshim/functional_tests.ps1 deleted file mode 100644 index ce6edbcf32..0000000000 --- a/vendor/github.com/Microsoft/hcsshim/functional_tests.ps1 +++ /dev/null @@ -1,12 +0,0 @@ -# Requirements so far: -# dockerd running -# - image microsoft/nanoserver (matching host base image) docker load -i c:\baseimages\nanoserver.tar -# - image alpine (linux) docker pull --platform=linux alpine - - -# TODO: Add this a parameter for debugging. ie "functional-tests -debug=$true" -#$env:HCSSHIM_FUNCTIONAL_TESTS_DEBUG="yes please" - -#pushd uvm -go test -v -tags "functional uvmcreate uvmscratch uvmscsi uvmvpmem uvmvsmb uvmp9" ./... -#popd \ No newline at end of file diff --git a/vendor/github.com/Microsoft/hcsshim/hcsshim.go b/vendor/github.com/Microsoft/hcsshim/hcsshim.go index ceb3ac85ee..13f80e4a81 100644 --- a/vendor/github.com/Microsoft/hcsshim/hcsshim.go +++ b/vendor/github.com/Microsoft/hcsshim/hcsshim.go @@ -1,15 +1,17 @@ +//go:build windows + // Shim for the Host Compute Service (HCS) to manage Windows Server // containers and Hyper-V containers. package hcsshim import ( - "syscall" + "golang.org/x/sys/windows" "github.com/Microsoft/hcsshim/internal/hcserror" ) -//go:generate go run mksyscall_windows.go -output zsyscall_windows.go hcsshim.go +//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -output zsyscall_windows.go hcsshim.go //sys SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) = iphlpapi.SetCurrentThreadCompartmentId @@ -17,9 +19,9 @@ const ( // Specific user-visible exit codes WaitErrExecFailed = 32767 - ERROR_GEN_FAILURE = hcserror.ERROR_GEN_FAILURE - ERROR_SHUTDOWN_IN_PROGRESS = syscall.Errno(1115) - WSAEINVAL = syscall.Errno(10022) + ERROR_GEN_FAILURE = windows.ERROR_GEN_FAILURE + ERROR_SHUTDOWN_IN_PROGRESS = windows.ERROR_SHUTDOWN_IN_PROGRESS + WSAEINVAL = windows.WSAEINVAL // Timeout on wait calls TimeoutInfinite = 0xFFFFFFFF diff --git a/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go b/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go index 9e0059447d..d8a73de98d 100644 --- a/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go +++ b/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go @@ -1,3 +1,5 @@ +//go:build windows + package hcsshim import ( @@ -13,7 +15,7 @@ type HNSEndpointStats = hns.EndpointStats // Namespace represents a Compartment. type Namespace = hns.Namespace -//SystemType represents the type of the system on which actions are done +// SystemType represents the type of the system on which actions are done type SystemType string // SystemType const diff --git a/vendor/github.com/Microsoft/hcsshim/hnsglobals.go b/vendor/github.com/Microsoft/hcsshim/hnsglobals.go index 2b53819047..c564bf4a35 100644 --- a/vendor/github.com/Microsoft/hcsshim/hnsglobals.go +++ b/vendor/github.com/Microsoft/hcsshim/hnsglobals.go @@ -1,3 +1,5 @@ +//go:build windows + package hcsshim import ( diff --git a/vendor/github.com/Microsoft/hcsshim/hnsnetwork.go b/vendor/github.com/Microsoft/hcsshim/hnsnetwork.go index f775fa1d07..925c212495 100644 --- a/vendor/github.com/Microsoft/hcsshim/hnsnetwork.go +++ b/vendor/github.com/Microsoft/hcsshim/hnsnetwork.go @@ -1,14 +1,16 @@ +//go:build windows + package hcsshim import ( "github.com/Microsoft/hcsshim/internal/hns" ) -// Subnet is assoicated with a network and represents a list +// Subnet is associated with a network and represents a list // of subnets available to the network type Subnet = hns.Subnet -// MacPool is assoicated with a network and represents a list +// MacPool is associated with a network and represents a list // of macaddresses available to the network type MacPool = hns.MacPool diff --git a/vendor/github.com/Microsoft/hcsshim/hnspolicylist.go b/vendor/github.com/Microsoft/hcsshim/hnspolicylist.go index 55aaa4a50e..9bfe61ee83 100644 --- a/vendor/github.com/Microsoft/hcsshim/hnspolicylist.go +++ b/vendor/github.com/Microsoft/hcsshim/hnspolicylist.go @@ -1,3 +1,5 @@ +//go:build windows + package hcsshim import ( diff --git a/vendor/github.com/Microsoft/hcsshim/hnssupport.go b/vendor/github.com/Microsoft/hcsshim/hnssupport.go index 69405244b6..d97681e0ca 100644 --- a/vendor/github.com/Microsoft/hcsshim/hnssupport.go +++ b/vendor/github.com/Microsoft/hcsshim/hnssupport.go @@ -1,3 +1,5 @@ +//go:build windows + package hcsshim import ( diff --git a/vendor/github.com/Microsoft/hcsshim/interface.go b/vendor/github.com/Microsoft/hcsshim/interface.go index 300eb59966..81a2819516 100644 --- a/vendor/github.com/Microsoft/hcsshim/interface.go +++ b/vendor/github.com/Microsoft/hcsshim/interface.go @@ -1,3 +1,5 @@ +//go:build windows + package hcsshim import ( diff --git a/vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go b/vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go index f46af33bb6..b60cd383b6 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go @@ -1,3 +1,5 @@ +//go:build windows + package cow import ( diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go index d13772b030..7b27173c3a 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go @@ -1,3 +1,5 @@ +//go:build windows + package hcs import ( diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/doc.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/doc.go new file mode 100644 index 0000000000..d792dda986 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/doc.go @@ -0,0 +1 @@ +package hcs diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go index 295d4b849c..3e10f5c7e0 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go @@ -1,3 +1,5 @@ +//go:build windows + package hcs import ( @@ -51,6 +53,9 @@ var ( // ErrUnexpectedValue is an error encountered when hcs returns an invalid value ErrUnexpectedValue = errors.New("unexpected value returned from hcs") + // ErrOperationDenied is an error when hcs attempts an operation that is explicitly denied + ErrOperationDenied = errors.New("operation denied") + // ErrVmcomputeAlreadyStopped is an error encountered when a shutdown or terminate request is made on a stopped container ErrVmcomputeAlreadyStopped = syscall.Errno(0xc0370110) @@ -82,7 +87,7 @@ var ( // ErrProcessAlreadyStopped is returned by hcs if the process we're trying to kill has already been stopped. ErrProcessAlreadyStopped = syscall.Errno(0x8037011f) - // ErrInvalidHandle is an error that can be encountrered when querying the properties of a compute system when the handle to that + // ErrInvalidHandle is an error that can be encountered when querying the properties of a compute system when the handle to that // compute system has already been closed. ErrInvalidHandle = syscall.Errno(0x6) ) @@ -152,33 +157,38 @@ func (e *HcsError) Error() string { return s } +func (e *HcsError) Is(target error) bool { + return errors.Is(e.Err, target) +} + +// unwrap isnt really needed, but helpful convince function + +func (e *HcsError) Unwrap() error { + return e.Err +} + +// Deprecated: net.Error.Temporary is deprecated. func (e *HcsError) Temporary() bool { - err, ok := e.Err.(net.Error) - return ok && err.Temporary() //nolint:staticcheck + err := e.netError() + return (err != nil) && err.Temporary() } func (e *HcsError) Timeout() bool { - err, ok := e.Err.(net.Error) - return ok && err.Timeout() + err := e.netError() + return (err != nil) && err.Timeout() } -// ProcessError is an error encountered in HCS during an operation on a Process object -type ProcessError struct { - SystemID string - Pid int - Op string - Err error - Events []ErrorEvent +func (e *HcsError) netError() (err net.Error) { + if errors.As(e.Unwrap(), &err) { + return err + } + return nil } -var _ net.Error = &ProcessError{} - // SystemError is an error encountered in HCS during an operation on a Container object type SystemError struct { - ID string - Op string - Err error - Events []ErrorEvent + HcsError + ID string } var _ net.Error = &SystemError{} @@ -191,29 +201,32 @@ func (e *SystemError) Error() string { return s } -func (e *SystemError) Temporary() bool { - err, ok := e.Err.(net.Error) - return ok && err.Temporary() //nolint:staticcheck -} - -func (e *SystemError) Timeout() bool { - err, ok := e.Err.(net.Error) - return ok && err.Timeout() -} - func makeSystemError(system *System, op string, err error, events []ErrorEvent) error { // Don't double wrap errors - if _, ok := err.(*SystemError); ok { + var e *SystemError + if errors.As(err, &e) { return err } + return &SystemError{ - ID: system.ID(), - Op: op, - Err: err, - Events: events, + ID: system.ID(), + HcsError: HcsError{ + Op: op, + Err: err, + Events: events, + }, } } +// ProcessError is an error encountered in HCS during an operation on a Process object +type ProcessError struct { + HcsError + SystemID string + Pid int +} + +var _ net.Error = &ProcessError{} + func (e *ProcessError) Error() string { s := fmt.Sprintf("%s %s:%d: %s", e.Op, e.SystemID, e.Pid, e.Err.Error()) for _, ev := range e.Events { @@ -222,27 +235,20 @@ func (e *ProcessError) Error() string { return s } -func (e *ProcessError) Temporary() bool { - err, ok := e.Err.(net.Error) - return ok && err.Temporary() //nolint:staticcheck -} - -func (e *ProcessError) Timeout() bool { - err, ok := e.Err.(net.Error) - return ok && err.Timeout() -} - func makeProcessError(process *Process, op string, err error, events []ErrorEvent) error { // Don't double wrap errors - if _, ok := err.(*ProcessError); ok { + var e *ProcessError + if errors.As(err, &e) { return err } return &ProcessError{ Pid: process.Pid(), SystemID: process.SystemID(), - Op: op, - Err: err, - Events: events, + HcsError: HcsError{ + Op: op, + Err: err, + Events: events, + }, } } @@ -251,41 +257,41 @@ func makeProcessError(process *Process, op string, err error, events []ErrorEven // already exited, or does not exist. Both IsAlreadyStopped and IsNotExist // will currently return true when the error is ErrElementNotFound. func IsNotExist(err error) bool { - err = getInnerError(err) - return err == ErrComputeSystemDoesNotExist || - err == ErrElementNotFound + return IsAny(err, ErrComputeSystemDoesNotExist, ErrElementNotFound) } // IsErrorInvalidHandle checks whether the error is the result of an operation carried // out on a handle that is invalid/closed. This error popped up while trying to query // stats on a container in the process of being stopped. func IsErrorInvalidHandle(err error) bool { - err = getInnerError(err) - return err == ErrInvalidHandle + return errors.Is(err, ErrInvalidHandle) } // IsAlreadyClosed checks if an error is caused by the Container or Process having been // already closed by a call to the Close() method. func IsAlreadyClosed(err error) bool { - err = getInnerError(err) - return err == ErrAlreadyClosed + return errors.Is(err, ErrAlreadyClosed) } // IsPending returns a boolean indicating whether the error is that // the requested operation is being completed in the background. func IsPending(err error) bool { - err = getInnerError(err) - return err == ErrVmcomputeOperationPending + return errors.Is(err, ErrVmcomputeOperationPending) } // IsTimeout returns a boolean indicating whether the error is caused by // a timeout waiting for the operation to complete. func IsTimeout(err error) bool { - if err, ok := err.(net.Error); ok && err.Timeout() { + // HcsError and co. implement Timeout regardless of whether the errors they wrap do, + // so `errors.As(err, net.Error)`` will always be true. + // Using `errors.As(err.Unwrap(), net.Err)` wont work for general errors. + // So first check if there an `ErrTimeout` in the chain, then convert to a net error. + if errors.Is(err, ErrTimeout) { return true } - err = getInnerError(err) - return err == ErrTimeout + + var nerr net.Error + return errors.As(err, &nerr) && nerr.Timeout() } // IsAlreadyStopped returns a boolean indicating whether the error is caused by @@ -294,10 +300,7 @@ func IsTimeout(err error) bool { // already exited, or does not exist. Both IsAlreadyStopped and IsNotExist // will currently return true when the error is ErrElementNotFound. func IsAlreadyStopped(err error) bool { - err = getInnerError(err) - return err == ErrVmcomputeAlreadyStopped || - err == ErrProcessAlreadyStopped || - err == ErrElementNotFound + return IsAny(err, ErrVmcomputeAlreadyStopped, ErrProcessAlreadyStopped, ErrElementNotFound) } // IsNotSupported returns a boolean indicating whether the error is caused by @@ -306,38 +309,28 @@ func IsAlreadyStopped(err error) bool { // ErrVmcomputeInvalidJSON, ErrInvalidData, ErrNotSupported or ErrVmcomputeUnknownMessage // is thrown from the Platform func IsNotSupported(err error) bool { - err = getInnerError(err) // If Platform doesn't recognize or support the request sent, below errors are seen - return err == ErrVmcomputeInvalidJSON || - err == ErrInvalidData || - err == ErrNotSupported || - err == ErrVmcomputeUnknownMessage + return IsAny(err, ErrVmcomputeInvalidJSON, ErrInvalidData, ErrNotSupported, ErrVmcomputeUnknownMessage) } // IsOperationInvalidState returns true when err is caused by // `ErrVmcomputeOperationInvalidState`. func IsOperationInvalidState(err error) bool { - err = getInnerError(err) - return err == ErrVmcomputeOperationInvalidState + return errors.Is(err, ErrVmcomputeOperationInvalidState) } // IsAccessIsDenied returns true when err is caused by // `ErrVmcomputeOperationAccessIsDenied`. func IsAccessIsDenied(err error) bool { - err = getInnerError(err) - return err == ErrVmcomputeOperationAccessIsDenied + return errors.Is(err, ErrVmcomputeOperationAccessIsDenied) } -func getInnerError(err error) error { - switch pe := err.(type) { - case nil: - return nil - case *HcsError: - err = pe.Err - case *SystemError: - err = pe.Err - case *ProcessError: - err = pe.Err +// IsAny is a vectorized version of [errors.Is], it returns true if err is one of targets. +func IsAny(err error, targets ...error) bool { + for _, e := range targets { + if errors.Is(err, e) { + return true + } } - return err + return false } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go index 78490d6cdd..e437e297c0 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go @@ -1,3 +1,5 @@ +//go:build windows + package hcs import ( @@ -10,6 +12,7 @@ import ( "syscall" "time" + "github.com/Microsoft/hcsshim/internal/cow" "github.com/Microsoft/hcsshim/internal/log" "github.com/Microsoft/hcsshim/internal/oc" "github.com/Microsoft/hcsshim/internal/vmcompute" @@ -36,6 +39,8 @@ type Process struct { waitError error } +var _ cow.Process = &Process{} + func newProcess(process vmcompute.HcsProcess, processID int, computeSystem *System) *Process { return &Process{ handle: process, @@ -89,10 +94,7 @@ func (process *Process) processSignalResult(ctx context.Context, err error) (boo case nil: return true, nil case ErrVmcomputeOperationInvalidState, ErrComputeSystemDoesNotExist, ErrElementNotFound: - select { - case <-process.waitBlock: - // The process exit notification has already arrived. - default: + if !process.stopped() { // The process should be gone, but we have not received the notification. // After a second, force unblock the process wait to work around a possible // deadlock in the HCS. @@ -114,9 +116,9 @@ func (process *Process) processSignalResult(ctx context.Context, err error) (boo // Signal signals the process with `options`. // -// For LCOW `guestrequest.SignalProcessOptionsLCOW`. +// For LCOW `guestresource.SignalProcessOptionsLCOW`. // -// For WCOW `guestrequest.SignalProcessOptionsWCOW`. +// For WCOW `guestresource.SignalProcessOptionsWCOW`. func (process *Process) Signal(ctx context.Context, options interface{}) (bool, error) { process.handleLock.RLock() defer process.handleLock.RUnlock() @@ -152,6 +154,10 @@ func (process *Process) Kill(ctx context.Context) (bool, error) { return false, makeProcessError(process, operation, ErrAlreadyClosed, nil) } + if process.stopped() { + return false, makeProcessError(process, operation, ErrProcessAlreadyStopped, nil) + } + if process.killSignalDelivered { // A kill signal has already been sent to this process. Sending a second // one offers no real benefit, as processes cannot stop themselves from @@ -233,7 +239,7 @@ func (process *Process) Kill(ctx context.Context) (bool, error) { // call multiple times. func (process *Process) waitBackground() { operation := "hcs::Process::waitBackground" - ctx, span := trace.StartSpan(context.Background(), operation) + ctx, span := oc.StartSpan(context.Background(), operation) defer span.End() span.AddAttributes( trace.StringAttribute("cid", process.SystemID()), @@ -259,12 +265,12 @@ func (process *Process) waitBackground() { propertiesJSON, resultJSON, err = vmcompute.HcsGetProcessProperties(ctx, process.handle) events := processHcsResult(ctx, resultJSON) if err != nil { - err = makeProcessError(process, operation, err, events) //nolint:ineffassign + err = makeProcessError(process, operation, err, events) } else { properties := &processStatus{} err = json.Unmarshal([]byte(propertiesJSON), properties) if err != nil { - err = makeProcessError(process, operation, err, nil) //nolint:ineffassign + err = makeProcessError(process, operation, err, nil) } else { if properties.LastWaitResult != 0 { log.G(ctx).WithField("wait-result", properties.LastWaitResult).Warning("non-zero last wait result") @@ -286,12 +292,22 @@ func (process *Process) waitBackground() { } // Wait waits for the process to exit. If the process has already exited returns -// the pervious error (if any). +// the previous error (if any). func (process *Process) Wait() error { <-process.waitBlock return process.waitError } +// Exited returns if the process has stopped +func (process *Process) stopped() bool { + select { + case <-process.waitBlock: + return true + default: + return false + } +} + // ResizeConsole resizes the console of the process. func (process *Process) ResizeConsole(ctx context.Context, width, height uint16) error { process.handleLock.RLock() @@ -328,15 +344,13 @@ func (process *Process) ResizeConsole(ctx context.Context, width, height uint16) // ExitCode returns the exit code of the process. The process must have // already terminated. func (process *Process) ExitCode() (int, error) { - select { - case <-process.waitBlock: - if process.waitError != nil { - return -1, process.waitError - } - return process.exitCode, nil - default: + if !process.stopped() { return -1, makeProcessError(process, "hcs::Process::ExitCode", ErrInvalidProcessState, nil) } + if process.waitError != nil { + return -1, process.waitError + } + return process.exitCode, nil } // StdioLegacy returns the stdin, stdout, and stderr pipes, respectively. Closing @@ -344,7 +358,7 @@ func (process *Process) ExitCode() (int, error) { // are the responsibility of the caller to close. func (process *Process) StdioLegacy() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadCloser, err error) { operation := "hcs::Process::StdioLegacy" - ctx, span := trace.StartSpan(context.Background(), operation) + ctx, span := oc.StartSpan(context.Background(), operation) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes( @@ -382,7 +396,7 @@ func (process *Process) StdioLegacy() (_ io.WriteCloser, _ io.ReadCloser, _ io.R } // Stdio returns the stdin, stdout, and stderr pipes, respectively. -// To close them, close the process handle. +// To close them, close the process handle, or use the `CloseStd*` functions. func (process *Process) Stdio() (stdin io.Writer, stdout, stderr io.Reader) { process.stdioLock.Lock() defer process.stdioLock.Unlock() @@ -391,46 +405,57 @@ func (process *Process) Stdio() (stdin io.Writer, stdout, stderr io.Reader) { // CloseStdin closes the write side of the stdin pipe so that the process is // notified on the read side that there is no more data in stdin. -func (process *Process) CloseStdin(ctx context.Context) error { +func (process *Process) CloseStdin(ctx context.Context) (err error) { + operation := "hcs::Process::CloseStdin" + ctx, span := trace.StartSpan(ctx, operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("cid", process.SystemID()), + trace.Int64Attribute("pid", int64(process.processID))) + process.handleLock.RLock() defer process.handleLock.RUnlock() - operation := "hcs::Process::CloseStdin" - if process.handle == 0 { return makeProcessError(process, operation, ErrAlreadyClosed, nil) } - modifyRequest := processModifyRequest{ - Operation: modifyCloseHandle, - CloseHandle: &closeHandle{ - Handle: stdIn, - }, - } - - modifyRequestb, err := json.Marshal(modifyRequest) - if err != nil { - return err - } - - resultJSON, err := vmcompute.HcsModifyProcess(ctx, process.handle, string(modifyRequestb)) - events := processHcsResult(ctx, resultJSON) - if err != nil { - return makeProcessError(process, operation, err, events) - } - process.stdioLock.Lock() - if process.stdin != nil { - process.stdin.Close() - process.stdin = nil + defer process.stdioLock.Unlock() + if process.stdin == nil { + return nil } - process.stdioLock.Unlock() + + //HcsModifyProcess request to close stdin will fail if the process has already exited + if !process.stopped() { + modifyRequest := processModifyRequest{ + Operation: modifyCloseHandle, + CloseHandle: &closeHandle{ + Handle: stdIn, + }, + } + + modifyRequestb, err := json.Marshal(modifyRequest) + if err != nil { + return err + } + + resultJSON, err := vmcompute.HcsModifyProcess(ctx, process.handle, string(modifyRequestb)) + events := processHcsResult(ctx, resultJSON) + if err != nil { + return makeProcessError(process, operation, err, events) + } + } + + process.stdin.Close() + process.stdin = nil return nil } func (process *Process) CloseStdout(ctx context.Context) (err error) { - ctx, span := trace.StartSpan(ctx, "hcs::Process::CloseStdout") //nolint:ineffassign,staticcheck + ctx, span := oc.StartSpan(ctx, "hcs::Process::CloseStdout") //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes( @@ -454,7 +479,7 @@ func (process *Process) CloseStdout(ctx context.Context) (err error) { } func (process *Process) CloseStderr(ctx context.Context) (err error) { - ctx, span := trace.StartSpan(ctx, "hcs::Process::CloseStderr") //nolint:ineffassign,staticcheck + ctx, span := oc.StartSpan(ctx, "hcs::Process::CloseStderr") //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes( @@ -473,7 +498,6 @@ func (process *Process) CloseStderr(ctx context.Context) (err error) { if process.stderr != nil { process.stderr.Close() process.stderr = nil - } return nil } @@ -482,7 +506,7 @@ func (process *Process) CloseStderr(ctx context.Context) (err error) { // or wait on it. func (process *Process) Close() (err error) { operation := "hcs::Process::Close" - ctx, span := trace.StartSpan(context.Background(), operation) + ctx, span := oc.StartSpan(context.Background(), operation) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes( diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema1/schema1.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema1/schema1.go index b621c55938..d1f219cfad 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema1/schema1.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema1/schema1.go @@ -1,3 +1,5 @@ +//go:build windows + package schema1 import ( @@ -101,7 +103,7 @@ type ContainerConfig struct { HvRuntime *HvRuntime `json:",omitempty"` // Hyper-V container settings. Used by Hyper-V containers only. Format ImagePath=%root%\BaseLayerID\UtilityVM Servicing bool `json:",omitempty"` // True if this container is for servicing AllowUnqualifiedDNSQuery bool `json:",omitempty"` // True to allow unqualified DNS name resolution - DNSSearchList string `json:",omitempty"` // Comma seperated list of DNS suffixes to use for name resolution + DNSSearchList string `json:",omitempty"` // Comma separated list of DNS suffixes to use for name resolution ContainerType string `json:",omitempty"` // "Linux" for Linux containers on Windows. Omitted otherwise. TerminateOnLastHandleClosed bool `json:",omitempty"` // Should HCS terminate the container once all handles have been closed MappedVirtualDisks []MappedVirtualDisk `json:",omitempty"` // Array of virtual disks to mount at start diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/cpu_group_property.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/cpu_group_property.go index bbad6a2c45..31fe07c3aa 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/cpu_group_property.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/cpu_group_property.go @@ -9,6 +9,14 @@ package hcsschema +type CPUGroupPropertyCode uint32 + +const ( + CPUCapacityProperty = 0x00010000 + CPUSchedulingPriorityProperty = 0x00020000 + IdleLPReserveProperty = 0x00030000 +) + type CpuGroupProperty struct { PropertyCode uint32 `json:"PropertyCode,omitempty"` PropertyValue uint32 `json:"PropertyValue,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/debug_options.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/debug_options.go new file mode 100644 index 0000000000..5385850fe4 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/debug_options.go @@ -0,0 +1,22 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type DebugOptions struct { + // BugcheckSavedStateFileName is the path for the file in which the guest VM state will be saved when + // the guest crashes. + BugcheckSavedStateFileName string `json:"BugcheckSavedStateFileName,omitempty"` + // BugcheckNoCrashdumpSavedStateFileName is the path of the file in which the guest VM state will be + // saved when the guest crashes but the guest isn't able to generate the crash dump. This usually + // happens in early boot failures. + BugcheckNoCrashdumpSavedStateFileName string `json:"BugcheckNoCrashdumpSavedStateFileName,omitempty"` + TripleFaultSavedStateFileName string `json:"TripleFaultSavedStateFileName,omitempty"` + FirmwareDumpFileName string `json:"FirmwareDumpFileName,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/guest_state.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/guest_state.go index ef1eec8865..a48a653945 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/guest_state.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/guest_state.go @@ -14,6 +14,9 @@ type GuestState struct { // The path to an existing file uses for persistent guest state storage. An empty string indicates the system should initialize new transient, in-memory guest state. GuestStateFilePath string `json:"GuestStateFilePath,omitempty"` + // The guest state file type affected by different guest isolation modes - whether a file or block storage. + GuestStateFileType string `json:"GuestStateFileType,omitempty"` + // The path to an existing file for persistent runtime state storage. An empty string indicates the system should initialize new transient, in-memory runtime state. RuntimeStateFilePath string `json:"RuntimeStateFilePath,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/isolation_settings.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/isolation_settings.go new file mode 100644 index 0000000000..3726a297e1 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/isolation_settings.go @@ -0,0 +1,21 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type IsolationSettings struct { + // Guest isolation type options to decide virtual trust levels of virtual machine + IsolationType string `json:"IsolationType,omitempty"` + // Configuration to debug HCL layer for HCS VM TODO: Task 31102306: Miss the way to prevent the exposure of private debug configuration in HCS TODO: Think about the secret configurations which are private in VMMS VM (only edit by hvsedit) + DebugHost string `json:"DebugHost,omitempty"` + DebugPort int64 `json:"DebugPort,omitempty"` + // Optional data passed by host on isolated virtual machine start + LaunchData string `json:"LaunchData,omitempty"` + HclEnabled bool `json:"HclEnabled,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/modify_setting_request.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/modify_setting_request.go index d29455a3e4..6364da8e23 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/modify_setting_request.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/modify_setting_request.go @@ -9,10 +9,12 @@ package hcsschema +import "github.com/Microsoft/hcsshim/internal/protocol/guestrequest" + type ModifySettingRequest struct { ResourcePath string `json:"ResourcePath,omitempty"` - RequestType string `json:"RequestType,omitempty"` + RequestType guestrequest.RequestType `json:"RequestType,omitempty"` // NOTE: Swagger generated as string. Locally updated. Settings interface{} `json:"Settings,omitempty"` // NOTE: Swagger generated as *interface{}. Locally updated diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/security_settings.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/security_settings.go new file mode 100644 index 0000000000..14f0299e32 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/security_settings.go @@ -0,0 +1,16 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type SecuritySettings struct { + // Enablement of Trusted Platform Module on the computer system + EnableTpm bool `json:"EnableTpm,omitempty"` + Isolation *IsolationSettings `json:"Isolation,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/system_time.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/system_time.go new file mode 100644 index 0000000000..72de801493 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/system_time.go @@ -0,0 +1,28 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type SystemTime struct { + Year int32 `json:"Year,omitempty"` + + Month int32 `json:"Month,omitempty"` + + DayOfWeek int32 `json:"DayOfWeek,omitempty"` + + Day int32 `json:"Day,omitempty"` + + Hour int32 `json:"Hour,omitempty"` + + Minute int32 `json:"Minute,omitempty"` + + Second int32 `json:"Second,omitempty"` + + Milliseconds int32 `json:"Milliseconds,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/time_zone_information.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/time_zone_information.go new file mode 100644 index 0000000000..529743d753 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/time_zone_information.go @@ -0,0 +1,26 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type TimeZoneInformation struct { + Bias int32 `json:"Bias,omitempty"` + + StandardName string `json:"StandardName,omitempty"` + + StandardDate *SystemTime `json:"StandardDate,omitempty"` + + StandardBias int32 `json:"StandardBias,omitempty"` + + DaylightName string `json:"DaylightName,omitempty"` + + DaylightDate *SystemTime `json:"DaylightDate,omitempty"` + + DaylightBias int32 `json:"DaylightBias,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/uefi.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/uefi.go index 0e48ece500..9228923fe4 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/uefi.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/uefi.go @@ -12,6 +12,8 @@ package hcsschema type Uefi struct { EnableDebugger bool `json:"EnableDebugger,omitempty"` + ApplySecureBootTemplate string `json:"ApplySecureBootTemplate,omitempty"` + SecureBootTemplateId string `json:"SecureBootTemplateId,omitempty"` BootThis *UefiBootEntry `json:"BootThis,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_machine.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_machine.go index 2d22b1bcb0..1e0fab2890 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_machine.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_machine.go @@ -29,4 +29,8 @@ type VirtualMachine struct { StorageQoS *StorageQoS `json:"StorageQoS,omitempty"` GuestConnection *GuestConnection `json:"GuestConnection,omitempty"` + + SecuritySettings *SecuritySettings `json:"SecuritySettings,omitempty"` + + DebugOptions *DebugOptions `json:"DebugOptions,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/service.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/service.go index a634dfc151..a46b0051df 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/service.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/service.go @@ -1,3 +1,5 @@ +//go:build windows + package hcs import ( diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go index a76f6b253e..cf20adefc9 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go @@ -1,3 +1,5 @@ +//go:build windows + package hcs import ( @@ -37,6 +39,9 @@ type System struct { startTime time.Time } +var _ cow.Container = &System{} +var _ cow.ProcessHost = &System{} + func newSystem(id string) *System { return &System{ id: id, @@ -55,7 +60,7 @@ func CreateComputeSystem(ctx context.Context, id string, hcsDocumentInterface in // hcsCreateComputeSystemContext is an async operation. Start the outer span // here to measure the full create time. - ctx, span := trace.StartSpan(ctx, operation) + ctx, span := oc.StartSpan(ctx, operation) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes(trace.StringAttribute("cid", id)) @@ -89,7 +94,8 @@ func CreateComputeSystem(ctx context.Context, id string, hcsDocumentInterface in } } - events, err := processAsyncHcsResult(ctx, createError, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.SystemCreate) + events, err := processAsyncHcsResult(ctx, createError, resultJSON, computeSystem.callbackNumber, + hcsNotificationSystemCreateCompleted, &timeout.SystemCreate) if err != nil { if err == ErrTimeout { // Terminate the compute system if it still exists. We're okay to @@ -190,7 +196,7 @@ func (computeSystem *System) Start(ctx context.Context) (err error) { // hcsStartComputeSystemContext is an async operation. Start the outer span // here to measure the full start time. - ctx, span := trace.StartSpan(ctx, operation) + ctx, span := oc.StartSpan(ctx, operation) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) @@ -198,12 +204,15 @@ func (computeSystem *System) Start(ctx context.Context) (err error) { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() + // prevent starting an exited system because waitblock we do not recreate waitBlock + // or rerun waitBackground, so we have no way to be notified of it closing again if computeSystem.handle == 0 { return makeSystemError(computeSystem, operation, ErrAlreadyClosed, nil) } resultJSON, err := vmcompute.HcsStartComputeSystem(ctx, computeSystem.handle, "") - events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.SystemStart) + events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, + hcsNotificationSystemStartCompleted, &timeout.SystemStart) if err != nil { return makeSystemError(computeSystem, operation, err, events) } @@ -223,7 +232,7 @@ func (computeSystem *System) Shutdown(ctx context.Context) error { operation := "hcs::System::Shutdown" - if computeSystem.handle == 0 { + if computeSystem.handle == 0 || computeSystem.stopped() { return nil } @@ -244,7 +253,7 @@ func (computeSystem *System) Terminate(ctx context.Context) error { operation := "hcs::System::Terminate" - if computeSystem.handle == 0 { + if computeSystem.handle == 0 || computeSystem.stopped() { return nil } @@ -265,7 +274,7 @@ func (computeSystem *System) Terminate(ctx context.Context) error { // safe to call multiple times. func (computeSystem *System) waitBackground() { operation := "hcs::System::waitBackground" - ctx, span := trace.StartSpan(context.Background(), operation) + ctx, span := oc.StartSpan(context.Background(), operation) defer span.End() span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) @@ -302,17 +311,25 @@ func (computeSystem *System) Wait() error { return computeSystem.WaitError() } -// ExitError returns an error describing the reason the compute system terminated. -func (computeSystem *System) ExitError() error { +// stopped returns true if the compute system stopped. +func (computeSystem *System) stopped() bool { select { case <-computeSystem.waitBlock: - if computeSystem.waitError != nil { - return computeSystem.waitError - } - return computeSystem.exitError + return true default: + } + return false +} + +// ExitError returns an error describing the reason the compute system terminated. +func (computeSystem *System) ExitError() error { + if !computeSystem.stopped() { return errors.New("container not exited") } + if computeSystem.waitError != nil { + return computeSystem.waitError + } + return computeSystem.exitError } // Properties returns the requested container properties targeting a V1 schema container. @@ -322,6 +339,10 @@ func (computeSystem *System) Properties(ctx context.Context, types ...schema1.Pr operation := "hcs::System::Properties" + if computeSystem.handle == 0 { + return nil, makeSystemError(computeSystem, operation, ErrAlreadyClosed, nil) + } + queryBytes, err := json.Marshal(schema1.PropertyQuery{PropertyTypes: types}) if err != nil { return nil, makeSystemError(computeSystem, operation, err, nil) @@ -349,7 +370,11 @@ func (computeSystem *System) Properties(ctx context.Context, types ...schema1.Pr // failed to be queried they will be tallied up and returned in as the first return value. Failures on // query are NOT considered errors; the only failure case for this method is if the containers job object // cannot be opened. -func (computeSystem *System) queryInProc(ctx context.Context, props *hcsschema.Properties, types []hcsschema.PropertyType) ([]hcsschema.PropertyType, error) { +func (computeSystem *System) queryInProc( + ctx context.Context, + props *hcsschema.Properties, + types []hcsschema.PropertyType, +) ([]hcsschema.PropertyType, error) { // In the future we can make use of some new functionality in the HCS that allows you // to pass a job object for HCS to use for the container. Currently, the only way we'll // be able to open the job/silo is if we're running as SYSTEM. @@ -415,7 +440,7 @@ func (computeSystem *System) statisticsInProc(job *jobobject.JobObject) (*hcssch // as well which isn't great and is wasted work to fetch. // // HCS only let's you grab statistics in an all or nothing fashion, so we can't just grab the private - // working set ourselves and ask for everything else seperately. The optimization we can make here is + // working set ourselves and ask for everything else separately. The optimization we can make here is // to open the silo ourselves and do the same queries for the rest of the info, as well as calculating // the private working set in a more efficient manner by: // @@ -455,6 +480,10 @@ func (computeSystem *System) statisticsInProc(job *jobobject.JobObject) (*hcssch func (computeSystem *System) hcsPropertiesV2Query(ctx context.Context, types []hcsschema.PropertyType) (*hcsschema.Properties, error) { operation := "hcs::System::PropertiesV2" + if computeSystem.handle == 0 { + return nil, makeSystemError(computeSystem, operation, ErrAlreadyClosed, nil) + } + queryBytes, err := json.Marshal(hcsschema.PropertyQuery{PropertyTypes: types}) if err != nil { return nil, makeSystemError(computeSystem, operation, err, nil) @@ -503,7 +532,7 @@ func (computeSystem *System) PropertiesV2(ctx context.Context, types ...hcsschem if err == nil && len(fallbackTypes) == 0 { return properties, nil } else if err != nil { - logEntry.WithError(fmt.Errorf("failed to query compute system properties in-proc: %w", err)) + logEntry = logEntry.WithError(fmt.Errorf("failed to query compute system properties in-proc: %w", err)) fallbackTypes = types } @@ -535,9 +564,9 @@ func (computeSystem *System) PropertiesV2(ctx context.Context, types ...hcsschem func (computeSystem *System) Pause(ctx context.Context) (err error) { operation := "hcs::System::Pause" - // hcsPauseComputeSystemContext is an async peration. Start the outer span + // hcsPauseComputeSystemContext is an async operation. Start the outer span // here to measure the full pause time. - ctx, span := trace.StartSpan(ctx, operation) + ctx, span := oc.StartSpan(ctx, operation) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) @@ -550,7 +579,8 @@ func (computeSystem *System) Pause(ctx context.Context) (err error) { } resultJSON, err := vmcompute.HcsPauseComputeSystem(ctx, computeSystem.handle, "") - events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.SystemPause) + events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, + hcsNotificationSystemPauseCompleted, &timeout.SystemPause) if err != nil { return makeSystemError(computeSystem, operation, err, events) } @@ -564,7 +594,7 @@ func (computeSystem *System) Resume(ctx context.Context) (err error) { // hcsResumeComputeSystemContext is an async operation. Start the outer span // here to measure the full restore time. - ctx, span := trace.StartSpan(ctx, operation) + ctx, span := oc.StartSpan(ctx, operation) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) @@ -577,7 +607,8 @@ func (computeSystem *System) Resume(ctx context.Context) (err error) { } resultJSON, err := vmcompute.HcsResumeComputeSystem(ctx, computeSystem.handle, "") - events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.SystemResume) + events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, + hcsNotificationSystemResumeCompleted, &timeout.SystemResume) if err != nil { return makeSystemError(computeSystem, operation, err, events) } @@ -589,9 +620,9 @@ func (computeSystem *System) Resume(ctx context.Context) (err error) { func (computeSystem *System) Save(ctx context.Context, options interface{}) (err error) { operation := "hcs::System::Save" - // hcsSaveComputeSystemContext is an async peration. Start the outer span + // hcsSaveComputeSystemContext is an async operation. Start the outer span // here to measure the full save time. - ctx, span := trace.StartSpan(ctx, operation) + ctx, span := oc.StartSpan(ctx, operation) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) @@ -609,7 +640,8 @@ func (computeSystem *System) Save(ctx context.Context, options interface{}) (err } result, err := vmcompute.HcsSaveComputeSystem(ctx, computeSystem.handle, string(saveOptions)) - events, err := processAsyncHcsResult(ctx, err, result, computeSystem.callbackNumber, hcsNotificationSystemSaveCompleted, &timeout.SystemSave) + events, err := processAsyncHcsResult(ctx, err, result, computeSystem.callbackNumber, + hcsNotificationSystemSaveCompleted, &timeout.SystemSave) if err != nil { return makeSystemError(computeSystem, operation, err, events) } @@ -634,6 +666,11 @@ func (computeSystem *System) createProcess(ctx context.Context, operation string processInfo, processHandle, resultJSON, err := vmcompute.HcsCreateProcess(ctx, computeSystem.handle, configuration) events := processHcsResult(ctx, resultJSON) if err != nil { + if v2, ok := c.(*hcsschema.ProcessParameters); ok { + operation += ": " + v2.CommandLine + } else if v1, ok := c.(*schema1.ProcessConfig); ok { + operation += ": " + v1.CommandLine + } return nil, nil, makeSystemError(computeSystem, operation, err, events) } @@ -700,7 +737,7 @@ func (computeSystem *System) OpenProcess(ctx context.Context, pid int) (*Process // Close cleans up any state associated with the compute system but does not terminate or wait for it. func (computeSystem *System) Close() (err error) { operation := "hcs::System::Close" - ctx, span := trace.StartSpan(context.Background(), operation) + ctx, span := oc.StartSpan(context.Background(), operation) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) @@ -743,7 +780,8 @@ func (computeSystem *System) registerCallback(ctx context.Context) error { callbackMap[callbackNumber] = callbackContext callbackMapLock.Unlock() - callbackHandle, err := vmcompute.HcsRegisterComputeSystemCallback(ctx, computeSystem.handle, notificationWatcherCallback, callbackNumber) + callbackHandle, err := vmcompute.HcsRegisterComputeSystemCallback(ctx, computeSystem.handle, + notificationWatcherCallback, callbackNumber) if err != nil { return err } @@ -770,7 +808,7 @@ func (computeSystem *System) unregisterCallback(ctx context.Context) error { return nil } - // hcsUnregisterComputeSystemCallback has its own syncronization + // hcsUnregisterComputeSystemCallback has its own synchronization // to wait for all callbacks to complete. We must NOT hold the callbackMapLock. err := vmcompute.HcsUnregisterComputeSystemCallback(ctx, handle) if err != nil { diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/utils.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/utils.go index 3342e5bb94..5dcb97eb39 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/utils.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/utils.go @@ -1,3 +1,5 @@ +//go:build windows + package hcs import ( diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go index db4e14fdfb..3a51ed1955 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go @@ -1,3 +1,5 @@ +//go:build windows + package hcs import ( @@ -7,7 +9,14 @@ import ( "github.com/Microsoft/hcsshim/internal/log" ) -func processAsyncHcsResult(ctx context.Context, err error, resultJSON string, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) { +func processAsyncHcsResult( + ctx context.Context, + err error, + resultJSON string, + callbackNumber uintptr, + expectedNotification hcsNotification, + timeout *time.Duration, +) ([]ErrorEvent, error) { events := processHcsResult(ctx, resultJSON) if IsPending(err) { return nil, waitForNotification(ctx, callbackNumber, expectedNotification, timeout) @@ -16,7 +25,12 @@ func processAsyncHcsResult(ctx context.Context, err error, resultJSON string, ca return events, err } -func waitForNotification(ctx context.Context, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error { +func waitForNotification( + ctx context.Context, + callbackNumber uintptr, + expectedNotification hcsNotification, + timeout *time.Duration, +) error { callbackMapLock.RLock() if _, ok := callbackMap[callbackNumber]; !ok { callbackMapLock.RUnlock() diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcserror/doc.go b/vendor/github.com/Microsoft/hcsshim/internal/hcserror/doc.go new file mode 100644 index 0000000000..ce70676789 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcserror/doc.go @@ -0,0 +1 @@ +package hcserror diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcserror/hcserror.go b/vendor/github.com/Microsoft/hcsshim/internal/hcserror/hcserror.go index 921c2c8556..a70d80da07 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcserror/hcserror.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcserror/hcserror.go @@ -1,11 +1,13 @@ +//go:build windows + package hcserror import ( + "errors" "fmt" - "syscall" -) -const ERROR_GEN_FAILURE = syscall.Errno(31) + "golang.org/x/sys/windows" +) type HcsError struct { title string @@ -30,18 +32,21 @@ func (e *HcsError) Error() string { func New(err error, title, rest string) error { // Pass through DLL errors directly since they do not originate from HCS. - if _, ok := err.(*syscall.DLLError); ok { + var e *windows.DLLError + if errors.As(err, &e) { return err } return &HcsError{title, rest, err} } func Win32FromError(err error) uint32 { - if herr, ok := err.(*HcsError); ok { + var herr *HcsError + if errors.As(err, &herr) { return Win32FromError(herr.Err) } - if code, ok := err.(syscall.Errno); ok { + var code windows.Errno + if errors.As(err, &code) { return uint32(code) } - return uint32(ERROR_GEN_FAILURE) + return uint32(windows.ERROR_GEN_FAILURE) } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/doc.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/doc.go new file mode 100644 index 0000000000..f6d35df0e5 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/doc.go @@ -0,0 +1 @@ +package hns diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hns.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hns.go index b2e475f53c..ec4c907d1f 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hns.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hns.go @@ -2,7 +2,7 @@ package hns import "fmt" -//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hns.go +//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -output zsyscall_windows.go hns.go //sys _hnsCall(method string, path string, object string, response **uint16) (hr error) = vmcompute.HNSCall? diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go index 7cf954c7b2..593664419d 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go @@ -1,3 +1,5 @@ +//go:build windows + package hns import ( @@ -34,7 +36,7 @@ type HNSEndpoint struct { SharedContainers []string `json:",omitempty"` } -//SystemType represents the type of the system on which actions are done +// SystemType represents the type of the system on which actions are done type SystemType string // SystemType const @@ -146,7 +148,6 @@ func (endpoint *HNSEndpoint) IsAttached(vID string) (bool, error) { } return false, nil - } // Create Endpoint by sending EndpointRequest to HNS. TODO: Create a separate HNS interface to place all these methods @@ -281,7 +282,6 @@ func (endpoint *HNSEndpoint) HostAttach(compartmentID uint16) error { return err } return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response) - } // HostDetach detaches a nic on the host diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go index 2df4a57f56..0a8f36d832 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go @@ -1,3 +1,5 @@ +//go:build windows + package hns import ( diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsglobals.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsglobals.go index a8d8cc56ae..464bb8954f 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsglobals.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsglobals.go @@ -1,3 +1,5 @@ +//go:build windows + package hns type HNSGlobals struct { diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go index f12d3ab041..8861faee7a 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go @@ -1,13 +1,16 @@ +//go:build windows + package hns import ( "encoding/json" "errors" - "github.com/sirupsen/logrus" "net" + + "github.com/sirupsen/logrus" ) -// Subnet is assoicated with a network and represents a list +// Subnet is associated with a network and represents a list // of subnets available to the network type Subnet struct { AddressPrefix string `json:",omitempty"` @@ -15,7 +18,7 @@ type Subnet struct { Policies []json.RawMessage `json:",omitempty"` } -// MacPool is assoicated with a network and represents a list +// MacPool is associated with a network and represents a list // of macaddresses available to the network type MacPool struct { StartMacAddress string `json:",omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go index 84b3682184..082c018a4e 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go @@ -94,15 +94,15 @@ type ACLPolicy struct { InternalPort uint16 `json:",omitempty"` Action ActionType Direction DirectionType - LocalAddresses string `json:",omitempty"` - RemoteAddresses string `json:",omitempty"` - LocalPorts string `json:"LocalPorts,omitempty"` - LocalPort uint16 `json:",omitempty"` - RemotePorts string `json:"RemotePorts,omitempty"` - RemotePort uint16 `json:",omitempty"` - RuleType RuleType `json:"RuleType,omitempty"` - Priority uint16 `json:",omitempty"` - ServiceName string `json:",omitempty"` + LocalAddresses string `json:",omitempty"` + RemoteAddresses string `json:",omitempty"` + LocalPorts string `json:"LocalPorts,omitempty"` + LocalPort uint16 `json:",omitempty"` + RemotePorts string `json:"RemotePorts,omitempty"` + RemotePort uint16 `json:",omitempty"` + RuleType RuleType `json:"RuleType,omitempty"` + Priority uint16 `json:",omitempty"` + ServiceName string `json:",omitempty"` } type Policy struct { diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicylist.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicylist.go index 31322a6816..b98db40e8d 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicylist.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicylist.go @@ -1,3 +1,5 @@ +//go:build windows + package hns import ( diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnssupport.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnssupport.go index d5efba7f28..b9c30b9019 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnssupport.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnssupport.go @@ -1,3 +1,5 @@ +//go:build windows + package hns import ( diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/namespace.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/namespace.go index d3b04eefe0..749588ad39 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/namespace.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/namespace.go @@ -1,3 +1,5 @@ +//go:build windows + package hns import ( diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/zsyscall_windows.go index 204633a488..a35ee945db 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/zsyscall_windows.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/zsyscall_windows.go @@ -1,4 +1,6 @@ -// Code generated mksyscall_windows.exe DO NOT EDIT +//go:build windows + +// Code generated by 'go generate' using "github.com/Microsoft/go-winio/tools/mkwinsyscall"; DO NOT EDIT. package hns @@ -19,6 +21,7 @@ const ( var ( errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) + errERROR_EINVAL error = syscall.EINVAL ) // errnoErr returns common boxed Errno values, to prevent @@ -26,7 +29,7 @@ var ( func errnoErr(e syscall.Errno) error { switch e { case 0: - return nil + return errERROR_EINVAL case errnoERROR_IO_PENDING: return errERROR_IO_PENDING } @@ -62,7 +65,8 @@ func _hnsCall(method string, path string, object string, response **uint16) (hr } func __hnsCall(method *uint16, path *uint16, object *uint16, response **uint16) (hr error) { - if hr = procHNSCall.Find(); hr != nil { + hr = procHNSCall.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall6(procHNSCall.Addr(), 4, uintptr(unsafe.Pointer(method)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(object)), uintptr(unsafe.Pointer(response)), 0, 0) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/interop/doc.go b/vendor/github.com/Microsoft/hcsshim/internal/interop/doc.go new file mode 100644 index 0000000000..cb554867fe --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/interop/doc.go @@ -0,0 +1 @@ +package interop diff --git a/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go b/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go index 922f7c679e..a564696568 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go @@ -1,3 +1,5 @@ +//go:build windows + package interop import ( @@ -5,7 +7,7 @@ import ( "unsafe" ) -//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go interop.go +//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -output zsyscall_windows.go interop.go //sys coTaskMemFree(buffer unsafe.Pointer) = api_ms_win_core_com_l1_1_0.CoTaskMemFree diff --git a/vendor/github.com/Microsoft/hcsshim/internal/interop/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/interop/zsyscall_windows.go index 12b0c71c5a..a17a112508 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/interop/zsyscall_windows.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/interop/zsyscall_windows.go @@ -1,4 +1,6 @@ -// Code generated mksyscall_windows.exe DO NOT EDIT +//go:build windows + +// Code generated by 'go generate' using "github.com/Microsoft/go-winio/tools/mkwinsyscall"; DO NOT EDIT. package interop @@ -19,6 +21,7 @@ const ( var ( errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) + errERROR_EINVAL error = syscall.EINVAL ) // errnoErr returns common boxed Errno values, to prevent @@ -26,7 +29,7 @@ var ( func errnoErr(e syscall.Errno) error { switch e { case 0: - return nil + return errERROR_EINVAL case errnoERROR_IO_PENDING: return errERROR_IO_PENDING } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/jobobject/doc.go b/vendor/github.com/Microsoft/hcsshim/internal/jobobject/doc.go new file mode 100644 index 0000000000..34b53d6e48 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/jobobject/doc.go @@ -0,0 +1,8 @@ +// This package provides higher level constructs for the win32 job object API. +// Most of the core creation and management functions are already present in "golang.org/x/sys/windows" +// (CreateJobObject, AssignProcessToJobObject, etc.) as well as most of the limit information +// structs and associated limit flags. Whatever is not present from the job object API +// in golang.org/x/sys/windows is located in /internal/winapi. +// +// https://docs.microsoft.com/en-us/windows/win32/procthread/job-objects +package jobobject diff --git a/vendor/github.com/Microsoft/hcsshim/internal/jobobject/iocp.go b/vendor/github.com/Microsoft/hcsshim/internal/jobobject/iocp.go index 5d6acd69e6..bcca84b0da 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/jobobject/iocp.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/jobobject/iocp.go @@ -1,3 +1,5 @@ +//go:build windows + package jobobject import ( diff --git a/vendor/github.com/Microsoft/hcsshim/internal/jobobject/jobobject.go b/vendor/github.com/Microsoft/hcsshim/internal/jobobject/jobobject.go index c9fdd921a7..64afd35dc6 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/jobobject/jobobject.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/jobobject/jobobject.go @@ -1,10 +1,15 @@ +//go:build windows + package jobobject import ( "context" "errors" "fmt" + "os" + "path/filepath" "sync" + "sync/atomic" "unsafe" "github.com/Microsoft/hcsshim/internal/queue" @@ -12,19 +17,14 @@ import ( "golang.org/x/sys/windows" ) -// This file provides higher level constructs for the win32 job object API. -// Most of the core creation and management functions are already present in "golang.org/x/sys/windows" -// (CreateJobObject, AssignProcessToJobObject, etc.) as well as most of the limit information -// structs and associated limit flags. Whatever is not present from the job object API -// in golang.org/x/sys/windows is located in /internal/winapi. -// -// https://docs.microsoft.com/en-us/windows/win32/procthread/job-objects - // JobObject is a high level wrapper around a Windows job object. Holds a handle to // the job, a queue to receive iocp notifications about the lifecycle // of the job and a mutex for synchronized handle access. type JobObject struct { - handle windows.Handle + handle windows.Handle + // All accesses to this MUST be done atomically except in `Open` as the object + // is being created in the function. 1 signifies that this job is currently a silo. + silo uint32 mq *queue.MessageQueue handleLock sync.RWMutex } @@ -56,6 +56,7 @@ const ( var ( ErrAlreadyClosed = errors.New("the handle has already been closed") ErrNotRegistered = errors.New("job is not registered to receive notifications") + ErrNotSilo = errors.New("job is not a silo") ) // Options represents the set of configurable options when making or opening a job object. @@ -68,6 +69,9 @@ type Options struct { // `UseNTVariant` specifies if we should use the `Nt` variant of Open/CreateJobObject. // Defaults to false. UseNTVariant bool + // `Silo` specifies to promote the job to a silo. This additionally sets the flag + // JOB_OBJECT_LIMIT_KILL_ON_JOB_CLOSE as it is required for the upgrade to complete. + Silo bool // `IOTracking` enables tracking I/O statistics on the job object. More specifically this // calls SetInformationJobObject with the JobObjectIoAttribution class. EnableIOTracking bool @@ -143,6 +147,16 @@ func Create(ctx context.Context, options *Options) (_ *JobObject, err error) { } } + if options.Silo { + // This is a required setting for upgrading to a silo. + if err := job.SetTerminateOnLastHandleClose(); err != nil { + return nil, err + } + if err := job.PromoteToSilo(); err != nil { + return nil, err + } + } + return job, nil } @@ -163,7 +177,7 @@ func Open(ctx context.Context, options *Options) (_ *JobObject, err error) { } var jobHandle windows.Handle - if options != nil && options.UseNTVariant { + if options.UseNTVariant { oa := winapi.ObjectAttributes{ Length: unsafe.Sizeof(winapi.ObjectAttributes{}), ObjectName: unicodeJobName, @@ -174,7 +188,7 @@ func Open(ctx context.Context, options *Options) (_ *JobObject, err error) { return nil, winapi.RtlNtStatusToDosError(status) } } else { - jobHandle, err = winapi.OpenJobObject(winapi.JOB_OBJECT_ALL_ACCESS, false, unicodeJobName.Buffer) + jobHandle, err = winapi.OpenJobObject(winapi.JOB_OBJECT_ALL_ACCESS, 0, unicodeJobName.Buffer) if err != nil { return nil, err } @@ -190,9 +204,13 @@ func Open(ctx context.Context, options *Options) (_ *JobObject, err error) { handle: jobHandle, } + if isJobSilo(jobHandle) { + job.silo = 1 + } + // If the IOCP we'll be using to receive messages for all jobs hasn't been // created, create it and start polling. - if options != nil && options.Notifications { + if options.Notifications { mq, err := setupNotifications(ctx, job) if err != nil { return nil, err @@ -450,6 +468,119 @@ func (job *JobObject) QueryStorageStats() (*winapi.JOBOBJECT_IO_ATTRIBUTION_INFO return &info, nil } +// ApplyFileBinding makes a file binding using the Bind Filter from target to root. If the job has +// not been upgraded to a silo this call will fail. The binding is only applied and visible for processes +// running in the job, any processes on the host or in another job will not be able to see the binding. +func (job *JobObject) ApplyFileBinding(root, target string, readOnly bool) error { + job.handleLock.RLock() + defer job.handleLock.RUnlock() + + if job.handle == 0 { + return ErrAlreadyClosed + } + + if !job.isSilo() { + return ErrNotSilo + } + + // The parent directory needs to exist for the bind to work. MkdirAll stats and + // returns nil if the directory exists internally so we should be fine to mkdirall + // every time. + if err := os.MkdirAll(filepath.Dir(root), 0); err != nil { + return err + } + + rootPtr, err := windows.UTF16PtrFromString(root) + if err != nil { + return err + } + + targetPtr, err := windows.UTF16PtrFromString(target) + if err != nil { + return err + } + + flags := winapi.BINDFLT_FLAG_USE_CURRENT_SILO_MAPPING + if readOnly { + flags |= winapi.BINDFLT_FLAG_READ_ONLY_MAPPING + } + + if err := winapi.BfSetupFilter( + job.handle, + flags, + rootPtr, + targetPtr, + nil, + 0, + ); err != nil { + return fmt.Errorf("failed to bind target %q to root %q for job object: %w", target, root, err) + } + return nil +} + +// isJobSilo is a helper to determine if a job object that was opened is a silo. This should ONLY be called +// from `Open` and any callers in this package afterwards should use `job.isSilo()` +func isJobSilo(h windows.Handle) bool { + // None of the information from the structure that this info class expects will be used, this is just used as + // the call will fail if the job hasn't been upgraded to a silo so we can use this to tell when we open a job + // if it's a silo or not. Because none of the info matters simply define a dummy struct with the size that the call + // expects which is 16 bytes. + type isSiloObj struct { + _ [16]byte + } + var siloInfo isSiloObj + err := winapi.QueryInformationJobObject( + h, + winapi.JobObjectSiloBasicInformation, + unsafe.Pointer(&siloInfo), + uint32(unsafe.Sizeof(siloInfo)), + nil, + ) + return err == nil +} + +// PromoteToSilo promotes a job object to a silo. There must be no running processess +// in the job for this to succeed. If the job is already a silo this is a no-op. +func (job *JobObject) PromoteToSilo() error { + job.handleLock.RLock() + defer job.handleLock.RUnlock() + + if job.handle == 0 { + return ErrAlreadyClosed + } + + if job.isSilo() { + return nil + } + + pids, err := job.Pids() + if err != nil { + return err + } + + if len(pids) != 0 { + return fmt.Errorf("job cannot have running processes to be promoted to a silo, found %d running processes", len(pids)) + } + + _, err = windows.SetInformationJobObject( + job.handle, + winapi.JobObjectCreateSilo, + 0, + 0, + ) + if err != nil { + return fmt.Errorf("failed to promote job to silo: %w", err) + } + + atomic.StoreUint32(&job.silo, 1) + return nil +} + +// isSilo returns if the job object is a silo. +func (job *JobObject) isSilo() bool { + return atomic.LoadUint32(&job.silo) == 1 +} + // QueryPrivateWorkingSet returns the private working set size for the job. This is calculated by adding up the // private working set for every process running in the job. func (job *JobObject) QueryPrivateWorkingSet() (uint64, error) { diff --git a/vendor/github.com/Microsoft/hcsshim/internal/jobobject/limits.go b/vendor/github.com/Microsoft/hcsshim/internal/jobobject/limits.go index 4efde292c4..03f71d9a42 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/jobobject/limits.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/jobobject/limits.go @@ -1,3 +1,5 @@ +//go:build windows + package jobobject import ( diff --git a/vendor/github.com/Microsoft/hcsshim/internal/log/context.go b/vendor/github.com/Microsoft/hcsshim/internal/log/context.go new file mode 100644 index 0000000000..d17d909d93 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/log/context.go @@ -0,0 +1,118 @@ +package log + +import ( + "context" + + "github.com/sirupsen/logrus" + "go.opencensus.io/trace" +) + +type entryContextKeyType int + +const _entryContextKey entryContextKeyType = iota + +var ( + // L is the default, blank logging entry. WithField and co. all return a copy + // of the original entry, so this will not leak fields between calls. + // + // Do NOT modify fields directly, as that will corrupt state for all users and + // is not thread safe. + // Instead, use `L.With*` or `L.Dup()`. Or `G(context.Background())`. + L = logrus.NewEntry(logrus.StandardLogger()) + + // G is an alias for GetEntry + G = GetEntry + + // S is an alias for SetEntry + S = SetEntry + + // U is an alias for UpdateContext + U = UpdateContext +) + +// GetEntry returns a `logrus.Entry` stored in the context, if one exists. +// Otherwise, it returns a default entry that points to the current context. +// +// Note: if the a new entry is returned, it will reference the passed in context. +// However, existing contexts may be stored in parent contexts and additionally reference +// earlier contexts. +// Use `UpdateContext` to update the entry and context. +func GetEntry(ctx context.Context) *logrus.Entry { + entry := fromContext(ctx) + + if entry == nil { + entry = L.WithContext(ctx) + } + + return entry +} + +// SetEntry updates the log entry in the context with the provided fields, and +// returns both. It is equivalent to: +// +// entry := GetEntry(ctx).WithFields(fields) +// ctx = WithContext(ctx, entry) +// +// See WithContext for more information. +func SetEntry(ctx context.Context, fields logrus.Fields) (context.Context, *logrus.Entry) { + e := GetEntry(ctx) + if len(fields) > 0 { + e = e.WithFields(fields) + } + return WithContext(ctx, e) +} + +// UpdateContext extracts the log entry from the context, and, if the entry's +// context points to a parent's of the current context, ands the entry +// to the most recent context. It is equivalent to: +// +// entry := GetEntry(ctx) +// ctx = WithContext(ctx, entry) +// +// This allows the entry to reference the most recent context and any new +// values (such as span contexts) added to it. +// +// See WithContext for more information. +func UpdateContext(ctx context.Context) context.Context { + // there is no way to check its ctx (and not one of its parents) that contains `e` + // so, at a slight cost, force add `e` to the context + ctx, _ = WithContext(ctx, GetEntry(ctx)) + return ctx +} + +// WithContext returns a context that contains the provided log entry. +// The entry can be extracted with `GetEntry` (`G`) +// +// The entry in the context is a copy of `entry` (generated by `entry.WithContext`) +func WithContext(ctx context.Context, entry *logrus.Entry) (context.Context, *logrus.Entry) { + // regardless of the order, entry.Context != GetEntry(ctx) + // here, the returned entry will reference the supplied context + entry = entry.WithContext(ctx) + ctx = context.WithValue(ctx, _entryContextKey, entry) + + return ctx, entry +} + +// Copy extracts the tracing Span and logging entry from the src Context, if they +// exist, and adds them to the dst Context. +// +// This is useful to share tracing and logging between contexts, but not the +// cancellation. For example, if the src Context has been cancelled but cleanup +// operations triggered by the cancellation require a non-cancelled context to +// execute. +func Copy(dst context.Context, src context.Context) context.Context { + if s := trace.FromContext(src); s != nil { + dst = trace.NewContext(dst, s) + } + + if e := fromContext(src); e != nil { + dst, _ = WithContext(dst, e) + } + + return dst +} + +func fromContext(ctx context.Context) *logrus.Entry { + e, _ := ctx.Value(_entryContextKey).(*logrus.Entry) + return e +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/log/g.go b/vendor/github.com/Microsoft/hcsshim/internal/log/g.go deleted file mode 100644 index ba6b1a4a53..0000000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/log/g.go +++ /dev/null @@ -1,23 +0,0 @@ -package log - -import ( - "context" - - "github.com/sirupsen/logrus" - "go.opencensus.io/trace" -) - -// G returns a `logrus.Entry` with the `TraceID, SpanID` from `ctx` if `ctx` -// contains an OpenCensus `trace.Span`. -func G(ctx context.Context) *logrus.Entry { - span := trace.FromContext(ctx) - if span != nil { - sctx := span.SpanContext() - return logrus.WithFields(logrus.Fields{ - "traceID": sctx.TraceID.String(), - "spanID": sctx.SpanID.String(), - // "parentSpanID": TODO: JTERRY75 - Try to convince OC to export this? - }) - } - return logrus.NewEntry(logrus.StandardLogger()) -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/log/hook.go b/vendor/github.com/Microsoft/hcsshim/internal/log/hook.go new file mode 100644 index 0000000000..8f89405923 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/log/hook.go @@ -0,0 +1,45 @@ +package log + +import ( + "github.com/Microsoft/hcsshim/internal/logfields" + "github.com/sirupsen/logrus" + "go.opencensus.io/trace" +) + +// Hook serves to intercept and format `logrus.Entry`s before they are passed +// to the ETW hook. +// +// The containerd shim discards the (formatted) logrus output, and outputs only via ETW. +// The Linux GCS outputs logrus entries over stdout, which is consumed by the shim and +// then re-output via the ETW hook. +type Hook struct{} + +var _ logrus.Hook = &Hook{} + +func NewHook() *Hook { + return &Hook{} +} + +func (h *Hook) Levels() []logrus.Level { + return logrus.AllLevels +} + +func (h *Hook) Fire(e *logrus.Entry) (err error) { + h.addSpanContext(e) + + return nil +} + +func (h *Hook) addSpanContext(e *logrus.Entry) { + ctx := e.Context + if ctx == nil { + return + } + span := trace.FromContext(ctx) + if span == nil { + return + } + sctx := span.SpanContext() + e.Data[logfields.TraceID] = sctx.TraceID.String() + e.Data[logfields.SpanID] = sctx.SpanID.String() +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/log/scrub.go b/vendor/github.com/Microsoft/hcsshim/internal/log/scrub.go new file mode 100644 index 0000000000..d51e0fd89f --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/log/scrub.go @@ -0,0 +1,194 @@ +package log + +import ( + "bytes" + "encoding/json" + "errors" + "strings" + "sync/atomic" + + hcsschema "github.com/Microsoft/hcsshim/internal/hcs/schema2" +) + +// This package scrubs objects of potentially sensitive information to pass to logging + +type genMap = map[string]interface{} +type scrubberFunc func(genMap) error + +const _scrubbedReplacement = "" + +var ( + ErrUnknownType = errors.New("encoded object is of unknown type") + + // case sensitive keywords, so "env" is not a substring on "Environment" + _scrubKeywords = [][]byte{[]byte("env"), []byte("Environment")} + + _scrub int32 +) + +// SetScrubbing enables scrubbing +func SetScrubbing(enable bool) { + v := int32(0) // cant convert from bool to int32 directly + if enable { + v = 1 + } + atomic.StoreInt32(&_scrub, v) +} + +// IsScrubbingEnabled checks if scrubbing is enabled +func IsScrubbingEnabled() bool { + v := atomic.LoadInt32(&_scrub) + return v != 0 +} + +// ScrubProcessParameters scrubs HCS Create Process requests with config parameters of +// type internal/hcs/schema2.ScrubProcessParameters (aka hcsshema.ScrubProcessParameters) +func ScrubProcessParameters(s string) (string, error) { + // todo: deal with v1 ProcessConfig + b := []byte(s) + if !IsScrubbingEnabled() || !hasKeywords(b) || !json.Valid(b) { + return s, nil + } + + pp := hcsschema.ProcessParameters{} + if err := json.Unmarshal(b, &pp); err != nil { + return "", err + } + pp.Environment = map[string]string{_scrubbedReplacement: _scrubbedReplacement} + + buf := bytes.NewBuffer(b[:0]) + if err := encode(buf, pp); err != nil { + return "", err + } + return strings.TrimSpace(buf.String()), nil +} + +// ScrubBridgeCreate scrubs requests sent over the bridge of type +// internal/gcs/protocol.containerCreate wrapping an internal/hcsoci.linuxHostedSystem +func ScrubBridgeCreate(b []byte) ([]byte, error) { + return scrubBytes(b, scrubBridgeCreate) +} + +func scrubBridgeCreate(m genMap) error { + if !isRequestBase(m) { + return ErrUnknownType + } + if ss, ok := m["ContainerConfig"]; ok { + // ContainerConfig is a json encoded struct passed as a regular string field + s, ok := ss.(string) + if !ok { + return ErrUnknownType + } + b, err := scrubBytes([]byte(s), scrubLinuxHostedSystem) + if err != nil { + return err + } + m["ContainerConfig"] = string(b) + return nil + } + return ErrUnknownType +} + +func scrubLinuxHostedSystem(m genMap) error { + if m, ok := index(m, "OciSpecification"); ok { + if _, ok := m["annotations"]; ok { + m["annotations"] = map[string]string{_scrubbedReplacement: _scrubbedReplacement} + } + if m, ok := index(m, "process"); ok { + if _, ok := m["env"]; ok { + m["env"] = []string{_scrubbedReplacement} + return nil + } + } + } + return ErrUnknownType +} + +// ScrubBridgeExecProcess scrubs requests sent over the bridge of type +// internal/gcs/protocol.containerExecuteProcess +func ScrubBridgeExecProcess(b []byte) ([]byte, error) { + return scrubBytes(b, scrubExecuteProcess) +} + +func scrubExecuteProcess(m genMap) error { + if !isRequestBase(m) { + return ErrUnknownType + } + if m, ok := index(m, "Settings"); ok { + if ss, ok := m["ProcessParameters"]; ok { + // ProcessParameters is a json encoded struct passed as a regular sting field + s, ok := ss.(string) + if !ok { + return ErrUnknownType + } + + s, err := ScrubProcessParameters(s) + if err != nil { + return err + } + + m["ProcessParameters"] = s + return nil + } + } + return ErrUnknownType +} + +func scrubBytes(b []byte, scrub scrubberFunc) ([]byte, error) { + if !IsScrubbingEnabled() || !hasKeywords(b) || !json.Valid(b) { + return b, nil + } + + m := make(genMap) + if err := json.Unmarshal(b, &m); err != nil { + return nil, err + } + + // could use regexp, but if the env strings contain braces, the regexp fails + // parsing into individual structs would require access to private structs + if err := scrub(m); err != nil { + return nil, err + } + + buf := &bytes.Buffer{} + if err := encode(buf, m); err != nil { + return nil, err + } + + return bytes.TrimSpace(buf.Bytes()), nil +} + +func encode(buf *bytes.Buffer, v interface{}) error { + enc := json.NewEncoder(buf) + enc.SetEscapeHTML(false) + if err := enc.Encode(v); err != nil { + return err + } + return nil +} + +func isRequestBase(m genMap) bool { + // neither of these are (currently) `omitempty` + _, a := m["ActivityId"] + _, c := m["ContainerId"] + return a && c +} + +// combination `m, ok := m[s]` and `m, ok := m.(genMap)` +func index(m genMap, s string) (genMap, bool) { + if m, ok := m[s]; ok { + mm, ok := m.(genMap) + return mm, ok + } + + return m, false +} + +func hasKeywords(b []byte) bool { + for _, bb := range _scrubKeywords { + if bytes.Contains(b, bb) { + return true + } + } + return false +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/logfields/fields.go b/vendor/github.com/Microsoft/hcsshim/internal/logfields/fields.go index cf2c166d9b..3e175e5222 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/logfields/fields.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/logfields/fields.go @@ -3,21 +3,44 @@ package logfields const ( // Identifiers + Name = "name" + Namespace = "namespace" + Operation = "operation" + + ID = "id" + SandboxID = "sid" ContainerID = "cid" - UVMID = "uvm-id" + ExecID = "eid" ProcessID = "pid" + TaskID = "tid" + UVMID = "uvm-id" + + // networking and IO + + File = "file" + Path = "path" + Bytes = "bytes" + Pipe = "pipe" // Common Misc - // Timeout represents an operation timeout. - Timeout = "timeout" + Attempt = "attemptNo" JSON = "json" + // Time + + StartTime = "startTime" + EndTime = "endTime" + Duration = "duration" + Timeout = "timeout" + // Keys/values Field = "field" + Key = "key" OCIAnnotation = "oci-annotation" Value = "value" + Options = "options" // Golang type's @@ -29,4 +52,10 @@ const ( // runhcs VMShimOperation = "vmshim-op" + + // logging and tracing + + TraceID = "traceID" + SpanID = "spanID" + ParentSpanID = "parentSpanID" ) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/memory/pool.go b/vendor/github.com/Microsoft/hcsshim/internal/memory/pool.go new file mode 100644 index 0000000000..1ef5814d7e --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/memory/pool.go @@ -0,0 +1,316 @@ +package memory + +import ( + "github.com/pkg/errors" +) + +const ( + minimumClassSize = MiB + maximumClassSize = 4 * GiB + memoryClassNumber = 7 +) + +var ( + ErrInvalidMemoryClass = errors.New("invalid memory class") + ErrEarlyMerge = errors.New("not all children have been freed") + ErrEmptyPoolOperation = errors.New("operation on empty pool") +) + +// GetMemoryClassType returns the minimum memory class type that can hold a device of +// a given size. The smallest class is 1MB and the largest one is 4GB with 2 bit offset +// intervals in between, for a total of 7 different classes. This function does not +// do a validity check +func GetMemoryClassType(s uint64) classType { + s = (s - 1) >> 20 + memCls := uint32(0) + for s > 0 { + s = s >> 2 + memCls++ + } + return classType(memCls) +} + +// GetMemoryClassSize returns size in bytes for a given memory class +func GetMemoryClassSize(memCls classType) (uint64, error) { + if memCls >= memoryClassNumber { + return 0, ErrInvalidMemoryClass + } + return minimumClassSize << (2 * memCls), nil +} + +// region represents a contiguous memory block +type region struct { + // parent region that has been split into 4 + parent *region + class classType + // offset represents offset in bytes + offset uint64 +} + +// memoryPool tracks free and busy (used) memory regions +type memoryPool struct { + free map[uint64]*region + busy map[uint64]*region +} + +// PoolAllocator implements a memory allocation strategy similar to buddy-malloc https://github.com/evanw/buddy-malloc/blob/master/buddy-malloc.c +// We borrow the idea of spanning a tree of fixed size regions on top of a contiguous memory +// space. +// +// There are a total of 7 different region sizes that can be allocated, with the smallest +// being 1MB and the largest 4GB (the default maximum size of a Virtual PMem device). +// +// For efficiency and to reduce fragmentation an entire region is allocated when requested. +// When there's no available region of requested size, we try to allocate more memory for +// this particular size by splitting the next available larger region into smaller ones, e.g. +// if there's no region available for size class 0, we try splitting a region from class 1, +// then class 2 etc, until we are able to do so or hit the upper limit. +type PoolAllocator struct { + pools [memoryClassNumber]*memoryPool +} + +var _ MappedRegion = ®ion{} +var _ Allocator = &PoolAllocator{} + +func (r *region) Offset() uint64 { + return r.offset +} + +func (r *region) Size() uint64 { + sz, err := GetMemoryClassSize(r.class) + if err != nil { + panic(err) + } + return sz +} + +func (r *region) Type() classType { + return r.class +} + +func newEmptyMemoryPool() *memoryPool { + return &memoryPool{ + free: make(map[uint64]*region), + busy: make(map[uint64]*region), + } +} + +func NewPoolMemoryAllocator() PoolAllocator { + pa := PoolAllocator{} + p := newEmptyMemoryPool() + // by default we allocate a single region with maximum possible size (class type) + p.free[0] = ®ion{ + class: memoryClassNumber - 1, + offset: 0, + } + pa.pools[memoryClassNumber-1] = p + return pa +} + +// Allocate checks memory region pool for the given `size` and returns a free region with +// minimal offset, if none available tries expanding matched memory pool. +// +// Internally it's done via moving a region from free pool into a busy pool +func (pa *PoolAllocator) Allocate(size uint64) (MappedRegion, error) { + memCls := GetMemoryClassType(size) + if memCls >= memoryClassNumber { + return nil, ErrInvalidMemoryClass + } + + // find region with the smallest offset + nextCls, nextOffset, err := pa.findNextOffset(memCls) + if err != nil { + return nil, err + } + + // this means that there are no more regions for the current class, try expanding + if nextCls != memCls { + if err := pa.split(memCls); err != nil { + if err == ErrInvalidMemoryClass { + return nil, ErrNotEnoughSpace + } + return nil, err + } + } + + if err := pa.markBusy(memCls, nextOffset); err != nil { + return nil, err + } + + // by this point memory pool for memCls should have been created, + // either prior or during split call + if r := pa.pools[memCls].busy[nextOffset]; r != nil { + return r, nil + } + + return nil, ErrNotEnoughSpace +} + +// Release marks a memory region of class `memCls` and offset `offset` as free and tries to merge smaller regions into +// a bigger one +func (pa *PoolAllocator) Release(reg MappedRegion) error { + mp := pa.pools[reg.Type()] + if mp == nil { + return ErrEmptyPoolOperation + } + + err := pa.markFree(reg.Type(), reg.Offset()) + if err != nil { + return err + } + + n := mp.free[reg.Offset()] + if n == nil { + return ErrNotAllocated + } + if err := pa.merge(n.parent); err != nil { + if err != ErrEarlyMerge { + return err + } + } + return nil +} + +// findNextOffset finds next region location for a given memCls +func (pa *PoolAllocator) findNextOffset(memCls classType) (classType, uint64, error) { + for mc := memCls; mc < memoryClassNumber; mc++ { + pi := pa.pools[mc] + if pi == nil || len(pi.free) == 0 { + continue + } + + target := uint64(maximumClassSize) + for offset := range pi.free { + if offset < target { + target = offset + } + } + return mc, target, nil + } + return 0, 0, ErrNotEnoughSpace +} + +// split tries to recursively split a bigger memory region into smaller ones until it succeeds or hits the upper limit +func (pa *PoolAllocator) split(clsType classType) error { + nextClsType := clsType + 1 + if nextClsType >= memoryClassNumber { + return ErrInvalidMemoryClass + } + + nextPool := pa.pools[nextClsType] + if nextPool == nil { + nextPool = newEmptyMemoryPool() + pa.pools[nextClsType] = nextPool + } + + cls, offset, err := pa.findNextOffset(nextClsType) + if err != nil { + return err + } + // not enough memory in the next class, try to recursively expand + if cls != nextClsType { + if err := pa.split(nextClsType); err != nil { + return err + } + } + + if err := pa.markBusy(nextClsType, offset); err != nil { + return err + } + + // memCls validity has been checked already, we can ignore the error + clsSize, _ := GetMemoryClassSize(clsType) + + nextReg := nextPool.busy[offset] + if nextReg == nil { + return ErrNotAllocated + } + + // expand memCls + cp := pa.pools[clsType] + if cp == nil { + cp = newEmptyMemoryPool() + pa.pools[clsType] = cp + } + // create 4 smaller regions + for i := uint64(0); i < 4; i++ { + offset := nextReg.offset + i*clsSize + reg := ®ion{ + parent: nextReg, + class: clsType, + offset: offset, + } + cp.free[offset] = reg + } + return nil +} + +func (pa *PoolAllocator) merge(parent *region) error { + // nothing to merge + if parent == nil { + return nil + } + + childCls := parent.class - 1 + childPool := pa.pools[childCls] + // no child nodes to merge, try to merge parent + if childPool == nil { + return pa.merge(parent.parent) + } + + childSize, err := GetMemoryClassSize(childCls) + if err != nil { + return err + } + + // check if all the child nodes are free + var children []*region + for i := uint64(0); i < 4; i++ { + child, free := childPool.free[parent.offset+i*childSize] + if !free { + return ErrEarlyMerge + } + children = append(children, child) + } + + // at this point all the child nodes will be free and we can merge + for _, child := range children { + delete(childPool.free, child.offset) + } + + if err := pa.markFree(parent.class, parent.offset); err != nil { + return err + } + + return pa.merge(parent.parent) +} + +// markFree internally moves a region with `offset` from busy to free map +func (pa *PoolAllocator) markFree(memCls classType, offset uint64) error { + clsPool := pa.pools[memCls] + if clsPool == nil { + return ErrEmptyPoolOperation + } + + if reg, exists := clsPool.busy[offset]; exists { + clsPool.free[offset] = reg + delete(clsPool.busy, offset) + return nil + } + return ErrNotAllocated +} + +// markBusy internally moves a region with `offset` from free to busy map +func (pa *PoolAllocator) markBusy(memCls classType, offset uint64) error { + clsPool := pa.pools[memCls] + if clsPool == nil { + return ErrEmptyPoolOperation + } + + if reg, exists := clsPool.free[offset]; exists { + clsPool.busy[offset] = reg + delete(clsPool.free, offset) + return nil + } + return ErrNotAllocated +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/memory/types.go b/vendor/github.com/Microsoft/hcsshim/internal/memory/types.go new file mode 100644 index 0000000000..d6cdb8cc4c --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/memory/types.go @@ -0,0 +1,28 @@ +package memory + +import "github.com/pkg/errors" + +type classType uint32 + +const ( + MiB = 1024 * 1024 + GiB = 1024 * MiB +) + +var ( + ErrNotEnoughSpace = errors.New("not enough space") + ErrNotAllocated = errors.New("no memory allocated at the given offset") +) + +// MappedRegion represents a memory block with an offset +type MappedRegion interface { + Offset() uint64 + Size() uint64 + Type() classType +} + +// Allocator is an interface for memory allocation +type Allocator interface { + Allocate(uint64) (MappedRegion, error) + Release(MappedRegion) error +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/oc/span.go b/vendor/github.com/Microsoft/hcsshim/internal/oc/span.go index fee4765cbc..0e2b7e9bf6 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/oc/span.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/oc/span.go @@ -1,9 +1,14 @@ package oc import ( + "context" + + "github.com/Microsoft/hcsshim/internal/log" "go.opencensus.io/trace" ) +var DefaultSampler = trace.AlwaysSample() + // SetSpanStatus sets `span.SetStatus` to the proper status depending on `err`. If // `err` is `nil` assumes `trace.StatusCodeOk`. func SetSpanStatus(span *trace.Span, err error) { @@ -15,3 +20,29 @@ func SetSpanStatus(span *trace.Span, err error) { } span.SetStatus(status) } + +// StartSpan wraps "go.opencensus.io/trace".StartSpan, but, if the span is sampling, +// adds a log entry to the context that points to the newly created span. +func StartSpan(ctx context.Context, name string, o ...trace.StartOption) (context.Context, *trace.Span) { + ctx, s := trace.StartSpan(ctx, name, o...) + return update(ctx, s) +} + +// StartSpanWithRemoteParent wraps "go.opencensus.io/trace".StartSpanWithRemoteParent. +// +// See StartSpan for more information. +func StartSpanWithRemoteParent(ctx context.Context, name string, parent trace.SpanContext, o ...trace.StartOption) (context.Context, *trace.Span) { + ctx, s := trace.StartSpanWithRemoteParent(ctx, name, parent, o...) + return update(ctx, s) +} + +func update(ctx context.Context, s *trace.Span) (context.Context, *trace.Span) { + if s.IsRecordingEvents() { + ctx = log.UpdateContext(ctx) + } + + return ctx, s +} + +var WithServerSpanKind = trace.WithSpanKind(trace.SpanKindServer) +var WithClientSpanKind = trace.WithSpanKind(trace.SpanKindClient) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/protocol/guestrequest/types.go b/vendor/github.com/Microsoft/hcsshim/internal/protocol/guestrequest/types.go new file mode 100644 index 0000000000..d8d0c20b10 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/protocol/guestrequest/types.go @@ -0,0 +1,56 @@ +package guestrequest + +// These are constants for v2 schema modify requests. + +type RequestType string +type ResourceType string + +// RequestType const +const ( + RequestTypeAdd RequestType = "Add" + RequestTypeRemove RequestType = "Remove" + RequestTypePreAdd RequestType = "PreAdd" // For networking + RequestTypeUpdate RequestType = "Update" +) + +type SignalValueWCOW string + +const ( + SignalValueWCOWCtrlC SignalValueWCOW = "CtrlC" + SignalValueWCOWCtrlBreak SignalValueWCOW = "CtrlBreak" + SignalValueWCOWCtrlClose SignalValueWCOW = "CtrlClose" + SignalValueWCOWCtrlLogOff SignalValueWCOW = "CtrlLogOff" + SignalValueWCOWCtrlShutdown SignalValueWCOW = "CtrlShutdown" +) + +// ModificationRequest is for modify commands passed to the guest. +type ModificationRequest struct { + RequestType RequestType `json:"RequestType,omitempty"` + ResourceType ResourceType `json:"ResourceType,omitempty"` + Settings interface{} `json:"Settings,omitempty"` +} + +type NetworkModifyRequest struct { + AdapterId string `json:"AdapterId,omitempty"` //nolint:stylecheck + RequestType RequestType `json:"RequestType,omitempty"` + Settings interface{} `json:"Settings,omitempty"` +} + +type RS4NetworkModifyRequest struct { + AdapterInstanceId string `json:"AdapterInstanceId,omitempty"` //nolint:stylecheck + RequestType RequestType `json:"RequestType,omitempty"` + Settings interface{} `json:"Settings,omitempty"` +} + +var ( + // V5 GUIDs for SCSI controllers + // These GUIDs are created with namespace GUID "d422512d-2bf2-4752-809d-7b82b5fcb1b4" + // and index as names. For example, first GUID is created like this: + // guid.NewV5("d422512d-2bf2-4752-809d-7b82b5fcb1b4", []byte("0")) + ScsiControllerGuids = []string{ + "df6d0690-79e5-55b6-a5ec-c1e2f77f580a", + "0110f83b-de10-5172-a266-78bca56bf50a", + "b5d2d8d4-3a75-51bf-945b-3444dc6b8579", + "305891a9-b251-5dfe-91a2-c25d9212275b", + } +) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/safefile/do.go b/vendor/github.com/Microsoft/hcsshim/internal/safefile/do.go new file mode 100644 index 0000000000..f211d25e72 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/safefile/do.go @@ -0,0 +1 @@ +package safefile diff --git a/vendor/github.com/Microsoft/hcsshim/internal/safefile/safeopen.go b/vendor/github.com/Microsoft/hcsshim/internal/safefile/safeopen.go index 66b8d7e035..74967f21af 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/safefile/safeopen.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/safefile/safeopen.go @@ -1,3 +1,5 @@ +//go:build windows + package safefile import ( @@ -156,7 +158,6 @@ func LinkRelative(oldname string, oldroot *os.File, newname string, newroot *os. if (fi.FileAttributes & syscall.FILE_ATTRIBUTE_REPARSE_POINT) != 0 { return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(newroot.Name(), newname), Err: winapi.RtlNtStatusToDosError(winapi.STATUS_REPARSE_POINT_ENCOUNTERED)} } - } else { parent = newroot } @@ -339,6 +340,33 @@ func MkdirRelative(path string, root *os.File) error { return err } +// MkdirAllRelative creates each directory in the path relative to a root, failing if +// any existing intermediate path components are reparse points. +func MkdirAllRelative(path string, root *os.File) error { + pathParts := strings.Split(filepath.Clean(path), (string)(filepath.Separator)) + for index := range pathParts { + partialPath := filepath.Join(pathParts[0 : index+1]...) + stat, err := LstatRelative(partialPath, root) + + if err != nil { + if os.IsNotExist(err) { + if err := MkdirRelative(partialPath, root); err != nil { + return err + } + continue + } + return err + } + + if !stat.IsDir() { + fullPath := filepath.Join(root.Name(), partialPath) + return &os.PathError{Op: "mkdir", Path: fullPath, Err: syscall.ENOTDIR} + } + } + + return nil +} + // LstatRelative performs a stat operation on a file relative to a root, failing // if any intermediate path components are reparse points. func LstatRelative(path string, root *os.File) (os.FileInfo, error) { diff --git a/vendor/github.com/Microsoft/go-winio/pkg/security/grantvmgroupaccess.go b/vendor/github.com/Microsoft/hcsshim/internal/security/grantvmgroupaccess.go similarity index 63% rename from vendor/github.com/Microsoft/go-winio/pkg/security/grantvmgroupaccess.go rename to vendor/github.com/Microsoft/hcsshim/internal/security/grantvmgroupaccess.go index 6df87b7499..bfcc157699 100644 --- a/vendor/github.com/Microsoft/go-winio/pkg/security/grantvmgroupaccess.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/security/grantvmgroupaccess.go @@ -20,34 +20,43 @@ type ( securityInformation uint32 trusteeForm uint32 trusteeType uint32 - - //nolint:structcheck // structcheck thinks fields are unused, but the are used to pass data to OS - explicitAccess struct { - accessPermissions accessMask - accessMode accessMode - inheritance inheritMode - trustee trustee - } - - //nolint:structcheck,unused // structcheck thinks fields are unused, but the are used to pass data to OS - trustee struct { - multipleTrustee *trustee - multipleTrusteeOperation int32 - trusteeForm trusteeForm - trusteeType trusteeType - name uintptr - } ) +type explicitAccess struct { + //nolint:structcheck + accessPermissions accessMask + //nolint:structcheck + accessMode accessMode + //nolint:structcheck + inheritance inheritMode + //nolint:structcheck + trustee trustee +} + +type trustee struct { + //nolint:unused,structcheck + multipleTrustee *trustee + //nolint:unused,structcheck + multipleTrusteeOperation int32 + trusteeForm trusteeForm + trusteeType trusteeType + name uintptr +} + const ( - accessMaskDesiredPermission accessMask = 1 << 31 // GENERIC_READ + AccessMaskNone accessMask = 0 + AccessMaskRead accessMask = 1 << 31 // GENERIC_READ + AccessMaskWrite accessMask = 1 << 30 // GENERIC_WRITE + AccessMaskExecute accessMask = 1 << 29 // GENERIC_EXECUTE + AccessMaskAll accessMask = 1 << 28 // GENERIC_ALL + + accessMaskDesiredPermission = AccessMaskRead accessModeGrant accessMode = 1 desiredAccessReadControl desiredAccess = 0x20000 desiredAccessWriteDac desiredAccess = 0x40000 - //cspell:disable-next-line gvmga = "GrantVmGroupAccess:" inheritModeNoInheritance inheritMode = 0x0 @@ -60,20 +69,28 @@ const ( shareModeRead shareMode = 0x1 shareModeWrite shareMode = 0x2 - sidVMGroup = "S-1-5-83-0" + //nolint:stylecheck // ST1003 + sidVmGroup = "S-1-5-83-0" - trusteeFormIsSID trusteeForm = 0 + trusteeFormIsSid trusteeForm = 0 trusteeTypeWellKnownGroup trusteeType = 5 ) -// GrantVMGroupAccess sets the DACL for a specified file or directory to +// GrantVmGroupAccess sets the DACL for a specified file or directory to // include Grant ACE entries for the VM Group SID. This is a golang re- // implementation of the same function in vmcompute, just not exported in // RS5. Which kind of sucks. Sucks a lot :/ -// -//revive:disable-next-line:var-naming VM, not Vm -func GrantVmGroupAccess(name string) error { +func GrantVmGroupAccess(name string) error { //nolint:stylecheck // ST1003 + return GrantVmGroupAccessWithMask(name, accessMaskDesiredPermission) +} + +// GrantVmGroupAccessWithMask sets the desired DACL for a specified file or +// directory. +func GrantVmGroupAccessWithMask(name string, access accessMask) error { //nolint:stylecheck // ST1003 + if access == 0 || access<<4 != 0 { + return fmt.Errorf("invalid access mask: 0x%08x", access) + } // Stat (to determine if `name` is a directory). s, err := os.Stat(name) if err != nil { @@ -85,7 +102,9 @@ func GrantVmGroupAccess(name string) error { if err != nil { return err // Already wrapped } - defer syscall.CloseHandle(fd) //nolint:errcheck + defer func() { + _ = syscall.CloseHandle(fd) + }() // Get the current DACL and Security Descriptor. Must defer LocalFree on success. ot := objectTypeFileObject @@ -95,15 +114,19 @@ func GrantVmGroupAccess(name string) error { if err := getSecurityInfo(fd, uint32(ot), uint32(si), nil, nil, &origDACL, nil, &sd); err != nil { return fmt.Errorf("%s GetSecurityInfo %s: %w", gvmga, name, err) } - defer syscall.LocalFree((syscall.Handle)(unsafe.Pointer(sd))) //nolint:errcheck + defer func() { + _, _ = syscall.LocalFree((syscall.Handle)(unsafe.Pointer(sd))) + }() // Generate a new DACL which is the current DACL with the required ACEs added. // Must defer LocalFree on success. - newDACL, err := generateDACLWithAcesAdded(name, s.IsDir(), origDACL) + newDACL, err := generateDACLWithAcesAdded(name, s.IsDir(), access, origDACL) if err != nil { return err // Already wrapped } - defer syscall.LocalFree((syscall.Handle)(unsafe.Pointer(newDACL))) //nolint:errcheck + defer func() { + _, _ = syscall.LocalFree((syscall.Handle)(unsafe.Pointer(newDACL))) + }() // And finally use SetSecurityInfo to apply the updated DACL. if err := setSecurityInfo(fd, uint32(ot), uint32(si), uintptr(0), uintptr(0), newDACL, uintptr(0)); err != nil { @@ -118,28 +141,28 @@ func GrantVmGroupAccess(name string) error { func createFile(name string, isDir bool) (syscall.Handle, error) { namep, err := syscall.UTF16FromString(name) if err != nil { - return syscall.InvalidHandle, fmt.Errorf("could not convernt name to UTF-16: %w", err) + return 0, fmt.Errorf("syscall.UTF16FromString %s: %w", name, err) } da := uint32(desiredAccessReadControl | desiredAccessWriteDac) sm := uint32(shareModeRead | shareModeWrite) fa := uint32(syscall.FILE_ATTRIBUTE_NORMAL) if isDir { - fa |= syscall.FILE_FLAG_BACKUP_SEMANTICS + fa = uint32(fa | syscall.FILE_FLAG_BACKUP_SEMANTICS) } fd, err := syscall.CreateFile(&namep[0], da, sm, nil, syscall.OPEN_EXISTING, fa, 0) if err != nil { - return syscall.InvalidHandle, fmt.Errorf("%s syscall.CreateFile %s: %w", gvmga, name, err) + return 0, fmt.Errorf("%s syscall.CreateFile %s: %w", gvmga, name, err) } return fd, nil } // generateDACLWithAcesAdded generates a new DACL with the two needed ACEs added. // The caller is responsible for LocalFree of the returned DACL on success. -func generateDACLWithAcesAdded(name string, isDir bool, origDACL uintptr) (uintptr, error) { +func generateDACLWithAcesAdded(name string, isDir bool, desiredAccess accessMask, origDACL uintptr) (uintptr, error) { // Generate pointers to the SIDs based on the string SIDs - sid, err := syscall.StringToSid(sidVMGroup) + sid, err := syscall.StringToSid(sidVmGroup) if err != nil { - return 0, fmt.Errorf("%s syscall.StringToSid %s %s: %w", gvmga, name, sidVMGroup, err) + return 0, fmt.Errorf("%s syscall.StringToSid %s %s: %w", gvmga, name, sidVmGroup, err) } inheritance := inheritModeNoInheritance @@ -149,11 +172,11 @@ func generateDACLWithAcesAdded(name string, isDir bool, origDACL uintptr) (uintp eaArray := []explicitAccess{ { - accessPermissions: accessMaskDesiredPermission, + accessPermissions: desiredAccess, accessMode: accessModeGrant, inheritance: inheritance, trustee: trustee{ - trusteeForm: trusteeFormIsSID, + trusteeForm: trusteeFormIsSid, trusteeType: trusteeTypeWellKnownGroup, name: uintptr(unsafe.Pointer(sid)), }, diff --git a/vendor/github.com/Microsoft/go-winio/pkg/security/syscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/security/syscall_windows.go similarity index 100% rename from vendor/github.com/Microsoft/go-winio/pkg/security/syscall_windows.go rename to vendor/github.com/Microsoft/hcsshim/internal/security/syscall_windows.go diff --git a/vendor/github.com/Microsoft/go-winio/pkg/security/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/security/zsyscall_windows.go similarity index 100% rename from vendor/github.com/Microsoft/go-winio/pkg/security/zsyscall_windows.go rename to vendor/github.com/Microsoft/hcsshim/internal/security/zsyscall_windows.go diff --git a/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/doc.go b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/doc.go new file mode 100644 index 0000000000..9dd00c8128 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/doc.go @@ -0,0 +1 @@ +package vmcompute diff --git a/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go index e7f114b67a..79b14ef972 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go @@ -1,3 +1,5 @@ +//go:build windows + package vmcompute import ( @@ -5,15 +7,17 @@ import ( "syscall" "time" + "github.com/sirupsen/logrus" + "go.opencensus.io/trace" + "github.com/Microsoft/hcsshim/internal/interop" "github.com/Microsoft/hcsshim/internal/log" "github.com/Microsoft/hcsshim/internal/logfields" "github.com/Microsoft/hcsshim/internal/oc" "github.com/Microsoft/hcsshim/internal/timeout" - "go.opencensus.io/trace" ) -//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go vmcompute.go +//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -output zsyscall_windows.go vmcompute.go //sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems? //sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem? @@ -62,7 +66,7 @@ type HcsCallback syscall.Handle type HcsProcessInformation struct { // ProcessId is the pid of the created process. ProcessId uint32 - reserved uint32 //nolint:structcheck + _ uint32 // reserved padding // StdInput is the handle associated with the stdin of the process. StdInput syscall.Handle // StdOutput is the handle associated with the stdout of the process. @@ -72,12 +76,28 @@ type HcsProcessInformation struct { } func execute(ctx gcontext.Context, timeout time.Duration, f func() error) error { + now := time.Now() if timeout > 0 { var cancel gcontext.CancelFunc ctx, cancel = gcontext.WithTimeout(ctx, timeout) defer cancel() } + // if ctx already has prior deadlines, the shortest timeout takes precedence and is used. + // find the true timeout for reporting + // + // this is mostly an issue with (*UtilityVM).Start(context.Context), which sets its + // own (2 minute) timeout. + deadline, ok := ctx.Deadline() + trueTimeout := timeout + if ok { + trueTimeout = deadline.Sub(now) + log.G(ctx).WithFields(logrus.Fields{ + logfields.Timeout: trueTimeout, + "desiredTimeout": timeout, + }).Trace("Executing syscall with deadline") + } + done := make(chan error, 1) go func() { done <- f() @@ -85,8 +105,10 @@ func execute(ctx gcontext.Context, timeout time.Duration, f func() error) error select { case <-ctx.Done(): if ctx.Err() == gcontext.DeadlineExceeded { - log.G(ctx).WithField(logfields.Timeout, timeout). - Warning("Syscall did not complete within operation timeout. This may indicate a platform issue. If it appears to be making no forward progress, obtain the stacks and see if there is a syscall stuck in the platform API for a significant length of time.") + log.G(ctx).WithField(logfields.Timeout, trueTimeout). + Warning("Syscall did not complete within operation timeout. This may indicate a platform issue. " + + "If it appears to be making no forward progress, obtain the stacks and see if there is a syscall " + + "stuck in the platform API for a significant length of time.") } return ctx.Err() case err := <-done: @@ -95,7 +117,7 @@ func execute(ctx gcontext.Context, timeout time.Duration, f func() error) error } func HcsEnumerateComputeSystems(ctx gcontext.Context, query string) (computeSystems, result string, hr error) { - ctx, span := trace.StartSpan(ctx, "HcsEnumerateComputeSystems") + ctx, span := oc.StartSpan(ctx, "HcsEnumerateComputeSystems") defer span.End() defer func() { if result != "" { @@ -122,7 +144,7 @@ func HcsEnumerateComputeSystems(ctx gcontext.Context, query string) (computeSyst } func HcsCreateComputeSystem(ctx gcontext.Context, id string, configuration string, identity syscall.Handle) (computeSystem HcsSystem, result string, hr error) { - ctx, span := trace.StartSpan(ctx, "HcsCreateComputeSystem") + ctx, span := oc.StartSpan(ctx, "HcsCreateComputeSystem") defer span.End() defer func() { if result != "" { @@ -147,7 +169,7 @@ func HcsCreateComputeSystem(ctx gcontext.Context, id string, configuration strin } func HcsOpenComputeSystem(ctx gcontext.Context, id string) (computeSystem HcsSystem, result string, hr error) { - ctx, span := trace.StartSpan(ctx, "HcsOpenComputeSystem") + ctx, span := oc.StartSpan(ctx, "HcsOpenComputeSystem") defer span.End() defer func() { if result != "" { @@ -167,7 +189,7 @@ func HcsOpenComputeSystem(ctx gcontext.Context, id string) (computeSystem HcsSys } func HcsCloseComputeSystem(ctx gcontext.Context, computeSystem HcsSystem) (hr error) { - ctx, span := trace.StartSpan(ctx, "HcsCloseComputeSystem") + ctx, span := oc.StartSpan(ctx, "HcsCloseComputeSystem") defer span.End() defer func() { oc.SetSpanStatus(span, hr) }() @@ -177,7 +199,7 @@ func HcsCloseComputeSystem(ctx gcontext.Context, computeSystem HcsSystem) (hr er } func HcsStartComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { - ctx, span := trace.StartSpan(ctx, "HcsStartComputeSystem") + ctx, span := oc.StartSpan(ctx, "HcsStartComputeSystem") defer span.End() defer func() { if result != "" { @@ -200,7 +222,7 @@ func HcsStartComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, option } func HcsShutdownComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { - ctx, span := trace.StartSpan(ctx, "HcsShutdownComputeSystem") + ctx, span := oc.StartSpan(ctx, "HcsShutdownComputeSystem") defer span.End() defer func() { if result != "" { @@ -223,7 +245,7 @@ func HcsShutdownComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, opt } func HcsTerminateComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { - ctx, span := trace.StartSpan(ctx, "HcsTerminateComputeSystem") + ctx, span := oc.StartSpan(ctx, "HcsTerminateComputeSystem") defer span.End() defer func() { if result != "" { @@ -246,7 +268,7 @@ func HcsTerminateComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, op } func HcsPauseComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { - ctx, span := trace.StartSpan(ctx, "HcsPauseComputeSystem") + ctx, span := oc.StartSpan(ctx, "HcsPauseComputeSystem") defer span.End() defer func() { if result != "" { @@ -269,7 +291,7 @@ func HcsPauseComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, option } func HcsResumeComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { - ctx, span := trace.StartSpan(ctx, "HcsResumeComputeSystem") + ctx, span := oc.StartSpan(ctx, "HcsResumeComputeSystem") defer span.End() defer func() { if result != "" { @@ -292,7 +314,7 @@ func HcsResumeComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, optio } func HcsGetComputeSystemProperties(ctx gcontext.Context, computeSystem HcsSystem, propertyQuery string) (properties, result string, hr error) { - ctx, span := trace.StartSpan(ctx, "HcsGetComputeSystemProperties") + ctx, span := oc.StartSpan(ctx, "HcsGetComputeSystemProperties") defer span.End() defer func() { if result != "" { @@ -319,7 +341,7 @@ func HcsGetComputeSystemProperties(ctx gcontext.Context, computeSystem HcsSystem } func HcsModifyComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, configuration string) (result string, hr error) { - ctx, span := trace.StartSpan(ctx, "HcsModifyComputeSystem") + ctx, span := oc.StartSpan(ctx, "HcsModifyComputeSystem") defer span.End() defer func() { if result != "" { @@ -340,7 +362,7 @@ func HcsModifyComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, confi } func HcsModifyServiceSettings(ctx gcontext.Context, settings string) (result string, hr error) { - ctx, span := trace.StartSpan(ctx, "HcsModifyServiceSettings") + ctx, span := oc.StartSpan(ctx, "HcsModifyServiceSettings") defer span.End() defer func() { if result != "" { @@ -361,7 +383,7 @@ func HcsModifyServiceSettings(ctx gcontext.Context, settings string) (result str } func HcsRegisterComputeSystemCallback(ctx gcontext.Context, computeSystem HcsSystem, callback uintptr, context uintptr) (callbackHandle HcsCallback, hr error) { - ctx, span := trace.StartSpan(ctx, "HcsRegisterComputeSystemCallback") + ctx, span := oc.StartSpan(ctx, "HcsRegisterComputeSystemCallback") defer span.End() defer func() { oc.SetSpanStatus(span, hr) }() @@ -371,7 +393,7 @@ func HcsRegisterComputeSystemCallback(ctx gcontext.Context, computeSystem HcsSys } func HcsUnregisterComputeSystemCallback(ctx gcontext.Context, callbackHandle HcsCallback) (hr error) { - ctx, span := trace.StartSpan(ctx, "HcsUnregisterComputeSystemCallback") + ctx, span := oc.StartSpan(ctx, "HcsUnregisterComputeSystemCallback") defer span.End() defer func() { oc.SetSpanStatus(span, hr) }() @@ -381,7 +403,7 @@ func HcsUnregisterComputeSystemCallback(ctx gcontext.Context, callbackHandle Hcs } func HcsCreateProcess(ctx gcontext.Context, computeSystem HcsSystem, processParameters string) (processInformation HcsProcessInformation, process HcsProcess, result string, hr error) { - ctx, span := trace.StartSpan(ctx, "HcsCreateProcess") + ctx, span := oc.StartSpan(ctx, "HcsCreateProcess") defer span.End() defer func() { if result != "" { @@ -389,7 +411,12 @@ func HcsCreateProcess(ctx gcontext.Context, computeSystem HcsSystem, processPara } oc.SetSpanStatus(span, hr) }() - span.AddAttributes(trace.StringAttribute("processParameters", processParameters)) + if span.IsRecordingEvents() { + // wont handle v1 process parameters + if s, err := log.ScrubProcessParameters(processParameters); err == nil { + span.AddAttributes(trace.StringAttribute("processParameters", s)) + } + } return processInformation, process, result, execute(ctx, timeout.SyscallWatcher, func() error { var resultp *uint16 @@ -402,7 +429,7 @@ func HcsCreateProcess(ctx gcontext.Context, computeSystem HcsSystem, processPara } func HcsOpenProcess(ctx gcontext.Context, computeSystem HcsSystem, pid uint32) (process HcsProcess, result string, hr error) { - ctx, span := trace.StartSpan(ctx, "HcsOpenProcess") + ctx, span := oc.StartSpan(ctx, "HcsOpenProcess") defer span.End() defer func() { if result != "" { @@ -423,7 +450,7 @@ func HcsOpenProcess(ctx gcontext.Context, computeSystem HcsSystem, pid uint32) ( } func HcsCloseProcess(ctx gcontext.Context, process HcsProcess) (hr error) { - ctx, span := trace.StartSpan(ctx, "HcsCloseProcess") + ctx, span := oc.StartSpan(ctx, "HcsCloseProcess") defer span.End() defer func() { oc.SetSpanStatus(span, hr) }() @@ -433,7 +460,7 @@ func HcsCloseProcess(ctx gcontext.Context, process HcsProcess) (hr error) { } func HcsTerminateProcess(ctx gcontext.Context, process HcsProcess) (result string, hr error) { - ctx, span := trace.StartSpan(ctx, "HcsTerminateProcess") + ctx, span := oc.StartSpan(ctx, "HcsTerminateProcess") defer span.End() defer func() { if result != "" { @@ -453,7 +480,7 @@ func HcsTerminateProcess(ctx gcontext.Context, process HcsProcess) (result strin } func HcsSignalProcess(ctx gcontext.Context, process HcsProcess, options string) (result string, hr error) { - ctx, span := trace.StartSpan(ctx, "HcsSignalProcess") + ctx, span := oc.StartSpan(ctx, "HcsSignalProcess") defer span.End() defer func() { if result != "" { @@ -474,7 +501,7 @@ func HcsSignalProcess(ctx gcontext.Context, process HcsProcess, options string) } func HcsGetProcessInfo(ctx gcontext.Context, process HcsProcess) (processInformation HcsProcessInformation, result string, hr error) { - ctx, span := trace.StartSpan(ctx, "HcsGetProcessInfo") + ctx, span := oc.StartSpan(ctx, "HcsGetProcessInfo") defer span.End() defer func() { if result != "" { @@ -494,7 +521,7 @@ func HcsGetProcessInfo(ctx gcontext.Context, process HcsProcess) (processInforma } func HcsGetProcessProperties(ctx gcontext.Context, process HcsProcess) (processProperties, result string, hr error) { - ctx, span := trace.StartSpan(ctx, "HcsGetProcessProperties") + ctx, span := oc.StartSpan(ctx, "HcsGetProcessProperties") defer span.End() defer func() { if result != "" { @@ -520,7 +547,7 @@ func HcsGetProcessProperties(ctx gcontext.Context, process HcsProcess) (processP } func HcsModifyProcess(ctx gcontext.Context, process HcsProcess, settings string) (result string, hr error) { - ctx, span := trace.StartSpan(ctx, "HcsModifyProcess") + ctx, span := oc.StartSpan(ctx, "HcsModifyProcess") defer span.End() defer func() { if result != "" { @@ -541,7 +568,7 @@ func HcsModifyProcess(ctx gcontext.Context, process HcsProcess, settings string) } func HcsGetServiceProperties(ctx gcontext.Context, propertyQuery string) (properties, result string, hr error) { - ctx, span := trace.StartSpan(ctx, "HcsGetServiceProperties") + ctx, span := oc.StartSpan(ctx, "HcsGetServiceProperties") defer span.End() defer func() { if result != "" { @@ -568,7 +595,7 @@ func HcsGetServiceProperties(ctx gcontext.Context, propertyQuery string) (proper } func HcsRegisterProcessCallback(ctx gcontext.Context, process HcsProcess, callback uintptr, context uintptr) (callbackHandle HcsCallback, hr error) { - ctx, span := trace.StartSpan(ctx, "HcsRegisterProcessCallback") + ctx, span := oc.StartSpan(ctx, "HcsRegisterProcessCallback") defer span.End() defer func() { oc.SetSpanStatus(span, hr) }() @@ -578,7 +605,7 @@ func HcsRegisterProcessCallback(ctx gcontext.Context, process HcsProcess, callba } func HcsUnregisterProcessCallback(ctx gcontext.Context, callbackHandle HcsCallback) (hr error) { - ctx, span := trace.StartSpan(ctx, "HcsUnregisterProcessCallback") + ctx, span := oc.StartSpan(ctx, "HcsUnregisterProcessCallback") defer span.End() defer func() { oc.SetSpanStatus(span, hr) }() @@ -588,7 +615,7 @@ func HcsUnregisterProcessCallback(ctx gcontext.Context, callbackHandle HcsCallba } func HcsSaveComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { - ctx, span := trace.StartSpan(ctx, "HcsSaveComputeSystem") + ctx, span := oc.StartSpan(ctx, "HcsSaveComputeSystem") defer span.End() defer func() { if result != "" { diff --git a/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/zsyscall_windows.go index cae55058de..42368872b7 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/zsyscall_windows.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/zsyscall_windows.go @@ -1,4 +1,6 @@ -// Code generated mksyscall_windows.exe DO NOT EDIT +//go:build windows + +// Code generated by 'go generate' using "github.com/Microsoft/go-winio/tools/mkwinsyscall"; DO NOT EDIT. package vmcompute @@ -19,6 +21,7 @@ const ( var ( errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) + errERROR_EINVAL error = syscall.EINVAL ) // errnoErr returns common boxed Errno values, to prevent @@ -26,7 +29,7 @@ var ( func errnoErr(e syscall.Errno) error { switch e { case 0: - return nil + return errERROR_EINVAL case errnoERROR_IO_PENDING: return errERROR_IO_PENDING } @@ -39,48 +42,55 @@ func errnoErr(e syscall.Errno) error { var ( modvmcompute = windows.NewLazySystemDLL("vmcompute.dll") - procHcsEnumerateComputeSystems = modvmcompute.NewProc("HcsEnumerateComputeSystems") - procHcsCreateComputeSystem = modvmcompute.NewProc("HcsCreateComputeSystem") - procHcsOpenComputeSystem = modvmcompute.NewProc("HcsOpenComputeSystem") procHcsCloseComputeSystem = modvmcompute.NewProc("HcsCloseComputeSystem") - procHcsStartComputeSystem = modvmcompute.NewProc("HcsStartComputeSystem") - procHcsShutdownComputeSystem = modvmcompute.NewProc("HcsShutdownComputeSystem") - procHcsTerminateComputeSystem = modvmcompute.NewProc("HcsTerminateComputeSystem") - procHcsPauseComputeSystem = modvmcompute.NewProc("HcsPauseComputeSystem") - procHcsResumeComputeSystem = modvmcompute.NewProc("HcsResumeComputeSystem") - procHcsGetComputeSystemProperties = modvmcompute.NewProc("HcsGetComputeSystemProperties") - procHcsModifyComputeSystem = modvmcompute.NewProc("HcsModifyComputeSystem") - procHcsModifyServiceSettings = modvmcompute.NewProc("HcsModifyServiceSettings") - procHcsRegisterComputeSystemCallback = modvmcompute.NewProc("HcsRegisterComputeSystemCallback") - procHcsUnregisterComputeSystemCallback = modvmcompute.NewProc("HcsUnregisterComputeSystemCallback") - procHcsSaveComputeSystem = modvmcompute.NewProc("HcsSaveComputeSystem") - procHcsCreateProcess = modvmcompute.NewProc("HcsCreateProcess") - procHcsOpenProcess = modvmcompute.NewProc("HcsOpenProcess") procHcsCloseProcess = modvmcompute.NewProc("HcsCloseProcess") - procHcsTerminateProcess = modvmcompute.NewProc("HcsTerminateProcess") - procHcsSignalProcess = modvmcompute.NewProc("HcsSignalProcess") + procHcsCreateComputeSystem = modvmcompute.NewProc("HcsCreateComputeSystem") + procHcsCreateProcess = modvmcompute.NewProc("HcsCreateProcess") + procHcsEnumerateComputeSystems = modvmcompute.NewProc("HcsEnumerateComputeSystems") + procHcsGetComputeSystemProperties = modvmcompute.NewProc("HcsGetComputeSystemProperties") procHcsGetProcessInfo = modvmcompute.NewProc("HcsGetProcessInfo") procHcsGetProcessProperties = modvmcompute.NewProc("HcsGetProcessProperties") - procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess") procHcsGetServiceProperties = modvmcompute.NewProc("HcsGetServiceProperties") + procHcsModifyComputeSystem = modvmcompute.NewProc("HcsModifyComputeSystem") + procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess") + procHcsModifyServiceSettings = modvmcompute.NewProc("HcsModifyServiceSettings") + procHcsOpenComputeSystem = modvmcompute.NewProc("HcsOpenComputeSystem") + procHcsOpenProcess = modvmcompute.NewProc("HcsOpenProcess") + procHcsPauseComputeSystem = modvmcompute.NewProc("HcsPauseComputeSystem") + procHcsRegisterComputeSystemCallback = modvmcompute.NewProc("HcsRegisterComputeSystemCallback") procHcsRegisterProcessCallback = modvmcompute.NewProc("HcsRegisterProcessCallback") + procHcsResumeComputeSystem = modvmcompute.NewProc("HcsResumeComputeSystem") + procHcsSaveComputeSystem = modvmcompute.NewProc("HcsSaveComputeSystem") + procHcsShutdownComputeSystem = modvmcompute.NewProc("HcsShutdownComputeSystem") + procHcsSignalProcess = modvmcompute.NewProc("HcsSignalProcess") + procHcsStartComputeSystem = modvmcompute.NewProc("HcsStartComputeSystem") + procHcsTerminateComputeSystem = modvmcompute.NewProc("HcsTerminateComputeSystem") + procHcsTerminateProcess = modvmcompute.NewProc("HcsTerminateProcess") + procHcsUnregisterComputeSystemCallback = modvmcompute.NewProc("HcsUnregisterComputeSystemCallback") procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback") ) -func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(query) +func hcsCloseComputeSystem(computeSystem HcsSystem) (hr error) { + hr = procHcsCloseComputeSystem.Find() if hr != nil { return } - return _hcsEnumerateComputeSystems(_p0, computeSystems, result) + r0, _, _ := syscall.Syscall(procHcsCloseComputeSystem.Addr(), 1, uintptr(computeSystem), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return } -func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result **uint16) (hr error) { - if hr = procHcsEnumerateComputeSystems.Find(); hr != nil { +func hcsCloseProcess(process HcsProcess) (hr error) { + hr = procHcsCloseProcess.Find() + if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsEnumerateComputeSystems.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(computeSystems)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall(procHcsCloseProcess.Addr(), 1, uintptr(process), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -105,7 +115,8 @@ func hcsCreateComputeSystem(id string, configuration string, identity syscall.Ha } func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) { - if hr = procHcsCreateComputeSystem.Find(); hr != nil { + hr = procHcsCreateComputeSystem.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall6(procHcsCreateComputeSystem.Addr(), 5, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(configuration)), uintptr(identity), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)), 0) @@ -118,278 +129,6 @@ func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall return } -func hcsOpenComputeSystem(id string, computeSystem *HcsSystem, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(id) - if hr != nil { - return - } - return _hcsOpenComputeSystem(_p0, computeSystem, result) -} - -func _hcsOpenComputeSystem(id *uint16, computeSystem *HcsSystem, result **uint16) (hr error) { - if hr = procHcsOpenComputeSystem.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsOpenComputeSystem.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result))) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return -} - -func hcsCloseComputeSystem(computeSystem HcsSystem) (hr error) { - if hr = procHcsCloseComputeSystem.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsCloseComputeSystem.Addr(), 1, uintptr(computeSystem), 0, 0) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return -} - -func hcsStartComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(options) - if hr != nil { - return - } - return _hcsStartComputeSystem(computeSystem, _p0, result) -} - -func _hcsStartComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { - if hr = procHcsStartComputeSystem.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsStartComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return -} - -func hcsShutdownComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(options) - if hr != nil { - return - } - return _hcsShutdownComputeSystem(computeSystem, _p0, result) -} - -func _hcsShutdownComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { - if hr = procHcsShutdownComputeSystem.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsShutdownComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return -} - -func hcsTerminateComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(options) - if hr != nil { - return - } - return _hcsTerminateComputeSystem(computeSystem, _p0, result) -} - -func _hcsTerminateComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { - if hr = procHcsTerminateComputeSystem.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsTerminateComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return -} - -func hcsPauseComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(options) - if hr != nil { - return - } - return _hcsPauseComputeSystem(computeSystem, _p0, result) -} - -func _hcsPauseComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { - if hr = procHcsPauseComputeSystem.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsPauseComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return -} - -func hcsResumeComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(options) - if hr != nil { - return - } - return _hcsResumeComputeSystem(computeSystem, _p0, result) -} - -func _hcsResumeComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { - if hr = procHcsResumeComputeSystem.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsResumeComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return -} - -func hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(propertyQuery) - if hr != nil { - return - } - return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result) -} - -func _hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { - if hr = procHcsGetComputeSystemProperties.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall6(procHcsGetComputeSystemProperties.Addr(), 4, uintptr(computeSystem), uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return -} - -func hcsModifyComputeSystem(computeSystem HcsSystem, configuration string, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(configuration) - if hr != nil { - return - } - return _hcsModifyComputeSystem(computeSystem, _p0, result) -} - -func _hcsModifyComputeSystem(computeSystem HcsSystem, configuration *uint16, result **uint16) (hr error) { - if hr = procHcsModifyComputeSystem.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsModifyComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(configuration)), uintptr(unsafe.Pointer(result))) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return -} - -func hcsModifyServiceSettings(settings string, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(settings) - if hr != nil { - return - } - return _hcsModifyServiceSettings(_p0, result) -} - -func _hcsModifyServiceSettings(settings *uint16, result **uint16) (hr error) { - if hr = procHcsModifyServiceSettings.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsModifyServiceSettings.Addr(), 2, uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result)), 0) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return -} - -func hcsRegisterComputeSystemCallback(computeSystem HcsSystem, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) { - if hr = procHcsRegisterComputeSystemCallback.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall6(procHcsRegisterComputeSystemCallback.Addr(), 4, uintptr(computeSystem), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return -} - -func hcsUnregisterComputeSystemCallback(callbackHandle HcsCallback) (hr error) { - if hr = procHcsUnregisterComputeSystemCallback.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsUnregisterComputeSystemCallback.Addr(), 1, uintptr(callbackHandle), 0, 0) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return -} - -func hcsSaveComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(options) - if hr != nil { - return - } - return _hcsSaveComputeSystem(computeSystem, _p0, result) -} - -func _hcsSaveComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { - if hr = procHcsSaveComputeSystem.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsSaveComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return -} - func hcsCreateProcess(computeSystem HcsSystem, processParameters string, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(processParameters) @@ -400,7 +139,8 @@ func hcsCreateProcess(computeSystem HcsSystem, processParameters string, process } func _hcsCreateProcess(computeSystem HcsSystem, processParameters *uint16, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) { - if hr = procHcsCreateProcess.Find(); hr != nil { + hr = procHcsCreateProcess.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall6(procHcsCreateProcess.Addr(), 5, uintptr(computeSystem), uintptr(unsafe.Pointer(processParameters)), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0) @@ -413,62 +153,45 @@ func _hcsCreateProcess(computeSystem HcsSystem, processParameters *uint16, proce return } -func hcsOpenProcess(computeSystem HcsSystem, pid uint32, process *HcsProcess, result **uint16) (hr error) { - if hr = procHcsOpenProcess.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall6(procHcsOpenProcess.Addr(), 4, uintptr(computeSystem), uintptr(pid), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0, 0) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return -} - -func hcsCloseProcess(process HcsProcess) (hr error) { - if hr = procHcsCloseProcess.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsCloseProcess.Addr(), 1, uintptr(process), 0, 0) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return -} - -func hcsTerminateProcess(process HcsProcess, result **uint16) (hr error) { - if hr = procHcsTerminateProcess.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 2, uintptr(process), uintptr(unsafe.Pointer(result)), 0) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return -} - -func hcsSignalProcess(process HcsProcess, options string, result **uint16) (hr error) { +func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) { var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(options) + _p0, hr = syscall.UTF16PtrFromString(query) if hr != nil { return } - return _hcsSignalProcess(process, _p0, result) + return _hcsEnumerateComputeSystems(_p0, computeSystems, result) } -func _hcsSignalProcess(process HcsProcess, options *uint16, result **uint16) (hr error) { - if hr = procHcsSignalProcess.Find(); hr != nil { +func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result **uint16) (hr error) { + hr = procHcsEnumerateComputeSystems.Find() + if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsSignalProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall(procHcsEnumerateComputeSystems.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(computeSystems)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(propertyQuery) + if hr != nil { + return + } + return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result) +} + +func _hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { + hr = procHcsGetComputeSystemProperties.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsGetComputeSystemProperties.Addr(), 4, uintptr(computeSystem), uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -479,7 +202,8 @@ func _hcsSignalProcess(process HcsProcess, options *uint16, result **uint16) (hr } func hcsGetProcessInfo(process HcsProcess, processInformation *HcsProcessInformation, result **uint16) (hr error) { - if hr = procHcsGetProcessInfo.Find(); hr != nil { + hr = procHcsGetProcessInfo.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcsGetProcessInfo.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(result))) @@ -493,33 +217,11 @@ func hcsGetProcessInfo(process HcsProcess, processInformation *HcsProcessInforma } func hcsGetProcessProperties(process HcsProcess, processProperties **uint16, result **uint16) (hr error) { - if hr = procHcsGetProcessProperties.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsGetProcessProperties.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processProperties)), uintptr(unsafe.Pointer(result))) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return -} - -func hcsModifyProcess(process HcsProcess, settings string, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(settings) + hr = procHcsGetProcessProperties.Find() if hr != nil { return } - return _hcsModifyProcess(process, _p0, result) -} - -func _hcsModifyProcess(process HcsProcess, settings *uint16, result **uint16) (hr error) { - if hr = procHcsModifyProcess.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsModifyProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall(procHcsGetProcessProperties.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processProperties)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -539,7 +241,8 @@ func hcsGetServiceProperties(propertyQuery string, properties **uint16, result * } func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { - if hr = procHcsGetServiceProperties.Find(); hr != nil { + hr = procHcsGetServiceProperties.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcsGetServiceProperties.Addr(), 3, uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result))) @@ -552,8 +255,159 @@ func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result return } +func hcsModifyComputeSystem(computeSystem HcsSystem, configuration string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(configuration) + if hr != nil { + return + } + return _hcsModifyComputeSystem(computeSystem, _p0, result) +} + +func _hcsModifyComputeSystem(computeSystem HcsSystem, configuration *uint16, result **uint16) (hr error) { + hr = procHcsModifyComputeSystem.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsModifyComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(configuration)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsModifyProcess(process HcsProcess, settings string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(settings) + if hr != nil { + return + } + return _hcsModifyProcess(process, _p0, result) +} + +func _hcsModifyProcess(process HcsProcess, settings *uint16, result **uint16) (hr error) { + hr = procHcsModifyProcess.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsModifyProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsModifyServiceSettings(settings string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(settings) + if hr != nil { + return + } + return _hcsModifyServiceSettings(_p0, result) +} + +func _hcsModifyServiceSettings(settings *uint16, result **uint16) (hr error) { + hr = procHcsModifyServiceSettings.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsModifyServiceSettings.Addr(), 2, uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result)), 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsOpenComputeSystem(id string, computeSystem *HcsSystem, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _hcsOpenComputeSystem(_p0, computeSystem, result) +} + +func _hcsOpenComputeSystem(id *uint16, computeSystem *HcsSystem, result **uint16) (hr error) { + hr = procHcsOpenComputeSystem.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsOpenComputeSystem.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsOpenProcess(computeSystem HcsSystem, pid uint32, process *HcsProcess, result **uint16) (hr error) { + hr = procHcsOpenProcess.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsOpenProcess.Addr(), 4, uintptr(computeSystem), uintptr(pid), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsPauseComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsPauseComputeSystem(computeSystem, _p0, result) +} + +func _hcsPauseComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { + hr = procHcsPauseComputeSystem.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsPauseComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsRegisterComputeSystemCallback(computeSystem HcsSystem, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) { + hr = procHcsRegisterComputeSystemCallback.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsRegisterComputeSystemCallback.Addr(), 4, uintptr(computeSystem), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + func hcsRegisterProcessCallback(process HcsProcess, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) { - if hr = procHcsRegisterProcessCallback.Find(); hr != nil { + hr = procHcsRegisterProcessCallback.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall6(procHcsRegisterProcessCallback.Addr(), 4, uintptr(process), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0) @@ -566,8 +420,183 @@ func hcsRegisterProcessCallback(process HcsProcess, callback uintptr, context ui return } +func hcsResumeComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsResumeComputeSystem(computeSystem, _p0, result) +} + +func _hcsResumeComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { + hr = procHcsResumeComputeSystem.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsResumeComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsSaveComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsSaveComputeSystem(computeSystem, _p0, result) +} + +func _hcsSaveComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { + hr = procHcsSaveComputeSystem.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsSaveComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsShutdownComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsShutdownComputeSystem(computeSystem, _p0, result) +} + +func _hcsShutdownComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { + hr = procHcsShutdownComputeSystem.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsShutdownComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsSignalProcess(process HcsProcess, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsSignalProcess(process, _p0, result) +} + +func _hcsSignalProcess(process HcsProcess, options *uint16, result **uint16) (hr error) { + hr = procHcsSignalProcess.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsSignalProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsStartComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsStartComputeSystem(computeSystem, _p0, result) +} + +func _hcsStartComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { + hr = procHcsStartComputeSystem.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsStartComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsTerminateComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsTerminateComputeSystem(computeSystem, _p0, result) +} + +func _hcsTerminateComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { + hr = procHcsTerminateComputeSystem.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsTerminateComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsTerminateProcess(process HcsProcess, result **uint16) (hr error) { + hr = procHcsTerminateProcess.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 2, uintptr(process), uintptr(unsafe.Pointer(result)), 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsUnregisterComputeSystemCallback(callbackHandle HcsCallback) (hr error) { + hr = procHcsUnregisterComputeSystemCallback.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsUnregisterComputeSystemCallback.Addr(), 1, uintptr(callbackHandle), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + func hcsUnregisterProcessCallback(callbackHandle HcsCallback) (hr error) { - if hr = procHcsUnregisterProcessCallback.Find(); hr != nil { + hr = procHcsUnregisterProcessCallback.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcsUnregisterProcessCallback.Addr(), 1, uintptr(callbackHandle), 0, 0) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/activatelayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/activatelayer.go index 5debe974d4..e12253c947 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/activatelayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/activatelayer.go @@ -1,3 +1,5 @@ +//go:build windows + package wclayer import ( @@ -14,7 +16,7 @@ import ( // An activated layer must later be deactivated via DeactivateLayer. func ActivateLayer(ctx context.Context, path string) (err error) { title := "hcsshim::ActivateLayer" - ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + ctx, span := oc.StartSpan(ctx, title) //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes(trace.StringAttribute("path", path)) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/baselayerreader.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/baselayerreader.go new file mode 100644 index 0000000000..ec4423effe --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/baselayerreader.go @@ -0,0 +1,216 @@ +package wclayer + +import ( + "errors" + "io" + "os" + "path/filepath" + "strings" + "syscall" + + "github.com/Microsoft/go-winio" + "github.com/Microsoft/hcsshim/internal/longpath" + "github.com/Microsoft/hcsshim/internal/oc" + "go.opencensus.io/trace" +) + +type baseLayerReader struct { + s *trace.Span + root string + result chan *fileEntry + proceed chan bool + currentFile *os.File + backupReader *winio.BackupFileReader +} + +func newBaseLayerReader(root string, s *trace.Span) (r *baseLayerReader) { + r = &baseLayerReader{ + s: s, + root: root, + result: make(chan *fileEntry), + proceed: make(chan bool), + } + go r.walk() + return r +} + +func (r *baseLayerReader) walkUntilCancelled() error { + root, err := longpath.LongAbs(r.root) + if err != nil { + return err + } + + r.root = root + + err = filepath.Walk(filepath.Join(r.root, filesPath), func(path string, info os.FileInfo, err error) error { + if err != nil { + return err + } + + // Indirect fix for https://github.com/moby/moby/issues/32838#issuecomment-343610048. + // Handle failure from what may be a golang bug in the conversion of + // UTF16 to UTF8 in files which are left in the recycle bin. Os.Lstat + // which is called by filepath.Walk will fail when a filename contains + // unicode characters. Skip the recycle bin regardless which is goodness. + if strings.EqualFold(path, filepath.Join(r.root, `Files\$Recycle.Bin`)) && info.IsDir() { + return filepath.SkipDir + } + + r.result <- &fileEntry{path, info, nil} + if !<-r.proceed { + return errorIterationCanceled + } + + return nil + }) + + if err == errorIterationCanceled { + return nil + } + + if err != nil { + return err + } + + utilityVMAbsPath := filepath.Join(r.root, utilityVMPath) + utilityVMFilesAbsPath := filepath.Join(r.root, utilityVMFilesPath) + + // Ignore a UtilityVM without Files, that's not _really_ a UtiltyVM + if _, err = os.Lstat(utilityVMFilesAbsPath); err != nil { + if os.IsNotExist(err) { + return io.EOF + } + return err + } + + err = filepath.Walk(utilityVMAbsPath, func(path string, info os.FileInfo, err error) error { + if err != nil { + return err + } + + if path != utilityVMAbsPath && path != utilityVMFilesAbsPath && !hasPathPrefix(path, utilityVMFilesAbsPath) { + if info.IsDir() { + return filepath.SkipDir + } + return nil + } + + r.result <- &fileEntry{path, info, nil} + if !<-r.proceed { + return errorIterationCanceled + } + + return nil + }) + + if err == errorIterationCanceled { + return nil + } + + if err != nil { + return err + } + + return io.EOF +} + +func (r *baseLayerReader) walk() { + defer close(r.result) + if !<-r.proceed { + return + } + + err := r.walkUntilCancelled() + if err != nil { + for { + r.result <- &fileEntry{err: err} + if !<-r.proceed { + return + } + } + } +} + +func (r *baseLayerReader) reset() { + if r.backupReader != nil { + r.backupReader.Close() + r.backupReader = nil + } + if r.currentFile != nil { + r.currentFile.Close() + r.currentFile = nil + } +} + +func (r *baseLayerReader) Next() (path string, size int64, fileInfo *winio.FileBasicInfo, err error) { + r.reset() + r.proceed <- true + fe := <-r.result + if fe == nil { + err = errors.New("BaseLayerReader closed") + return + } + if fe.err != nil { + err = fe.err + return + } + + path, err = filepath.Rel(r.root, fe.path) + if err != nil { + return + } + + f, err := openFileOrDir(fe.path, syscall.GENERIC_READ, syscall.OPEN_EXISTING) + if err != nil { + return + } + defer func() { + if f != nil { + f.Close() + } + }() + + fileInfo, err = winio.GetFileBasicInfo(f) + if err != nil { + return + } + + size = fe.fi.Size() + r.backupReader = winio.NewBackupFileReader(f, true) + + r.currentFile = f + f = nil + return +} + +func (r *baseLayerReader) LinkInfo() (uint32, *winio.FileIDInfo, error) { + fileStandardInfo, err := winio.GetFileStandardInfo(r.currentFile) + if err != nil { + return 0, nil, err + } + fileIDInfo, err := winio.GetFileID(r.currentFile) + if err != nil { + return 0, nil, err + } + return fileStandardInfo.NumberOfLinks, fileIDInfo, nil +} + +func (r *baseLayerReader) Read(b []byte) (int, error) { + if r.backupReader == nil { + return 0, io.EOF + } + return r.backupReader.Read(b) +} + +func (r *baseLayerReader) Close() (err error) { + defer r.s.End() + defer func() { + oc.SetSpanStatus(r.s, err) + close(r.proceed) + }() + r.proceed <- false + // The r.result channel will be closed once walk() returns + <-r.result + r.reset() + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/baselayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/baselayerwriter.go similarity index 99% rename from vendor/github.com/Microsoft/hcsshim/internal/wclayer/baselayer.go rename to vendor/github.com/Microsoft/hcsshim/internal/wclayer/baselayerwriter.go index 3ec708d1ed..aea8b421ef 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/baselayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/baselayerwriter.go @@ -1,3 +1,5 @@ +//go:build windows + package wclayer import ( @@ -48,7 +50,6 @@ func reapplyDirectoryTimes(root *os.File, dis []dirInfo) error { if err != nil { return err } - } return nil } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/converttobaselayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/converttobaselayer.go new file mode 100644 index 0000000000..ceb3b50835 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/converttobaselayer.go @@ -0,0 +1,158 @@ +package wclayer + +import ( + "context" + "fmt" + "os" + "path/filepath" + "syscall" + + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/Microsoft/hcsshim/internal/longpath" + "github.com/Microsoft/hcsshim/internal/oc" + "github.com/Microsoft/hcsshim/internal/safefile" + "github.com/Microsoft/hcsshim/internal/winapi" + "github.com/pkg/errors" + "go.opencensus.io/trace" + "golang.org/x/sys/windows" +) + +var hiveNames = []string{"DEFAULT", "SAM", "SECURITY", "SOFTWARE", "SYSTEM"} + +// Ensure the given file exists as an ordinary file, and create a minimal hive file if not. +func ensureHive(path string, root *os.File) (err error) { + _, err = safefile.LstatRelative(path, root) + if err != nil && !os.IsNotExist(err) { + return fmt.Errorf("accessing %s: %w", path, err) + } + + version := windows.RtlGetVersion() + if version == nil { + return fmt.Errorf("failed to get OS version") + } + + var fullPath string + fullPath, err = longpath.LongAbs(filepath.Join(root.Name(), path)) + if err != nil { + return fmt.Errorf("getting path: %w", err) + } + + var key syscall.Handle + err = winapi.ORCreateHive(&key) + if err != nil { + return fmt.Errorf("creating hive: %w", err) + } + + defer func() { + closeErr := winapi.ORCloseHive(key) + if closeErr != nil && err == nil { + err = fmt.Errorf("closing hive key: %w", closeErr) + } + }() + + err = winapi.ORSaveHive(key, fullPath, version.MajorVersion, version.MinorVersion) + if err != nil { + return fmt.Errorf("saving hive: %w", err) + } + + return nil +} + +func ensureBaseLayer(root *os.File) (hasUtilityVM bool, err error) { + // The base layer registry hives will be copied from here + const hiveSourcePath = "Files\\Windows\\System32\\config" + if err = safefile.MkdirAllRelative(hiveSourcePath, root); err != nil { + return + } + + for _, hiveName := range hiveNames { + hivePath := filepath.Join(hiveSourcePath, hiveName) + if err = ensureHive(hivePath, root); err != nil { + return + } + } + + stat, err := safefile.LstatRelative(utilityVMFilesPath, root) + + if os.IsNotExist(err) { + return false, nil + } + + if err != nil { + return + } + + if !stat.Mode().IsDir() { + fullPath := filepath.Join(root.Name(), utilityVMFilesPath) + return false, errors.Errorf("%s has unexpected file mode %s", fullPath, stat.Mode().String()) + } + + const bcdRelativePath = "EFI\\Microsoft\\Boot\\BCD" + + // Just check that this exists as a regular file. If it exists but is not a valid registry hive, + // ProcessUtilityVMImage will complain: + // "The registry could not read in, or write out, or flush, one of the files that contain the system's image of the registry." + bcdPath := filepath.Join(utilityVMFilesPath, bcdRelativePath) + + stat, err = safefile.LstatRelative(bcdPath, root) + if err != nil { + return false, errors.Wrapf(err, "UtilityVM must contain '%s'", bcdRelativePath) + } + + if !stat.Mode().IsRegular() { + fullPath := filepath.Join(root.Name(), bcdPath) + return false, errors.Errorf("%s has unexpected file mode %s", fullPath, stat.Mode().String()) + } + + return true, nil +} + +func convertToBaseLayer(ctx context.Context, root *os.File) error { + hasUtilityVM, err := ensureBaseLayer(root) + + if err != nil { + return err + } + + if err := ProcessBaseLayer(ctx, root.Name()); err != nil { + return err + } + + if !hasUtilityVM { + return nil + } + + err = safefile.EnsureNotReparsePointRelative(utilityVMPath, root) + if err != nil { + return err + } + + utilityVMPath := filepath.Join(root.Name(), utilityVMPath) + return ProcessUtilityVMImage(ctx, utilityVMPath) +} + +// ConvertToBaseLayer processes a candidate base layer, i.e. a directory +// containing the desired file content under Files/, and optionally the +// desired file content for a UtilityVM under UtilityVM/Files/ +func ConvertToBaseLayer(ctx context.Context, path string) (err error) { + title := "hcsshim::ConvertToBaseLayer" + ctx, span := trace.StartSpan(ctx, title) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("path", path)) + + root, err := safefile.OpenRoot(path) + if err != nil { + return hcserror.New(err, title+" - failed", "") + } + defer func() { + if err2 := root.Close(); err == nil && err2 != nil { + err = hcserror.New(err2, title+" - failed", "") + } + }() + + if err = convertToBaseLayer(ctx, root); err != nil { + return hcserror.New(err, title+" - failed", "") + } + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createlayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createlayer.go index 480aee8725..932475723a 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createlayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createlayer.go @@ -1,3 +1,5 @@ +//go:build windows + package wclayer import ( @@ -12,7 +14,7 @@ import ( // the parent layer provided. func CreateLayer(ctx context.Context, path, parent string) (err error) { title := "hcsshim::CreateLayer" - ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + ctx, span := oc.StartSpan(ctx, title) //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes( diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createscratchlayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createscratchlayer.go index 131aa94f14..5c9d5d2507 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createscratchlayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createscratchlayer.go @@ -1,3 +1,5 @@ +//go:build windows + package wclayer import ( @@ -13,7 +15,7 @@ import ( // This requires the full list of paths to all parent layers up to the base func CreateScratchLayer(ctx context.Context, path string, parentLayerPaths []string) (err error) { title := "hcsshim::CreateScratchLayer" - ctx, span := trace.StartSpan(ctx, title) + ctx, span := oc.StartSpan(ctx, title) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes( diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/deactivatelayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/deactivatelayer.go index d5bf2f5bdc..e3bc77cbc8 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/deactivatelayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/deactivatelayer.go @@ -1,3 +1,5 @@ +//go:build windows + package wclayer import ( @@ -11,7 +13,7 @@ import ( // DeactivateLayer will dismount a layer that was mounted via ActivateLayer. func DeactivateLayer(ctx context.Context, path string) (err error) { title := "hcsshim::DeactivateLayer" - ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + ctx, span := oc.StartSpan(ctx, title) //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes(trace.StringAttribute("path", path)) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/destroylayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/destroylayer.go index 424467ac33..d0a59efe12 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/destroylayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/destroylayer.go @@ -1,3 +1,5 @@ +//go:build windows + package wclayer import ( @@ -12,7 +14,7 @@ import ( // path, including that layer's containing folder, if any. func DestroyLayer(ctx context.Context, path string) (err error) { title := "hcsshim::DestroyLayer" - ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + ctx, span := oc.StartSpan(ctx, title) //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes(trace.StringAttribute("path", path)) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/doc.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/doc.go new file mode 100644 index 0000000000..dd1d555804 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/doc.go @@ -0,0 +1,4 @@ +// Package wclayer provides bindings to HCS's legacy layer management API and +// provides a higher level interface around these calls for container layer +// management. +package wclayer diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go index 035c9041e6..e2ec27ad08 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go @@ -1,3 +1,5 @@ +//go:build windows + package wclayer import ( @@ -16,7 +18,7 @@ import ( // ExpandScratchSize expands the size of a layer to at least size bytes. func ExpandScratchSize(ctx context.Context, path string, size uint64) (err error) { title := "hcsshim::ExpandScratchSize" - ctx, span := trace.StartSpan(ctx, title) + ctx, span := oc.StartSpan(ctx, title) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes( diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/exportlayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/exportlayer.go index 97b27eb7d6..d4c677aabf 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/exportlayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/exportlayer.go @@ -1,8 +1,9 @@ +//go:build windows + package wclayer import ( "context" - "io/ioutil" "os" "strings" @@ -19,7 +20,7 @@ import ( // perform the export. func ExportLayer(ctx context.Context, path string, exportFolderPath string, parentLayerPaths []string) (err error) { title := "hcsshim::ExportLayer" - ctx, span := trace.StartSpan(ctx, title) + ctx, span := oc.StartSpan(ctx, title) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes( @@ -40,9 +41,16 @@ func ExportLayer(ctx context.Context, path string, exportFolderPath string, pare return nil } +// LayerReader is an interface that supports reading an existing container image layer. type LayerReader interface { + // Next advances to the next file and returns the name, size, and file info Next() (string, int64, *winio.FileBasicInfo, error) + // LinkInfo returns the number of links and the file identifier for the current file. + LinkInfo() (uint32, *winio.FileIDInfo, error) + // Read reads data from the current file, in the format of a Win32 backup stream, and + // returns the number of bytes read. Read(b []byte) (int, error) + // Close finishes the layer reading process and releases any resources. Close() error } @@ -50,7 +58,7 @@ type LayerReader interface { // The caller must have taken the SeBackupPrivilege privilege // to call this and any methods on the resulting LayerReader. func NewLayerReader(ctx context.Context, path string, parentLayerPaths []string) (_ LayerReader, err error) { - ctx, span := trace.StartSpan(ctx, "hcsshim::NewLayerReader") + ctx, span := oc.StartSpan(ctx, "hcsshim::NewLayerReader") defer func() { if err != nil { oc.SetSpanStatus(span, err) @@ -61,7 +69,12 @@ func NewLayerReader(ctx context.Context, path string, parentLayerPaths []string) trace.StringAttribute("path", path), trace.StringAttribute("parentLayerPaths", strings.Join(parentLayerPaths, ", "))) - exportPath, err := ioutil.TempDir("", "hcs") + if len(parentLayerPaths) == 0 { + // This is a base layer. It gets exported differently. + return newBaseLayerReader(path, span), nil + } + + exportPath, err := os.MkdirTemp("", "hcs") if err != nil { return nil, err } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getlayermountpath.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getlayermountpath.go index 8d213f5871..715e06e379 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getlayermountpath.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getlayermountpath.go @@ -1,3 +1,5 @@ +//go:build windows + package wclayer import ( @@ -16,7 +18,7 @@ import ( // folder path at which the layer is stored. func GetLayerMountPath(ctx context.Context, path string) (_ string, err error) { title := "hcsshim::GetLayerMountPath" - ctx, span := trace.StartSpan(ctx, title) + ctx, span := oc.StartSpan(ctx, title) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes(trace.StringAttribute("path", path)) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getsharedbaseimages.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getsharedbaseimages.go index ae1fff8403..5e400fb209 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getsharedbaseimages.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getsharedbaseimages.go @@ -1,3 +1,5 @@ +//go:build windows + package wclayer import ( @@ -14,7 +16,7 @@ import ( // of registering them with the graphdriver, graph, and tagstore. func GetSharedBaseImages(ctx context.Context) (_ string, err error) { title := "hcsshim::GetSharedBaseImages" - ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + ctx, span := oc.StartSpan(ctx, title) //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/grantvmaccess.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/grantvmaccess.go index 4b282fef9d..20217ed81b 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/grantvmaccess.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/grantvmaccess.go @@ -1,3 +1,5 @@ +//go:build windows + package wclayer import ( @@ -11,7 +13,7 @@ import ( // GrantVmAccess adds access to a file for a given VM func GrantVmAccess(ctx context.Context, vmid string, filepath string) (err error) { title := "hcsshim::GrantVmAccess" - ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + ctx, span := oc.StartSpan(ctx, title) //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes( diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/importlayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/importlayer.go index 687550f0be..50f669a261 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/importlayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/importlayer.go @@ -1,8 +1,9 @@ +//go:build windows + package wclayer import ( "context" - "io/ioutil" "os" "path/filepath" "strings" @@ -20,7 +21,7 @@ import ( // be present on the system at the paths provided in parentLayerPaths. func ImportLayer(ctx context.Context, path string, importFolderPath string, parentLayerPaths []string) (err error) { title := "hcsshim::ImportLayer" - ctx, span := trace.StartSpan(ctx, title) + ctx, span := oc.StartSpan(ctx, title) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes( @@ -124,7 +125,7 @@ func (r *legacyLayerWriterWrapper) Close() (err error) { // The caller must have taken the SeBackupPrivilege and SeRestorePrivilege privileges // to call this and any methods on the resulting LayerWriter. func NewLayerWriter(ctx context.Context, path string, parentLayerPaths []string) (_ LayerWriter, err error) { - ctx, span := trace.StartSpan(ctx, "hcsshim::NewLayerWriter") + ctx, span := oc.StartSpan(ctx, "hcsshim::NewLayerWriter") defer func() { if err != nil { oc.SetSpanStatus(span, err) @@ -148,7 +149,7 @@ func NewLayerWriter(ctx context.Context, path string, parentLayerPaths []string) }, nil } - importPath, err := ioutil.TempDir("", "hcs") + importPath, err := os.MkdirTemp("", "hcs") if err != nil { return nil, err } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerexists.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerexists.go index 01e6723393..4d82977ea1 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerexists.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerexists.go @@ -1,3 +1,5 @@ +//go:build windows + package wclayer import ( @@ -12,7 +14,7 @@ import ( // to the system. func LayerExists(ctx context.Context, path string) (_ bool, err error) { title := "hcsshim::LayerExists" - ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + ctx, span := oc.StartSpan(ctx, title) //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes(trace.StringAttribute("path", path)) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go index 0ce34a30f8..d4805f1444 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go @@ -1,3 +1,5 @@ +//go:build windows + package wclayer import ( @@ -12,7 +14,7 @@ import ( // LayerID returns the layer ID of a layer on disk. func LayerID(ctx context.Context, path string) (_ guid.GUID, err error) { title := "hcsshim::LayerID" - ctx, span := trace.StartSpan(ctx, title) + ctx, span := oc.StartSpan(ctx, title) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes(trace.StringAttribute("path", path)) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go index 1ec893c6af..d5d2cb137a 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go @@ -1,3 +1,5 @@ +//go:build windows + package wclayer // This file contains utility functions to support storage (graph) related @@ -11,7 +13,9 @@ import ( "github.com/sirupsen/logrus" ) -/* To pass into syscall, we need a struct matching the following: +/* +To pass into syscall, we need a struct matching the following: + enum GraphDriverType { DiffDriver, @@ -34,32 +38,34 @@ var ( stdDriverInfo = driverInfo{1, &utf16EmptyString} ) -/* To pass into syscall, we need a struct matching the following: +/* +To pass into syscall, we need a struct matching the following: + typedef struct _WC_LAYER_DESCRIPTOR { - // - // The ID of the layer - // + // + // The ID of the layer + // - GUID LayerId; + GUID LayerId; - // - // Additional flags - // + // + // Additional flags + // - union { - struct { - ULONG Reserved : 31; - ULONG Dirty : 1; // Created from sandbox as a result of snapshot - }; - ULONG Value; - } Flags; + union { + struct { + ULONG Reserved : 31; + ULONG Dirty : 1; // Created from sandbox as a result of snapshot + }; + ULONG Value; + } Flags; - // - // Path to the layer root directory, null-terminated - // + // + // Path to the layer root directory, null-terminated + // - PCWSTR Path; + PCWSTR Path; } WC_LAYER_DESCRIPTOR, *PWC_LAYER_DESCRIPTOR; */ diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/legacy.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/legacy.go index b7f3064f26..ee8da5df9c 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/legacy.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/legacy.go @@ -1,3 +1,5 @@ +//go:build windows + package wclayer import ( @@ -6,7 +8,6 @@ import ( "errors" "fmt" "io" - "io/ioutil" "os" "path/filepath" "strings" @@ -262,7 +263,6 @@ func (r *legacyLayerReader) Next() (path string, size int64, fileInfo *winio.Fil // The creation time and access time get reset for files outside of the Files path. fileInfo.CreationTime = fileInfo.LastWriteTime fileInfo.LastAccessTime = fileInfo.LastWriteTime - } else { // The file attributes are written before the backup stream. var attr uint32 @@ -294,6 +294,18 @@ func (r *legacyLayerReader) Next() (path string, size int64, fileInfo *winio.Fil return } +func (r *legacyLayerReader) LinkInfo() (uint32, *winio.FileIDInfo, error) { + fileStandardInfo, err := winio.GetFileStandardInfo(r.currentFile) + if err != nil { + return 0, nil, err + } + fileIDInfo, err := winio.GetFileID(r.currentFile) + if err != nil { + return 0, nil, err + } + return fileStandardInfo.NumberOfLinks, fileIDInfo, nil +} + func (r *legacyLayerReader) Read(b []byte) (int, error) { if r.backupReader == nil { if r.currentFile == nil { @@ -349,7 +361,7 @@ type legacyLayerWriter struct { currentIsDir bool } -// newLegacyLayerWriter returns a LayerWriter that can write the contaler layer +// newLegacyLayerWriter returns a LayerWriter that can write the container layer // transport format to disk. func newLegacyLayerWriter(root string, parentRoots []string, destRoot string) (w *legacyLayerWriter, err error) { w = &legacyLayerWriter{ @@ -376,7 +388,7 @@ func newLegacyLayerWriter(root string, parentRoots []string, destRoot string) (w } w.parentRoots = append(w.parentRoots, f) } - w.bufWriter = bufio.NewWriterSize(ioutil.Discard, 65536) + w.bufWriter = bufio.NewWriterSize(io.Discard, 65536) return } @@ -419,7 +431,7 @@ func (w *legacyLayerWriter) reset() error { if err != nil { return err } - w.bufWriter.Reset(ioutil.Discard) + w.bufWriter.Reset(io.Discard) if w.currentIsDir { r := w.currentFile br := winio.NewBackupStreamReader(r) @@ -695,7 +707,7 @@ func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) erro // The file attributes are written before the stream. err = binary.Write(w.bufWriter, binary.LittleEndian, uint32(fileInfo.FileAttributes)) if err != nil { - w.bufWriter.Reset(ioutil.Discard) + w.bufWriter.Reset(io.Discard) return err } } @@ -730,7 +742,7 @@ func (w *legacyLayerWriter) AddLink(name string, target string) error { return errors.New("invalid hard link in layer") } - // Find to try the target of the link in a previously added file. If that + // Try to find the target of the link in a previously added file. If that // fails, search in parent layers. var selectedRoot *os.File if _, ok := w.addedFiles[target]; ok { diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go index 09950297ce..c45fa2750c 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go @@ -1,3 +1,5 @@ +//go:build windows + package wclayer import ( @@ -14,7 +16,7 @@ import ( // across all clients. func NameToGuid(ctx context.Context, name string) (_ guid.GUID, err error) { title := "hcsshim::NameToGuid" - ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + ctx, span := oc.StartSpan(ctx, title) //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes(trace.StringAttribute("objectName", name)) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/preparelayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/preparelayer.go index 90129faefb..b66e071245 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/preparelayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/preparelayer.go @@ -1,3 +1,5 @@ +//go:build windows + package wclayer import ( @@ -19,7 +21,7 @@ var prepareLayerLock sync.Mutex // Disabling the filter must be done via UnprepareLayer. func PrepareLayer(ctx context.Context, path string, parentLayerPaths []string) (err error) { title := "hcsshim::PrepareLayer" - ctx, span := trace.StartSpan(ctx, title) + ctx, span := oc.StartSpan(ctx, title) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes( diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/processimage.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/processimage.go index 30bcdff5f5..7c49cbda45 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/processimage.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/processimage.go @@ -1,3 +1,5 @@ +//go:build windows + package wclayer import ( @@ -12,7 +14,7 @@ import ( // The files should have been extracted to \Files. func ProcessBaseLayer(ctx context.Context, path string) (err error) { title := "hcsshim::ProcessBaseLayer" - ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + ctx, span := oc.StartSpan(ctx, title) //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes(trace.StringAttribute("path", path)) @@ -28,7 +30,7 @@ func ProcessBaseLayer(ctx context.Context, path string) (err error) { // The files should have been extracted to \Files. func ProcessUtilityVMImage(ctx context.Context, path string) (err error) { title := "hcsshim::ProcessUtilityVMImage" - ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + ctx, span := oc.StartSpan(ctx, title) //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes(trace.StringAttribute("path", path)) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/unpreparelayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/unpreparelayer.go index 71b130c525..fe20702c18 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/unpreparelayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/unpreparelayer.go @@ -1,3 +1,5 @@ +//go:build windows + package wclayer import ( @@ -12,7 +14,7 @@ import ( // the given id. func UnprepareLayer(ctx context.Context, path string) (err error) { title := "hcsshim::UnprepareLayer" - ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + ctx, span := oc.StartSpan(ctx, title) //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes(trace.StringAttribute("path", path)) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go index 9b1e06d50c..39682b8171 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go @@ -1,11 +1,10 @@ -// Package wclayer provides bindings to HCS's legacy layer management API and -// provides a higher level interface around these calls for container layer -// management. +//go:build windows + package wclayer import "github.com/Microsoft/go-winio/pkg/guid" -//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go wclayer.go +//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -output zsyscall_windows.go wclayer.go //sys activateLayer(info *driverInfo, id string) (hr error) = vmcompute.ActivateLayer? //sys copyLayer(info *driverInfo, srcId string, dstId string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CopyLayer? diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go index 67f917f07e..0cb509c46f 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go @@ -1,4 +1,6 @@ -// Code generated mksyscall_windows.exe DO NOT EDIT +//go:build windows + +// Code generated by 'go generate' using "github.com/Microsoft/go-winio/tools/mkwinsyscall"; DO NOT EDIT. package wclayer @@ -19,6 +21,7 @@ const ( var ( errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) + errERROR_EINVAL error = syscall.EINVAL ) // errnoErr returns common boxed Errno values, to prevent @@ -26,7 +29,7 @@ var ( func errnoErr(e syscall.Errno) error { switch e { case 0: - return nil + return errERROR_EINVAL case errnoERROR_IO_PENDING: return errERROR_IO_PENDING } @@ -37,33 +40,75 @@ func errnoErr(e syscall.Errno) error { } var ( - modvmcompute = windows.NewLazySystemDLL("vmcompute.dll") - modvirtdisk = windows.NewLazySystemDLL("virtdisk.dll") modkernel32 = windows.NewLazySystemDLL("kernel32.dll") + modvirtdisk = windows.NewLazySystemDLL("virtdisk.dll") + modvmcompute = windows.NewLazySystemDLL("vmcompute.dll") + procGetDiskFreeSpaceExW = modkernel32.NewProc("GetDiskFreeSpaceExW") + procAttachVirtualDisk = modvirtdisk.NewProc("AttachVirtualDisk") + procOpenVirtualDisk = modvirtdisk.NewProc("OpenVirtualDisk") procActivateLayer = modvmcompute.NewProc("ActivateLayer") procCopyLayer = modvmcompute.NewProc("CopyLayer") procCreateLayer = modvmcompute.NewProc("CreateLayer") procCreateSandboxLayer = modvmcompute.NewProc("CreateSandboxLayer") - procExpandSandboxSize = modvmcompute.NewProc("ExpandSandboxSize") procDeactivateLayer = modvmcompute.NewProc("DeactivateLayer") procDestroyLayer = modvmcompute.NewProc("DestroyLayer") + procExpandSandboxSize = modvmcompute.NewProc("ExpandSandboxSize") procExportLayer = modvmcompute.NewProc("ExportLayer") - procGetLayerMountPath = modvmcompute.NewProc("GetLayerMountPath") procGetBaseImages = modvmcompute.NewProc("GetBaseImages") + procGetLayerMountPath = modvmcompute.NewProc("GetLayerMountPath") + procGrantVmAccess = modvmcompute.NewProc("GrantVmAccess") procImportLayer = modvmcompute.NewProc("ImportLayer") procLayerExists = modvmcompute.NewProc("LayerExists") procNameToGuid = modvmcompute.NewProc("NameToGuid") procPrepareLayer = modvmcompute.NewProc("PrepareLayer") - procUnprepareLayer = modvmcompute.NewProc("UnprepareLayer") procProcessBaseImage = modvmcompute.NewProc("ProcessBaseImage") procProcessUtilityImage = modvmcompute.NewProc("ProcessUtilityImage") - procGrantVmAccess = modvmcompute.NewProc("GrantVmAccess") - procOpenVirtualDisk = modvirtdisk.NewProc("OpenVirtualDisk") - procAttachVirtualDisk = modvirtdisk.NewProc("AttachVirtualDisk") - procGetDiskFreeSpaceExW = modkernel32.NewProc("GetDiskFreeSpaceExW") + procUnprepareLayer = modvmcompute.NewProc("UnprepareLayer") ) +func getDiskFreeSpaceEx(directoryName string, freeBytesAvailableToCaller *int64, totalNumberOfBytes *int64, totalNumberOfFreeBytes *int64) (err error) { + var _p0 *uint16 + _p0, err = syscall.UTF16PtrFromString(directoryName) + if err != nil { + return + } + return _getDiskFreeSpaceEx(_p0, freeBytesAvailableToCaller, totalNumberOfBytes, totalNumberOfFreeBytes) +} + +func _getDiskFreeSpaceEx(directoryName *uint16, freeBytesAvailableToCaller *int64, totalNumberOfBytes *int64, totalNumberOfFreeBytes *int64) (err error) { + r1, _, e1 := syscall.Syscall6(procGetDiskFreeSpaceExW.Addr(), 4, uintptr(unsafe.Pointer(directoryName)), uintptr(unsafe.Pointer(freeBytesAvailableToCaller)), uintptr(unsafe.Pointer(totalNumberOfBytes)), uintptr(unsafe.Pointer(totalNumberOfFreeBytes)), 0, 0) + if r1 == 0 { + err = errnoErr(e1) + } + return +} + +func attachVirtualDisk(handle syscall.Handle, sd uintptr, flags uint32, providerFlags uint32, params uintptr, overlapped uintptr) (err error) { + r1, _, e1 := syscall.Syscall6(procAttachVirtualDisk.Addr(), 6, uintptr(handle), uintptr(sd), uintptr(flags), uintptr(providerFlags), uintptr(params), uintptr(overlapped)) + if r1 != 0 { + err = errnoErr(e1) + } + return +} + +func openVirtualDisk(virtualStorageType *virtualStorageType, path string, virtualDiskAccessMask uint32, flags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (err error) { + var _p0 *uint16 + _p0, err = syscall.UTF16PtrFromString(path) + if err != nil { + return + } + return _openVirtualDisk(virtualStorageType, _p0, virtualDiskAccessMask, flags, parameters, handle) +} + +func _openVirtualDisk(virtualStorageType *virtualStorageType, path *uint16, virtualDiskAccessMask uint32, flags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (err error) { + r1, _, e1 := syscall.Syscall6(procOpenVirtualDisk.Addr(), 6, uintptr(unsafe.Pointer(virtualStorageType)), uintptr(unsafe.Pointer(path)), uintptr(virtualDiskAccessMask), uintptr(flags), uintptr(unsafe.Pointer(parameters)), uintptr(unsafe.Pointer(handle))) + if r1 != 0 { + err = errnoErr(e1) + } + return +} + func activateLayer(info *driverInfo, id string) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(id) @@ -74,7 +119,8 @@ func activateLayer(info *driverInfo, id string) (hr error) { } func _activateLayer(info *driverInfo, id *uint16) (hr error) { - if hr = procActivateLayer.Find(); hr != nil { + hr = procActivateLayer.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procActivateLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) @@ -102,13 +148,14 @@ func copyLayer(info *driverInfo, srcId string, dstId string, descriptors []WC_LA } func _copyLayer(info *driverInfo, srcId *uint16, dstId *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + hr = procCopyLayer.Find() + if hr != nil { + return + } var _p2 *WC_LAYER_DESCRIPTOR if len(descriptors) > 0 { _p2 = &descriptors[0] } - if hr = procCopyLayer.Find(); hr != nil { - return - } r0, _, _ := syscall.Syscall6(procCopyLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(srcId)), uintptr(unsafe.Pointer(dstId)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { @@ -134,7 +181,8 @@ func createLayer(info *driverInfo, id string, parent string) (hr error) { } func _createLayer(info *driverInfo, id *uint16, parent *uint16) (hr error) { - if hr = procCreateLayer.Find(); hr != nil { + hr = procCreateLayer.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procCreateLayer.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(parent))) @@ -157,13 +205,14 @@ func createSandboxLayer(info *driverInfo, id string, parent uintptr, descriptors } func _createSandboxLayer(info *driverInfo, id *uint16, parent uintptr, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + hr = procCreateSandboxLayer.Find() + if hr != nil { + return + } var _p1 *WC_LAYER_DESCRIPTOR if len(descriptors) > 0 { _p1 = &descriptors[0] } - if hr = procCreateSandboxLayer.Find(); hr != nil { - return - } r0, _, _ := syscall.Syscall6(procCreateSandboxLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(parent), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { @@ -174,29 +223,6 @@ func _createSandboxLayer(info *driverInfo, id *uint16, parent uintptr, descripto return } -func expandSandboxSize(info *driverInfo, id string, size uint64) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(id) - if hr != nil { - return - } - return _expandSandboxSize(info, _p0, size) -} - -func _expandSandboxSize(info *driverInfo, id *uint16, size uint64) (hr error) { - if hr = procExpandSandboxSize.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procExpandSandboxSize.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(size)) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return -} - func deactivateLayer(info *driverInfo, id string) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(id) @@ -207,7 +233,8 @@ func deactivateLayer(info *driverInfo, id string) (hr error) { } func _deactivateLayer(info *driverInfo, id *uint16) (hr error) { - if hr = procDeactivateLayer.Find(); hr != nil { + hr = procDeactivateLayer.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procDeactivateLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) @@ -230,7 +257,8 @@ func destroyLayer(info *driverInfo, id string) (hr error) { } func _destroyLayer(info *driverInfo, id *uint16) (hr error) { - if hr = procDestroyLayer.Find(); hr != nil { + hr = procDestroyLayer.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procDestroyLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) @@ -243,6 +271,30 @@ func _destroyLayer(info *driverInfo, id *uint16) (hr error) { return } +func expandSandboxSize(info *driverInfo, id string, size uint64) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _expandSandboxSize(info, _p0, size) +} + +func _expandSandboxSize(info *driverInfo, id *uint16, size uint64) (hr error) { + hr = procExpandSandboxSize.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall(procExpandSandboxSize.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(size)) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + func exportLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(id) @@ -258,14 +310,30 @@ func exportLayer(info *driverInfo, id string, path string, descriptors []WC_LAYE } func _exportLayer(info *driverInfo, id *uint16, path *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + hr = procExportLayer.Find() + if hr != nil { + return + } var _p2 *WC_LAYER_DESCRIPTOR if len(descriptors) > 0 { _p2 = &descriptors[0] } - if hr = procExportLayer.Find(); hr != nil { + r0, _, _ := syscall.Syscall6(procExportLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func getBaseImages(buffer **uint16) (hr error) { + hr = procGetBaseImages.Find() + if hr != nil { return } - r0, _, _ := syscall.Syscall6(procExportLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) + r0, _, _ := syscall.Syscall(procGetBaseImages.Addr(), 1, uintptr(unsafe.Pointer(buffer)), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -285,7 +353,8 @@ func getLayerMountPath(info *driverInfo, id string, length *uintptr, buffer *uin } func _getLayerMountPath(info *driverInfo, id *uint16, length *uintptr, buffer *uint16) (hr error) { - if hr = procGetLayerMountPath.Find(); hr != nil { + hr = procGetLayerMountPath.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall6(procGetLayerMountPath.Addr(), 4, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(length)), uintptr(unsafe.Pointer(buffer)), 0, 0) @@ -298,194 +367,6 @@ func _getLayerMountPath(info *driverInfo, id *uint16, length *uintptr, buffer *u return } -func getBaseImages(buffer **uint16) (hr error) { - if hr = procGetBaseImages.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procGetBaseImages.Addr(), 1, uintptr(unsafe.Pointer(buffer)), 0, 0) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return -} - -func importLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(id) - if hr != nil { - return - } - var _p1 *uint16 - _p1, hr = syscall.UTF16PtrFromString(path) - if hr != nil { - return - } - return _importLayer(info, _p0, _p1, descriptors) -} - -func _importLayer(info *driverInfo, id *uint16, path *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { - var _p2 *WC_LAYER_DESCRIPTOR - if len(descriptors) > 0 { - _p2 = &descriptors[0] - } - if hr = procImportLayer.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall6(procImportLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return -} - -func layerExists(info *driverInfo, id string, exists *uint32) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(id) - if hr != nil { - return - } - return _layerExists(info, _p0, exists) -} - -func _layerExists(info *driverInfo, id *uint16, exists *uint32) (hr error) { - if hr = procLayerExists.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procLayerExists.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(exists))) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return -} - -func nameToGuid(name string, guid *_guid) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(name) - if hr != nil { - return - } - return _nameToGuid(_p0, guid) -} - -func _nameToGuid(name *uint16, guid *_guid) (hr error) { - if hr = procNameToGuid.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procNameToGuid.Addr(), 2, uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(guid)), 0) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return -} - -func prepareLayer(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(id) - if hr != nil { - return - } - return _prepareLayer(info, _p0, descriptors) -} - -func _prepareLayer(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { - var _p1 *WC_LAYER_DESCRIPTOR - if len(descriptors) > 0 { - _p1 = &descriptors[0] - } - if hr = procPrepareLayer.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall6(procPrepareLayer.Addr(), 4, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), 0, 0) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return -} - -func unprepareLayer(info *driverInfo, id string) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(id) - if hr != nil { - return - } - return _unprepareLayer(info, _p0) -} - -func _unprepareLayer(info *driverInfo, id *uint16) (hr error) { - if hr = procUnprepareLayer.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procUnprepareLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return -} - -func processBaseImage(path string) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(path) - if hr != nil { - return - } - return _processBaseImage(_p0) -} - -func _processBaseImage(path *uint16) (hr error) { - if hr = procProcessBaseImage.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procProcessBaseImage.Addr(), 1, uintptr(unsafe.Pointer(path)), 0, 0) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return -} - -func processUtilityImage(path string) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(path) - if hr != nil { - return - } - return _processUtilityImage(_p0) -} - -func _processUtilityImage(path *uint16) (hr error) { - if hr = procProcessUtilityImage.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procProcessUtilityImage.Addr(), 1, uintptr(unsafe.Pointer(path)), 0, 0) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return -} - func grantVmAccess(vmid string, filepath string) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(vmid) @@ -501,7 +382,8 @@ func grantVmAccess(vmid string, filepath string) (hr error) { } func _grantVmAccess(vmid *uint16, filepath *uint16) (hr error) { - if hr = procGrantVmAccess.Find(); hr != nil { + hr = procGrantVmAccess.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procGrantVmAccess.Addr(), 2, uintptr(unsafe.Pointer(vmid)), uintptr(unsafe.Pointer(filepath)), 0) @@ -514,56 +396,183 @@ func _grantVmAccess(vmid *uint16, filepath *uint16) (hr error) { return } -func openVirtualDisk(virtualStorageType *virtualStorageType, path string, virtualDiskAccessMask uint32, flags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (err error) { +func importLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { var _p0 *uint16 - _p0, err = syscall.UTF16PtrFromString(path) - if err != nil { + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { return } - return _openVirtualDisk(virtualStorageType, _p0, virtualDiskAccessMask, flags, parameters, handle) -} - -func _openVirtualDisk(virtualStorageType *virtualStorageType, path *uint16, virtualDiskAccessMask uint32, flags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (err error) { - r1, _, e1 := syscall.Syscall6(procOpenVirtualDisk.Addr(), 6, uintptr(unsafe.Pointer(virtualStorageType)), uintptr(unsafe.Pointer(path)), uintptr(virtualDiskAccessMask), uintptr(flags), uintptr(unsafe.Pointer(parameters)), uintptr(unsafe.Pointer(handle))) - if r1 != 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } - } - return -} - -func attachVirtualDisk(handle syscall.Handle, sd uintptr, flags uint32, providerFlags uint32, params uintptr, overlapped uintptr) (err error) { - r1, _, e1 := syscall.Syscall6(procAttachVirtualDisk.Addr(), 6, uintptr(handle), uintptr(sd), uintptr(flags), uintptr(providerFlags), uintptr(params), uintptr(overlapped)) - if r1 != 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } - } - return -} - -func getDiskFreeSpaceEx(directoryName string, freeBytesAvailableToCaller *int64, totalNumberOfBytes *int64, totalNumberOfFreeBytes *int64) (err error) { - var _p0 *uint16 - _p0, err = syscall.UTF16PtrFromString(directoryName) - if err != nil { + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(path) + if hr != nil { return } - return _getDiskFreeSpaceEx(_p0, freeBytesAvailableToCaller, totalNumberOfBytes, totalNumberOfFreeBytes) + return _importLayer(info, _p0, _p1, descriptors) } -func _getDiskFreeSpaceEx(directoryName *uint16, freeBytesAvailableToCaller *int64, totalNumberOfBytes *int64, totalNumberOfFreeBytes *int64) (err error) { - r1, _, e1 := syscall.Syscall6(procGetDiskFreeSpaceExW.Addr(), 4, uintptr(unsafe.Pointer(directoryName)), uintptr(unsafe.Pointer(freeBytesAvailableToCaller)), uintptr(unsafe.Pointer(totalNumberOfBytes)), uintptr(unsafe.Pointer(totalNumberOfFreeBytes)), 0, 0) - if r1 == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL +func _importLayer(info *driverInfo, id *uint16, path *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + hr = procImportLayer.Find() + if hr != nil { + return + } + var _p2 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p2 = &descriptors[0] + } + r0, _, _ := syscall.Syscall6(procImportLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff } + hr = syscall.Errno(r0) + } + return +} + +func layerExists(info *driverInfo, id string, exists *uint32) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _layerExists(info, _p0, exists) +} + +func _layerExists(info *driverInfo, id *uint16, exists *uint32) (hr error) { + hr = procLayerExists.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall(procLayerExists.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(exists))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func nameToGuid(name string, guid *_guid) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(name) + if hr != nil { + return + } + return _nameToGuid(_p0, guid) +} + +func _nameToGuid(name *uint16, guid *_guid) (hr error) { + hr = procNameToGuid.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall(procNameToGuid.Addr(), 2, uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(guid)), 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func prepareLayer(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _prepareLayer(info, _p0, descriptors) +} + +func _prepareLayer(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + hr = procPrepareLayer.Find() + if hr != nil { + return + } + var _p1 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p1 = &descriptors[0] + } + r0, _, _ := syscall.Syscall6(procPrepareLayer.Addr(), 4, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func processBaseImage(path string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(path) + if hr != nil { + return + } + return _processBaseImage(_p0) +} + +func _processBaseImage(path *uint16) (hr error) { + hr = procProcessBaseImage.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall(procProcessBaseImage.Addr(), 1, uintptr(unsafe.Pointer(path)), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func processUtilityImage(path string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(path) + if hr != nil { + return + } + return _processUtilityImage(_p0) +} + +func _processUtilityImage(path *uint16) (hr error) { + hr = procProcessUtilityImage.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall(procProcessUtilityImage.Addr(), 1, uintptr(unsafe.Pointer(path)), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func unprepareLayer(info *driverInfo, id string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _unprepareLayer(info, _p0) +} + +func _unprepareLayer(info *driverInfo, id *uint16) (hr error) { + hr = procUnprepareLayer.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall(procUnprepareLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) } return } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/bindflt.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/bindflt.go new file mode 100644 index 0000000000..559d443256 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/bindflt.go @@ -0,0 +1,19 @@ +package winapi + +const ( + BINDFLT_FLAG_READ_ONLY_MAPPING uint32 = 0x00000001 + BINDFLT_FLAG_MERGED_BIND_MAPPING uint32 = 0x00000002 + BINDFLT_FLAG_USE_CURRENT_SILO_MAPPING uint32 = 0x00000004 +) + +// HRESULT +// BfSetupFilter( +// _In_opt_ HANDLE JobHandle, +// _In_ ULONG Flags, +// _In_ LPCWSTR VirtualizationRootPath, +// _In_ LPCWSTR VirtualizationTargetPath, +// _In_reads_opt_( VirtualizationExceptionPathCount ) LPCWSTR* VirtualizationExceptionPaths, +// _In_opt_ ULONG VirtualizationExceptionPathCount +// ); +// +//sys BfSetupFilter(jobHandle windows.Handle, flags uint32, virtRootPath *uint16, virtTargetPath *uint16, virtExceptions **uint16, virtExceptionPathCount uint32) (hr error) = bindfltapi.BfSetupFilter? diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/console.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/console.go index def9525417..4547cdd8e8 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/winapi/console.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/console.go @@ -1,3 +1,5 @@ +//go:build windows + package winapi import ( diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/devices.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/devices.go index df28ea2421..7875466cad 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/winapi/devices.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/devices.go @@ -1,3 +1,5 @@ +//go:build windows + package winapi import "github.com/Microsoft/go-winio/pkg/guid" diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/doc.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/doc.go new file mode 100644 index 0000000000..9acc0bfc17 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/doc.go @@ -0,0 +1,3 @@ +// Package winapi contains various low-level bindings to Windows APIs. It can +// be thought of as an extension to golang.org/x/sys/windows. +package winapi diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/elevation.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/elevation.go new file mode 100644 index 0000000000..40cbf8712f --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/elevation.go @@ -0,0 +1,11 @@ +//go:build windows + +package winapi + +import ( + "golang.org/x/sys/windows" +) + +func IsElevated() bool { + return windows.GetCurrentProcessToken().IsElevated() +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/errors.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/errors.go index 4e80ef68c9..49ce924cbe 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/winapi/errors.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/errors.go @@ -1,3 +1,5 @@ +//go:build windows + package winapi import "syscall" diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/filesystem.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/filesystem.go index 7ce52afd5e..3dcb3faa0b 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/winapi/filesystem.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/filesystem.go @@ -1,5 +1,8 @@ +//go:build windows + package winapi +//sys CopyFileW(existingFileName *uint16, newFileName *uint16, failIfExists int32) (err error) = kernel32.CopyFileW //sys NtCreateFile(handle *uintptr, accessMask uint32, oa *ObjectAttributes, iosb *IOStatusBlock, allocationSize *uint64, fileAttributes uint32, shareAccess uint32, createDisposition uint32, createOptions uint32, eaBuffer *byte, eaLength uint32) (status uint32) = ntdll.NtCreateFile //sys NtSetInformationFile(handle uintptr, iosb *IOStatusBlock, information uintptr, length uint32, class uint32) (status uint32) = ntdll.NtSetInformationFile @@ -34,34 +37,35 @@ const ( // Select entries from FILE_INFO_BY_HANDLE_CLASS. // // C declaration: -// typedef enum _FILE_INFO_BY_HANDLE_CLASS { -// FileBasicInfo, -// FileStandardInfo, -// FileNameInfo, -// FileRenameInfo, -// FileDispositionInfo, -// FileAllocationInfo, -// FileEndOfFileInfo, -// FileStreamInfo, -// FileCompressionInfo, -// FileAttributeTagInfo, -// FileIdBothDirectoryInfo, -// FileIdBothDirectoryRestartInfo, -// FileIoPriorityHintInfo, -// FileRemoteProtocolInfo, -// FileFullDirectoryInfo, -// FileFullDirectoryRestartInfo, -// FileStorageInfo, -// FileAlignmentInfo, -// FileIdInfo, -// FileIdExtdDirectoryInfo, -// FileIdExtdDirectoryRestartInfo, -// FileDispositionInfoEx, -// FileRenameInfoEx, -// FileCaseSensitiveInfo, -// FileNormalizedNameInfo, -// MaximumFileInfoByHandleClass -// } FILE_INFO_BY_HANDLE_CLASS, *PFILE_INFO_BY_HANDLE_CLASS; +// +// typedef enum _FILE_INFO_BY_HANDLE_CLASS { +// FileBasicInfo, +// FileStandardInfo, +// FileNameInfo, +// FileRenameInfo, +// FileDispositionInfo, +// FileAllocationInfo, +// FileEndOfFileInfo, +// FileStreamInfo, +// FileCompressionInfo, +// FileAttributeTagInfo, +// FileIdBothDirectoryInfo, +// FileIdBothDirectoryRestartInfo, +// FileIoPriorityHintInfo, +// FileRemoteProtocolInfo, +// FileFullDirectoryInfo, +// FileFullDirectoryRestartInfo, +// FileStorageInfo, +// FileAlignmentInfo, +// FileIdInfo, +// FileIdExtdDirectoryInfo, +// FileIdExtdDirectoryRestartInfo, +// FileDispositionInfoEx, +// FileRenameInfoEx, +// FileCaseSensitiveInfo, +// FileNormalizedNameInfo, +// MaximumFileInfoByHandleClass +// } FILE_INFO_BY_HANDLE_CLASS, *PFILE_INFO_BY_HANDLE_CLASS; // // Documentation: https://docs.microsoft.com/en-us/windows/win32/api/minwinbase/ne-minwinbase-file_info_by_handle_class const ( @@ -98,10 +102,11 @@ type FileLinkInformation struct { } // C declaration: -// typedef struct _FILE_ID_INFO { -// ULONGLONG VolumeSerialNumber; -// FILE_ID_128 FileId; -// } FILE_ID_INFO, *PFILE_ID_INFO; +// +// typedef struct _FILE_ID_INFO { +// ULONGLONG VolumeSerialNumber; +// FILE_ID_128 FileId; +// } FILE_ID_INFO, *PFILE_ID_INFO; // // Documentation: https://docs.microsoft.com/en-us/windows/win32/api/winbase/ns-winbase-file_id_info type FILE_ID_INFO struct { diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/jobobject.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/jobobject.go index 7eb13f8f0a..b0deb5c72d 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/winapi/jobobject.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/jobobject.go @@ -1,3 +1,5 @@ +//go:build windows + package winapi import ( @@ -55,6 +57,8 @@ const ( JobObjectLimitViolationInformation uint32 = 13 JobObjectMemoryUsageInformation uint32 = 28 JobObjectNotificationLimitInformation2 uint32 = 33 + JobObjectCreateSilo uint32 = 35 + JobObjectSiloBasicInformation uint32 = 36 JobObjectIoAttribution uint32 = 42 ) @@ -111,29 +115,27 @@ type JOBOBJECT_BASIC_ACCOUNTING_INFORMATION struct { TotalTerminateProcesses uint32 } -//https://docs.microsoft.com/en-us/windows/win32/api/winnt/ns-winnt-jobobject_basic_and_io_accounting_information +// https://docs.microsoft.com/en-us/windows/win32/api/winnt/ns-winnt-jobobject_basic_and_io_accounting_information type JOBOBJECT_BASIC_AND_IO_ACCOUNTING_INFORMATION struct { BasicInfo JOBOBJECT_BASIC_ACCOUNTING_INFORMATION IoInfo windows.IO_COUNTERS } -// typedef struct _JOBOBJECT_MEMORY_USAGE_INFORMATION { -// ULONG64 JobMemory; -// ULONG64 PeakJobMemoryUsed; -// } JOBOBJECT_MEMORY_USAGE_INFORMATION, *PJOBOBJECT_MEMORY_USAGE_INFORMATION; -// +// typedef struct _JOBOBJECT_MEMORY_USAGE_INFORMATION { +// ULONG64 JobMemory; +// ULONG64 PeakJobMemoryUsed; +// } JOBOBJECT_MEMORY_USAGE_INFORMATION, *PJOBOBJECT_MEMORY_USAGE_INFORMATION; type JOBOBJECT_MEMORY_USAGE_INFORMATION struct { JobMemory uint64 PeakJobMemoryUsed uint64 } -// typedef struct _JOBOBJECT_IO_ATTRIBUTION_STATS { -// ULONG_PTR IoCount; -// ULONGLONG TotalNonOverlappedQueueTime; -// ULONGLONG TotalNonOverlappedServiceTime; -// ULONGLONG TotalSize; -// } JOBOBJECT_IO_ATTRIBUTION_STATS, *PJOBOBJECT_IO_ATTRIBUTION_STATS; -// +// typedef struct _JOBOBJECT_IO_ATTRIBUTION_STATS { +// ULONG_PTR IoCount; +// ULONGLONG TotalNonOverlappedQueueTime; +// ULONGLONG TotalNonOverlappedServiceTime; +// ULONGLONG TotalSize; +// } JOBOBJECT_IO_ATTRIBUTION_STATS, *PJOBOBJECT_IO_ATTRIBUTION_STATS; type JOBOBJECT_IO_ATTRIBUTION_STATS struct { IoCount uintptr TotalNonOverlappedQueueTime uint64 @@ -141,12 +143,11 @@ type JOBOBJECT_IO_ATTRIBUTION_STATS struct { TotalSize uint64 } -// typedef struct _JOBOBJECT_IO_ATTRIBUTION_INFORMATION { -// ULONG ControlFlags; -// JOBOBJECT_IO_ATTRIBUTION_STATS ReadStats; -// JOBOBJECT_IO_ATTRIBUTION_STATS WriteStats; -// } JOBOBJECT_IO_ATTRIBUTION_INFORMATION, *PJOBOBJECT_IO_ATTRIBUTION_INFORMATION; -// +// typedef struct _JOBOBJECT_IO_ATTRIBUTION_INFORMATION { +// ULONG ControlFlags; +// JOBOBJECT_IO_ATTRIBUTION_STATS ReadStats; +// JOBOBJECT_IO_ATTRIBUTION_STATS WriteStats; +// } JOBOBJECT_IO_ATTRIBUTION_INFORMATION, *PJOBOBJECT_IO_ATTRIBUTION_INFORMATION; type JOBOBJECT_IO_ATTRIBUTION_INFORMATION struct { ControlFlags uint32 ReadStats JOBOBJECT_IO_ATTRIBUTION_STATS @@ -183,7 +184,7 @@ type JOBOBJECT_ASSOCIATE_COMPLETION_PORT struct { // LPCWSTR lpName // ); // -//sys OpenJobObject(desiredAccess uint32, inheritHandle bool, lpName *uint16) (handle windows.Handle, err error) = kernel32.OpenJobObjectW +//sys OpenJobObject(desiredAccess uint32, inheritHandle int32, lpName *uint16) (handle windows.Handle, err error) = kernel32.OpenJobObjectW // DWORD SetIoRateControlInformationJobObject( // HANDLE hJob, @@ -198,6 +199,7 @@ type JOBOBJECT_ASSOCIATE_COMPLETION_PORT struct { // JOBOBJECT_IO_RATE_CONTROL_INFORMATION **InfoBlocks, // ULONG *InfoBlockCount // ); +// //sys QueryIoRateControlInformationJobObject(jobHandle windows.Handle, volumeName *uint16, ioRateControlInfo **JOBOBJECT_IO_RATE_CONTROL_INFORMATION, infoBlockCount *uint32) (ret uint32, err error) = kernel32.QueryIoRateControlInformationJobObject // NTSTATUS @@ -206,6 +208,7 @@ type JOBOBJECT_ASSOCIATE_COMPLETION_PORT struct { // _In_ ACCESS_MASK DesiredAccess, // _In_ POBJECT_ATTRIBUTES ObjectAttributes // ); +// //sys NtOpenJobObject(jobHandle *windows.Handle, desiredAccess uint32, objAttributes *ObjectAttributes) (status uint32) = ntdll.NtOpenJobObject // NTSTATUS @@ -215,4 +218,5 @@ type JOBOBJECT_ASSOCIATE_COMPLETION_PORT struct { // _In_ ACCESS_MASK DesiredAccess, // _In_opt_ POBJECT_ATTRIBUTES ObjectAttributes // ); +// //sys NtCreateJobObject(jobHandle *windows.Handle, desiredAccess uint32, objAttributes *ObjectAttributes) (status uint32) = ntdll.NtCreateJobObject diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/ofreg.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/ofreg.go new file mode 100644 index 0000000000..d8f7afe8a4 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/ofreg.go @@ -0,0 +1,5 @@ +package winapi + +//sys ORCreateHive(key *syscall.Handle) (regerrno error) = offreg.ORCreateHive +//sys ORSaveHive(key syscall.Handle, file string, OsMajorVersion uint32, OsMinorVersion uint32) (regerrno error) = offreg.ORSaveHive +//sys ORCloseHive(key syscall.Handle) (regerrno error) = offreg.ORCloseHive diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/path.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/path.go index 908920e872..c6a149b552 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/winapi/path.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/path.go @@ -8,4 +8,5 @@ package winapi // LPWSTR lpBuffer, // LPWSTR *lpFilePart // ); +// //sys SearchPath(lpPath *uint16, lpFileName *uint16, lpExtension *uint16, nBufferLength uint32, lpBuffer *uint16, lpFilePath *uint16) (size uint32, err error) = kernel32.SearchPathW diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/process.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/process.go index 222529f433..f4ae94cfa5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/winapi/process.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/process.go @@ -20,22 +20,20 @@ const ProcessVmCounters = 3 // //sys NtQueryInformationProcess(processHandle windows.Handle, processInfoClass uint32, processInfo unsafe.Pointer, processInfoLength uint32, returnLength *uint32) (status uint32) = ntdll.NtQueryInformationProcess -// typedef struct _VM_COUNTERS_EX -// { -// SIZE_T PeakVirtualSize; -// SIZE_T VirtualSize; -// ULONG PageFaultCount; -// SIZE_T PeakWorkingSetSize; -// SIZE_T WorkingSetSize; -// SIZE_T QuotaPeakPagedPoolUsage; -// SIZE_T QuotaPagedPoolUsage; -// SIZE_T QuotaPeakNonPagedPoolUsage; -// SIZE_T QuotaNonPagedPoolUsage; -// SIZE_T PagefileUsage; -// SIZE_T PeakPagefileUsage; -// SIZE_T PrivateUsage; -// } VM_COUNTERS_EX, *PVM_COUNTERS_EX; -// +// typedef struct _VM_COUNTERS_EX { +// SIZE_T PeakVirtualSize; +// SIZE_T VirtualSize; +// ULONG PageFaultCount; +// SIZE_T PeakWorkingSetSize; +// SIZE_T WorkingSetSize; +// SIZE_T QuotaPeakPagedPoolUsage; +// SIZE_T QuotaPagedPoolUsage; +// SIZE_T QuotaPeakNonPagedPoolUsage; +// SIZE_T QuotaNonPagedPoolUsage; +// SIZE_T PagefileUsage; +// SIZE_T PeakPagefileUsage; +// SIZE_T PrivateUsage; +// } VM_COUNTERS_EX, *PVM_COUNTERS_EX; type VM_COUNTERS_EX struct { PeakVirtualSize uintptr VirtualSize uintptr @@ -51,13 +49,11 @@ type VM_COUNTERS_EX struct { PrivateUsage uintptr } -// typedef struct _VM_COUNTERS_EX2 -// { -// VM_COUNTERS_EX CountersEx; -// SIZE_T PrivateWorkingSetSize; -// SIZE_T SharedCommitUsage; -// } VM_COUNTERS_EX2, *PVM_COUNTERS_EX2; -// +// typedef struct _VM_COUNTERS_EX2 { +// VM_COUNTERS_EX CountersEx; +// SIZE_T PrivateWorkingSetSize; +// SIZE_T SharedCommitUsage; +// } VM_COUNTERS_EX2, *PVM_COUNTERS_EX2; type VM_COUNTERS_EX2 struct { CountersEx VM_COUNTERS_EX PrivateWorkingSetSize uintptr diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/system.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/system.go index 78fe01a4b4..cb494aaa65 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/winapi/system.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/system.go @@ -1,3 +1,5 @@ +//go:build windows + package winapi import "golang.org/x/sys/windows" diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/thread.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/thread.go index 4724713e3e..f23141a836 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/winapi/thread.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/thread.go @@ -9,4 +9,5 @@ package winapi // DWORD dwCreationFlags, // LPDWORD lpThreadId // ); +// //sys CreateRemoteThread(process windows.Handle, sa *windows.SecurityAttributes, stackSize uint32, startAddr uintptr, parameter uintptr, creationFlags uint32, threadID *uint32) (handle windows.Handle, err error) = kernel32.CreateRemoteThread diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/user.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/user.go new file mode 100644 index 0000000000..84d4cc294d --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/user.go @@ -0,0 +1,194 @@ +//go:build windows + +package winapi + +import ( + "syscall" + + "golang.org/x/sys/windows" +) + +const UserNameCharLimit = 20 + +const ( + USER_PRIV_GUEST uint32 = iota + USER_PRIV_USER + USER_PRIV_ADMIN +) + +const ( + UF_NORMAL_ACCOUNT = 0x00200 + UF_DONT_EXPIRE_PASSWD = 0x10000 +) + +const NERR_UserNotFound = syscall.Errno(0x8AD) + +// typedef struct _LOCALGROUP_MEMBERS_INFO_0 { +// PSID lgrmi0_sid; +// } LOCALGROUP_MEMBERS_INFO_0, *PLOCALGROUP_MEMBERS_INFO_0, *LPLOCALGROUP_MEMBERS_INFO_0; +type LocalGroupMembersInfo0 struct { + Sid *windows.SID +} + +// typedef struct _LOCALGROUP_INFO_1 { +// LPWSTR lgrpi1_name; +// LPWSTR lgrpi1_comment; +// } LOCALGROUP_INFO_1, *PLOCALGROUP_INFO_1, *LPLOCALGROUP_INFO_1; +type LocalGroupInfo1 struct { + Name *uint16 + Comment *uint16 +} + +// typedef struct _USER_INFO_1 { +// LPWSTR usri1_name; +// LPWSTR usri1_password; +// DWORD usri1_password_age; +// DWORD usri1_priv; +// LPWSTR usri1_home_dir; +// LPWSTR usri1_comment; +// DWORD usri1_flags; +// LPWSTR usri1_script_path; +// } USER_INFO_1, *PUSER_INFO_1, *LPUSER_INFO_1; +type UserInfo1 struct { + Name *uint16 + Password *uint16 + PasswordAge uint32 + Priv uint32 + HomeDir *uint16 + Comment *uint16 + Flags uint32 + ScriptPath *uint16 +} + +// NET_API_STATUS NET_API_FUNCTION NetLocalGroupGetInfo( +// [in] LPCWSTR servername, +// [in] LPCWSTR groupname, +// [in] DWORD level, +// [out] LPBYTE *bufptr +// ); +// +//sys netLocalGroupGetInfo(serverName *uint16, groupName *uint16, level uint32, bufptr **byte) (status error) = netapi32.NetLocalGroupGetInfo + +// NetLocalGroupGetInfo is a slightly go friendlier wrapper around the NetLocalGroupGetInfo function. Instead of taking in *uint16's, it takes in +// go strings and does the conversion internally. +func NetLocalGroupGetInfo(serverName, groupName string, level uint32, bufPtr **byte) (err error) { + var ( + serverNameUTF16 *uint16 + groupNameUTF16 *uint16 + ) + if serverName != "" { + serverNameUTF16, err = windows.UTF16PtrFromString(serverName) + if err != nil { + return err + } + } + if groupName != "" { + groupNameUTF16, err = windows.UTF16PtrFromString(groupName) + if err != nil { + return err + } + } + return netLocalGroupGetInfo( + serverNameUTF16, + groupNameUTF16, + level, + bufPtr, + ) +} + +// NET_API_STATUS NET_API_FUNCTION NetUserAdd( +// [in] LPCWSTR servername, +// [in] DWORD level, +// [in] LPBYTE buf, +// [out] LPDWORD parm_err +// ); +// +//sys netUserAdd(serverName *uint16, level uint32, buf *byte, parm_err *uint32) (status error) = netapi32.NetUserAdd + +// NetUserAdd is a slightly go friendlier wrapper around the NetUserAdd function. Instead of taking in *uint16's, it takes in +// go strings and does the conversion internally. +func NetUserAdd(serverName string, level uint32, buf *byte, parm_err *uint32) (err error) { + var serverNameUTF16 *uint16 + if serverName != "" { + serverNameUTF16, err = windows.UTF16PtrFromString(serverName) + if err != nil { + return err + } + } + return netUserAdd( + serverNameUTF16, + level, + buf, + parm_err, + ) +} + +// NET_API_STATUS NET_API_FUNCTION NetUserDel( +// [in] LPCWSTR servername, +// [in] LPCWSTR username +// ); +// +//sys netUserDel(serverName *uint16, username *uint16) (status error) = netapi32.NetUserDel + +// NetUserDel is a slightly go friendlier wrapper around the NetUserDel function. Instead of taking in *uint16's, it takes in +// go strings and does the conversion internally. +func NetUserDel(serverName, userName string) (err error) { + var ( + serverNameUTF16 *uint16 + userNameUTF16 *uint16 + ) + if serverName != "" { + serverNameUTF16, err = windows.UTF16PtrFromString(serverName) + if err != nil { + return err + } + } + if userName != "" { + userNameUTF16, err = windows.UTF16PtrFromString(userName) + if err != nil { + return err + } + } + return netUserDel( + serverNameUTF16, + userNameUTF16, + ) +} + +// NET_API_STATUS NET_API_FUNCTION NetLocalGroupAddMembers( +// [in] LPCWSTR servername, +// [in] LPCWSTR groupname, +// [in] DWORD level, +// [in] LPBYTE buf, +// [in] DWORD totalentries +// ); +// +//sys netLocalGroupAddMembers(serverName *uint16, groupName *uint16, level uint32, buf *byte, totalEntries uint32) (status error) = netapi32.NetLocalGroupAddMembers + +// NetLocalGroupAddMembers is a slightly go friendlier wrapper around the NetLocalGroupAddMembers function. Instead of taking in *uint16's, it takes in +// go strings and does the conversion internally. +func NetLocalGroupAddMembers(serverName, groupName string, level uint32, buf *byte, totalEntries uint32) (err error) { + var ( + serverNameUTF16 *uint16 + groupNameUTF16 *uint16 + ) + if serverName != "" { + serverNameUTF16, err = windows.UTF16PtrFromString(serverName) + if err != nil { + return err + } + } + if groupName != "" { + groupNameUTF16, err = windows.UTF16PtrFromString(groupName) + if err != nil { + return err + } + } + return netLocalGroupAddMembers( + serverNameUTF16, + groupNameUTF16, + level, + buf, + totalEntries, + ) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/utils.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/utils.go index 859b753c24..a2da570707 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/winapi/utils.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/utils.go @@ -1,3 +1,5 @@ +//go:build windows + package winapi import ( @@ -32,7 +34,7 @@ type UnicodeString struct { // denotes the maximum number of wide chars a path can have. const NTSTRSAFE_UNICODE_STRING_MAX_CCH = 32767 -//String converts a UnicodeString to a golang string +// String converts a UnicodeString to a golang string func (uni UnicodeString) String() string { // UnicodeString is not guaranteed to be null terminated, therefore // use the UnicodeString's Length field diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/winapi.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/winapi.go index d2cc9d9fba..6a90e3a69a 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/winapi/winapi.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/winapi.go @@ -1,5 +1,3 @@ -// Package winapi contains various low-level bindings to Windows APIs. It can -// be thought of as an extension to golang.org/x/sys/windows. package winapi -//go:generate go run ..\..\mksyscall_windows.go -output zsyscall_windows.go user.go console.go system.go net.go path.go thread.go jobobject.go logon.go memory.go process.go processor.go devices.go filesystem.go errors.go +//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -output zsyscall_windows.go ./*.go diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/zsyscall_windows.go index 1f16cf0b8e..c607245eb3 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/winapi/zsyscall_windows.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/zsyscall_windows.go @@ -1,4 +1,6 @@ -// Code generated mksyscall_windows.exe DO NOT EDIT +//go:build windows + +// Code generated by 'go generate' using "github.com/Microsoft/go-winio/tools/mkwinsyscall"; DO NOT EDIT. package winapi @@ -19,6 +21,7 @@ const ( var ( errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) + errERROR_EINVAL error = syscall.EINVAL ) // errnoErr returns common boxed Errno values, to prevent @@ -26,7 +29,7 @@ var ( func errnoErr(e syscall.Errno) error { switch e { case 0: - return nil + return errERROR_EINVAL case errnoERROR_IO_PENDING: return errERROR_IO_PENDING } @@ -37,227 +40,79 @@ func errnoErr(e syscall.Errno) error { } var ( - modkernel32 = windows.NewLazySystemDLL("kernel32.dll") - modntdll = windows.NewLazySystemDLL("ntdll.dll") - modiphlpapi = windows.NewLazySystemDLL("iphlpapi.dll") - modadvapi32 = windows.NewLazySystemDLL("advapi32.dll") - modcfgmgr32 = windows.NewLazySystemDLL("cfgmgr32.dll") + modadvapi32 = windows.NewLazySystemDLL("advapi32.dll") + modbindfltapi = windows.NewLazySystemDLL("bindfltapi.dll") + modcfgmgr32 = windows.NewLazySystemDLL("cfgmgr32.dll") + modiphlpapi = windows.NewLazySystemDLL("iphlpapi.dll") + modkernel32 = windows.NewLazySystemDLL("kernel32.dll") + modnetapi32 = windows.NewLazySystemDLL("netapi32.dll") + modntdll = windows.NewLazySystemDLL("ntdll.dll") + modoffreg = windows.NewLazySystemDLL("offreg.dll") - procCreatePseudoConsole = modkernel32.NewProc("CreatePseudoConsole") - procClosePseudoConsole = modkernel32.NewProc("ClosePseudoConsole") - procResizePseudoConsole = modkernel32.NewProc("ResizePseudoConsole") - procNtQuerySystemInformation = modntdll.NewProc("NtQuerySystemInformation") - procSetJobCompartmentId = modiphlpapi.NewProc("SetJobCompartmentId") - procSearchPathW = modkernel32.NewProc("SearchPathW") - procCreateRemoteThread = modkernel32.NewProc("CreateRemoteThread") - procIsProcessInJob = modkernel32.NewProc("IsProcessInJob") - procQueryInformationJobObject = modkernel32.NewProc("QueryInformationJobObject") - procOpenJobObjectW = modkernel32.NewProc("OpenJobObjectW") - procSetIoRateControlInformationJobObject = modkernel32.NewProc("SetIoRateControlInformationJobObject") - procQueryIoRateControlInformationJobObject = modkernel32.NewProc("QueryIoRateControlInformationJobObject") - procNtOpenJobObject = modntdll.NewProc("NtOpenJobObject") - procNtCreateJobObject = modntdll.NewProc("NtCreateJobObject") procLogonUserW = modadvapi32.NewProc("LogonUserW") + procBfSetupFilter = modbindfltapi.NewProc("BfSetupFilter") + procCM_Get_DevNode_PropertyW = modcfgmgr32.NewProc("CM_Get_DevNode_PropertyW") + procCM_Get_Device_ID_ListA = modcfgmgr32.NewProc("CM_Get_Device_ID_ListA") + procCM_Get_Device_ID_List_SizeA = modcfgmgr32.NewProc("CM_Get_Device_ID_List_SizeA") + procCM_Locate_DevNodeW = modcfgmgr32.NewProc("CM_Locate_DevNodeW") + procSetJobCompartmentId = modiphlpapi.NewProc("SetJobCompartmentId") + procClosePseudoConsole = modkernel32.NewProc("ClosePseudoConsole") + procCopyFileW = modkernel32.NewProc("CopyFileW") + procCreatePseudoConsole = modkernel32.NewProc("CreatePseudoConsole") + procCreateRemoteThread = modkernel32.NewProc("CreateRemoteThread") + procGetActiveProcessorCount = modkernel32.NewProc("GetActiveProcessorCount") + procIsProcessInJob = modkernel32.NewProc("IsProcessInJob") procLocalAlloc = modkernel32.NewProc("LocalAlloc") procLocalFree = modkernel32.NewProc("LocalFree") - procNtQueryInformationProcess = modntdll.NewProc("NtQueryInformationProcess") - procGetActiveProcessorCount = modkernel32.NewProc("GetActiveProcessorCount") - procCM_Get_Device_ID_List_SizeA = modcfgmgr32.NewProc("CM_Get_Device_ID_List_SizeA") - procCM_Get_Device_ID_ListA = modcfgmgr32.NewProc("CM_Get_Device_ID_ListA") - procCM_Locate_DevNodeW = modcfgmgr32.NewProc("CM_Locate_DevNodeW") - procCM_Get_DevNode_PropertyW = modcfgmgr32.NewProc("CM_Get_DevNode_PropertyW") + procOpenJobObjectW = modkernel32.NewProc("OpenJobObjectW") + procQueryInformationJobObject = modkernel32.NewProc("QueryInformationJobObject") + procQueryIoRateControlInformationJobObject = modkernel32.NewProc("QueryIoRateControlInformationJobObject") + procResizePseudoConsole = modkernel32.NewProc("ResizePseudoConsole") + procSearchPathW = modkernel32.NewProc("SearchPathW") + procSetIoRateControlInformationJobObject = modkernel32.NewProc("SetIoRateControlInformationJobObject") + procNetLocalGroupAddMembers = modnetapi32.NewProc("NetLocalGroupAddMembers") + procNetLocalGroupGetInfo = modnetapi32.NewProc("NetLocalGroupGetInfo") + procNetUserAdd = modnetapi32.NewProc("NetUserAdd") + procNetUserDel = modnetapi32.NewProc("NetUserDel") procNtCreateFile = modntdll.NewProc("NtCreateFile") - procNtSetInformationFile = modntdll.NewProc("NtSetInformationFile") + procNtCreateJobObject = modntdll.NewProc("NtCreateJobObject") procNtOpenDirectoryObject = modntdll.NewProc("NtOpenDirectoryObject") + procNtOpenJobObject = modntdll.NewProc("NtOpenJobObject") procNtQueryDirectoryObject = modntdll.NewProc("NtQueryDirectoryObject") + procNtQueryInformationProcess = modntdll.NewProc("NtQueryInformationProcess") + procNtQuerySystemInformation = modntdll.NewProc("NtQuerySystemInformation") + procNtSetInformationFile = modntdll.NewProc("NtSetInformationFile") procRtlNtStatusToDosError = modntdll.NewProc("RtlNtStatusToDosError") + procORCloseHive = modoffreg.NewProc("ORCloseHive") + procORCreateHive = modoffreg.NewProc("ORCreateHive") + procORSaveHive = modoffreg.NewProc("ORSaveHive") ) -func createPseudoConsole(size uint32, hInput windows.Handle, hOutput windows.Handle, dwFlags uint32, hpcon *windows.Handle) (hr error) { - r0, _, _ := syscall.Syscall6(procCreatePseudoConsole.Addr(), 5, uintptr(size), uintptr(hInput), uintptr(hOutput), uintptr(dwFlags), uintptr(unsafe.Pointer(hpcon)), 0) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return -} - -func ClosePseudoConsole(hpc windows.Handle) { - syscall.Syscall(procClosePseudoConsole.Addr(), 1, uintptr(hpc), 0, 0) - return -} - -func resizePseudoConsole(hPc windows.Handle, size uint32) (hr error) { - r0, _, _ := syscall.Syscall(procResizePseudoConsole.Addr(), 2, uintptr(hPc), uintptr(size), 0) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return -} - -func NtQuerySystemInformation(systemInfoClass int, systemInformation unsafe.Pointer, systemInfoLength uint32, returnLength *uint32) (status uint32) { - r0, _, _ := syscall.Syscall6(procNtQuerySystemInformation.Addr(), 4, uintptr(systemInfoClass), uintptr(systemInformation), uintptr(systemInfoLength), uintptr(unsafe.Pointer(returnLength)), 0, 0) - status = uint32(r0) - return -} - -func SetJobCompartmentId(handle windows.Handle, compartmentId uint32) (win32Err error) { - r0, _, _ := syscall.Syscall(procSetJobCompartmentId.Addr(), 2, uintptr(handle), uintptr(compartmentId), 0) - if r0 != 0 { - win32Err = syscall.Errno(r0) - } - return -} - -func SearchPath(lpPath *uint16, lpFileName *uint16, lpExtension *uint16, nBufferLength uint32, lpBuffer *uint16, lpFilePath *uint16) (size uint32, err error) { - r0, _, e1 := syscall.Syscall6(procSearchPathW.Addr(), 6, uintptr(unsafe.Pointer(lpPath)), uintptr(unsafe.Pointer(lpFileName)), uintptr(unsafe.Pointer(lpExtension)), uintptr(nBufferLength), uintptr(unsafe.Pointer(lpBuffer)), uintptr(unsafe.Pointer(lpFilePath))) - size = uint32(r0) - if size == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } - } - return -} - -func CreateRemoteThread(process windows.Handle, sa *windows.SecurityAttributes, stackSize uint32, startAddr uintptr, parameter uintptr, creationFlags uint32, threadID *uint32) (handle windows.Handle, err error) { - r0, _, e1 := syscall.Syscall9(procCreateRemoteThread.Addr(), 7, uintptr(process), uintptr(unsafe.Pointer(sa)), uintptr(stackSize), uintptr(startAddr), uintptr(parameter), uintptr(creationFlags), uintptr(unsafe.Pointer(threadID)), 0, 0) - handle = windows.Handle(r0) - if handle == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } - } - return -} - -func IsProcessInJob(procHandle windows.Handle, jobHandle windows.Handle, result *int32) (err error) { - r1, _, e1 := syscall.Syscall(procIsProcessInJob.Addr(), 3, uintptr(procHandle), uintptr(jobHandle), uintptr(unsafe.Pointer(result))) - if r1 == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } - } - return -} - -func QueryInformationJobObject(jobHandle windows.Handle, infoClass uint32, jobObjectInfo unsafe.Pointer, jobObjectInformationLength uint32, lpReturnLength *uint32) (err error) { - r1, _, e1 := syscall.Syscall6(procQueryInformationJobObject.Addr(), 5, uintptr(jobHandle), uintptr(infoClass), uintptr(jobObjectInfo), uintptr(jobObjectInformationLength), uintptr(unsafe.Pointer(lpReturnLength)), 0) - if r1 == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } - } - return -} - -func OpenJobObject(desiredAccess uint32, inheritHandle bool, lpName *uint16) (handle windows.Handle, err error) { - var _p0 uint32 - if inheritHandle { - _p0 = 1 - } else { - _p0 = 0 - } - r0, _, e1 := syscall.Syscall(procOpenJobObjectW.Addr(), 3, uintptr(desiredAccess), uintptr(_p0), uintptr(unsafe.Pointer(lpName))) - handle = windows.Handle(r0) - if handle == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } - } - return -} - -func SetIoRateControlInformationJobObject(jobHandle windows.Handle, ioRateControlInfo *JOBOBJECT_IO_RATE_CONTROL_INFORMATION) (ret uint32, err error) { - r0, _, e1 := syscall.Syscall(procSetIoRateControlInformationJobObject.Addr(), 2, uintptr(jobHandle), uintptr(unsafe.Pointer(ioRateControlInfo)), 0) - ret = uint32(r0) - if ret == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } - } - return -} - -func QueryIoRateControlInformationJobObject(jobHandle windows.Handle, volumeName *uint16, ioRateControlInfo **JOBOBJECT_IO_RATE_CONTROL_INFORMATION, infoBlockCount *uint32) (ret uint32, err error) { - r0, _, e1 := syscall.Syscall6(procQueryIoRateControlInformationJobObject.Addr(), 4, uintptr(jobHandle), uintptr(unsafe.Pointer(volumeName)), uintptr(unsafe.Pointer(ioRateControlInfo)), uintptr(unsafe.Pointer(infoBlockCount)), 0, 0) - ret = uint32(r0) - if ret == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } - } - return -} - -func NtOpenJobObject(jobHandle *windows.Handle, desiredAccess uint32, objAttributes *ObjectAttributes) (status uint32) { - r0, _, _ := syscall.Syscall(procNtOpenJobObject.Addr(), 3, uintptr(unsafe.Pointer(jobHandle)), uintptr(desiredAccess), uintptr(unsafe.Pointer(objAttributes))) - status = uint32(r0) - return -} - -func NtCreateJobObject(jobHandle *windows.Handle, desiredAccess uint32, objAttributes *ObjectAttributes) (status uint32) { - r0, _, _ := syscall.Syscall(procNtCreateJobObject.Addr(), 3, uintptr(unsafe.Pointer(jobHandle)), uintptr(desiredAccess), uintptr(unsafe.Pointer(objAttributes))) - status = uint32(r0) - return -} - func LogonUser(username *uint16, domain *uint16, password *uint16, logonType uint32, logonProvider uint32, token *windows.Token) (err error) { r1, _, e1 := syscall.Syscall6(procLogonUserW.Addr(), 6, uintptr(unsafe.Pointer(username)), uintptr(unsafe.Pointer(domain)), uintptr(unsafe.Pointer(password)), uintptr(logonType), uintptr(logonProvider), uintptr(unsafe.Pointer(token))) if r1 == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } + err = errnoErr(e1) } return } -func LocalAlloc(flags uint32, size int) (ptr uintptr) { - r0, _, _ := syscall.Syscall(procLocalAlloc.Addr(), 2, uintptr(flags), uintptr(size), 0) - ptr = uintptr(r0) +func BfSetupFilter(jobHandle windows.Handle, flags uint32, virtRootPath *uint16, virtTargetPath *uint16, virtExceptions **uint16, virtExceptionPathCount uint32) (hr error) { + hr = procBfSetupFilter.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procBfSetupFilter.Addr(), 6, uintptr(jobHandle), uintptr(flags), uintptr(unsafe.Pointer(virtRootPath)), uintptr(unsafe.Pointer(virtTargetPath)), uintptr(unsafe.Pointer(virtExceptions)), uintptr(virtExceptionPathCount)) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } return } -func LocalFree(ptr uintptr) { - syscall.Syscall(procLocalFree.Addr(), 1, uintptr(ptr), 0, 0) - return -} - -func NtQueryInformationProcess(processHandle windows.Handle, processInfoClass uint32, processInfo unsafe.Pointer, processInfoLength uint32, returnLength *uint32) (status uint32) { - r0, _, _ := syscall.Syscall6(procNtQueryInformationProcess.Addr(), 5, uintptr(processHandle), uintptr(processInfoClass), uintptr(processInfo), uintptr(processInfoLength), uintptr(unsafe.Pointer(returnLength)), 0) - status = uint32(r0) - return -} - -func GetActiveProcessorCount(groupNumber uint16) (amount uint32) { - r0, _, _ := syscall.Syscall(procGetActiveProcessorCount.Addr(), 1, uintptr(groupNumber), 0, 0) - amount = uint32(r0) - return -} - -func CMGetDeviceIDListSize(pulLen *uint32, pszFilter *byte, uFlags uint32) (hr error) { - r0, _, _ := syscall.Syscall(procCM_Get_Device_ID_List_SizeA.Addr(), 3, uintptr(unsafe.Pointer(pulLen)), uintptr(unsafe.Pointer(pszFilter)), uintptr(uFlags)) +func CMGetDevNodeProperty(dnDevInst uint32, propertyKey *DevPropKey, propertyType *uint32, propertyBuffer *uint16, propertyBufferSize *uint32, uFlags uint32) (hr error) { + r0, _, _ := syscall.Syscall6(procCM_Get_DevNode_PropertyW.Addr(), 6, uintptr(dnDevInst), uintptr(unsafe.Pointer(propertyKey)), uintptr(unsafe.Pointer(propertyType)), uintptr(unsafe.Pointer(propertyBuffer)), uintptr(unsafe.Pointer(propertyBufferSize)), uintptr(uFlags)) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -278,6 +133,17 @@ func CMGetDeviceIDList(pszFilter *byte, buffer *byte, bufferLen uint32, uFlags u return } +func CMGetDeviceIDListSize(pulLen *uint32, pszFilter *byte, uFlags uint32) (hr error) { + r0, _, _ := syscall.Syscall(procCM_Get_Device_ID_List_SizeA.Addr(), 3, uintptr(unsafe.Pointer(pulLen)), uintptr(unsafe.Pointer(pszFilter)), uintptr(uFlags)) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + func CMLocateDevNode(pdnDevInst *uint32, pDeviceID string, uFlags uint32) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(pDeviceID) @@ -298,8 +164,29 @@ func _CMLocateDevNode(pdnDevInst *uint32, pDeviceID *uint16, uFlags uint32) (hr return } -func CMGetDevNodeProperty(dnDevInst uint32, propertyKey *DevPropKey, propertyType *uint32, propertyBuffer *uint16, propertyBufferSize *uint32, uFlags uint32) (hr error) { - r0, _, _ := syscall.Syscall6(procCM_Get_DevNode_PropertyW.Addr(), 6, uintptr(dnDevInst), uintptr(unsafe.Pointer(propertyKey)), uintptr(unsafe.Pointer(propertyType)), uintptr(unsafe.Pointer(propertyBuffer)), uintptr(unsafe.Pointer(propertyBufferSize)), uintptr(uFlags)) +func SetJobCompartmentId(handle windows.Handle, compartmentId uint32) (win32Err error) { + r0, _, _ := syscall.Syscall(procSetJobCompartmentId.Addr(), 2, uintptr(handle), uintptr(compartmentId), 0) + if r0 != 0 { + win32Err = syscall.Errno(r0) + } + return +} + +func ClosePseudoConsole(hpc windows.Handle) { + syscall.Syscall(procClosePseudoConsole.Addr(), 1, uintptr(hpc), 0, 0) + return +} + +func CopyFileW(existingFileName *uint16, newFileName *uint16, failIfExists int32) (err error) { + r1, _, e1 := syscall.Syscall(procCopyFileW.Addr(), 3, uintptr(unsafe.Pointer(existingFileName)), uintptr(unsafe.Pointer(newFileName)), uintptr(failIfExists)) + if r1 == 0 { + err = errnoErr(e1) + } + return +} + +func createPseudoConsole(size uint32, hInput windows.Handle, hOutput windows.Handle, dwFlags uint32, hpcon *windows.Handle) (hr error) { + r0, _, _ := syscall.Syscall6(procCreatePseudoConsole.Addr(), 5, uintptr(size), uintptr(hInput), uintptr(hOutput), uintptr(dwFlags), uintptr(unsafe.Pointer(hpcon)), 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -309,14 +196,135 @@ func CMGetDevNodeProperty(dnDevInst uint32, propertyKey *DevPropKey, propertyTyp return } +func CreateRemoteThread(process windows.Handle, sa *windows.SecurityAttributes, stackSize uint32, startAddr uintptr, parameter uintptr, creationFlags uint32, threadID *uint32) (handle windows.Handle, err error) { + r0, _, e1 := syscall.Syscall9(procCreateRemoteThread.Addr(), 7, uintptr(process), uintptr(unsafe.Pointer(sa)), uintptr(stackSize), uintptr(startAddr), uintptr(parameter), uintptr(creationFlags), uintptr(unsafe.Pointer(threadID)), 0, 0) + handle = windows.Handle(r0) + if handle == 0 { + err = errnoErr(e1) + } + return +} + +func GetActiveProcessorCount(groupNumber uint16) (amount uint32) { + r0, _, _ := syscall.Syscall(procGetActiveProcessorCount.Addr(), 1, uintptr(groupNumber), 0, 0) + amount = uint32(r0) + return +} + +func IsProcessInJob(procHandle windows.Handle, jobHandle windows.Handle, result *int32) (err error) { + r1, _, e1 := syscall.Syscall(procIsProcessInJob.Addr(), 3, uintptr(procHandle), uintptr(jobHandle), uintptr(unsafe.Pointer(result))) + if r1 == 0 { + err = errnoErr(e1) + } + return +} + +func LocalAlloc(flags uint32, size int) (ptr uintptr) { + r0, _, _ := syscall.Syscall(procLocalAlloc.Addr(), 2, uintptr(flags), uintptr(size), 0) + ptr = uintptr(r0) + return +} + +func LocalFree(ptr uintptr) { + syscall.Syscall(procLocalFree.Addr(), 1, uintptr(ptr), 0, 0) + return +} + +func OpenJobObject(desiredAccess uint32, inheritHandle int32, lpName *uint16) (handle windows.Handle, err error) { + r0, _, e1 := syscall.Syscall(procOpenJobObjectW.Addr(), 3, uintptr(desiredAccess), uintptr(inheritHandle), uintptr(unsafe.Pointer(lpName))) + handle = windows.Handle(r0) + if handle == 0 { + err = errnoErr(e1) + } + return +} + +func QueryInformationJobObject(jobHandle windows.Handle, infoClass uint32, jobObjectInfo unsafe.Pointer, jobObjectInformationLength uint32, lpReturnLength *uint32) (err error) { + r1, _, e1 := syscall.Syscall6(procQueryInformationJobObject.Addr(), 5, uintptr(jobHandle), uintptr(infoClass), uintptr(jobObjectInfo), uintptr(jobObjectInformationLength), uintptr(unsafe.Pointer(lpReturnLength)), 0) + if r1 == 0 { + err = errnoErr(e1) + } + return +} + +func QueryIoRateControlInformationJobObject(jobHandle windows.Handle, volumeName *uint16, ioRateControlInfo **JOBOBJECT_IO_RATE_CONTROL_INFORMATION, infoBlockCount *uint32) (ret uint32, err error) { + r0, _, e1 := syscall.Syscall6(procQueryIoRateControlInformationJobObject.Addr(), 4, uintptr(jobHandle), uintptr(unsafe.Pointer(volumeName)), uintptr(unsafe.Pointer(ioRateControlInfo)), uintptr(unsafe.Pointer(infoBlockCount)), 0, 0) + ret = uint32(r0) + if ret == 0 { + err = errnoErr(e1) + } + return +} + +func resizePseudoConsole(hPc windows.Handle, size uint32) (hr error) { + r0, _, _ := syscall.Syscall(procResizePseudoConsole.Addr(), 2, uintptr(hPc), uintptr(size), 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func SearchPath(lpPath *uint16, lpFileName *uint16, lpExtension *uint16, nBufferLength uint32, lpBuffer *uint16, lpFilePath *uint16) (size uint32, err error) { + r0, _, e1 := syscall.Syscall6(procSearchPathW.Addr(), 6, uintptr(unsafe.Pointer(lpPath)), uintptr(unsafe.Pointer(lpFileName)), uintptr(unsafe.Pointer(lpExtension)), uintptr(nBufferLength), uintptr(unsafe.Pointer(lpBuffer)), uintptr(unsafe.Pointer(lpFilePath))) + size = uint32(r0) + if size == 0 { + err = errnoErr(e1) + } + return +} + +func SetIoRateControlInformationJobObject(jobHandle windows.Handle, ioRateControlInfo *JOBOBJECT_IO_RATE_CONTROL_INFORMATION) (ret uint32, err error) { + r0, _, e1 := syscall.Syscall(procSetIoRateControlInformationJobObject.Addr(), 2, uintptr(jobHandle), uintptr(unsafe.Pointer(ioRateControlInfo)), 0) + ret = uint32(r0) + if ret == 0 { + err = errnoErr(e1) + } + return +} + +func netLocalGroupAddMembers(serverName *uint16, groupName *uint16, level uint32, buf *byte, totalEntries uint32) (status error) { + r0, _, _ := syscall.Syscall6(procNetLocalGroupAddMembers.Addr(), 5, uintptr(unsafe.Pointer(serverName)), uintptr(unsafe.Pointer(groupName)), uintptr(level), uintptr(unsafe.Pointer(buf)), uintptr(totalEntries), 0) + if r0 != 0 { + status = syscall.Errno(r0) + } + return +} + +func netLocalGroupGetInfo(serverName *uint16, groupName *uint16, level uint32, bufptr **byte) (status error) { + r0, _, _ := syscall.Syscall6(procNetLocalGroupGetInfo.Addr(), 4, uintptr(unsafe.Pointer(serverName)), uintptr(unsafe.Pointer(groupName)), uintptr(level), uintptr(unsafe.Pointer(bufptr)), 0, 0) + if r0 != 0 { + status = syscall.Errno(r0) + } + return +} + +func netUserAdd(serverName *uint16, level uint32, buf *byte, parm_err *uint32) (status error) { + r0, _, _ := syscall.Syscall6(procNetUserAdd.Addr(), 4, uintptr(unsafe.Pointer(serverName)), uintptr(level), uintptr(unsafe.Pointer(buf)), uintptr(unsafe.Pointer(parm_err)), 0, 0) + if r0 != 0 { + status = syscall.Errno(r0) + } + return +} + +func netUserDel(serverName *uint16, username *uint16) (status error) { + r0, _, _ := syscall.Syscall(procNetUserDel.Addr(), 2, uintptr(unsafe.Pointer(serverName)), uintptr(unsafe.Pointer(username)), 0) + if r0 != 0 { + status = syscall.Errno(r0) + } + return +} + func NtCreateFile(handle *uintptr, accessMask uint32, oa *ObjectAttributes, iosb *IOStatusBlock, allocationSize *uint64, fileAttributes uint32, shareAccess uint32, createDisposition uint32, createOptions uint32, eaBuffer *byte, eaLength uint32) (status uint32) { r0, _, _ := syscall.Syscall12(procNtCreateFile.Addr(), 11, uintptr(unsafe.Pointer(handle)), uintptr(accessMask), uintptr(unsafe.Pointer(oa)), uintptr(unsafe.Pointer(iosb)), uintptr(unsafe.Pointer(allocationSize)), uintptr(fileAttributes), uintptr(shareAccess), uintptr(createDisposition), uintptr(createOptions), uintptr(unsafe.Pointer(eaBuffer)), uintptr(eaLength), 0) status = uint32(r0) return } -func NtSetInformationFile(handle uintptr, iosb *IOStatusBlock, information uintptr, length uint32, class uint32) (status uint32) { - r0, _, _ := syscall.Syscall6(procNtSetInformationFile.Addr(), 5, uintptr(handle), uintptr(unsafe.Pointer(iosb)), uintptr(information), uintptr(length), uintptr(class), 0) +func NtCreateJobObject(jobHandle *windows.Handle, desiredAccess uint32, objAttributes *ObjectAttributes) (status uint32) { + r0, _, _ := syscall.Syscall(procNtCreateJobObject.Addr(), 3, uintptr(unsafe.Pointer(jobHandle)), uintptr(desiredAccess), uintptr(unsafe.Pointer(objAttributes))) status = uint32(r0) return } @@ -327,24 +335,44 @@ func NtOpenDirectoryObject(handle *uintptr, accessMask uint32, oa *ObjectAttribu return } +func NtOpenJobObject(jobHandle *windows.Handle, desiredAccess uint32, objAttributes *ObjectAttributes) (status uint32) { + r0, _, _ := syscall.Syscall(procNtOpenJobObject.Addr(), 3, uintptr(unsafe.Pointer(jobHandle)), uintptr(desiredAccess), uintptr(unsafe.Pointer(objAttributes))) + status = uint32(r0) + return +} + func NtQueryDirectoryObject(handle uintptr, buffer *byte, length uint32, singleEntry bool, restartScan bool, context *uint32, returnLength *uint32) (status uint32) { var _p0 uint32 if singleEntry { _p0 = 1 - } else { - _p0 = 0 } var _p1 uint32 if restartScan { _p1 = 1 - } else { - _p1 = 0 } r0, _, _ := syscall.Syscall9(procNtQueryDirectoryObject.Addr(), 7, uintptr(handle), uintptr(unsafe.Pointer(buffer)), uintptr(length), uintptr(_p0), uintptr(_p1), uintptr(unsafe.Pointer(context)), uintptr(unsafe.Pointer(returnLength)), 0, 0) status = uint32(r0) return } +func NtQueryInformationProcess(processHandle windows.Handle, processInfoClass uint32, processInfo unsafe.Pointer, processInfoLength uint32, returnLength *uint32) (status uint32) { + r0, _, _ := syscall.Syscall6(procNtQueryInformationProcess.Addr(), 5, uintptr(processHandle), uintptr(processInfoClass), uintptr(processInfo), uintptr(processInfoLength), uintptr(unsafe.Pointer(returnLength)), 0) + status = uint32(r0) + return +} + +func NtQuerySystemInformation(systemInfoClass int, systemInformation unsafe.Pointer, systemInfoLength uint32, returnLength *uint32) (status uint32) { + r0, _, _ := syscall.Syscall6(procNtQuerySystemInformation.Addr(), 4, uintptr(systemInfoClass), uintptr(systemInformation), uintptr(systemInfoLength), uintptr(unsafe.Pointer(returnLength)), 0, 0) + status = uint32(r0) + return +} + +func NtSetInformationFile(handle uintptr, iosb *IOStatusBlock, information uintptr, length uint32, class uint32) (status uint32) { + r0, _, _ := syscall.Syscall6(procNtSetInformationFile.Addr(), 5, uintptr(handle), uintptr(unsafe.Pointer(iosb)), uintptr(information), uintptr(length), uintptr(class), 0) + status = uint32(r0) + return +} + func RtlNtStatusToDosError(status uint32) (winerr error) { r0, _, _ := syscall.Syscall(procRtlNtStatusToDosError.Addr(), 1, uintptr(status), 0, 0) if r0 != 0 { @@ -352,3 +380,36 @@ func RtlNtStatusToDosError(status uint32) (winerr error) { } return } + +func ORCloseHive(key syscall.Handle) (regerrno error) { + r0, _, _ := syscall.Syscall(procORCloseHive.Addr(), 1, uintptr(key), 0, 0) + if r0 != 0 { + regerrno = syscall.Errno(r0) + } + return +} + +func ORCreateHive(key *syscall.Handle) (regerrno error) { + r0, _, _ := syscall.Syscall(procORCreateHive.Addr(), 1, uintptr(unsafe.Pointer(key)), 0, 0) + if r0 != 0 { + regerrno = syscall.Errno(r0) + } + return +} + +func ORSaveHive(key syscall.Handle, file string, OsMajorVersion uint32, OsMinorVersion uint32) (regerrno error) { + var _p0 *uint16 + _p0, regerrno = syscall.UTF16PtrFromString(file) + if regerrno != nil { + return + } + return _ORSaveHive(key, _p0, OsMajorVersion, OsMinorVersion) +} + +func _ORSaveHive(key syscall.Handle, file *uint16, OsMajorVersion uint32, OsMinorVersion uint32) (regerrno error) { + r0, _, _ := syscall.Syscall6(procORSaveHive.Addr(), 4, uintptr(key), uintptr(unsafe.Pointer(file)), uintptr(OsMajorVersion), uintptr(OsMinorVersion), 0, 0) + if r0 != 0 { + regerrno = syscall.Errno(r0) + } + return +} diff --git a/vendor/github.com/Microsoft/hcsshim/layer.go b/vendor/github.com/Microsoft/hcsshim/layer.go index 8916163706..afd1ddd0ae 100644 --- a/vendor/github.com/Microsoft/hcsshim/layer.go +++ b/vendor/github.com/Microsoft/hcsshim/layer.go @@ -1,3 +1,5 @@ +//go:build windows + package hcsshim import ( @@ -68,6 +70,9 @@ func ProcessUtilityVMImage(path string) error { func UnprepareLayer(info DriverInfo, layerId string) error { return wclayer.UnprepareLayer(context.Background(), layerPath(&info, layerId)) } +func ConvertToBaseLayer(path string) error { + return wclayer.ConvertToBaseLayer(context.Background(), path) +} type DriverInfo struct { Flavour int diff --git a/vendor/github.com/Microsoft/hcsshim/osversion/osversion_windows.go b/vendor/github.com/Microsoft/hcsshim/osversion/osversion_windows.go index 3ab3bcd89a..6c435d2b64 100644 --- a/vendor/github.com/Microsoft/hcsshim/osversion/osversion_windows.go +++ b/vendor/github.com/Microsoft/hcsshim/osversion/osversion_windows.go @@ -45,6 +45,15 @@ func Build() uint16 { return Get().Build } -func (osv OSVersion) ToString() string { +// String returns the OSVersion formatted as a string. It implements the +// [fmt.Stringer] interface. +func (osv OSVersion) String() string { return fmt.Sprintf("%d.%d.%d", osv.MajorVersion, osv.MinorVersion, osv.Build) } + +// ToString returns the OSVersion formatted as a string. +// +// Deprecated: use [OSVersion.String]. +func (osv OSVersion) ToString() string { + return osv.String() +} diff --git a/vendor/github.com/Microsoft/hcsshim/osversion/windowsbuilds.go b/vendor/github.com/Microsoft/hcsshim/osversion/windowsbuilds.go index 75dce5d821..446369591a 100644 --- a/vendor/github.com/Microsoft/hcsshim/osversion/windowsbuilds.go +++ b/vendor/github.com/Microsoft/hcsshim/osversion/windowsbuilds.go @@ -1,37 +1,63 @@ package osversion +// Windows Client and Server build numbers. +// +// See: +// https://learn.microsoft.com/en-us/windows/release-health/release-information +// https://learn.microsoft.com/en-us/windows/release-health/windows-server-release-info +// https://learn.microsoft.com/en-us/windows/release-health/windows11-release-information const ( // RS1 (version 1607, codename "Redstone 1") corresponds to Windows Server // 2016 (ltsc2016) and Windows 10 (Anniversary Update). RS1 = 14393 + // V1607 (version 1607, codename "Redstone 1") is an alias for [RS1]. + V1607 = RS1 + // LTSC2016 (Windows Server 2016) is an alias for [RS1]. + LTSC2016 = RS1 // RS2 (version 1703, codename "Redstone 2") was a client-only update, and // corresponds to Windows 10 (Creators Update). RS2 = 15063 + // V1703 (version 1703, codename "Redstone 2") is an alias for [RS2]. + V1703 = RS2 // RS3 (version 1709, codename "Redstone 3") corresponds to Windows Server // 1709 (Semi-Annual Channel (SAC)), and Windows 10 (Fall Creators Update). RS3 = 16299 + // V1709 (version 1709, codename "Redstone 3") is an alias for [RS3]. + V1709 = RS3 // RS4 (version 1803, codename "Redstone 4") corresponds to Windows Server // 1803 (Semi-Annual Channel (SAC)), and Windows 10 (April 2018 Update). RS4 = 17134 + // V1803 (version 1803, codename "Redstone 4") is an alias for [RS4]. + V1803 = RS4 // RS5 (version 1809, codename "Redstone 5") corresponds to Windows Server // 2019 (ltsc2019), and Windows 10 (October 2018 Update). RS5 = 17763 + // V1809 (version 1809, codename "Redstone 5") is an alias for [RS5]. + V1809 = RS5 + // LTSC2019 (Windows Server 2019) is an alias for [RS5]. + LTSC2019 = RS5 - // V19H1 (version 1903) corresponds to Windows Server 1903 (semi-annual + // V19H1 (version 1903, codename 19H1) corresponds to Windows Server 1903 (semi-annual // channel). V19H1 = 18362 + // V1903 (version 1903) is an alias for [V19H1]. + V1903 = V19H1 - // V19H2 (version 1909) corresponds to Windows Server 1909 (semi-annual + // V19H2 (version 1909, codename 19H2) corresponds to Windows Server 1909 (semi-annual // channel). V19H2 = 18363 + // V1909 (version 1909) is an alias for [V19H2]. + V1909 = V19H2 - // V20H1 (version 2004) corresponds to Windows Server 2004 (semi-annual + // V20H1 (version 2004, codename 20H1) corresponds to Windows Server 2004 (semi-annual // channel). V20H1 = 19041 + // V2004 (version 2004) is an alias for [V20H1]. + V2004 = V20H1 // V20H2 corresponds to Windows Server 20H2 (semi-annual channel). V20H2 = 19042 @@ -44,7 +70,15 @@ const ( // V21H2Server corresponds to Windows Server 2022 (ltsc2022). V21H2Server = 20348 + // LTSC2022 (Windows Server 2022) is an alias for [V21H2Server] + LTSC2022 = V21H2Server // V21H2Win11 corresponds to Windows 11 (original release). V21H2Win11 = 22000 + + // V22H2Win10 corresponds to Windows 10 (2022 Update). + V22H2Win10 = 19045 + + // V22H2Win11 corresponds to Windows 11 (2022 Update). + V22H2Win11 = 22621 ) diff --git a/vendor/github.com/Microsoft/hcsshim/process.go b/vendor/github.com/Microsoft/hcsshim/process.go index 3362c68335..44df91cde2 100644 --- a/vendor/github.com/Microsoft/hcsshim/process.go +++ b/vendor/github.com/Microsoft/hcsshim/process.go @@ -1,3 +1,5 @@ +//go:build windows + package hcsshim import ( diff --git a/vendor/github.com/Microsoft/hcsshim/tools.go b/vendor/github.com/Microsoft/hcsshim/tools.go new file mode 100644 index 0000000000..3964e2f023 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/tools.go @@ -0,0 +1,5 @@ +//go:build tools + +package hcsshim + +import _ "github.com/Microsoft/go-winio/tools/mkwinsyscall" diff --git a/vendor/github.com/Microsoft/hcsshim/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/zsyscall_windows.go index 8bed848573..9b619b6e62 100644 --- a/vendor/github.com/Microsoft/hcsshim/zsyscall_windows.go +++ b/vendor/github.com/Microsoft/hcsshim/zsyscall_windows.go @@ -1,4 +1,6 @@ -// Code generated mksyscall_windows.exe DO NOT EDIT +//go:build windows + +// Code generated by 'go generate' using "github.com/Microsoft/go-winio/tools/mkwinsyscall"; DO NOT EDIT. package hcsshim @@ -19,6 +21,7 @@ const ( var ( errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) + errERROR_EINVAL error = syscall.EINVAL ) // errnoErr returns common boxed Errno values, to prevent @@ -26,7 +29,7 @@ var ( func errnoErr(e syscall.Errno) error { switch e { case 0: - return nil + return errERROR_EINVAL case errnoERROR_IO_PENDING: return errERROR_IO_PENDING } diff --git a/vendor/github.com/containerd/containerd/log/context.go b/vendor/github.com/containerd/containerd/log/context.go index 0db9562b82..92cfcd91ae 100644 --- a/vendor/github.com/containerd/containerd/log/context.go +++ b/vendor/github.com/containerd/containerd/log/context.go @@ -35,6 +35,9 @@ var ( type ( loggerKey struct{} + + // Fields type to pass to `WithFields`, alias from `logrus`. + Fields = logrus.Fields ) const ( diff --git a/vendor/github.com/containerd/containerd/pkg/userns/userns_unsupported.go b/vendor/github.com/containerd/containerd/pkg/userns/userns_unsupported.go index 4f8d7dd2d5..c67f773d0a 100644 --- a/vendor/github.com/containerd/containerd/pkg/userns/userns_unsupported.go +++ b/vendor/github.com/containerd/containerd/pkg/userns/userns_unsupported.go @@ -1,5 +1,4 @@ //go:build !linux -// +build !linux /* Copyright The containerd Authors. diff --git a/vendor/github.com/containerd/containerd/platforms/cpuinfo.go b/vendor/github.com/containerd/containerd/platforms/cpuinfo.go index 046e0356d1..8c600fc96b 100644 --- a/vendor/github.com/containerd/containerd/platforms/cpuinfo.go +++ b/vendor/github.com/containerd/containerd/platforms/cpuinfo.go @@ -17,14 +17,9 @@ package platforms import ( - "bufio" - "fmt" - "os" "runtime" - "strings" "sync" - "github.com/containerd/containerd/errdefs" "github.com/containerd/containerd/log" ) @@ -37,95 +32,12 @@ var cpuVariantOnce sync.Once func cpuVariant() string { cpuVariantOnce.Do(func() { if isArmArch(runtime.GOARCH) { - cpuVariantValue = getCPUVariant() + var err error + cpuVariantValue, err = getCPUVariant() + if err != nil { + log.L.Errorf("Error getCPUVariant for OS %s: %v", runtime.GOOS, err) + } } }) return cpuVariantValue } - -// For Linux, the kernel has already detected the ABI, ISA and Features. -// So we don't need to access the ARM registers to detect platform information -// by ourselves. We can just parse these information from /proc/cpuinfo -func getCPUInfo(pattern string) (info string, err error) { - if !isLinuxOS(runtime.GOOS) { - return "", fmt.Errorf("getCPUInfo for OS %s: %w", runtime.GOOS, errdefs.ErrNotImplemented) - } - - cpuinfo, err := os.Open("/proc/cpuinfo") - if err != nil { - return "", err - } - defer cpuinfo.Close() - - // Start to Parse the Cpuinfo line by line. For SMP SoC, we parse - // the first core is enough. - scanner := bufio.NewScanner(cpuinfo) - for scanner.Scan() { - newline := scanner.Text() - list := strings.Split(newline, ":") - - if len(list) > 1 && strings.EqualFold(strings.TrimSpace(list[0]), pattern) { - return strings.TrimSpace(list[1]), nil - } - } - - // Check whether the scanner encountered errors - err = scanner.Err() - if err != nil { - return "", err - } - - return "", fmt.Errorf("getCPUInfo for pattern: %s: %w", pattern, errdefs.ErrNotFound) -} - -func getCPUVariant() string { - if runtime.GOOS == "windows" || runtime.GOOS == "darwin" { - // Windows/Darwin only supports v7 for ARM32 and v8 for ARM64 and so we can use - // runtime.GOARCH to determine the variants - var variant string - switch runtime.GOARCH { - case "arm64": - variant = "v8" - case "arm": - variant = "v7" - default: - variant = "unknown" - } - - return variant - } - - variant, err := getCPUInfo("Cpu architecture") - if err != nil { - log.L.WithError(err).Error("failure getting variant") - return "" - } - - // handle edge case for Raspberry Pi ARMv6 devices (which due to a kernel quirk, report "CPU architecture: 7") - // https://www.raspberrypi.org/forums/viewtopic.php?t=12614 - if runtime.GOARCH == "arm" && variant == "7" { - model, err := getCPUInfo("model name") - if err == nil && strings.HasPrefix(strings.ToLower(model), "armv6-compatible") { - variant = "6" - } - } - - switch strings.ToLower(variant) { - case "8", "aarch64": - variant = "v8" - case "7", "7m", "?(12)", "?(13)", "?(14)", "?(15)", "?(16)", "?(17)": - variant = "v7" - case "6", "6tej": - variant = "v6" - case "5", "5t", "5te", "5tej": - variant = "v5" - case "4", "4t": - variant = "v4" - case "3": - variant = "v3" - default: - variant = "unknown" - } - - return variant -} diff --git a/vendor/github.com/containerd/containerd/platforms/cpuinfo_linux.go b/vendor/github.com/containerd/containerd/platforms/cpuinfo_linux.go new file mode 100644 index 0000000000..722d86c357 --- /dev/null +++ b/vendor/github.com/containerd/containerd/platforms/cpuinfo_linux.go @@ -0,0 +1,161 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package platforms + +import ( + "bufio" + "bytes" + "fmt" + "os" + "runtime" + "strings" + + "github.com/containerd/containerd/errdefs" + "golang.org/x/sys/unix" +) + +// getMachineArch retrieves the machine architecture through system call +func getMachineArch() (string, error) { + var uname unix.Utsname + err := unix.Uname(&uname) + if err != nil { + return "", err + } + + arch := string(uname.Machine[:bytes.IndexByte(uname.Machine[:], 0)]) + + return arch, nil +} + +// For Linux, the kernel has already detected the ABI, ISA and Features. +// So we don't need to access the ARM registers to detect platform information +// by ourselves. We can just parse these information from /proc/cpuinfo +func getCPUInfo(pattern string) (info string, err error) { + + cpuinfo, err := os.Open("/proc/cpuinfo") + if err != nil { + return "", err + } + defer cpuinfo.Close() + + // Start to Parse the Cpuinfo line by line. For SMP SoC, we parse + // the first core is enough. + scanner := bufio.NewScanner(cpuinfo) + for scanner.Scan() { + newline := scanner.Text() + list := strings.Split(newline, ":") + + if len(list) > 1 && strings.EqualFold(strings.TrimSpace(list[0]), pattern) { + return strings.TrimSpace(list[1]), nil + } + } + + // Check whether the scanner encountered errors + err = scanner.Err() + if err != nil { + return "", err + } + + return "", fmt.Errorf("getCPUInfo for pattern %s: %w", pattern, errdefs.ErrNotFound) +} + +// getCPUVariantFromArch get CPU variant from arch through a system call +func getCPUVariantFromArch(arch string) (string, error) { + + var variant string + + arch = strings.ToLower(arch) + + if arch == "aarch64" { + variant = "8" + } else if arch[0:4] == "armv" && len(arch) >= 5 { + //Valid arch format is in form of armvXx + switch arch[3:5] { + case "v8": + variant = "8" + case "v7": + variant = "7" + case "v6": + variant = "6" + case "v5": + variant = "5" + case "v4": + variant = "4" + case "v3": + variant = "3" + default: + variant = "unknown" + } + } else { + return "", fmt.Errorf("getCPUVariantFromArch invalid arch: %s, %w", arch, errdefs.ErrInvalidArgument) + } + return variant, nil +} + +// getCPUVariant returns cpu variant for ARM +// We first try reading "Cpu architecture" field from /proc/cpuinfo +// If we can't find it, then fall back using a system call +// This is to cover running ARM in emulated environment on x86 host as this field in /proc/cpuinfo +// was not present. +func getCPUVariant() (string, error) { + + variant, err := getCPUInfo("Cpu architecture") + if err != nil { + if errdefs.IsNotFound(err) { + //Let's try getting CPU variant from machine architecture + arch, err := getMachineArch() + if err != nil { + return "", fmt.Errorf("failure getting machine architecture: %v", err) + } + + variant, err = getCPUVariantFromArch(arch) + if err != nil { + return "", fmt.Errorf("failure getting CPU variant from machine architecture: %v", err) + } + } else { + return "", fmt.Errorf("failure getting CPU variant: %v", err) + } + } + + // handle edge case for Raspberry Pi ARMv6 devices (which due to a kernel quirk, report "CPU architecture: 7") + // https://www.raspberrypi.org/forums/viewtopic.php?t=12614 + if runtime.GOARCH == "arm" && variant == "7" { + model, err := getCPUInfo("model name") + if err == nil && strings.HasPrefix(strings.ToLower(model), "armv6-compatible") { + variant = "6" + } + } + + switch strings.ToLower(variant) { + case "8", "aarch64": + variant = "v8" + case "7", "7m", "?(12)", "?(13)", "?(14)", "?(15)", "?(16)", "?(17)": + variant = "v7" + case "6", "6tej": + variant = "v6" + case "5", "5t", "5te", "5tej": + variant = "v5" + case "4", "4t": + variant = "v4" + case "3": + variant = "v3" + default: + variant = "unknown" + } + + return variant, nil +} diff --git a/vendor/github.com/containerd/containerd/platforms/cpuinfo_other.go b/vendor/github.com/containerd/containerd/platforms/cpuinfo_other.go new file mode 100644 index 0000000000..fa5f19c427 --- /dev/null +++ b/vendor/github.com/containerd/containerd/platforms/cpuinfo_other.go @@ -0,0 +1,59 @@ +//go:build !linux + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package platforms + +import ( + "fmt" + "runtime" + + "github.com/containerd/containerd/errdefs" +) + +func getCPUVariant() (string, error) { + + var variant string + + if runtime.GOOS == "windows" || runtime.GOOS == "darwin" { + // Windows/Darwin only supports v7 for ARM32 and v8 for ARM64 and so we can use + // runtime.GOARCH to determine the variants + switch runtime.GOARCH { + case "arm64": + variant = "v8" + case "arm": + variant = "v7" + default: + variant = "unknown" + } + } else if runtime.GOOS == "freebsd" { + // FreeBSD supports ARMv6 and ARMv7 as well as ARMv4 and ARMv5 (though deprecated) + // detecting those variants is currently unimplemented + switch runtime.GOARCH { + case "arm64": + variant = "v8" + default: + variant = "unknown" + } + + } else { + return "", fmt.Errorf("getCPUVariant for OS %s: %v", runtime.GOOS, errdefs.ErrNotImplemented) + + } + + return variant, nil +} diff --git a/vendor/github.com/containerd/containerd/platforms/database.go b/vendor/github.com/containerd/containerd/platforms/database.go index dbe9957ca9..2e26fd3b4f 100644 --- a/vendor/github.com/containerd/containerd/platforms/database.go +++ b/vendor/github.com/containerd/containerd/platforms/database.go @@ -21,13 +21,6 @@ import ( "strings" ) -// isLinuxOS returns true if the operating system is Linux. -// -// The OS value should be normalized before calling this function. -func isLinuxOS(os string) bool { - return os == "linux" -} - // These function are generated from https://golang.org/src/go/build/syslist.go. // // We use switch statements because they are slightly faster than map lookups diff --git a/vendor/github.com/containerd/containerd/platforms/defaults_darwin.go b/vendor/github.com/containerd/containerd/platforms/defaults_darwin.go index e249fe48d3..72355ca85f 100644 --- a/vendor/github.com/containerd/containerd/platforms/defaults_darwin.go +++ b/vendor/github.com/containerd/containerd/platforms/defaults_darwin.go @@ -1,5 +1,4 @@ //go:build darwin -// +build darwin /* Copyright The containerd Authors. diff --git a/vendor/github.com/containerd/containerd/platforms/defaults_freebsd.go b/vendor/github.com/containerd/containerd/platforms/defaults_freebsd.go new file mode 100644 index 0000000000..d3fe89e076 --- /dev/null +++ b/vendor/github.com/containerd/containerd/platforms/defaults_freebsd.go @@ -0,0 +1,43 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package platforms + +import ( + "runtime" + + specs "github.com/opencontainers/image-spec/specs-go/v1" +) + +// DefaultSpec returns the current platform's default platform specification. +func DefaultSpec() specs.Platform { + return specs.Platform{ + OS: runtime.GOOS, + Architecture: runtime.GOARCH, + // The Variant field will be empty if arch != ARM. + Variant: cpuVariant(), + } +} + +// Default returns the default matcher for the platform. +func Default() MatchComparer { + return Ordered(DefaultSpec(), specs.Platform{ + OS: "linux", + Architecture: runtime.GOARCH, + // The Variant field will be empty if arch != ARM. + Variant: cpuVariant(), + }) +} diff --git a/vendor/github.com/containerd/containerd/platforms/defaults_unix.go b/vendor/github.com/containerd/containerd/platforms/defaults_unix.go index 49690f1b3e..44acc47eb3 100644 --- a/vendor/github.com/containerd/containerd/platforms/defaults_unix.go +++ b/vendor/github.com/containerd/containerd/platforms/defaults_unix.go @@ -1,5 +1,4 @@ -//go:build !windows && !darwin -// +build !windows,!darwin +//go:build !windows && !darwin && !freebsd /* Copyright The containerd Authors. diff --git a/vendor/github.com/containerd/containerd/platforms/defaults_windows.go b/vendor/github.com/containerd/containerd/platforms/defaults_windows.go index ff9771a600..fd5756516c 100644 --- a/vendor/github.com/containerd/containerd/platforms/defaults_windows.go +++ b/vendor/github.com/containerd/containerd/platforms/defaults_windows.go @@ -22,7 +22,6 @@ import ( "strconv" "strings" - imagespec "github.com/opencontainers/image-spec/specs-go/v1" specs "github.com/opencontainers/image-spec/specs-go/v1" "golang.org/x/sys/windows" ) @@ -39,29 +38,31 @@ func DefaultSpec() specs.Platform { } } -type matchComparer struct { - defaults Matcher +type windowsmatcher struct { + specs.Platform osVersionPrefix string + defaultMatcher Matcher } // Match matches platform with the same windows major, minor // and build version. -func (m matchComparer) Match(p specs.Platform) bool { - match := m.defaults.Match(p) +func (m windowsmatcher) Match(p specs.Platform) bool { + match := m.defaultMatcher.Match(p) - if match && p.OS == "windows" { + if match && m.OS == "windows" { if strings.HasPrefix(p.OSVersion, m.osVersionPrefix) { return true } return p.OSVersion == "" } - return false + + return match } // Less sorts matched platforms in front of other platforms. // For matched platforms, it puts platforms with larger revision // number in front. -func (m matchComparer) Less(p1, p2 imagespec.Platform) bool { +func (m windowsmatcher) Less(p1, p2 specs.Platform) bool { m1, m2 := m.Match(p1), m.Match(p2) if m1 && m2 { r1, r2 := revision(p1.OSVersion), revision(p2.OSVersion) @@ -82,14 +83,15 @@ func revision(v string) int { return r } +func prefix(v string) string { + parts := strings.Split(v, ".") + if len(parts) < 4 { + return v + } + return strings.Join(parts[0:3], ".") +} + // Default returns the current platform's default platform specification. func Default() MatchComparer { - major, minor, build := windows.RtlGetNtVersionNumbers() - return matchComparer{ - defaults: Ordered(DefaultSpec(), specs.Platform{ - OS: "linux", - Architecture: runtime.GOARCH, - }), - osVersionPrefix: fmt.Sprintf("%d.%d.%d", major, minor, build), - } + return Only(DefaultSpec()) } diff --git a/vendor/github.com/containerd/containerd/platforms/platforms.go b/vendor/github.com/containerd/containerd/platforms/platforms.go index 2343099418..8dcde7db7c 100644 --- a/vendor/github.com/containerd/containerd/platforms/platforms.go +++ b/vendor/github.com/containerd/containerd/platforms/platforms.go @@ -114,14 +114,18 @@ import ( "strconv" "strings" - "github.com/containerd/containerd/errdefs" specs "github.com/opencontainers/image-spec/specs-go/v1" + + "github.com/containerd/containerd/errdefs" ) var ( specifierRe = regexp.MustCompile(`^[A-Za-z0-9_-]+$`) ) +// Platform is a type alias for convenience, so there is no need to import image-spec package everywhere. +type Platform = specs.Platform + // Matcher matches platforms specifications, provided by an image or runtime. type Matcher interface { Match(platform specs.Platform) bool @@ -136,9 +140,7 @@ type Matcher interface { // // Applications should opt to use `Match` over directly parsing specifiers. func NewMatcher(platform specs.Platform) Matcher { - return &matcher{ - Platform: Normalize(platform), - } + return newDefaultMatcher(platform) } type matcher struct { @@ -257,5 +259,6 @@ func Format(platform specs.Platform) string { func Normalize(platform specs.Platform) specs.Platform { platform.OS = normalizeOS(platform.OS) platform.Architecture, platform.Variant = normalizeArch(platform.Architecture, platform.Variant) + return platform } diff --git a/vendor/github.com/containerd/containerd/platforms/platforms_other.go b/vendor/github.com/containerd/containerd/platforms/platforms_other.go new file mode 100644 index 0000000000..03f4dcd998 --- /dev/null +++ b/vendor/github.com/containerd/containerd/platforms/platforms_other.go @@ -0,0 +1,30 @@ +//go:build !windows + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package platforms + +import ( + specs "github.com/opencontainers/image-spec/specs-go/v1" +) + +// NewMatcher returns the default Matcher for containerd +func newDefaultMatcher(platform specs.Platform) Matcher { + return &matcher{ + Platform: Normalize(platform), + } +} diff --git a/vendor/github.com/containerd/containerd/platforms/platforms_windows.go b/vendor/github.com/containerd/containerd/platforms/platforms_windows.go new file mode 100644 index 0000000000..950e2a2ddb --- /dev/null +++ b/vendor/github.com/containerd/containerd/platforms/platforms_windows.go @@ -0,0 +1,34 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package platforms + +import ( + specs "github.com/opencontainers/image-spec/specs-go/v1" +) + +// NewMatcher returns a Windows matcher that will match on osVersionPrefix if +// the platform is Windows otherwise use the default matcher +func newDefaultMatcher(platform specs.Platform) Matcher { + prefix := prefix(platform.OSVersion) + return windowsmatcher{ + Platform: platform, + osVersionPrefix: prefix, + defaultMatcher: &matcher{ + Platform: Normalize(platform), + }, + } +} diff --git a/vendor/github.com/containers/common/libnetwork/netavark/config.go b/vendor/github.com/containers/common/libnetwork/netavark/config.go index f499829676..c71cc2eb52 100644 --- a/vendor/github.com/containers/common/libnetwork/netavark/config.go +++ b/vendor/github.com/containers/common/libnetwork/netavark/config.go @@ -57,6 +57,17 @@ func (n *netavarkNetwork) NetworkUpdate(name string, options types.NetworkUpdate if err != nil { return err } + // Nameservers must be IP Addresses. + for _, dnsServer := range options.AddDNSServers { + if net.ParseIP(dnsServer) == nil { + return fmt.Errorf("unable to parse ip %s specified in AddDNSServer: %w", dnsServer, types.ErrInvalidArg) + } + } + for _, dnsServer := range options.RemoveDNSServers { + if net.ParseIP(dnsServer) == nil { + return fmt.Errorf("unable to parse ip %s specified in RemoveDNSServer: %w", dnsServer, types.ErrInvalidArg) + } + } networkDNSServersBefore := network.NetworkDNSServers networkDNSServersAfter := []string{} for _, server := range networkDNSServersBefore { diff --git a/vendor/github.com/containers/common/pkg/config/config.go b/vendor/github.com/containers/common/pkg/config/config.go index c857f5d45b..de5de3429a 100644 --- a/vendor/github.com/containers/common/pkg/config/config.go +++ b/vendor/github.com/containers/common/pkg/config/config.go @@ -109,6 +109,10 @@ type ContainersConfig struct { // Default cgroup configuration Cgroups string `toml:"cgroups,omitempty"` + // CgroupConf entries specifies a list of cgroup files to write to and their values. For example + // "memory.high=1073741824" sets the memory.high limit to 1GB. + CgroupConf []string `toml:"cgroup_conf,omitempty"` + // Capabilities to add to all containers. DefaultCapabilities []string `toml:"default_capabilities,omitempty"` @@ -180,6 +184,10 @@ type ContainersConfig struct { // NoHosts tells container engine whether to create its own /etc/hosts NoHosts bool `toml:"no_hosts,omitempty"` + // OOMScoreAdj tunes the host's OOM preferences for containers + // (accepts values from -1000 to 1000). + OOMScoreAdj *int `toml:"oom_score_adj,omitempty"` + // PidsLimit is the number of processes each container is restricted to // by the cgroup process number controller. PidsLimit int64 `toml:"pids_limit,omitempty,omitzero"` diff --git a/vendor/github.com/containers/common/pkg/config/containers.conf b/vendor/github.com/containers/common/pkg/config/containers.conf index 2a08d8d3e0..9a2d243979 100644 --- a/vendor/github.com/containers/common/pkg/config/containers.conf +++ b/vendor/github.com/containers/common/pkg/config/containers.conf @@ -33,6 +33,11 @@ # #base_hosts_file = "" +# List of cgroup_conf entries specifying a list of cgroup files to write to and +# their values. For example `memory.high=1073741824` sets the +# memory.high limit to 1GB. +# cgroup_conf = [] + # Default way to to create a cgroup namespace for the container # Options are: # `private` Create private Cgroup Namespace for the container. @@ -197,6 +202,10 @@ default_sysctls = [ # #no_hosts = false +# Tune the host's OOM preferences for containers +# (accepts values from -1000 to 1000). +#oom_score_adj = 0 + # Default way to to create a PID namespace for the container # Options are: # `private` Create private PID Namespace for the container. diff --git a/vendor/github.com/containers/image/v5/copy/compression.go b/vendor/github.com/containers/image/v5/copy/compression.go index 8960894292..ba2b196b14 100644 --- a/vendor/github.com/containers/image/v5/copy/compression.go +++ b/vendor/github.com/containers/image/v5/copy/compression.go @@ -6,13 +6,32 @@ import ( "io" internalblobinfocache "github.com/containers/image/v5/internal/blobinfocache" + "github.com/containers/image/v5/manifest" "github.com/containers/image/v5/pkg/compression" compressiontypes "github.com/containers/image/v5/pkg/compression/types" "github.com/containers/image/v5/types" + imgspecv1 "github.com/opencontainers/image-spec/specs-go/v1" "github.com/sirupsen/logrus" "golang.org/x/exp/maps" ) +var ( + // defaultCompressionFormat is used if the destination transport requests + // compression, and the user does not explicitly instruct us to use an algorithm. + defaultCompressionFormat = &compression.Gzip + + // compressionBufferSize is the buffer size used to compress a blob + compressionBufferSize = 1048576 + + // expectedCompressionFormats is used to check if a blob with a specified media type is compressed + // using the algorithm that the media type says it should be compressed with + expectedCompressionFormats = map[string]*compressiontypes.Algorithm{ + imgspecv1.MediaTypeImageLayerGzip: &compression.Gzip, + imgspecv1.MediaTypeImageLayerZstd: &compression.Zstd, + manifest.DockerV2Schema2LayerMediaType: &compression.Gzip, + } +) + // bpDetectCompressionStepData contains data that the copy pipeline needs about the ā€œdetect compressionā€ step. type bpDetectCompressionStepData struct { isCompressed bool @@ -110,13 +129,13 @@ func (ic *imageCopier) bpcCompressUncompressed(stream *sourceStream, detected bp if ic.c.dest.DesiredLayerCompression() == types.Compress && !detected.isCompressed { logrus.Debugf("Compressing blob on the fly") var uploadedAlgorithm *compressiontypes.Algorithm - if ic.c.compressionFormat != nil { - uploadedAlgorithm = ic.c.compressionFormat + if ic.compressionFormat != nil { + uploadedAlgorithm = ic.compressionFormat } else { uploadedAlgorithm = defaultCompressionFormat } - reader, annotations := ic.c.compressedStream(stream.reader, *uploadedAlgorithm) + reader, annotations := ic.compressedStream(stream.reader, *uploadedAlgorithm) // Note: reader must be closed on all return paths. stream.reader = reader stream.info = types.BlobInfo{ // FIXME? Should we preserve more data in src.info? @@ -138,7 +157,7 @@ func (ic *imageCopier) bpcCompressUncompressed(stream *sourceStream, detected bp // bpcRecompressCompressed checks if we should be recompressing a compressed input to another format, and returns a *bpCompressionStepData if so. func (ic *imageCopier) bpcRecompressCompressed(stream *sourceStream, detected bpDetectCompressionStepData) (*bpCompressionStepData, error) { if ic.c.dest.DesiredLayerCompression() == types.Compress && detected.isCompressed && - ic.c.compressionFormat != nil && ic.c.compressionFormat.Name() != detected.format.Name() { + ic.compressionFormat != nil && ic.compressionFormat.Name() != detected.format.Name() { // When the blob is compressed, but the desired format is different, it first needs to be decompressed and finally // re-compressed using the desired format. logrus.Debugf("Blob will be converted") @@ -154,7 +173,7 @@ func (ic *imageCopier) bpcRecompressCompressed(stream *sourceStream, detected bp } }() - recompressed, annotations := ic.c.compressedStream(decompressed, *ic.c.compressionFormat) + recompressed, annotations := ic.compressedStream(decompressed, *ic.compressionFormat) // Note: recompressed must be closed on all return paths. stream.reader = recompressed stream.info = types.BlobInfo{ // FIXME? Should we preserve more data in src.info? @@ -164,10 +183,10 @@ func (ic *imageCopier) bpcRecompressCompressed(stream *sourceStream, detected bp succeeded = true return &bpCompressionStepData{ operation: types.PreserveOriginal, - uploadedAlgorithm: ic.c.compressionFormat, + uploadedAlgorithm: ic.compressionFormat, uploadedAnnotations: annotations, srcCompressorName: detected.srcCompressorName, - uploadedCompressorName: ic.c.compressionFormat.Name(), + uploadedCompressorName: ic.compressionFormat.Name(), closers: []io.Closer{decompressed, recompressed}, }, nil } @@ -299,24 +318,24 @@ func doCompression(dest io.Writer, src io.Reader, metadata map[string]string, co } // compressGoroutine reads all input from src and writes its compressed equivalent to dest. -func (c *copier) compressGoroutine(dest *io.PipeWriter, src io.Reader, metadata map[string]string, compressionFormat compressiontypes.Algorithm) { +func (ic *imageCopier) compressGoroutine(dest *io.PipeWriter, src io.Reader, metadata map[string]string, compressionFormat compressiontypes.Algorithm) { err := errors.New("Internal error: unexpected panic in compressGoroutine") defer func() { // Note that this is not the same as {defer dest.CloseWithError(err)}; we need err to be evaluated lazily. _ = dest.CloseWithError(err) // CloseWithError(nil) is equivalent to Close(), always returns nil }() - err = doCompression(dest, src, metadata, compressionFormat, c.compressionLevel) + err = doCompression(dest, src, metadata, compressionFormat, ic.compressionLevel) } // compressedStream returns a stream the input reader compressed using format, and a metadata map. // The caller must close the returned reader. // AFTER the stream is consumed, metadata will be updated with annotations to use on the data. -func (c *copier) compressedStream(reader io.Reader, algorithm compressiontypes.Algorithm) (io.ReadCloser, map[string]string) { +func (ic *imageCopier) compressedStream(reader io.Reader, algorithm compressiontypes.Algorithm) (io.ReadCloser, map[string]string) { pipeReader, pipeWriter := io.Pipe() annotations := map[string]string{} // If this fails while writing data, it will do pipeWriter.CloseWithError(); if it fails otherwise, // e.g. because we have exited and due to pipeReader.Close() above further writing to the pipe has failed, // we don’t care. - go c.compressGoroutine(pipeWriter, reader, annotations, algorithm) // Closes pipeWriter + go ic.compressGoroutine(pipeWriter, reader, annotations, algorithm) // Closes pipeWriter return pipeReader, annotations } diff --git a/vendor/github.com/containers/image/v5/copy/copy.go b/vendor/github.com/containers/image/v5/copy/copy.go index 0770e542d5..bf8f4015b6 100644 --- a/vendor/github.com/containers/image/v5/copy/copy.go +++ b/vendor/github.com/containers/image/v5/copy/copy.go @@ -1,15 +1,11 @@ package copy import ( - "bytes" "context" "errors" "fmt" "io" "os" - "reflect" - "strings" - "sync" "time" "github.com/containers/image/v5/docker/reference" @@ -18,22 +14,16 @@ import ( "github.com/containers/image/v5/internal/imagedestination" "github.com/containers/image/v5/internal/imagesource" internalManifest "github.com/containers/image/v5/internal/manifest" - "github.com/containers/image/v5/internal/pkg/platform" "github.com/containers/image/v5/internal/private" - "github.com/containers/image/v5/internal/set" "github.com/containers/image/v5/manifest" "github.com/containers/image/v5/pkg/blobinfocache" - "github.com/containers/image/v5/pkg/compression" - compressiontypes "github.com/containers/image/v5/pkg/compression/types" "github.com/containers/image/v5/signature" "github.com/containers/image/v5/signature/signer" "github.com/containers/image/v5/transports" "github.com/containers/image/v5/types" encconfig "github.com/containers/ocicrypt/config" digest "github.com/opencontainers/go-digest" - imgspecv1 "github.com/opencontainers/image-spec/specs-go/v1" "github.com/sirupsen/logrus" - "github.com/vbauerster/mpb/v8" "golang.org/x/exp/slices" "golang.org/x/sync/semaphore" "golang.org/x/term" @@ -46,55 +36,8 @@ var ( // maxParallelDownloads is used to limit the maximum number of parallel // downloads. Let's follow Firefox by limiting it to 6. maxParallelDownloads = uint(6) - - // defaultCompressionFormat is used if the destination transport requests - // compression, and the user does not explicitly instruct us to use an algorithm. - defaultCompressionFormat = &compression.Gzip ) -// compressionBufferSize is the buffer size used to compress a blob -var compressionBufferSize = 1048576 - -// expectedCompressionFormats is used to check if a blob with a specified media type is compressed -// using the algorithm that the media type says it should be compressed with -var expectedCompressionFormats = map[string]*compressiontypes.Algorithm{ - imgspecv1.MediaTypeImageLayerGzip: &compression.Gzip, - imgspecv1.MediaTypeImageLayerZstd: &compression.Zstd, - manifest.DockerV2Schema2LayerMediaType: &compression.Gzip, -} - -// copier allows us to keep track of diffID values for blobs, and other -// data shared across one or more images in a possible manifest list. -// The owner must call close() when done. -type copier struct { - dest private.ImageDestination - rawSource private.ImageSource - reportWriter io.Writer - progressOutput io.Writer - progressInterval time.Duration - progress chan types.ProgressProperties - blobInfoCache internalblobinfocache.BlobInfoCache2 - compressionFormat *compressiontypes.Algorithm // Compression algorithm to use, if the user explicitly requested one, or nil. - compressionLevel *int - ociDecryptConfig *encconfig.DecryptConfig - ociEncryptConfig *encconfig.EncryptConfig - concurrentBlobCopiesSemaphore *semaphore.Weighted // Limits the amount of concurrently copied blobs - downloadForeignLayers bool - signers []*signer.Signer // Signers to use to create new signatures for the image - signersToClose []*signer.Signer // Signers that should be closed when this copier is destroyed. -} - -// imageCopier tracks state specific to a single image (possibly an item of a manifest list) -type imageCopier struct { - c *copier - manifestUpdates *types.ManifestUpdateOptions - src *image.SourcedImage - diffIDsAreNeeded bool - cannotModifyManifestReason string // The reason the manifest cannot be modified, or an empty string if it can - canSubstituteBlobs bool - ociEncryptLayers *[]int -} - const ( // CopySystemImage is the default value which, when set in // Options.ImageListSelection, indicates that the caller expects only one @@ -158,8 +101,6 @@ type Options struct { // If OciEncryptConfig is non-nil, it indicates that an image should be encrypted. // The encryption options is derived from the construction of EncryptConfig object. - // Note: During initial encryption process of a layer, the resultant digest is not known - // during creation, so newDigestingReader has to be set with validateDigest = false OciEncryptConfig *encconfig.EncryptConfig // OciEncryptLayers represents the list of layers to encrypt. // If nil, don't encrypt any layers. @@ -187,14 +128,23 @@ type Options struct { DownloadForeignLayers bool } -// validateImageListSelection returns an error if the passed-in value is not one that we recognize as a valid ImageListSelection value -func validateImageListSelection(selection ImageListSelection) error { - switch selection { - case CopySystemImage, CopyAllImages, CopySpecificImages: - return nil - default: - return fmt.Errorf("Invalid value for options.ImageListSelection: %d", selection) - } +// copier allows us to keep track of diffID values for blobs, and other +// data shared across one or more images in a possible manifest list. +// The owner must call close() when done. +type copier struct { + dest private.ImageDestination + rawSource private.ImageSource + reportWriter io.Writer + progressOutput io.Writer + progressInterval time.Duration + progress chan types.ProgressProperties + blobInfoCache internalblobinfocache.BlobInfoCache2 + ociDecryptConfig *encconfig.DecryptConfig + ociEncryptConfig *encconfig.EncryptConfig + concurrentBlobCopiesSemaphore *semaphore.Weighted // Limits the amount of concurrently copied blobs + downloadForeignLayers bool + signers []*signer.Signer // Signers to use to create new signatures for the image + signersToClose []*signer.Signer // Signers that should be closed when this copier is destroyed. } // Image copies image from srcRef to destRef, using policyContext to validate @@ -295,12 +245,6 @@ func Image(ctx context.Context, policyContext *signature.PolicyContext, destRef, } } - if options.DestinationCtx != nil { - // Note that compressionFormat and compressionLevel can be nil. - c.compressionFormat = options.DestinationCtx.CompressionFormat - c.compressionLevel = options.DestinationCtx.CompressionLevel - } - if err := c.setupSigners(options); err != nil { return nil, err } @@ -313,7 +257,7 @@ func Image(ctx context.Context, policyContext *signature.PolicyContext, destRef, if !multiImage { // The simple case: just copy a single image. - if copiedManifest, _, _, err = c.copyOneImage(ctx, policyContext, options, unparsedToplevel, unparsedToplevel, nil); err != nil { + if copiedManifest, _, _, err = c.copySingleImage(ctx, policyContext, options, unparsedToplevel, unparsedToplevel, nil); err != nil { return nil, err } } else if options.ImageListSelection == CopySystemImage { @@ -334,7 +278,7 @@ func Image(ctx context.Context, policyContext *signature.PolicyContext, destRef, logrus.Debugf("Source is a manifest list; copying (only) instance %s for current system", instanceDigest) unparsedInstance := image.UnparsedInstance(rawSource, &instanceDigest) - if copiedManifest, _, _, err = c.copyOneImage(ctx, policyContext, options, unparsedToplevel, unparsedInstance, nil); err != nil { + if copiedManifest, _, _, err = c.copySingleImage(ctx, policyContext, options, unparsedToplevel, unparsedInstance, nil); err != nil { return nil, fmt.Errorf("copying system image from manifest list: %w", err) } } else { /* options.ImageListSelection == CopyAllImages or options.ImageListSelection == CopySpecificImages, */ @@ -361,6 +305,15 @@ func Image(ctx context.Context, policyContext *signature.PolicyContext, destRef, return copiedManifest, nil } +// Printf writes a formatted string to c.reportWriter. +// Note that the method name Printf is not entirely arbitrary: (go tool vet) +// has a built-in list of functions/methods (whatever object they are for) +// which have their format strings checked; for other names we would have +// to pass a parameter to every (go tool vet) invocation. +func (c *copier) Printf(format string, a ...any) { + fmt.Fprintf(c.reportWriter, format, a...) +} + // close tears down state owned by copier. func (c *copier) close() { for i, s := range c.signersToClose { @@ -370,6 +323,16 @@ func (c *copier) close() { } } +// validateImageListSelection returns an error if the passed-in value is not one that we recognize as a valid ImageListSelection value +func validateImageListSelection(selection ImageListSelection) error { + switch selection { + case CopySystemImage, CopyAllImages, CopySpecificImages: + return nil + default: + return fmt.Errorf("Invalid value for options.ImageListSelection: %d", selection) + } +} + // Checks if the destination supports accepting multiple images by checking if it can support // manifest types that are lists of other manifests. func supportsMultipleImages(dest types.ImageDestination) bool { @@ -381,504 +344,6 @@ func supportsMultipleImages(dest types.ImageDestination) bool { return slices.ContainsFunc(mtypes, manifest.MIMETypeIsMultiImage) } -// compareImageDestinationManifestEqual compares the `src` and `dest` image manifests (reading the manifest from the -// (possibly remote) destination). Returning true and the destination's manifest, type and digest if they compare equal. -func compareImageDestinationManifestEqual(ctx context.Context, options *Options, src *image.SourcedImage, targetInstance *digest.Digest, dest types.ImageDestination) (bool, []byte, string, digest.Digest, error) { - srcManifestDigest, err := manifest.Digest(src.ManifestBlob) - if err != nil { - return false, nil, "", "", fmt.Errorf("calculating manifest digest: %w", err) - } - - destImageSource, err := dest.Reference().NewImageSource(ctx, options.DestinationCtx) - if err != nil { - logrus.Debugf("Unable to create destination image %s source: %v", dest.Reference(), err) - return false, nil, "", "", nil - } - - destManifest, destManifestType, err := destImageSource.GetManifest(ctx, targetInstance) - if err != nil { - logrus.Debugf("Unable to get destination image %s/%s manifest: %v", destImageSource, targetInstance, err) - return false, nil, "", "", nil - } - - destManifestDigest, err := manifest.Digest(destManifest) - if err != nil { - return false, nil, "", "", fmt.Errorf("calculating manifest digest: %w", err) - } - - logrus.Debugf("Comparing source and destination manifest digests: %v vs. %v", srcManifestDigest, destManifestDigest) - if srcManifestDigest != destManifestDigest { - return false, nil, "", "", nil - } - - // Destination and source manifests, types and digests should all be equivalent - return true, destManifest, destManifestType, destManifestDigest, nil -} - -// copyMultipleImages copies some or all of an image list's instances, using -// policyContext to validate source image admissibility. -func (c *copier) copyMultipleImages(ctx context.Context, policyContext *signature.PolicyContext, options *Options, unparsedToplevel *image.UnparsedImage) (copiedManifest []byte, retErr error) { - // Parse the list and get a copy of the original value after it's re-encoded. - manifestList, manifestType, err := unparsedToplevel.Manifest(ctx) - if err != nil { - return nil, fmt.Errorf("reading manifest list: %w", err) - } - originalList, err := internalManifest.ListFromBlob(manifestList, manifestType) - if err != nil { - return nil, fmt.Errorf("parsing manifest list %q: %w", string(manifestList), err) - } - updatedList := originalList.CloneInternal() - - sigs, err := c.sourceSignatures(ctx, unparsedToplevel, options, - "Getting image list signatures", - "Checking if image list destination supports signatures") - if err != nil { - return nil, err - } - - // If the destination is a digested reference, make a note of that, determine what digest value we're - // expecting, and check that the source manifest matches it. - destIsDigestedReference := false - if named := c.dest.Reference().DockerReference(); named != nil { - if digested, ok := named.(reference.Digested); ok { - destIsDigestedReference = true - matches, err := manifest.MatchesDigest(manifestList, digested.Digest()) - if err != nil { - return nil, fmt.Errorf("computing digest of source image's manifest: %w", err) - } - if !matches { - return nil, errors.New("Digest of source image's manifest would not match destination reference") - } - } - } - - // Determine if we're allowed to modify the manifest list. - // If we can, set to the empty string. If we can't, set to the reason why. - // Compare, and perhaps keep in sync with, the version in copyOneImage. - cannotModifyManifestListReason := "" - if len(sigs) > 0 { - cannotModifyManifestListReason = "Would invalidate signatures" - } - if destIsDigestedReference { - cannotModifyManifestListReason = "Destination specifies a digest" - } - if options.PreserveDigests { - cannotModifyManifestListReason = "Instructed to preserve digests" - } - - // Determine if we'll need to convert the manifest list to a different format. - forceListMIMEType := options.ForceManifestMIMEType - switch forceListMIMEType { - case manifest.DockerV2Schema1MediaType, manifest.DockerV2Schema1SignedMediaType, manifest.DockerV2Schema2MediaType: - forceListMIMEType = manifest.DockerV2ListMediaType - case imgspecv1.MediaTypeImageManifest: - forceListMIMEType = imgspecv1.MediaTypeImageIndex - } - selectedListType, otherManifestMIMETypeCandidates, err := c.determineListConversion(manifestType, c.dest.SupportedManifestMIMETypes(), forceListMIMEType) - if err != nil { - return nil, fmt.Errorf("determining manifest list type to write to destination: %w", err) - } - if selectedListType != originalList.MIMEType() { - if cannotModifyManifestListReason != "" { - return nil, fmt.Errorf("Manifest list must be converted to type %q to be written to destination, but we cannot modify it: %q", selectedListType, cannotModifyManifestListReason) - } - } - - // Copy each image, or just the ones we want to copy, in turn. - instanceDigests := updatedList.Instances() - imagesToCopy := len(instanceDigests) - if options.ImageListSelection == CopySpecificImages { - imagesToCopy = len(options.Instances) - } - c.Printf("Copying %d of %d images in list\n", imagesToCopy, len(instanceDigests)) - updates := make([]manifest.ListUpdate, len(instanceDigests)) - instancesCopied := 0 - for i, instanceDigest := range instanceDigests { - if options.ImageListSelection == CopySpecificImages && - !slices.Contains(options.Instances, instanceDigest) { - update, err := updatedList.Instance(instanceDigest) - if err != nil { - return nil, err - } - logrus.Debugf("Skipping instance %s (%d/%d)", instanceDigest, i+1, len(instanceDigests)) - // Record the digest/size/type of the manifest that we didn't copy. - updates[i] = update - continue - } - logrus.Debugf("Copying instance %s (%d/%d)", instanceDigest, i+1, len(instanceDigests)) - c.Printf("Copying image %s (%d/%d)\n", instanceDigest, instancesCopied+1, imagesToCopy) - unparsedInstance := image.UnparsedInstance(c.rawSource, &instanceDigest) - updatedManifest, updatedManifestType, updatedManifestDigest, err := c.copyOneImage(ctx, policyContext, options, unparsedToplevel, unparsedInstance, &instanceDigest) - if err != nil { - return nil, fmt.Errorf("copying image %d/%d from manifest list: %w", instancesCopied+1, imagesToCopy, err) - } - instancesCopied++ - // Record the result of a possible conversion here. - update := manifest.ListUpdate{ - Digest: updatedManifestDigest, - Size: int64(len(updatedManifest)), - MediaType: updatedManifestType, - } - updates[i] = update - } - - // Now reset the digest/size/types of the manifests in the list to account for any conversions that we made. - if err = updatedList.UpdateInstances(updates); err != nil { - return nil, fmt.Errorf("updating manifest list: %w", err) - } - - // Iterate through supported list types, preferred format first. - c.Printf("Writing manifest list to image destination\n") - var errs []string - for _, thisListType := range append([]string{selectedListType}, otherManifestMIMETypeCandidates...) { - var attemptedList internalManifest.ListPublic = updatedList - - logrus.Debugf("Trying to use manifest list type %s…", thisListType) - - // Perform the list conversion, if we need one. - if thisListType != updatedList.MIMEType() { - attemptedList, err = updatedList.ConvertToMIMEType(thisListType) - if err != nil { - return nil, fmt.Errorf("converting manifest list to list with MIME type %q: %w", thisListType, err) - } - } - - // Check if the updates or a type conversion meaningfully changed the list of images - // by serializing them both so that we can compare them. - attemptedManifestList, err := attemptedList.Serialize() - if err != nil { - return nil, fmt.Errorf("encoding updated manifest list (%q: %#v): %w", updatedList.MIMEType(), updatedList.Instances(), err) - } - originalManifestList, err := originalList.Serialize() - if err != nil { - return nil, fmt.Errorf("encoding original manifest list for comparison (%q: %#v): %w", originalList.MIMEType(), originalList.Instances(), err) - } - - // If we can't just use the original value, but we have to change it, flag an error. - if !bytes.Equal(attemptedManifestList, originalManifestList) { - if cannotModifyManifestListReason != "" { - return nil, fmt.Errorf("Manifest list must be converted to type %q to be written to destination, but we cannot modify it: %q", thisListType, cannotModifyManifestListReason) - } - logrus.Debugf("Manifest list has been updated") - } else { - // We can just use the original value, so use it instead of the one we just rebuilt, so that we don't change the digest. - attemptedManifestList = manifestList - } - - // Save the manifest list. - err = c.dest.PutManifest(ctx, attemptedManifestList, nil) - if err != nil { - logrus.Debugf("Upload of manifest list type %s failed: %v", thisListType, err) - errs = append(errs, fmt.Sprintf("%s(%v)", thisListType, err)) - continue - } - errs = nil - manifestList = attemptedManifestList - break - } - if errs != nil { - return nil, fmt.Errorf("Uploading manifest list failed, attempted the following formats: %s", strings.Join(errs, ", ")) - } - - // Sign the manifest list. - newSigs, err := c.createSignatures(ctx, manifestList, options.SignIdentity) - if err != nil { - return nil, err - } - sigs = append(sigs, newSigs...) - - c.Printf("Storing list signatures\n") - if err := c.dest.PutSignaturesWithFormat(ctx, sigs, nil); err != nil { - return nil, fmt.Errorf("writing signatures: %w", err) - } - - return manifestList, nil -} - -// copyOneImage copies a single (non-manifest-list) image unparsedImage, using policyContext to validate -// source image admissibility. -func (c *copier) copyOneImage(ctx context.Context, policyContext *signature.PolicyContext, options *Options, unparsedToplevel, unparsedImage *image.UnparsedImage, targetInstance *digest.Digest) (retManifest []byte, retManifestType string, retManifestDigest digest.Digest, retErr error) { - // The caller is handling manifest lists; this could happen only if a manifest list contains a manifest list. - // Make sure we fail cleanly in such cases. - multiImage, err := isMultiImage(ctx, unparsedImage) - if err != nil { - // FIXME FIXME: How to name a reference for the sub-image? - return nil, "", "", fmt.Errorf("determining manifest MIME type for %s: %w", transports.ImageName(unparsedImage.Reference()), err) - } - if multiImage { - return nil, "", "", fmt.Errorf("Unexpectedly received a manifest list instead of a manifest for a single image") - } - - // Please keep this policy check BEFORE reading any other information about the image. - // (The multiImage check above only matches the MIME type, which we have received anyway. - // Actual parsing of anything should be deferred.) - if allowed, err := policyContext.IsRunningImageAllowed(ctx, unparsedImage); !allowed || err != nil { // Be paranoid and fail if either return value indicates so. - return nil, "", "", fmt.Errorf("Source image rejected: %w", err) - } - src, err := image.FromUnparsedImage(ctx, options.SourceCtx, unparsedImage) - if err != nil { - return nil, "", "", fmt.Errorf("initializing image from source %s: %w", transports.ImageName(c.rawSource.Reference()), err) - } - - // If the destination is a digested reference, make a note of that, determine what digest value we're - // expecting, and check that the source manifest matches it. If the source manifest doesn't, but it's - // one item from a manifest list that matches it, accept that as a match. - destIsDigestedReference := false - if named := c.dest.Reference().DockerReference(); named != nil { - if digested, ok := named.(reference.Digested); ok { - destIsDigestedReference = true - matches, err := manifest.MatchesDigest(src.ManifestBlob, digested.Digest()) - if err != nil { - return nil, "", "", fmt.Errorf("computing digest of source image's manifest: %w", err) - } - if !matches { - manifestList, _, err := unparsedToplevel.Manifest(ctx) - if err != nil { - return nil, "", "", fmt.Errorf("reading manifest from source image: %w", err) - } - matches, err = manifest.MatchesDigest(manifestList, digested.Digest()) - if err != nil { - return nil, "", "", fmt.Errorf("computing digest of source image's manifest: %w", err) - } - if !matches { - return nil, "", "", errors.New("Digest of source image's manifest would not match destination reference") - } - } - } - } - - if err := checkImageDestinationForCurrentRuntime(ctx, options.DestinationCtx, src, c.dest); err != nil { - return nil, "", "", err - } - - sigs, err := c.sourceSignatures(ctx, src, options, - "Getting image source signatures", - "Checking if image destination supports signatures") - if err != nil { - return nil, "", "", err - } - - // Determine if we're allowed to modify the manifest. - // If we can, set to the empty string. If we can't, set to the reason why. - // Compare, and perhaps keep in sync with, the version in copyMultipleImages. - cannotModifyManifestReason := "" - if len(sigs) > 0 { - cannotModifyManifestReason = "Would invalidate signatures" - } - if destIsDigestedReference { - cannotModifyManifestReason = "Destination specifies a digest" - } - if options.PreserveDigests { - cannotModifyManifestReason = "Instructed to preserve digests" - } - - ic := imageCopier{ - c: c, - manifestUpdates: &types.ManifestUpdateOptions{InformationOnly: types.ManifestUpdateInformation{Destination: c.dest}}, - src: src, - // diffIDsAreNeeded is computed later - cannotModifyManifestReason: cannotModifyManifestReason, - ociEncryptLayers: options.OciEncryptLayers, - } - // Decide whether we can substitute blobs with semantic equivalents: - // - Don’t do that if we can’t modify the manifest at all - // - Ensure _this_ copy sees exactly the intended data when either processing a signed image or signing it. - // This may be too conservative, but for now, better safe than sorry, _especially_ on the len(c.signers) != 0 path: - // The signature makes the content non-repudiable, so it very much matters that the signature is made over exactly what the user intended. - // We do intend the RecordDigestUncompressedPair calls to only work with reliable data, but at least there’s a risk - // that the compressed version coming from a third party may be designed to attack some other decompressor implementation, - // and we would reuse and sign it. - ic.canSubstituteBlobs = ic.cannotModifyManifestReason == "" && len(c.signers) == 0 - - if err := ic.updateEmbeddedDockerReference(); err != nil { - return nil, "", "", err - } - - destRequiresOciEncryption := (isEncrypted(src) && ic.c.ociDecryptConfig != nil) || options.OciEncryptLayers != nil - - manifestConversionPlan, err := determineManifestConversion(determineManifestConversionInputs{ - srcMIMEType: ic.src.ManifestMIMEType, - destSupportedManifestMIMETypes: ic.c.dest.SupportedManifestMIMETypes(), - forceManifestMIMEType: options.ForceManifestMIMEType, - requiresOCIEncryption: destRequiresOciEncryption, - cannotModifyManifestReason: ic.cannotModifyManifestReason, - }) - if err != nil { - return nil, "", "", err - } - // We set up this part of ic.manifestUpdates quite early, not just around the - // code that calls copyUpdatedConfigAndManifest, so that other parts of the copy code - // (e.g. the UpdatedImageNeedsLayerDiffIDs check just below) can make decisions based - // on the expected destination format. - if manifestConversionPlan.preferredMIMETypeNeedsConversion { - ic.manifestUpdates.ManifestMIMEType = manifestConversionPlan.preferredMIMEType - } - - // If src.UpdatedImageNeedsLayerDiffIDs(ic.manifestUpdates) will be true, it needs to be true by the time we get here. - ic.diffIDsAreNeeded = src.UpdatedImageNeedsLayerDiffIDs(*ic.manifestUpdates) - - // If enabled, fetch and compare the destination's manifest. And as an optimization skip updating the destination iff equal - if options.OptimizeDestinationImageAlreadyExists { - shouldUpdateSigs := len(sigs) > 0 || len(c.signers) != 0 // TODO: Consider allowing signatures updates only and skipping the image's layers/manifest copy if possible - noPendingManifestUpdates := ic.noPendingManifestUpdates() - - logrus.Debugf("Checking if we can skip copying: has signatures=%t, OCI encryption=%t, no manifest updates=%t", shouldUpdateSigs, destRequiresOciEncryption, noPendingManifestUpdates) - if !shouldUpdateSigs && !destRequiresOciEncryption && noPendingManifestUpdates { - isSrcDestManifestEqual, retManifest, retManifestType, retManifestDigest, err := compareImageDestinationManifestEqual(ctx, options, src, targetInstance, c.dest) - if err != nil { - logrus.Warnf("Failed to compare destination image manifest: %v", err) - return nil, "", "", err - } - - if isSrcDestManifestEqual { - c.Printf("Skipping: image already present at destination\n") - return retManifest, retManifestType, retManifestDigest, nil - } - } - } - - if err := ic.copyLayers(ctx); err != nil { - return nil, "", "", err - } - - // With docker/distribution registries we do not know whether the registry accepts schema2 or schema1 only; - // and at least with the OpenShift registry "acceptschema2" option, there is no way to detect the support - // without actually trying to upload something and getting a types.ManifestTypeRejectedError. - // So, try the preferred manifest MIME type with possibly-updated blob digests, media types, and sizes if - // we're altering how they're compressed. If the process succeeds, fine… - manifestBytes, retManifestDigest, err := ic.copyUpdatedConfigAndManifest(ctx, targetInstance) - retManifestType = manifestConversionPlan.preferredMIMEType - if err != nil { - logrus.Debugf("Writing manifest using preferred type %s failed: %v", manifestConversionPlan.preferredMIMEType, err) - // … if it fails, and the failure is either because the manifest is rejected by the registry, or - // because we failed to create a manifest of the specified type because the specific manifest type - // doesn't support the type of compression we're trying to use (e.g. docker v2s2 and zstd), we may - // have other options available that could still succeed. - var manifestTypeRejectedError types.ManifestTypeRejectedError - var manifestLayerCompressionIncompatibilityError manifest.ManifestLayerCompressionIncompatibilityError - isManifestRejected := errors.As(err, &manifestTypeRejectedError) - isCompressionIncompatible := errors.As(err, &manifestLayerCompressionIncompatibilityError) - if (!isManifestRejected && !isCompressionIncompatible) || len(manifestConversionPlan.otherMIMETypeCandidates) == 0 { - // We don’t have other options. - // In principle the code below would handle this as well, but the resulting error message is fairly ugly. - // Don’t bother the user with MIME types if we have no choice. - return nil, "", "", err - } - // If the original MIME type is acceptable, determineManifestConversion always uses it as manifestConversionPlan.preferredMIMEType. - // So if we are here, we will definitely be trying to convert the manifest. - // With ic.cannotModifyManifestReason != "", that would just be a string of repeated failures for the same reason, - // so let’s bail out early and with a better error message. - if ic.cannotModifyManifestReason != "" { - return nil, "", "", fmt.Errorf("writing manifest failed and we cannot try conversions: %q: %w", cannotModifyManifestReason, err) - } - - // errs is a list of errors when trying various manifest types. Also serves as an "upload succeeded" flag when set to nil. - errs := []string{fmt.Sprintf("%s(%v)", manifestConversionPlan.preferredMIMEType, err)} - for _, manifestMIMEType := range manifestConversionPlan.otherMIMETypeCandidates { - logrus.Debugf("Trying to use manifest type %s…", manifestMIMEType) - ic.manifestUpdates.ManifestMIMEType = manifestMIMEType - attemptedManifest, attemptedManifestDigest, err := ic.copyUpdatedConfigAndManifest(ctx, targetInstance) - if err != nil { - logrus.Debugf("Upload of manifest type %s failed: %v", manifestMIMEType, err) - errs = append(errs, fmt.Sprintf("%s(%v)", manifestMIMEType, err)) - continue - } - - // We have successfully uploaded a manifest. - manifestBytes = attemptedManifest - retManifestDigest = attemptedManifestDigest - retManifestType = manifestMIMEType - errs = nil // Mark this as a success so that we don't abort below. - break - } - if errs != nil { - return nil, "", "", fmt.Errorf("Uploading manifest failed, attempted the following formats: %s", strings.Join(errs, ", ")) - } - } - if targetInstance != nil { - targetInstance = &retManifestDigest - } - - newSigs, err := c.createSignatures(ctx, manifestBytes, options.SignIdentity) - if err != nil { - return nil, "", "", err - } - sigs = append(sigs, newSigs...) - - c.Printf("Storing signatures\n") - if err := c.dest.PutSignaturesWithFormat(ctx, sigs, targetInstance); err != nil { - return nil, "", "", fmt.Errorf("writing signatures: %w", err) - } - - return manifestBytes, retManifestType, retManifestDigest, nil -} - -// Printf writes a formatted string to c.reportWriter. -// Note that the method name Printf is not entirely arbitrary: (go tool vet) -// has a built-in list of functions/methods (whatever object they are for) -// which have their format strings checked; for other names we would have -// to pass a parameter to every (go tool vet) invocation. -func (c *copier) Printf(format string, a ...any) { - fmt.Fprintf(c.reportWriter, format, a...) -} - -// checkImageDestinationForCurrentRuntime enforces dest.MustMatchRuntimeOS, if necessary. -func checkImageDestinationForCurrentRuntime(ctx context.Context, sys *types.SystemContext, src types.Image, dest types.ImageDestination) error { - if dest.MustMatchRuntimeOS() { - c, err := src.OCIConfig(ctx) - if err != nil { - return fmt.Errorf("parsing image configuration: %w", err) - } - wantedPlatforms, err := platform.WantedPlatforms(sys) - if err != nil { - return fmt.Errorf("getting current platform information %#v: %w", sys, err) - } - - options := newOrderedSet() - match := false - for _, wantedPlatform := range wantedPlatforms { - // Waiting for https://github.com/opencontainers/image-spec/pull/777 : - // This currently can’t use image.MatchesPlatform because we don’t know what to use - // for image.Variant. - if wantedPlatform.OS == c.OS && wantedPlatform.Architecture == c.Architecture { - match = true - break - } - options.append(fmt.Sprintf("%s+%s", wantedPlatform.OS, wantedPlatform.Architecture)) - } - if !match { - logrus.Infof("Image operating system mismatch: image uses OS %q+architecture %q, expecting one of %q", - c.OS, c.Architecture, strings.Join(options.list, ", ")) - } - } - return nil -} - -// updateEmbeddedDockerReference handles the Docker reference embedded in Docker schema1 manifests. -func (ic *imageCopier) updateEmbeddedDockerReference() error { - if ic.c.dest.IgnoresEmbeddedDockerReference() { - return nil // Destination would prefer us not to update the embedded reference. - } - destRef := ic.c.dest.Reference().DockerReference() - if destRef == nil { - return nil // Destination does not care about Docker references - } - if !ic.src.EmbeddedDockerReferenceConflicts(destRef) { - return nil // No reference embedded in the manifest, or it matches destRef already. - } - - if ic.cannotModifyManifestReason != "" { - return fmt.Errorf("Copying a schema1 image with an embedded Docker reference to %s (Docker reference %s) would change the manifest, which we cannot do: %q", - transports.ImageName(ic.c.dest.Reference()), destRef.String(), ic.cannotModifyManifestReason) - } - ic.manifestUpdates.EmbeddedDockerReference = destRef - return nil -} - -func (ic *imageCopier) noPendingManifestUpdates() bool { - return reflect.DeepEqual(*ic.manifestUpdates, types.ManifestUpdateOptions{InformationOnly: ic.manifestUpdates.InformationOnly}) -} - // isTTY returns true if the io.Writer is a file and a tty. func isTTY(w io.Writer) bool { if f, ok := w.(*os.File); ok { @@ -886,452 +351,3 @@ func isTTY(w io.Writer) bool { } return false } - -// copyLayers copies layers from ic.src/ic.c.rawSource to dest, using and updating ic.manifestUpdates if necessary and ic.cannotModifyManifestReason == "". -func (ic *imageCopier) copyLayers(ctx context.Context) error { - srcInfos := ic.src.LayerInfos() - numLayers := len(srcInfos) - updatedSrcInfos, err := ic.src.LayerInfosForCopy(ctx) - if err != nil { - return err - } - srcInfosUpdated := false - // If we only need to check authorization, no updates required. - if updatedSrcInfos != nil && !reflect.DeepEqual(srcInfos, updatedSrcInfos) { - if ic.cannotModifyManifestReason != "" { - return fmt.Errorf("Copying this image would require changing layer representation, which we cannot do: %q", ic.cannotModifyManifestReason) - } - srcInfos = updatedSrcInfos - srcInfosUpdated = true - } - - type copyLayerData struct { - destInfo types.BlobInfo - diffID digest.Digest - err error - } - - // The manifest is used to extract the information whether a given - // layer is empty. - man, err := manifest.FromBlob(ic.src.ManifestBlob, ic.src.ManifestMIMEType) - if err != nil { - return err - } - manifestLayerInfos := man.LayerInfos() - - // copyGroup is used to determine if all layers are copied - copyGroup := sync.WaitGroup{} - - data := make([]copyLayerData, numLayers) - copyLayerHelper := func(index int, srcLayer types.BlobInfo, toEncrypt bool, pool *mpb.Progress, srcRef reference.Named) { - defer ic.c.concurrentBlobCopiesSemaphore.Release(1) - defer copyGroup.Done() - cld := copyLayerData{} - if !ic.c.downloadForeignLayers && ic.c.dest.AcceptsForeignLayerURLs() && len(srcLayer.URLs) != 0 { - // DiffIDs are, currently, needed only when converting from schema1. - // In which case src.LayerInfos will not have URLs because schema1 - // does not support them. - if ic.diffIDsAreNeeded { - cld.err = errors.New("getting DiffID for foreign layers is unimplemented") - } else { - cld.destInfo = srcLayer - logrus.Debugf("Skipping foreign layer %q copy to %s", cld.destInfo.Digest, ic.c.dest.Reference().Transport().Name()) - } - } else { - cld.destInfo, cld.diffID, cld.err = ic.copyLayer(ctx, srcLayer, toEncrypt, pool, index, srcRef, manifestLayerInfos[index].EmptyLayer) - } - data[index] = cld - } - - // Decide which layers to encrypt - layersToEncrypt := set.New[int]() - var encryptAll bool - if ic.ociEncryptLayers != nil { - encryptAll = len(*ic.ociEncryptLayers) == 0 - totalLayers := len(srcInfos) - for _, l := range *ic.ociEncryptLayers { - // if layer is negative, it is reverse indexed. - layersToEncrypt.Add((totalLayers + l) % totalLayers) - } - - if encryptAll { - for i := 0; i < len(srcInfos); i++ { - layersToEncrypt.Add(i) - } - } - } - - if err := func() error { // A scope for defer - progressPool := ic.c.newProgressPool() - defer progressPool.Wait() - - // Ensure we wait for all layers to be copied. progressPool.Wait() must not be called while any of the copyLayerHelpers interact with the progressPool. - defer copyGroup.Wait() - - for i, srcLayer := range srcInfos { - err = ic.c.concurrentBlobCopiesSemaphore.Acquire(ctx, 1) - if err != nil { - // This can only fail with ctx.Err(), so no need to blame acquiring the semaphore. - return fmt.Errorf("copying layer: %w", err) - } - copyGroup.Add(1) - go copyLayerHelper(i, srcLayer, layersToEncrypt.Contains(i), progressPool, ic.c.rawSource.Reference().DockerReference()) - } - - // A call to copyGroup.Wait() is done at this point by the defer above. - return nil - }(); err != nil { - return err - } - - destInfos := make([]types.BlobInfo, numLayers) - diffIDs := make([]digest.Digest, numLayers) - for i, cld := range data { - if cld.err != nil { - return cld.err - } - destInfos[i] = cld.destInfo - diffIDs[i] = cld.diffID - } - - // WARNING: If you are adding new reasons to change ic.manifestUpdates, also update the - // OptimizeDestinationImageAlreadyExists short-circuit conditions - ic.manifestUpdates.InformationOnly.LayerInfos = destInfos - if ic.diffIDsAreNeeded { - ic.manifestUpdates.InformationOnly.LayerDiffIDs = diffIDs - } - if srcInfosUpdated || layerDigestsDiffer(srcInfos, destInfos) { - ic.manifestUpdates.LayerInfos = destInfos - } - return nil -} - -// layerDigestsDiffer returns true iff the digests in a and b differ (ignoring sizes and possible other fields) -func layerDigestsDiffer(a, b []types.BlobInfo) bool { - return !slices.EqualFunc(a, b, func(a, b types.BlobInfo) bool { - return a.Digest == b.Digest - }) -} - -// copyUpdatedConfigAndManifest updates the image per ic.manifestUpdates, if necessary, -// stores the resulting config and manifest to the destination, and returns the stored manifest -// and its digest. -func (ic *imageCopier) copyUpdatedConfigAndManifest(ctx context.Context, instanceDigest *digest.Digest) ([]byte, digest.Digest, error) { - var pendingImage types.Image = ic.src - if !ic.noPendingManifestUpdates() { - if ic.cannotModifyManifestReason != "" { - return nil, "", fmt.Errorf("Internal error: copy needs an updated manifest but that was known to be forbidden: %q", ic.cannotModifyManifestReason) - } - if !ic.diffIDsAreNeeded && ic.src.UpdatedImageNeedsLayerDiffIDs(*ic.manifestUpdates) { - // We have set ic.diffIDsAreNeeded based on the preferred MIME type returned by determineManifestConversion. - // So, this can only happen if we are trying to upload using one of the other MIME type candidates. - // Because UpdatedImageNeedsLayerDiffIDs is true only when converting from s1 to s2, this case should only arise - // when ic.c.dest.SupportedManifestMIMETypes() includes both s1 and s2, the upload using s1 failed, and we are now trying s2. - // Supposedly s2-only registries do not exist or are extremely rare, so failing with this error message is good enough for now. - // If handling such registries turns out to be necessary, we could compute ic.diffIDsAreNeeded based on the full list of manifest MIME type candidates. - return nil, "", fmt.Errorf("Can not convert image to %s, preparing DiffIDs for this case is not supported", ic.manifestUpdates.ManifestMIMEType) - } - pi, err := ic.src.UpdatedImage(ctx, *ic.manifestUpdates) - if err != nil { - return nil, "", fmt.Errorf("creating an updated image manifest: %w", err) - } - pendingImage = pi - } - man, _, err := pendingImage.Manifest(ctx) - if err != nil { - return nil, "", fmt.Errorf("reading manifest: %w", err) - } - - if err := ic.copyConfig(ctx, pendingImage); err != nil { - return nil, "", err - } - - ic.c.Printf("Writing manifest to image destination\n") - manifestDigest, err := manifest.Digest(man) - if err != nil { - return nil, "", err - } - if instanceDigest != nil { - instanceDigest = &manifestDigest - } - if err := ic.c.dest.PutManifest(ctx, man, instanceDigest); err != nil { - logrus.Debugf("Error %v while writing manifest %q", err, string(man)) - return nil, "", fmt.Errorf("writing manifest: %w", err) - } - return man, manifestDigest, nil -} - -// copyConfig copies config.json, if any, from src to dest. -func (ic *imageCopier) copyConfig(ctx context.Context, src types.Image) error { - srcInfo := src.ConfigInfo() - if srcInfo.Digest != "" { - if err := ic.c.concurrentBlobCopiesSemaphore.Acquire(ctx, 1); err != nil { - // This can only fail with ctx.Err(), so no need to blame acquiring the semaphore. - return fmt.Errorf("copying config: %w", err) - } - defer ic.c.concurrentBlobCopiesSemaphore.Release(1) - - destInfo, err := func() (types.BlobInfo, error) { // A scope for defer - progressPool := ic.c.newProgressPool() - defer progressPool.Wait() - bar := ic.c.createProgressBar(progressPool, false, srcInfo, "config", "done") - defer bar.Abort(false) - ic.c.printCopyInfo("config", srcInfo) - - configBlob, err := src.ConfigBlob(ctx) - if err != nil { - return types.BlobInfo{}, fmt.Errorf("reading config blob %s: %w", srcInfo.Digest, err) - } - - destInfo, err := ic.copyBlobFromStream(ctx, bytes.NewReader(configBlob), srcInfo, nil, true, false, bar, -1, false) - if err != nil { - return types.BlobInfo{}, err - } - - bar.mark100PercentComplete() - return destInfo, nil - }() - if err != nil { - return err - } - if destInfo.Digest != srcInfo.Digest { - return fmt.Errorf("Internal error: copying uncompressed config blob %s changed digest to %s", srcInfo.Digest, destInfo.Digest) - } - } - return nil -} - -// diffIDResult contains both a digest value and an error from diffIDComputationGoroutine. -// We could also send the error through the pipeReader, but this more cleanly separates the copying of the layer and the DiffID computation. -type diffIDResult struct { - digest digest.Digest - err error -} - -// copyLayer copies a layer with srcInfo (with known Digest and Annotations and possibly known Size) in src to dest, perhaps (de/re/)compressing it, -// and returns a complete blobInfo of the copied layer, and a value for LayerDiffIDs if diffIDIsNeeded -// srcRef can be used as an additional hint to the destination during checking whether a layer can be reused but srcRef can be nil. -func (ic *imageCopier) copyLayer(ctx context.Context, srcInfo types.BlobInfo, toEncrypt bool, pool *mpb.Progress, layerIndex int, srcRef reference.Named, emptyLayer bool) (types.BlobInfo, digest.Digest, error) { - // If the srcInfo doesn't contain compression information, try to compute it from the - // MediaType, which was either read from a manifest by way of LayerInfos() or constructed - // by LayerInfosForCopy(), if it was supplied at all. If we succeed in copying the blob, - // the BlobInfo we return will be passed to UpdatedImage() and then to UpdateLayerInfos(), - // which uses the compression information to compute the updated MediaType values. - // (Sadly UpdatedImage() is documented to not update MediaTypes from - // ManifestUpdateOptions.LayerInfos[].MediaType, so we are doing it indirectly.) - // - // This MIME type → compression mapping belongs in manifest-specific code in our manifest - // package (but we should preferably replace/change UpdatedImage instead of productizing - // this workaround). - if srcInfo.CompressionAlgorithm == nil { - switch srcInfo.MediaType { - case manifest.DockerV2Schema2LayerMediaType, imgspecv1.MediaTypeImageLayerGzip: - srcInfo.CompressionAlgorithm = &compression.Gzip - case imgspecv1.MediaTypeImageLayerZstd: - srcInfo.CompressionAlgorithm = &compression.Zstd - } - } - - ic.c.printCopyInfo("blob", srcInfo) - - cachedDiffID := ic.c.blobInfoCache.UncompressedDigest(srcInfo.Digest) // May be "" - diffIDIsNeeded := ic.diffIDsAreNeeded && cachedDiffID == "" - // When encrypting to decrypting, only use the simple code path. We might be able to optimize more - // (e.g. if we know the DiffID of an encrypted compressed layer, it might not be necessary to pull, decrypt and decompress again), - // but it’s not trivially safe to do such things, so until someone takes the effort to make a comprehensive argument, let’s not. - encryptingOrDecrypting := toEncrypt || (isOciEncrypted(srcInfo.MediaType) && ic.c.ociDecryptConfig != nil) - canAvoidProcessingCompleteLayer := !diffIDIsNeeded && !encryptingOrDecrypting - - // Don’t read the layer from the source if we already have the blob, and optimizations are acceptable. - if canAvoidProcessingCompleteLayer { - canChangeLayerCompression := ic.src.CanChangeLayerCompression(srcInfo.MediaType) - logrus.Debugf("Checking if we can reuse blob %s: general substitution = %v, compression for MIME type %q = %v", - srcInfo.Digest, ic.canSubstituteBlobs, srcInfo.MediaType, canChangeLayerCompression) - canSubstitute := ic.canSubstituteBlobs && ic.src.CanChangeLayerCompression(srcInfo.MediaType) - // TODO: at this point we don't know whether or not a blob we end up reusing is compressed using an algorithm - // that is acceptable for use on layers in the manifest that we'll be writing later, so if we end up reusing - // a blob that's compressed with e.g. zstd, but we're only allowed to write a v2s2 manifest, this will cause - // a failure when we eventually try to update the manifest with the digest and MIME type of the reused blob. - // Fixing that will probably require passing more information to TryReusingBlob() than the current version of - // the ImageDestination interface lets us pass in. - reused, blobInfo, err := ic.c.dest.TryReusingBlobWithOptions(ctx, srcInfo, private.TryReusingBlobOptions{ - Cache: ic.c.blobInfoCache, - CanSubstitute: canSubstitute, - EmptyLayer: emptyLayer, - LayerIndex: &layerIndex, - SrcRef: srcRef, - }) - if err != nil { - return types.BlobInfo{}, "", fmt.Errorf("trying to reuse blob %s at destination: %w", srcInfo.Digest, err) - } - if reused { - logrus.Debugf("Skipping blob %s (already present):", srcInfo.Digest) - func() { // A scope for defer - bar := ic.c.createProgressBar(pool, false, types.BlobInfo{Digest: blobInfo.Digest, Size: 0}, "blob", "skipped: already exists") - defer bar.Abort(false) - bar.mark100PercentComplete() - }() - - // Throw an event that the layer has been skipped - if ic.c.progress != nil && ic.c.progressInterval > 0 { - ic.c.progress <- types.ProgressProperties{ - Event: types.ProgressEventSkipped, - Artifact: srcInfo, - } - } - - // If the reused blob has the same digest as the one we asked for, but - // the transport didn't/couldn't supply compression info, fill it in based - // on what we know from the srcInfos we were given. - // If the srcInfos came from LayerInfosForCopy(), then UpdatedImage() will - // call UpdateLayerInfos(), which uses this information to compute the - // MediaType value for the updated layer infos, and it the transport - // didn't pass the information along from its input to its output, then - // it can derive the MediaType incorrectly. - if blobInfo.Digest == srcInfo.Digest && blobInfo.CompressionAlgorithm == nil { - blobInfo.CompressionOperation = srcInfo.CompressionOperation - blobInfo.CompressionAlgorithm = srcInfo.CompressionAlgorithm - } - return blobInfo, cachedDiffID, nil - } - } - - // A partial pull is managed by the destination storage, that decides what portions - // of the source file are not known yet and must be fetched. - // Attempt a partial only when the source allows to retrieve a blob partially and - // the destination has support for it. - if canAvoidProcessingCompleteLayer && ic.c.rawSource.SupportsGetBlobAt() && ic.c.dest.SupportsPutBlobPartial() { - if reused, blobInfo := func() (bool, types.BlobInfo) { // A scope for defer - bar := ic.c.createProgressBar(pool, true, srcInfo, "blob", "done") - hideProgressBar := true - defer func() { // Note that this is not the same as defer bar.Abort(hideProgressBar); we need hideProgressBar to be evaluated lazily. - bar.Abort(hideProgressBar) - }() - - proxy := blobChunkAccessorProxy{ - wrapped: ic.c.rawSource, - bar: bar, - } - info, err := ic.c.dest.PutBlobPartial(ctx, &proxy, srcInfo, ic.c.blobInfoCache) - if err == nil { - if srcInfo.Size != -1 { - bar.SetRefill(srcInfo.Size - bar.Current()) - } - bar.mark100PercentComplete() - hideProgressBar = false - logrus.Debugf("Retrieved partial blob %v", srcInfo.Digest) - return true, info - } - logrus.Debugf("Failed to retrieve partial blob: %v", err) - return false, types.BlobInfo{} - }(); reused { - return blobInfo, cachedDiffID, nil - } - } - - // Fallback: copy the layer, computing the diffID if we need to do so - return func() (types.BlobInfo, digest.Digest, error) { // A scope for defer - bar := ic.c.createProgressBar(pool, false, srcInfo, "blob", "done") - defer bar.Abort(false) - - srcStream, srcBlobSize, err := ic.c.rawSource.GetBlob(ctx, srcInfo, ic.c.blobInfoCache) - if err != nil { - return types.BlobInfo{}, "", fmt.Errorf("reading blob %s: %w", srcInfo.Digest, err) - } - defer srcStream.Close() - - blobInfo, diffIDChan, err := ic.copyLayerFromStream(ctx, srcStream, types.BlobInfo{Digest: srcInfo.Digest, Size: srcBlobSize, MediaType: srcInfo.MediaType, Annotations: srcInfo.Annotations}, diffIDIsNeeded, toEncrypt, bar, layerIndex, emptyLayer) - if err != nil { - return types.BlobInfo{}, "", err - } - - diffID := cachedDiffID - if diffIDIsNeeded { - select { - case <-ctx.Done(): - return types.BlobInfo{}, "", ctx.Err() - case diffIDResult := <-diffIDChan: - if diffIDResult.err != nil { - return types.BlobInfo{}, "", fmt.Errorf("computing layer DiffID: %w", diffIDResult.err) - } - logrus.Debugf("Computed DiffID %s for layer %s", diffIDResult.digest, srcInfo.Digest) - // Don’t record any associations that involve encrypted data. This is a bit crude, - // some blob substitutions (replacing pulls of encrypted data with local reuse of known decryption outcomes) - // might be safe, but it’s not trivially obvious, so let’s be conservative for now. - // This crude approach also means we don’t need to record whether a blob is encrypted - // in the blob info cache (which would probably be necessary for any more complex logic), - // and the simplicity is attractive. - if !encryptingOrDecrypting { - // This is safe because we have just computed diffIDResult.Digest ourselves, and in the process - // we have read all of the input blob, so srcInfo.Digest must have been validated by digestingReader. - ic.c.blobInfoCache.RecordDigestUncompressedPair(srcInfo.Digest, diffIDResult.digest) - } - diffID = diffIDResult.digest - } - } - - bar.mark100PercentComplete() - return blobInfo, diffID, nil - }() -} - -// copyLayerFromStream is an implementation detail of copyLayer; mostly providing a separate ā€œdeferā€ scope. -// it copies a blob with srcInfo (with known Digest and Annotations and possibly known Size) from srcStream to dest, -// perhaps (de/re/)compressing the stream, -// and returns a complete blobInfo of the copied blob and perhaps a <-chan diffIDResult if diffIDIsNeeded, to be read by the caller. -func (ic *imageCopier) copyLayerFromStream(ctx context.Context, srcStream io.Reader, srcInfo types.BlobInfo, - diffIDIsNeeded bool, toEncrypt bool, bar *progressBar, layerIndex int, emptyLayer bool) (types.BlobInfo, <-chan diffIDResult, error) { - var getDiffIDRecorder func(compressiontypes.DecompressorFunc) io.Writer // = nil - var diffIDChan chan diffIDResult - - err := errors.New("Internal error: unexpected panic in copyLayer") // For pipeWriter.CloseWithbelow - if diffIDIsNeeded { - diffIDChan = make(chan diffIDResult, 1) // Buffered, so that sending a value after this or our caller has failed and exited does not block. - pipeReader, pipeWriter := io.Pipe() - defer func() { // Note that this is not the same as {defer pipeWriter.CloseWithError(err)}; we need err to be evaluated lazily. - _ = pipeWriter.CloseWithError(err) // CloseWithError(nil) is equivalent to Close(), always returns nil - }() - - getDiffIDRecorder = func(decompressor compressiontypes.DecompressorFunc) io.Writer { - // If this fails, e.g. because we have exited and due to pipeWriter.CloseWithError() above further - // reading from the pipe has failed, we don’t really care. - // We only read from diffIDChan if the rest of the flow has succeeded, and when we do read from it, - // the return value includes an error indication, which we do check. - // - // If this gets never called, pipeReader will not be used anywhere, but pipeWriter will only be - // closed above, so we are happy enough with both pipeReader and pipeWriter to just get collected by GC. - go diffIDComputationGoroutine(diffIDChan, pipeReader, decompressor) // Closes pipeReader - return pipeWriter - } - } - - blobInfo, err := ic.copyBlobFromStream(ctx, srcStream, srcInfo, getDiffIDRecorder, false, toEncrypt, bar, layerIndex, emptyLayer) // Sets err to nil on success - return blobInfo, diffIDChan, err - // We need the defer … pipeWriter.CloseWithError() to happen HERE so that the caller can block on reading from diffIDChan -} - -// diffIDComputationGoroutine reads all input from layerStream, uncompresses using decompressor if necessary, and sends its digest, and status, if any, to dest. -func diffIDComputationGoroutine(dest chan<- diffIDResult, layerStream io.ReadCloser, decompressor compressiontypes.DecompressorFunc) { - result := diffIDResult{ - digest: "", - err: errors.New("Internal error: unexpected panic in diffIDComputationGoroutine"), - } - defer func() { dest <- result }() - defer layerStream.Close() // We do not care to bother the other end of the pipe with other failures; we send them to dest instead. - - result.digest, result.err = computeDiffID(layerStream, decompressor) -} - -// computeDiffID reads all input from layerStream, uncompresses it using decompressor if necessary, and returns its digest. -func computeDiffID(stream io.Reader, decompressor compressiontypes.DecompressorFunc) (digest.Digest, error) { - if decompressor != nil { - s, err := decompressor(stream) - if err != nil { - return "", err - } - defer s.Close() - stream = s - } - - return digest.Canonical.FromReader(stream) -} diff --git a/vendor/github.com/containers/image/v5/copy/multiple.go b/vendor/github.com/containers/image/v5/copy/multiple.go new file mode 100644 index 0000000000..097a18855e --- /dev/null +++ b/vendor/github.com/containers/image/v5/copy/multiple.go @@ -0,0 +1,198 @@ +package copy + +import ( + "bytes" + "context" + "errors" + "fmt" + "strings" + + "github.com/containers/image/v5/docker/reference" + "github.com/containers/image/v5/internal/image" + internalManifest "github.com/containers/image/v5/internal/manifest" + "github.com/containers/image/v5/manifest" + "github.com/containers/image/v5/signature" + imgspecv1 "github.com/opencontainers/image-spec/specs-go/v1" + "github.com/sirupsen/logrus" + "golang.org/x/exp/slices" +) + +// copyMultipleImages copies some or all of an image list's instances, using +// policyContext to validate source image admissibility. +func (c *copier) copyMultipleImages(ctx context.Context, policyContext *signature.PolicyContext, options *Options, unparsedToplevel *image.UnparsedImage) (copiedManifest []byte, retErr error) { + // Parse the list and get a copy of the original value after it's re-encoded. + manifestList, manifestType, err := unparsedToplevel.Manifest(ctx) + if err != nil { + return nil, fmt.Errorf("reading manifest list: %w", err) + } + originalList, err := internalManifest.ListFromBlob(manifestList, manifestType) + if err != nil { + return nil, fmt.Errorf("parsing manifest list %q: %w", string(manifestList), err) + } + updatedList := originalList.CloneInternal() + + sigs, err := c.sourceSignatures(ctx, unparsedToplevel, options, + "Getting image list signatures", + "Checking if image list destination supports signatures") + if err != nil { + return nil, err + } + + // If the destination is a digested reference, make a note of that, determine what digest value we're + // expecting, and check that the source manifest matches it. + destIsDigestedReference := false + if named := c.dest.Reference().DockerReference(); named != nil { + if digested, ok := named.(reference.Digested); ok { + destIsDigestedReference = true + matches, err := manifest.MatchesDigest(manifestList, digested.Digest()) + if err != nil { + return nil, fmt.Errorf("computing digest of source image's manifest: %w", err) + } + if !matches { + return nil, errors.New("Digest of source image's manifest would not match destination reference") + } + } + } + + // Determine if we're allowed to modify the manifest list. + // If we can, set to the empty string. If we can't, set to the reason why. + // Compare, and perhaps keep in sync with, the version in copySingleImage. + cannotModifyManifestListReason := "" + if len(sigs) > 0 { + cannotModifyManifestListReason = "Would invalidate signatures" + } + if destIsDigestedReference { + cannotModifyManifestListReason = "Destination specifies a digest" + } + if options.PreserveDigests { + cannotModifyManifestListReason = "Instructed to preserve digests" + } + + // Determine if we'll need to convert the manifest list to a different format. + forceListMIMEType := options.ForceManifestMIMEType + switch forceListMIMEType { + case manifest.DockerV2Schema1MediaType, manifest.DockerV2Schema1SignedMediaType, manifest.DockerV2Schema2MediaType: + forceListMIMEType = manifest.DockerV2ListMediaType + case imgspecv1.MediaTypeImageManifest: + forceListMIMEType = imgspecv1.MediaTypeImageIndex + } + selectedListType, otherManifestMIMETypeCandidates, err := c.determineListConversion(manifestType, c.dest.SupportedManifestMIMETypes(), forceListMIMEType) + if err != nil { + return nil, fmt.Errorf("determining manifest list type to write to destination: %w", err) + } + if selectedListType != originalList.MIMEType() { + if cannotModifyManifestListReason != "" { + return nil, fmt.Errorf("Manifest list must be converted to type %q to be written to destination, but we cannot modify it: %q", selectedListType, cannotModifyManifestListReason) + } + } + + // Copy each image, or just the ones we want to copy, in turn. + instanceDigests := updatedList.Instances() + imagesToCopy := len(instanceDigests) + if options.ImageListSelection == CopySpecificImages { + imagesToCopy = len(options.Instances) + } + c.Printf("Copying %d of %d images in list\n", imagesToCopy, len(instanceDigests)) + updates := make([]manifest.ListUpdate, len(instanceDigests)) + instancesCopied := 0 + for i, instanceDigest := range instanceDigests { + if options.ImageListSelection == CopySpecificImages && + !slices.Contains(options.Instances, instanceDigest) { + update, err := updatedList.Instance(instanceDigest) + if err != nil { + return nil, err + } + logrus.Debugf("Skipping instance %s (%d/%d)", instanceDigest, i+1, len(instanceDigests)) + // Record the digest/size/type of the manifest that we didn't copy. + updates[i] = update + continue + } + logrus.Debugf("Copying instance %s (%d/%d)", instanceDigest, i+1, len(instanceDigests)) + c.Printf("Copying image %s (%d/%d)\n", instanceDigest, instancesCopied+1, imagesToCopy) + unparsedInstance := image.UnparsedInstance(c.rawSource, &instanceDigest) + updatedManifest, updatedManifestType, updatedManifestDigest, err := c.copySingleImage(ctx, policyContext, options, unparsedToplevel, unparsedInstance, &instanceDigest) + if err != nil { + return nil, fmt.Errorf("copying image %d/%d from manifest list: %w", instancesCopied+1, imagesToCopy, err) + } + instancesCopied++ + // Record the result of a possible conversion here. + update := manifest.ListUpdate{ + Digest: updatedManifestDigest, + Size: int64(len(updatedManifest)), + MediaType: updatedManifestType, + } + updates[i] = update + } + + // Now reset the digest/size/types of the manifests in the list to account for any conversions that we made. + if err = updatedList.UpdateInstances(updates); err != nil { + return nil, fmt.Errorf("updating manifest list: %w", err) + } + + // Iterate through supported list types, preferred format first. + c.Printf("Writing manifest list to image destination\n") + var errs []string + for _, thisListType := range append([]string{selectedListType}, otherManifestMIMETypeCandidates...) { + var attemptedList internalManifest.ListPublic = updatedList + + logrus.Debugf("Trying to use manifest list type %s…", thisListType) + + // Perform the list conversion, if we need one. + if thisListType != updatedList.MIMEType() { + attemptedList, err = updatedList.ConvertToMIMEType(thisListType) + if err != nil { + return nil, fmt.Errorf("converting manifest list to list with MIME type %q: %w", thisListType, err) + } + } + + // Check if the updates or a type conversion meaningfully changed the list of images + // by serializing them both so that we can compare them. + attemptedManifestList, err := attemptedList.Serialize() + if err != nil { + return nil, fmt.Errorf("encoding updated manifest list (%q: %#v): %w", updatedList.MIMEType(), updatedList.Instances(), err) + } + originalManifestList, err := originalList.Serialize() + if err != nil { + return nil, fmt.Errorf("encoding original manifest list for comparison (%q: %#v): %w", originalList.MIMEType(), originalList.Instances(), err) + } + + // If we can't just use the original value, but we have to change it, flag an error. + if !bytes.Equal(attemptedManifestList, originalManifestList) { + if cannotModifyManifestListReason != "" { + return nil, fmt.Errorf("Manifest list must be converted to type %q to be written to destination, but we cannot modify it: %q", thisListType, cannotModifyManifestListReason) + } + logrus.Debugf("Manifest list has been updated") + } else { + // We can just use the original value, so use it instead of the one we just rebuilt, so that we don't change the digest. + attemptedManifestList = manifestList + } + + // Save the manifest list. + err = c.dest.PutManifest(ctx, attemptedManifestList, nil) + if err != nil { + logrus.Debugf("Upload of manifest list type %s failed: %v", thisListType, err) + errs = append(errs, fmt.Sprintf("%s(%v)", thisListType, err)) + continue + } + errs = nil + manifestList = attemptedManifestList + break + } + if errs != nil { + return nil, fmt.Errorf("Uploading manifest list failed, attempted the following formats: %s", strings.Join(errs, ", ")) + } + + // Sign the manifest list. + newSigs, err := c.createSignatures(ctx, manifestList, options.SignIdentity) + if err != nil { + return nil, err + } + sigs = append(sigs, newSigs...) + + c.Printf("Storing list signatures\n") + if err := c.dest.PutSignaturesWithFormat(ctx, sigs, nil); err != nil { + return nil, fmt.Errorf("writing signatures: %w", err) + } + + return manifestList, nil +} diff --git a/vendor/github.com/containers/image/v5/copy/single.go b/vendor/github.com/containers/image/v5/copy/single.go new file mode 100644 index 0000000000..c7b52ac9e3 --- /dev/null +++ b/vendor/github.com/containers/image/v5/copy/single.go @@ -0,0 +1,804 @@ +package copy + +import ( + "bytes" + "context" + "errors" + "fmt" + "io" + "reflect" + "strings" + "sync" + + "github.com/containers/image/v5/docker/reference" + "github.com/containers/image/v5/internal/image" + "github.com/containers/image/v5/internal/pkg/platform" + "github.com/containers/image/v5/internal/private" + "github.com/containers/image/v5/internal/set" + "github.com/containers/image/v5/manifest" + "github.com/containers/image/v5/pkg/compression" + compressiontypes "github.com/containers/image/v5/pkg/compression/types" + "github.com/containers/image/v5/signature" + "github.com/containers/image/v5/transports" + "github.com/containers/image/v5/types" + digest "github.com/opencontainers/go-digest" + imgspecv1 "github.com/opencontainers/image-spec/specs-go/v1" + "github.com/sirupsen/logrus" + "github.com/vbauerster/mpb/v8" + "golang.org/x/exp/slices" +) + +// imageCopier tracks state specific to a single image (possibly an item of a manifest list) +type imageCopier struct { + c *copier + manifestUpdates *types.ManifestUpdateOptions + src *image.SourcedImage + diffIDsAreNeeded bool + cannotModifyManifestReason string // The reason the manifest cannot be modified, or an empty string if it can + canSubstituteBlobs bool + compressionFormat *compressiontypes.Algorithm // Compression algorithm to use, if the user explicitly requested one, or nil. + compressionLevel *int + ociEncryptLayers *[]int +} + +// copySingleImage copies a single (non-manifest-list) image unparsedImage, using policyContext to validate +// source image admissibility. +func (c *copier) copySingleImage(ctx context.Context, policyContext *signature.PolicyContext, options *Options, unparsedToplevel, unparsedImage *image.UnparsedImage, targetInstance *digest.Digest) (retManifest []byte, retManifestType string, retManifestDigest digest.Digest, retErr error) { + // The caller is handling manifest lists; this could happen only if a manifest list contains a manifest list. + // Make sure we fail cleanly in such cases. + multiImage, err := isMultiImage(ctx, unparsedImage) + if err != nil { + // FIXME FIXME: How to name a reference for the sub-image? + return nil, "", "", fmt.Errorf("determining manifest MIME type for %s: %w", transports.ImageName(unparsedImage.Reference()), err) + } + if multiImage { + return nil, "", "", fmt.Errorf("Unexpectedly received a manifest list instead of a manifest for a single image") + } + + // Please keep this policy check BEFORE reading any other information about the image. + // (The multiImage check above only matches the MIME type, which we have received anyway. + // Actual parsing of anything should be deferred.) + if allowed, err := policyContext.IsRunningImageAllowed(ctx, unparsedImage); !allowed || err != nil { // Be paranoid and fail if either return value indicates so. + return nil, "", "", fmt.Errorf("Source image rejected: %w", err) + } + src, err := image.FromUnparsedImage(ctx, options.SourceCtx, unparsedImage) + if err != nil { + return nil, "", "", fmt.Errorf("initializing image from source %s: %w", transports.ImageName(c.rawSource.Reference()), err) + } + + // If the destination is a digested reference, make a note of that, determine what digest value we're + // expecting, and check that the source manifest matches it. If the source manifest doesn't, but it's + // one item from a manifest list that matches it, accept that as a match. + destIsDigestedReference := false + if named := c.dest.Reference().DockerReference(); named != nil { + if digested, ok := named.(reference.Digested); ok { + destIsDigestedReference = true + matches, err := manifest.MatchesDigest(src.ManifestBlob, digested.Digest()) + if err != nil { + return nil, "", "", fmt.Errorf("computing digest of source image's manifest: %w", err) + } + if !matches { + manifestList, _, err := unparsedToplevel.Manifest(ctx) + if err != nil { + return nil, "", "", fmt.Errorf("reading manifest from source image: %w", err) + } + matches, err = manifest.MatchesDigest(manifestList, digested.Digest()) + if err != nil { + return nil, "", "", fmt.Errorf("computing digest of source image's manifest: %w", err) + } + if !matches { + return nil, "", "", errors.New("Digest of source image's manifest would not match destination reference") + } + } + } + } + + if err := checkImageDestinationForCurrentRuntime(ctx, options.DestinationCtx, src, c.dest); err != nil { + return nil, "", "", err + } + + sigs, err := c.sourceSignatures(ctx, src, options, + "Getting image source signatures", + "Checking if image destination supports signatures") + if err != nil { + return nil, "", "", err + } + + // Determine if we're allowed to modify the manifest. + // If we can, set to the empty string. If we can't, set to the reason why. + // Compare, and perhaps keep in sync with, the version in copyMultipleImages. + cannotModifyManifestReason := "" + if len(sigs) > 0 { + cannotModifyManifestReason = "Would invalidate signatures" + } + if destIsDigestedReference { + cannotModifyManifestReason = "Destination specifies a digest" + } + if options.PreserveDigests { + cannotModifyManifestReason = "Instructed to preserve digests" + } + + ic := imageCopier{ + c: c, + manifestUpdates: &types.ManifestUpdateOptions{InformationOnly: types.ManifestUpdateInformation{Destination: c.dest}}, + src: src, + // diffIDsAreNeeded is computed later + cannotModifyManifestReason: cannotModifyManifestReason, + ociEncryptLayers: options.OciEncryptLayers, + } + if options.DestinationCtx != nil { + // Note that compressionFormat and compressionLevel can be nil. + ic.compressionFormat = options.DestinationCtx.CompressionFormat + ic.compressionLevel = options.DestinationCtx.CompressionLevel + } + // Decide whether we can substitute blobs with semantic equivalents: + // - Don’t do that if we can’t modify the manifest at all + // - Ensure _this_ copy sees exactly the intended data when either processing a signed image or signing it. + // This may be too conservative, but for now, better safe than sorry, _especially_ on the len(c.signers) != 0 path: + // The signature makes the content non-repudiable, so it very much matters that the signature is made over exactly what the user intended. + // We do intend the RecordDigestUncompressedPair calls to only work with reliable data, but at least there’s a risk + // that the compressed version coming from a third party may be designed to attack some other decompressor implementation, + // and we would reuse and sign it. + ic.canSubstituteBlobs = ic.cannotModifyManifestReason == "" && len(c.signers) == 0 + + if err := ic.updateEmbeddedDockerReference(); err != nil { + return nil, "", "", err + } + + destRequiresOciEncryption := (isEncrypted(src) && ic.c.ociDecryptConfig != nil) || options.OciEncryptLayers != nil + + manifestConversionPlan, err := determineManifestConversion(determineManifestConversionInputs{ + srcMIMEType: ic.src.ManifestMIMEType, + destSupportedManifestMIMETypes: ic.c.dest.SupportedManifestMIMETypes(), + forceManifestMIMEType: options.ForceManifestMIMEType, + requiresOCIEncryption: destRequiresOciEncryption, + cannotModifyManifestReason: ic.cannotModifyManifestReason, + }) + if err != nil { + return nil, "", "", err + } + // We set up this part of ic.manifestUpdates quite early, not just around the + // code that calls copyUpdatedConfigAndManifest, so that other parts of the copy code + // (e.g. the UpdatedImageNeedsLayerDiffIDs check just below) can make decisions based + // on the expected destination format. + if manifestConversionPlan.preferredMIMETypeNeedsConversion { + ic.manifestUpdates.ManifestMIMEType = manifestConversionPlan.preferredMIMEType + } + + // If src.UpdatedImageNeedsLayerDiffIDs(ic.manifestUpdates) will be true, it needs to be true by the time we get here. + ic.diffIDsAreNeeded = src.UpdatedImageNeedsLayerDiffIDs(*ic.manifestUpdates) + + // If enabled, fetch and compare the destination's manifest. And as an optimization skip updating the destination iff equal + if options.OptimizeDestinationImageAlreadyExists { + shouldUpdateSigs := len(sigs) > 0 || len(c.signers) != 0 // TODO: Consider allowing signatures updates only and skipping the image's layers/manifest copy if possible + noPendingManifestUpdates := ic.noPendingManifestUpdates() + + logrus.Debugf("Checking if we can skip copying: has signatures=%t, OCI encryption=%t, no manifest updates=%t", shouldUpdateSigs, destRequiresOciEncryption, noPendingManifestUpdates) + if !shouldUpdateSigs && !destRequiresOciEncryption && noPendingManifestUpdates { + isSrcDestManifestEqual, retManifest, retManifestType, retManifestDigest, err := compareImageDestinationManifestEqual(ctx, options, src, targetInstance, c.dest) + if err != nil { + logrus.Warnf("Failed to compare destination image manifest: %v", err) + return nil, "", "", err + } + + if isSrcDestManifestEqual { + c.Printf("Skipping: image already present at destination\n") + return retManifest, retManifestType, retManifestDigest, nil + } + } + } + + if err := ic.copyLayers(ctx); err != nil { + return nil, "", "", err + } + + // With docker/distribution registries we do not know whether the registry accepts schema2 or schema1 only; + // and at least with the OpenShift registry "acceptschema2" option, there is no way to detect the support + // without actually trying to upload something and getting a types.ManifestTypeRejectedError. + // So, try the preferred manifest MIME type with possibly-updated blob digests, media types, and sizes if + // we're altering how they're compressed. If the process succeeds, fine… + manifestBytes, retManifestDigest, err := ic.copyUpdatedConfigAndManifest(ctx, targetInstance) + retManifestType = manifestConversionPlan.preferredMIMEType + if err != nil { + logrus.Debugf("Writing manifest using preferred type %s failed: %v", manifestConversionPlan.preferredMIMEType, err) + // … if it fails, and the failure is either because the manifest is rejected by the registry, or + // because we failed to create a manifest of the specified type because the specific manifest type + // doesn't support the type of compression we're trying to use (e.g. docker v2s2 and zstd), we may + // have other options available that could still succeed. + var manifestTypeRejectedError types.ManifestTypeRejectedError + var manifestLayerCompressionIncompatibilityError manifest.ManifestLayerCompressionIncompatibilityError + isManifestRejected := errors.As(err, &manifestTypeRejectedError) + isCompressionIncompatible := errors.As(err, &manifestLayerCompressionIncompatibilityError) + if (!isManifestRejected && !isCompressionIncompatible) || len(manifestConversionPlan.otherMIMETypeCandidates) == 0 { + // We don’t have other options. + // In principle the code below would handle this as well, but the resulting error message is fairly ugly. + // Don’t bother the user with MIME types if we have no choice. + return nil, "", "", err + } + // If the original MIME type is acceptable, determineManifestConversion always uses it as manifestConversionPlan.preferredMIMEType. + // So if we are here, we will definitely be trying to convert the manifest. + // With ic.cannotModifyManifestReason != "", that would just be a string of repeated failures for the same reason, + // so let’s bail out early and with a better error message. + if ic.cannotModifyManifestReason != "" { + return nil, "", "", fmt.Errorf("writing manifest failed and we cannot try conversions: %q: %w", cannotModifyManifestReason, err) + } + + // errs is a list of errors when trying various manifest types. Also serves as an "upload succeeded" flag when set to nil. + errs := []string{fmt.Sprintf("%s(%v)", manifestConversionPlan.preferredMIMEType, err)} + for _, manifestMIMEType := range manifestConversionPlan.otherMIMETypeCandidates { + logrus.Debugf("Trying to use manifest type %s…", manifestMIMEType) + ic.manifestUpdates.ManifestMIMEType = manifestMIMEType + attemptedManifest, attemptedManifestDigest, err := ic.copyUpdatedConfigAndManifest(ctx, targetInstance) + if err != nil { + logrus.Debugf("Upload of manifest type %s failed: %v", manifestMIMEType, err) + errs = append(errs, fmt.Sprintf("%s(%v)", manifestMIMEType, err)) + continue + } + + // We have successfully uploaded a manifest. + manifestBytes = attemptedManifest + retManifestDigest = attemptedManifestDigest + retManifestType = manifestMIMEType + errs = nil // Mark this as a success so that we don't abort below. + break + } + if errs != nil { + return nil, "", "", fmt.Errorf("Uploading manifest failed, attempted the following formats: %s", strings.Join(errs, ", ")) + } + } + if targetInstance != nil { + targetInstance = &retManifestDigest + } + + newSigs, err := c.createSignatures(ctx, manifestBytes, options.SignIdentity) + if err != nil { + return nil, "", "", err + } + sigs = append(sigs, newSigs...) + + c.Printf("Storing signatures\n") + if err := c.dest.PutSignaturesWithFormat(ctx, sigs, targetInstance); err != nil { + return nil, "", "", fmt.Errorf("writing signatures: %w", err) + } + + return manifestBytes, retManifestType, retManifestDigest, nil +} + +// checkImageDestinationForCurrentRuntime enforces dest.MustMatchRuntimeOS, if necessary. +func checkImageDestinationForCurrentRuntime(ctx context.Context, sys *types.SystemContext, src types.Image, dest types.ImageDestination) error { + if dest.MustMatchRuntimeOS() { + c, err := src.OCIConfig(ctx) + if err != nil { + return fmt.Errorf("parsing image configuration: %w", err) + } + wantedPlatforms, err := platform.WantedPlatforms(sys) + if err != nil { + return fmt.Errorf("getting current platform information %#v: %w", sys, err) + } + + options := newOrderedSet() + match := false + for _, wantedPlatform := range wantedPlatforms { + // Waiting for https://github.com/opencontainers/image-spec/pull/777 : + // This currently can’t use image.MatchesPlatform because we don’t know what to use + // for image.Variant. + if wantedPlatform.OS == c.OS && wantedPlatform.Architecture == c.Architecture { + match = true + break + } + options.append(fmt.Sprintf("%s+%s", wantedPlatform.OS, wantedPlatform.Architecture)) + } + if !match { + logrus.Infof("Image operating system mismatch: image uses OS %q+architecture %q, expecting one of %q", + c.OS, c.Architecture, strings.Join(options.list, ", ")) + } + } + return nil +} + +// updateEmbeddedDockerReference handles the Docker reference embedded in Docker schema1 manifests. +func (ic *imageCopier) updateEmbeddedDockerReference() error { + if ic.c.dest.IgnoresEmbeddedDockerReference() { + return nil // Destination would prefer us not to update the embedded reference. + } + destRef := ic.c.dest.Reference().DockerReference() + if destRef == nil { + return nil // Destination does not care about Docker references + } + if !ic.src.EmbeddedDockerReferenceConflicts(destRef) { + return nil // No reference embedded in the manifest, or it matches destRef already. + } + + if ic.cannotModifyManifestReason != "" { + return fmt.Errorf("Copying a schema1 image with an embedded Docker reference to %s (Docker reference %s) would change the manifest, which we cannot do: %q", + transports.ImageName(ic.c.dest.Reference()), destRef.String(), ic.cannotModifyManifestReason) + } + ic.manifestUpdates.EmbeddedDockerReference = destRef + return nil +} + +func (ic *imageCopier) noPendingManifestUpdates() bool { + return reflect.DeepEqual(*ic.manifestUpdates, types.ManifestUpdateOptions{InformationOnly: ic.manifestUpdates.InformationOnly}) +} + +// compareImageDestinationManifestEqual compares the `src` and `dest` image manifests (reading the manifest from the +// (possibly remote) destination). Returning true and the destination's manifest, type and digest if they compare equal. +func compareImageDestinationManifestEqual(ctx context.Context, options *Options, src *image.SourcedImage, targetInstance *digest.Digest, dest types.ImageDestination) (bool, []byte, string, digest.Digest, error) { + srcManifestDigest, err := manifest.Digest(src.ManifestBlob) + if err != nil { + return false, nil, "", "", fmt.Errorf("calculating manifest digest: %w", err) + } + + destImageSource, err := dest.Reference().NewImageSource(ctx, options.DestinationCtx) + if err != nil { + logrus.Debugf("Unable to create destination image %s source: %v", dest.Reference(), err) + return false, nil, "", "", nil + } + + destManifest, destManifestType, err := destImageSource.GetManifest(ctx, targetInstance) + if err != nil { + logrus.Debugf("Unable to get destination image %s/%s manifest: %v", destImageSource, targetInstance, err) + return false, nil, "", "", nil + } + + destManifestDigest, err := manifest.Digest(destManifest) + if err != nil { + return false, nil, "", "", fmt.Errorf("calculating manifest digest: %w", err) + } + + logrus.Debugf("Comparing source and destination manifest digests: %v vs. %v", srcManifestDigest, destManifestDigest) + if srcManifestDigest != destManifestDigest { + return false, nil, "", "", nil + } + + // Destination and source manifests, types and digests should all be equivalent + return true, destManifest, destManifestType, destManifestDigest, nil +} + +// copyLayers copies layers from ic.src/ic.c.rawSource to dest, using and updating ic.manifestUpdates if necessary and ic.cannotModifyManifestReason == "". +func (ic *imageCopier) copyLayers(ctx context.Context) error { + srcInfos := ic.src.LayerInfos() + numLayers := len(srcInfos) + updatedSrcInfos, err := ic.src.LayerInfosForCopy(ctx) + if err != nil { + return err + } + srcInfosUpdated := false + if updatedSrcInfos != nil && !reflect.DeepEqual(srcInfos, updatedSrcInfos) { + if ic.cannotModifyManifestReason != "" { + return fmt.Errorf("Copying this image would require changing layer representation, which we cannot do: %q", ic.cannotModifyManifestReason) + } + srcInfos = updatedSrcInfos + srcInfosUpdated = true + } + + type copyLayerData struct { + destInfo types.BlobInfo + diffID digest.Digest + err error + } + + // The manifest is used to extract the information whether a given + // layer is empty. + man, err := manifest.FromBlob(ic.src.ManifestBlob, ic.src.ManifestMIMEType) + if err != nil { + return err + } + manifestLayerInfos := man.LayerInfos() + + // copyGroup is used to determine if all layers are copied + copyGroup := sync.WaitGroup{} + + data := make([]copyLayerData, numLayers) + copyLayerHelper := func(index int, srcLayer types.BlobInfo, toEncrypt bool, pool *mpb.Progress, srcRef reference.Named) { + defer ic.c.concurrentBlobCopiesSemaphore.Release(1) + defer copyGroup.Done() + cld := copyLayerData{} + if !ic.c.downloadForeignLayers && ic.c.dest.AcceptsForeignLayerURLs() && len(srcLayer.URLs) != 0 { + // DiffIDs are, currently, needed only when converting from schema1. + // In which case src.LayerInfos will not have URLs because schema1 + // does not support them. + if ic.diffIDsAreNeeded { + cld.err = errors.New("getting DiffID for foreign layers is unimplemented") + } else { + cld.destInfo = srcLayer + logrus.Debugf("Skipping foreign layer %q copy to %s", cld.destInfo.Digest, ic.c.dest.Reference().Transport().Name()) + } + } else { + cld.destInfo, cld.diffID, cld.err = ic.copyLayer(ctx, srcLayer, toEncrypt, pool, index, srcRef, manifestLayerInfos[index].EmptyLayer) + } + data[index] = cld + } + + // Decide which layers to encrypt + layersToEncrypt := set.New[int]() + var encryptAll bool + if ic.ociEncryptLayers != nil { + encryptAll = len(*ic.ociEncryptLayers) == 0 + totalLayers := len(srcInfos) + for _, l := range *ic.ociEncryptLayers { + // if layer is negative, it is reverse indexed. + layersToEncrypt.Add((totalLayers + l) % totalLayers) + } + + if encryptAll { + for i := 0; i < len(srcInfos); i++ { + layersToEncrypt.Add(i) + } + } + } + + if err := func() error { // A scope for defer + progressPool := ic.c.newProgressPool() + defer progressPool.Wait() + + // Ensure we wait for all layers to be copied. progressPool.Wait() must not be called while any of the copyLayerHelpers interact with the progressPool. + defer copyGroup.Wait() + + for i, srcLayer := range srcInfos { + err = ic.c.concurrentBlobCopiesSemaphore.Acquire(ctx, 1) + if err != nil { + // This can only fail with ctx.Err(), so no need to blame acquiring the semaphore. + return fmt.Errorf("copying layer: %w", err) + } + copyGroup.Add(1) + go copyLayerHelper(i, srcLayer, layersToEncrypt.Contains(i), progressPool, ic.c.rawSource.Reference().DockerReference()) + } + + // A call to copyGroup.Wait() is done at this point by the defer above. + return nil + }(); err != nil { + return err + } + + destInfos := make([]types.BlobInfo, numLayers) + diffIDs := make([]digest.Digest, numLayers) + for i, cld := range data { + if cld.err != nil { + return cld.err + } + destInfos[i] = cld.destInfo + diffIDs[i] = cld.diffID + } + + // WARNING: If you are adding new reasons to change ic.manifestUpdates, also update the + // OptimizeDestinationImageAlreadyExists short-circuit conditions + ic.manifestUpdates.InformationOnly.LayerInfos = destInfos + if ic.diffIDsAreNeeded { + ic.manifestUpdates.InformationOnly.LayerDiffIDs = diffIDs + } + if srcInfosUpdated || layerDigestsDiffer(srcInfos, destInfos) { + ic.manifestUpdates.LayerInfos = destInfos + } + return nil +} + +// layerDigestsDiffer returns true iff the digests in a and b differ (ignoring sizes and possible other fields) +func layerDigestsDiffer(a, b []types.BlobInfo) bool { + return !slices.EqualFunc(a, b, func(a, b types.BlobInfo) bool { + return a.Digest == b.Digest + }) +} + +// copyUpdatedConfigAndManifest updates the image per ic.manifestUpdates, if necessary, +// stores the resulting config and manifest to the destination, and returns the stored manifest +// and its digest. +func (ic *imageCopier) copyUpdatedConfigAndManifest(ctx context.Context, instanceDigest *digest.Digest) ([]byte, digest.Digest, error) { + var pendingImage types.Image = ic.src + if !ic.noPendingManifestUpdates() { + if ic.cannotModifyManifestReason != "" { + return nil, "", fmt.Errorf("Internal error: copy needs an updated manifest but that was known to be forbidden: %q", ic.cannotModifyManifestReason) + } + if !ic.diffIDsAreNeeded && ic.src.UpdatedImageNeedsLayerDiffIDs(*ic.manifestUpdates) { + // We have set ic.diffIDsAreNeeded based on the preferred MIME type returned by determineManifestConversion. + // So, this can only happen if we are trying to upload using one of the other MIME type candidates. + // Because UpdatedImageNeedsLayerDiffIDs is true only when converting from s1 to s2, this case should only arise + // when ic.c.dest.SupportedManifestMIMETypes() includes both s1 and s2, the upload using s1 failed, and we are now trying s2. + // Supposedly s2-only registries do not exist or are extremely rare, so failing with this error message is good enough for now. + // If handling such registries turns out to be necessary, we could compute ic.diffIDsAreNeeded based on the full list of manifest MIME type candidates. + return nil, "", fmt.Errorf("Can not convert image to %s, preparing DiffIDs for this case is not supported", ic.manifestUpdates.ManifestMIMEType) + } + pi, err := ic.src.UpdatedImage(ctx, *ic.manifestUpdates) + if err != nil { + return nil, "", fmt.Errorf("creating an updated image manifest: %w", err) + } + pendingImage = pi + } + man, _, err := pendingImage.Manifest(ctx) + if err != nil { + return nil, "", fmt.Errorf("reading manifest: %w", err) + } + + if err := ic.copyConfig(ctx, pendingImage); err != nil { + return nil, "", err + } + + ic.c.Printf("Writing manifest to image destination\n") + manifestDigest, err := manifest.Digest(man) + if err != nil { + return nil, "", err + } + if instanceDigest != nil { + instanceDigest = &manifestDigest + } + if err := ic.c.dest.PutManifest(ctx, man, instanceDigest); err != nil { + logrus.Debugf("Error %v while writing manifest %q", err, string(man)) + return nil, "", fmt.Errorf("writing manifest: %w", err) + } + return man, manifestDigest, nil +} + +// copyConfig copies config.json, if any, from src to dest. +func (ic *imageCopier) copyConfig(ctx context.Context, src types.Image) error { + srcInfo := src.ConfigInfo() + if srcInfo.Digest != "" { + if err := ic.c.concurrentBlobCopiesSemaphore.Acquire(ctx, 1); err != nil { + // This can only fail with ctx.Err(), so no need to blame acquiring the semaphore. + return fmt.Errorf("copying config: %w", err) + } + defer ic.c.concurrentBlobCopiesSemaphore.Release(1) + + destInfo, err := func() (types.BlobInfo, error) { // A scope for defer + progressPool := ic.c.newProgressPool() + defer progressPool.Wait() + bar := ic.c.createProgressBar(progressPool, false, srcInfo, "config", "done") + defer bar.Abort(false) + ic.c.printCopyInfo("config", srcInfo) + + configBlob, err := src.ConfigBlob(ctx) + if err != nil { + return types.BlobInfo{}, fmt.Errorf("reading config blob %s: %w", srcInfo.Digest, err) + } + + destInfo, err := ic.copyBlobFromStream(ctx, bytes.NewReader(configBlob), srcInfo, nil, true, false, bar, -1, false) + if err != nil { + return types.BlobInfo{}, err + } + + bar.mark100PercentComplete() + return destInfo, nil + }() + if err != nil { + return err + } + if destInfo.Digest != srcInfo.Digest { + return fmt.Errorf("Internal error: copying uncompressed config blob %s changed digest to %s", srcInfo.Digest, destInfo.Digest) + } + } + return nil +} + +// diffIDResult contains both a digest value and an error from diffIDComputationGoroutine. +// We could also send the error through the pipeReader, but this more cleanly separates the copying of the layer and the DiffID computation. +type diffIDResult struct { + digest digest.Digest + err error +} + +// copyLayer copies a layer with srcInfo (with known Digest and Annotations and possibly known Size) in src to dest, perhaps (de/re/)compressing it, +// and returns a complete blobInfo of the copied layer, and a value for LayerDiffIDs if diffIDIsNeeded +// srcRef can be used as an additional hint to the destination during checking whether a layer can be reused but srcRef can be nil. +func (ic *imageCopier) copyLayer(ctx context.Context, srcInfo types.BlobInfo, toEncrypt bool, pool *mpb.Progress, layerIndex int, srcRef reference.Named, emptyLayer bool) (types.BlobInfo, digest.Digest, error) { + // If the srcInfo doesn't contain compression information, try to compute it from the + // MediaType, which was either read from a manifest by way of LayerInfos() or constructed + // by LayerInfosForCopy(), if it was supplied at all. If we succeed in copying the blob, + // the BlobInfo we return will be passed to UpdatedImage() and then to UpdateLayerInfos(), + // which uses the compression information to compute the updated MediaType values. + // (Sadly UpdatedImage() is documented to not update MediaTypes from + // ManifestUpdateOptions.LayerInfos[].MediaType, so we are doing it indirectly.) + // + // This MIME type → compression mapping belongs in manifest-specific code in our manifest + // package (but we should preferably replace/change UpdatedImage instead of productizing + // this workaround). + if srcInfo.CompressionAlgorithm == nil { + switch srcInfo.MediaType { + case manifest.DockerV2Schema2LayerMediaType, imgspecv1.MediaTypeImageLayerGzip: + srcInfo.CompressionAlgorithm = &compression.Gzip + case imgspecv1.MediaTypeImageLayerZstd: + srcInfo.CompressionAlgorithm = &compression.Zstd + } + } + + ic.c.printCopyInfo("blob", srcInfo) + + cachedDiffID := ic.c.blobInfoCache.UncompressedDigest(srcInfo.Digest) // May be "" + diffIDIsNeeded := ic.diffIDsAreNeeded && cachedDiffID == "" + // When encrypting to decrypting, only use the simple code path. We might be able to optimize more + // (e.g. if we know the DiffID of an encrypted compressed layer, it might not be necessary to pull, decrypt and decompress again), + // but it’s not trivially safe to do such things, so until someone takes the effort to make a comprehensive argument, let’s not. + encryptingOrDecrypting := toEncrypt || (isOciEncrypted(srcInfo.MediaType) && ic.c.ociDecryptConfig != nil) + canAvoidProcessingCompleteLayer := !diffIDIsNeeded && !encryptingOrDecrypting + + // Don’t read the layer from the source if we already have the blob, and optimizations are acceptable. + if canAvoidProcessingCompleteLayer { + canChangeLayerCompression := ic.src.CanChangeLayerCompression(srcInfo.MediaType) + logrus.Debugf("Checking if we can reuse blob %s: general substitution = %v, compression for MIME type %q = %v", + srcInfo.Digest, ic.canSubstituteBlobs, srcInfo.MediaType, canChangeLayerCompression) + canSubstitute := ic.canSubstituteBlobs && ic.src.CanChangeLayerCompression(srcInfo.MediaType) + // TODO: at this point we don't know whether or not a blob we end up reusing is compressed using an algorithm + // that is acceptable for use on layers in the manifest that we'll be writing later, so if we end up reusing + // a blob that's compressed with e.g. zstd, but we're only allowed to write a v2s2 manifest, this will cause + // a failure when we eventually try to update the manifest with the digest and MIME type of the reused blob. + // Fixing that will probably require passing more information to TryReusingBlob() than the current version of + // the ImageDestination interface lets us pass in. + reused, blobInfo, err := ic.c.dest.TryReusingBlobWithOptions(ctx, srcInfo, private.TryReusingBlobOptions{ + Cache: ic.c.blobInfoCache, + CanSubstitute: canSubstitute, + EmptyLayer: emptyLayer, + LayerIndex: &layerIndex, + SrcRef: srcRef, + }) + if err != nil { + return types.BlobInfo{}, "", fmt.Errorf("trying to reuse blob %s at destination: %w", srcInfo.Digest, err) + } + if reused { + logrus.Debugf("Skipping blob %s (already present):", srcInfo.Digest) + func() { // A scope for defer + bar := ic.c.createProgressBar(pool, false, types.BlobInfo{Digest: blobInfo.Digest, Size: 0}, "blob", "skipped: already exists") + defer bar.Abort(false) + bar.mark100PercentComplete() + }() + + // Throw an event that the layer has been skipped + if ic.c.progress != nil && ic.c.progressInterval > 0 { + ic.c.progress <- types.ProgressProperties{ + Event: types.ProgressEventSkipped, + Artifact: srcInfo, + } + } + + // If the reused blob has the same digest as the one we asked for, but + // the transport didn't/couldn't supply compression info, fill it in based + // on what we know from the srcInfos we were given. + // If the srcInfos came from LayerInfosForCopy(), then UpdatedImage() will + // call UpdateLayerInfos(), which uses this information to compute the + // MediaType value for the updated layer infos, and it the transport + // didn't pass the information along from its input to its output, then + // it can derive the MediaType incorrectly. + if blobInfo.Digest == srcInfo.Digest && blobInfo.CompressionAlgorithm == nil { + blobInfo.CompressionOperation = srcInfo.CompressionOperation + blobInfo.CompressionAlgorithm = srcInfo.CompressionAlgorithm + } + return blobInfo, cachedDiffID, nil + } + } + + // A partial pull is managed by the destination storage, that decides what portions + // of the source file are not known yet and must be fetched. + // Attempt a partial only when the source allows to retrieve a blob partially and + // the destination has support for it. + if canAvoidProcessingCompleteLayer && ic.c.rawSource.SupportsGetBlobAt() && ic.c.dest.SupportsPutBlobPartial() { + if reused, blobInfo := func() (bool, types.BlobInfo) { // A scope for defer + bar := ic.c.createProgressBar(pool, true, srcInfo, "blob", "done") + hideProgressBar := true + defer func() { // Note that this is not the same as defer bar.Abort(hideProgressBar); we need hideProgressBar to be evaluated lazily. + bar.Abort(hideProgressBar) + }() + + proxy := blobChunkAccessorProxy{ + wrapped: ic.c.rawSource, + bar: bar, + } + info, err := ic.c.dest.PutBlobPartial(ctx, &proxy, srcInfo, ic.c.blobInfoCache) + if err == nil { + if srcInfo.Size != -1 { + bar.SetRefill(srcInfo.Size - bar.Current()) + } + bar.mark100PercentComplete() + hideProgressBar = false + logrus.Debugf("Retrieved partial blob %v", srcInfo.Digest) + return true, info + } + logrus.Debugf("Failed to retrieve partial blob: %v", err) + return false, types.BlobInfo{} + }(); reused { + return blobInfo, cachedDiffID, nil + } + } + + // Fallback: copy the layer, computing the diffID if we need to do so + return func() (types.BlobInfo, digest.Digest, error) { // A scope for defer + bar := ic.c.createProgressBar(pool, false, srcInfo, "blob", "done") + defer bar.Abort(false) + + srcStream, srcBlobSize, err := ic.c.rawSource.GetBlob(ctx, srcInfo, ic.c.blobInfoCache) + if err != nil { + return types.BlobInfo{}, "", fmt.Errorf("reading blob %s: %w", srcInfo.Digest, err) + } + defer srcStream.Close() + + blobInfo, diffIDChan, err := ic.copyLayerFromStream(ctx, srcStream, types.BlobInfo{Digest: srcInfo.Digest, Size: srcBlobSize, MediaType: srcInfo.MediaType, Annotations: srcInfo.Annotations}, diffIDIsNeeded, toEncrypt, bar, layerIndex, emptyLayer) + if err != nil { + return types.BlobInfo{}, "", err + } + + diffID := cachedDiffID + if diffIDIsNeeded { + select { + case <-ctx.Done(): + return types.BlobInfo{}, "", ctx.Err() + case diffIDResult := <-diffIDChan: + if diffIDResult.err != nil { + return types.BlobInfo{}, "", fmt.Errorf("computing layer DiffID: %w", diffIDResult.err) + } + logrus.Debugf("Computed DiffID %s for layer %s", diffIDResult.digest, srcInfo.Digest) + // Don’t record any associations that involve encrypted data. This is a bit crude, + // some blob substitutions (replacing pulls of encrypted data with local reuse of known decryption outcomes) + // might be safe, but it’s not trivially obvious, so let’s be conservative for now. + // This crude approach also means we don’t need to record whether a blob is encrypted + // in the blob info cache (which would probably be necessary for any more complex logic), + // and the simplicity is attractive. + if !encryptingOrDecrypting { + // This is safe because we have just computed diffIDResult.Digest ourselves, and in the process + // we have read all of the input blob, so srcInfo.Digest must have been validated by digestingReader. + ic.c.blobInfoCache.RecordDigestUncompressedPair(srcInfo.Digest, diffIDResult.digest) + } + diffID = diffIDResult.digest + } + } + + bar.mark100PercentComplete() + return blobInfo, diffID, nil + }() +} + +// copyLayerFromStream is an implementation detail of copyLayer; mostly providing a separate ā€œdeferā€ scope. +// it copies a blob with srcInfo (with known Digest and Annotations and possibly known Size) from srcStream to dest, +// perhaps (de/re/)compressing the stream, +// and returns a complete blobInfo of the copied blob and perhaps a <-chan diffIDResult if diffIDIsNeeded, to be read by the caller. +func (ic *imageCopier) copyLayerFromStream(ctx context.Context, srcStream io.Reader, srcInfo types.BlobInfo, + diffIDIsNeeded bool, toEncrypt bool, bar *progressBar, layerIndex int, emptyLayer bool) (types.BlobInfo, <-chan diffIDResult, error) { + var getDiffIDRecorder func(compressiontypes.DecompressorFunc) io.Writer // = nil + var diffIDChan chan diffIDResult + + err := errors.New("Internal error: unexpected panic in copyLayer") // For pipeWriter.CloseWithbelow + if diffIDIsNeeded { + diffIDChan = make(chan diffIDResult, 1) // Buffered, so that sending a value after this or our caller has failed and exited does not block. + pipeReader, pipeWriter := io.Pipe() + defer func() { // Note that this is not the same as {defer pipeWriter.CloseWithError(err)}; we need err to be evaluated lazily. + _ = pipeWriter.CloseWithError(err) // CloseWithError(nil) is equivalent to Close(), always returns nil + }() + + getDiffIDRecorder = func(decompressor compressiontypes.DecompressorFunc) io.Writer { + // If this fails, e.g. because we have exited and due to pipeWriter.CloseWithError() above further + // reading from the pipe has failed, we don’t really care. + // We only read from diffIDChan if the rest of the flow has succeeded, and when we do read from it, + // the return value includes an error indication, which we do check. + // + // If this gets never called, pipeReader will not be used anywhere, but pipeWriter will only be + // closed above, so we are happy enough with both pipeReader and pipeWriter to just get collected by GC. + go diffIDComputationGoroutine(diffIDChan, pipeReader, decompressor) // Closes pipeReader + return pipeWriter + } + } + + blobInfo, err := ic.copyBlobFromStream(ctx, srcStream, srcInfo, getDiffIDRecorder, false, toEncrypt, bar, layerIndex, emptyLayer) // Sets err to nil on success + return blobInfo, diffIDChan, err + // We need the defer … pipeWriter.CloseWithError() to happen HERE so that the caller can block on reading from diffIDChan +} + +// diffIDComputationGoroutine reads all input from layerStream, uncompresses using decompressor if necessary, and sends its digest, and status, if any, to dest. +func diffIDComputationGoroutine(dest chan<- diffIDResult, layerStream io.ReadCloser, decompressor compressiontypes.DecompressorFunc) { + result := diffIDResult{ + digest: "", + err: errors.New("Internal error: unexpected panic in diffIDComputationGoroutine"), + } + defer func() { dest <- result }() + defer layerStream.Close() // We do not care to bother the other end of the pipe with other failures; we send them to dest instead. + + result.digest, result.err = computeDiffID(layerStream, decompressor) +} + +// computeDiffID reads all input from layerStream, uncompresses it using decompressor if necessary, and returns its digest. +func computeDiffID(stream io.Reader, decompressor compressiontypes.DecompressorFunc) (digest.Digest, error) { + if decompressor != nil { + s, err := decompressor(stream) + if err != nil { + return "", err + } + defer s.Close() + stream = s + } + + return digest.Canonical.FromReader(stream) +} diff --git a/vendor/github.com/containers/storage/.cirrus.yml b/vendor/github.com/containers/storage/.cirrus.yml index 9a694350a9..f8fe6b6156 100644 --- a/vendor/github.com/containers/storage/.cirrus.yml +++ b/vendor/github.com/containers/storage/.cirrus.yml @@ -53,19 +53,31 @@ gce_instance: image_name: "${FEDORA_CACHE_IMAGE_NAME}" -fedora_testing_task: &fedora_testing - alias: fedora_testing - name: &std_test_name "${OS_NAME} ${TEST_DRIVER}" +linux_testing: &linux_testing depends_on: - lint only_if: $CIRRUS_CHANGE_TITLE !=~ '.*CI:DOCS.*' gce_instance: # Only need to specify differences from defaults (above) image_name: "${VM_IMAGE}" + # Separate scripts for separate outputs, makes debugging easier. + setup_script: '${CIRRUS_WORKING_DIR}/${SCRIPT_BASE}/setup.sh |& ${_TIMESTAMP}' + build_and_test_script: '${CIRRUS_WORKING_DIR}/${SCRIPT_BASE}/build_and_test.sh |& ${_TIMESTAMP}' + + always: + df_script: '${_DFCMD} || true' + rh_audit_log_script: '${_RAUDITCMD} || true' + ubuntu_audit_log_script: '${_UAUDITCMD} || true' + journal_log_script: '${_JOURNALCMD} || true' + + +fedora_testing_task: &fedora_testing + <<: *linux_testing + alias: fedora_testing + name: &std_test_name "${OS_NAME} ${TEST_DRIVER}" env: OS_NAME: "${FEDORA_NAME}" VM_IMAGE: "${FEDORA_CACHE_IMAGE_NAME}" - # Not all $TEST_DRIVER combinations valid for all $VM_IMAGE types. matrix: &test_matrix - env: @@ -81,26 +93,16 @@ fedora_testing_task: &fedora_testing - env: TEST_DRIVER: "btrfs" - # Separate scripts for separate outputs, makes debugging easier. - setup_script: '${CIRRUS_WORKING_DIR}/${SCRIPT_BASE}/setup.sh |& ${_TIMESTAMP}' - build_and_test_script: '${CIRRUS_WORKING_DIR}/${SCRIPT_BASE}/build_and_test.sh |& ${_TIMESTAMP}' - - always: - df_script: '${_DFCMD} || true' - rh_audit_log_script: '${_RAUDITCMD} || true' - ubuntu_audit_log_script: '${_UAUDITCMD} || true' - journal_log_script: '${_JOURNALCMD} || true' - # aufs was dropped between 20.04 and 22.04, can't test it ubuntu_testing_task: &ubuntu_testing - <<: *fedora_testing + <<: *linux_testing alias: ubuntu_testing name: *std_test_name - only_if: $CIRRUS_CHANGE_TITLE !=~ '.*CI:DOCS.*' env: OS_NAME: "${UBUNTU_NAME}" VM_IMAGE: "${UBUNTU_CACHE_IMAGE_NAME}" + # Not all $TEST_DRIVER combinations valid for all $VM_IMAGE types. matrix: - env: TEST_DRIVER: "vfs" diff --git a/vendor/github.com/containers/storage/pkg/chunked/storage_linux.go b/vendor/github.com/containers/storage/pkg/chunked/storage_linux.go index d0176df5ae..42389071c1 100644 --- a/vendor/github.com/containers/storage/pkg/chunked/storage_linux.go +++ b/vendor/github.com/containers/storage/pkg/chunked/storage_linux.go @@ -1180,7 +1180,7 @@ func (d whiteoutHandler) Mknod(path string, mode uint32, dev int) error { func checkChownErr(err error, name string, uid, gid int) error { if errors.Is(err, syscall.EINVAL) { - return fmt.Errorf("potentially insufficient UIDs or GIDs available in user namespace (requested %d:%d for %s): Check /etc/subuid and /etc/subgid if configured locally and run podman-system-migrate: %w", uid, gid, name, err) + return fmt.Errorf(`potentially insufficient UIDs or GIDs available in user namespace (requested %d:%d for %s): Check /etc/subuid and /etc/subgid if configured locally and run "podman system migrate": %w`, uid, gid, name, err) } return err } diff --git a/vendor/github.com/containers/storage/pkg/idtools/idtools.go b/vendor/github.com/containers/storage/pkg/idtools/idtools.go index 4cec8b263c..1e2d5bcc31 100644 --- a/vendor/github.com/containers/storage/pkg/idtools/idtools.go +++ b/vendor/github.com/containers/storage/pkg/idtools/idtools.go @@ -362,7 +362,7 @@ func parseSubidFile(path, username string) (ranges, error) { func checkChownErr(err error, name string, uid, gid int) error { var e *os.PathError if errors.As(err, &e) && e.Err == syscall.EINVAL { - return fmt.Errorf("potentially insufficient UIDs or GIDs available in user namespace (requested %d:%d for %s): Check /etc/subuid and /etc/subgid if configured locally and run podman-system-migrate: %w", uid, gid, name, err) + return fmt.Errorf(`potentially insufficient UIDs or GIDs available in user namespace (requested %d:%d for %s): Check /etc/subuid and /etc/subgid if configured locally and run "podman system migrate": %w`, uid, gid, name, err) } return err } diff --git a/vendor/github.com/golang/protobuf/jsonpb/decode.go b/vendor/github.com/golang/protobuf/jsonpb/decode.go index 60e82caa9a..6c16c255ff 100644 --- a/vendor/github.com/golang/protobuf/jsonpb/decode.go +++ b/vendor/github.com/golang/protobuf/jsonpb/decode.go @@ -386,8 +386,14 @@ func (u *Unmarshaler) unmarshalMessage(m protoreflect.Message, in []byte) error } func isSingularWellKnownValue(fd protoreflect.FieldDescriptor) bool { + if fd.Cardinality() == protoreflect.Repeated { + return false + } if md := fd.Message(); md != nil { - return md.FullName() == "google.protobuf.Value" && fd.Cardinality() != protoreflect.Repeated + return md.FullName() == "google.protobuf.Value" + } + if ed := fd.Enum(); ed != nil { + return ed.FullName() == "google.protobuf.NullValue" } return false } diff --git a/vendor/github.com/klauspost/compress/README.md b/vendor/github.com/klauspost/compress/README.md index 958666ed89..c2c7252fe1 100644 --- a/vendor/github.com/klauspost/compress/README.md +++ b/vendor/github.com/klauspost/compress/README.md @@ -16,6 +16,21 @@ This package provides various compression algorithms. # changelog +* Mar 13, 2023 - [v1.16.1](https://github.com/klauspost/compress/releases/tag/v1.16.1) + * zstd: Speed up + improve best encoder by @greatroar in https://github.com/klauspost/compress/pull/776 + * gzhttp: Add optional [BREACH mitigation](https://github.com/klauspost/compress/tree/master/gzhttp#breach-mitigation). https://github.com/klauspost/compress/pull/762 https://github.com/klauspost/compress/pull/768 https://github.com/klauspost/compress/pull/769 https://github.com/klauspost/compress/pull/770 https://github.com/klauspost/compress/pull/767 + * s2: Add Intel LZ4s converter https://github.com/klauspost/compress/pull/766 + * zstd: Minor bug fixes https://github.com/klauspost/compress/pull/771 https://github.com/klauspost/compress/pull/772 https://github.com/klauspost/compress/pull/773 + * huff0: Speed up compress1xDo by @greatroar in https://github.com/klauspost/compress/pull/774 + +* Feb 26, 2023 - [v1.16.0](https://github.com/klauspost/compress/releases/tag/v1.16.0) + * s2: Add [Dictionary](https://github.com/klauspost/compress/tree/master/s2#dictionaries) support. https://github.com/klauspost/compress/pull/685 + * s2: Add Compression Size Estimate. https://github.com/klauspost/compress/pull/752 + * s2: Add support for custom stream encoder. https://github.com/klauspost/compress/pull/755 + * s2: Add LZ4 block converter. https://github.com/klauspost/compress/pull/748 + * s2: Support io.ReaderAt in ReadSeeker. https://github.com/klauspost/compress/pull/747 + * s2c/s2sx: Use concurrent decoding. https://github.com/klauspost/compress/pull/746 + * Jan 21st, 2023 (v1.15.15) * deflate: Improve level 7-9 by @klauspost in https://github.com/klauspost/compress/pull/739 * zstd: Add delta encoding support by @greatroar in https://github.com/klauspost/compress/pull/728 diff --git a/vendor/github.com/klauspost/compress/fse/decompress.go b/vendor/github.com/klauspost/compress/fse/decompress.go index 926f5f1535..cc05d0f7ea 100644 --- a/vendor/github.com/klauspost/compress/fse/decompress.go +++ b/vendor/github.com/klauspost/compress/fse/decompress.go @@ -260,7 +260,9 @@ func (s *Scratch) buildDtable() error { // If the buffer is over-read an error is returned. func (s *Scratch) decompress() error { br := &s.bits - br.init(s.br.unread()) + if err := br.init(s.br.unread()); err != nil { + return err + } var s1, s2 decoder // Initialize and decode first state and symbol. diff --git a/vendor/github.com/klauspost/compress/huff0/bitwriter.go b/vendor/github.com/klauspost/compress/huff0/bitwriter.go index ec71f7a349..aed2347ced 100644 --- a/vendor/github.com/klauspost/compress/huff0/bitwriter.go +++ b/vendor/github.com/klauspost/compress/huff0/bitwriter.go @@ -60,6 +60,22 @@ func (b *bitWriter) encTwoSymbols(ct cTable, av, bv byte) { b.nBits += encA.nBits + encB.nBits } +// encFourSymbols adds up to 32 bits from four symbols. +// It will not check if there is space for them, +// so the caller must ensure that b has been flushed recently. +func (b *bitWriter) encFourSymbols(encA, encB, encC, encD cTableEntry) { + bitsA := encA.nBits + bitsB := bitsA + encB.nBits + bitsC := bitsB + encC.nBits + bitsD := bitsC + encD.nBits + combined := uint64(encA.val) | + (uint64(encB.val) << (bitsA & 63)) | + (uint64(encC.val) << (bitsB & 63)) | + (uint64(encD.val) << (bitsC & 63)) + b.bitContainer |= combined << (b.nBits & 63) + b.nBits += bitsD +} + // flush32 will flush out, so there are at least 32 bits available for writing. func (b *bitWriter) flush32() { if b.nBits < 32 { diff --git a/vendor/github.com/klauspost/compress/huff0/compress.go b/vendor/github.com/klauspost/compress/huff0/compress.go index cdc94856f2..4ee4fa18dd 100644 --- a/vendor/github.com/klauspost/compress/huff0/compress.go +++ b/vendor/github.com/klauspost/compress/huff0/compress.go @@ -248,8 +248,7 @@ func (s *Scratch) compress1xDo(dst, src []byte) ([]byte, error) { tmp := src[n : n+4] // tmp should be len 4 bw.flush32() - bw.encTwoSymbols(cTable, tmp[3], tmp[2]) - bw.encTwoSymbols(cTable, tmp[1], tmp[0]) + bw.encFourSymbols(cTable[tmp[3]], cTable[tmp[2]], cTable[tmp[1]], cTable[tmp[0]]) } } else { for ; n >= 0; n -= 4 { diff --git a/vendor/github.com/klauspost/compress/zstd/blockdec.go b/vendor/github.com/klauspost/compress/zstd/blockdec.go index 2445bb4fe5..5f272d87f6 100644 --- a/vendor/github.com/klauspost/compress/zstd/blockdec.go +++ b/vendor/github.com/klauspost/compress/zstd/blockdec.go @@ -9,6 +9,7 @@ import ( "encoding/binary" "errors" "fmt" + "hash/crc32" "io" "os" "path/filepath" @@ -442,6 +443,9 @@ func (b *blockDec) decodeLiterals(in []byte, hist *history) (remain []byte, err } } var err error + if debugDecoder { + println("huff table input:", len(literals), "CRC:", crc32.ChecksumIEEE(literals)) + } huff, literals, err = huff0.ReadTable(literals, huff) if err != nil { println("reading huffman table:", err) diff --git a/vendor/github.com/klauspost/compress/zstd/bytebuf.go b/vendor/github.com/klauspost/compress/zstd/bytebuf.go index 176788f259..512ffe5b95 100644 --- a/vendor/github.com/klauspost/compress/zstd/bytebuf.go +++ b/vendor/github.com/klauspost/compress/zstd/bytebuf.go @@ -54,7 +54,7 @@ func (b *byteBuf) readBig(n int, dst []byte) ([]byte, error) { func (b *byteBuf) readByte() (byte, error) { bb := *b if len(bb) < 1 { - return 0, nil + return 0, io.ErrUnexpectedEOF } r := bb[0] *b = bb[1:] diff --git a/vendor/github.com/klauspost/compress/zstd/enc_best.go b/vendor/github.com/klauspost/compress/zstd/enc_best.go index 830f5ba74a..07f657d36e 100644 --- a/vendor/github.com/klauspost/compress/zstd/enc_best.go +++ b/vendor/github.com/klauspost/compress/zstd/enc_best.go @@ -32,7 +32,6 @@ type match struct { length int32 rep int32 est int32 - _ [12]byte // Aligned size to cache line: 4+4+4+4+4 bytes + 12 bytes padding = 32 bytes } const highScore = 25000 @@ -189,12 +188,6 @@ encodeLoop: panic("offset0 was 0") } - bestOf := func(a, b *match) *match { - if a.est-b.est+(a.s-b.s)*bitsPerByte>>10 < 0 { - return a - } - return b - } const goodEnough = 100 nextHashL := hashLen(cv, bestLongTableBits, bestLongLen) @@ -202,40 +195,41 @@ encodeLoop: candidateL := e.longTable[nextHashL] candidateS := e.table[nextHashS] - matchAt := func(offset int32, s int32, first uint32, rep int32) match { + // Set m to a match at offset if it looks like that will improve compression. + improve := func(m *match, offset int32, s int32, first uint32, rep int32) { if s-offset >= e.maxMatchOff || load3232(src, offset) != first { - return match{s: s, est: highScore} + return } if debugAsserts { if !bytes.Equal(src[s:s+4], src[offset:offset+4]) { panic(fmt.Sprintf("first match mismatch: %v != %v, first: %08x", src[s:s+4], src[offset:offset+4], first)) } } - m := match{offset: offset, s: s, length: 4 + e.matchlen(s+4, offset+4, src), rep: rep} - m.estBits(bitsPerByte) - return m + cand := match{offset: offset, s: s, length: 4 + e.matchlen(s+4, offset+4, src), rep: rep} + cand.estBits(bitsPerByte) + if m.est >= highScore || cand.est-m.est+(cand.s-m.s)*bitsPerByte>>10 < 0 { + *m = cand + } } - m1 := matchAt(candidateL.offset-e.cur, s, uint32(cv), -1) - m2 := matchAt(candidateL.prev-e.cur, s, uint32(cv), -1) - m3 := matchAt(candidateS.offset-e.cur, s, uint32(cv), -1) - m4 := matchAt(candidateS.prev-e.cur, s, uint32(cv), -1) - best := bestOf(bestOf(&m1, &m2), bestOf(&m3, &m4)) + best := match{s: s, est: highScore} + improve(&best, candidateL.offset-e.cur, s, uint32(cv), -1) + improve(&best, candidateL.prev-e.cur, s, uint32(cv), -1) + improve(&best, candidateS.offset-e.cur, s, uint32(cv), -1) + improve(&best, candidateS.prev-e.cur, s, uint32(cv), -1) if canRepeat && best.length < goodEnough { cv32 := uint32(cv >> 8) spp := s + 1 - m1 := matchAt(spp-offset1, spp, cv32, 1) - m2 := matchAt(spp-offset2, spp, cv32, 2) - m3 := matchAt(spp-offset3, spp, cv32, 3) - best = bestOf(bestOf(best, &m1), bestOf(&m2, &m3)) + improve(&best, spp-offset1, spp, cv32, 1) + improve(&best, spp-offset2, spp, cv32, 2) + improve(&best, spp-offset3, spp, cv32, 3) if best.length > 0 { cv32 = uint32(cv >> 24) spp += 2 - m1 := matchAt(spp-offset1, spp, cv32, 1) - m2 := matchAt(spp-offset2, spp, cv32, 2) - m3 := matchAt(spp-offset3, spp, cv32, 3) - best = bestOf(bestOf(best, &m1), bestOf(&m2, &m3)) + improve(&best, spp-offset1, spp, cv32, 1) + improve(&best, spp-offset2, spp, cv32, 2) + improve(&best, spp-offset3, spp, cv32, 3) } } // Load next and check... @@ -262,18 +256,16 @@ encodeLoop: candidateL2 := e.longTable[hashLen(cv2, bestLongTableBits, bestLongLen)] // Short at s+1 - m1 := matchAt(candidateS.offset-e.cur, s, uint32(cv), -1) + improve(&best, candidateS.offset-e.cur, s, uint32(cv), -1) // Long at s+1, s+2 - m2 := matchAt(candidateL.offset-e.cur, s, uint32(cv), -1) - m3 := matchAt(candidateL.prev-e.cur, s, uint32(cv), -1) - m4 := matchAt(candidateL2.offset-e.cur, s+1, uint32(cv2), -1) - m5 := matchAt(candidateL2.prev-e.cur, s+1, uint32(cv2), -1) - best = bestOf(bestOf(bestOf(best, &m1), &m2), bestOf(bestOf(&m3, &m4), &m5)) + improve(&best, candidateL.offset-e.cur, s, uint32(cv), -1) + improve(&best, candidateL.prev-e.cur, s, uint32(cv), -1) + improve(&best, candidateL2.offset-e.cur, s+1, uint32(cv2), -1) + improve(&best, candidateL2.prev-e.cur, s+1, uint32(cv2), -1) if false { // Short at s+3. // Too often worse... - m := matchAt(e.table[hashLen(cv2>>8, bestShortTableBits, bestShortLen)].offset-e.cur, s+2, uint32(cv2>>8), -1) - best = bestOf(best, &m) + improve(&best, e.table[hashLen(cv2>>8, bestShortTableBits, bestShortLen)].offset-e.cur, s+2, uint32(cv2>>8), -1) } // See if we can find a better match by checking where the current best ends. // Use that offset to see if we can find a better full match. @@ -284,13 +276,10 @@ encodeLoop: // For this compression level 2 yields the best results. const skipBeginning = 2 if pos := candidateEnd.offset - e.cur - best.length + skipBeginning; pos >= 0 { - m := matchAt(pos, best.s+skipBeginning, load3232(src, best.s+skipBeginning), -1) - bestEnd := bestOf(best, &m) + improve(&best, pos, best.s+skipBeginning, load3232(src, best.s+skipBeginning), -1) if pos := candidateEnd.prev - e.cur - best.length + skipBeginning; pos >= 0 { - m := matchAt(pos, best.s+skipBeginning, load3232(src, best.s+skipBeginning), -1) - bestEnd = bestOf(bestEnd, &m) + improve(&best, pos, best.s+skipBeginning, load3232(src, best.s+skipBeginning), -1) } - best = bestEnd } } } diff --git a/vendor/github.com/klauspost/compress/zstd/seqdec.go b/vendor/github.com/klauspost/compress/zstd/seqdec.go index f833d1541f..27fdf90fbc 100644 --- a/vendor/github.com/klauspost/compress/zstd/seqdec.go +++ b/vendor/github.com/klauspost/compress/zstd/seqdec.go @@ -314,9 +314,6 @@ func (s *sequenceDecs) decodeSync(hist []byte) error { } size := ll + ml + len(out) if size-startSize > maxBlockSize { - if size-startSize == 424242 { - panic("here") - } return fmt.Errorf("output bigger than max block size (%d)", maxBlockSize) } if size > cap(out) { @@ -427,8 +424,7 @@ func (s *sequenceDecs) decodeSync(hist []byte) error { } } - // Check if space for literals - if size := len(s.literals) + len(s.out) - startSize; size > maxBlockSize { + if size := len(s.literals) + len(out) - startSize; size > maxBlockSize { return fmt.Errorf("output bigger than max block size (%d)", maxBlockSize) } diff --git a/vendor/github.com/klauspost/compress/zstd/seqdec_amd64.go b/vendor/github.com/klauspost/compress/zstd/seqdec_amd64.go index 191384adfd..387a30e99d 100644 --- a/vendor/github.com/klauspost/compress/zstd/seqdec_amd64.go +++ b/vendor/github.com/klauspost/compress/zstd/seqdec_amd64.go @@ -148,7 +148,6 @@ func (s *sequenceDecs) decodeSyncSimple(hist []byte) (bool, error) { s.seqSize += ctx.litRemain if s.seqSize > maxBlockSize { return true, fmt.Errorf("output bigger than max block size (%d)", maxBlockSize) - } err := br.close() if err != nil { diff --git a/vendor/github.com/onsi/gomega/CHANGELOG.md b/vendor/github.com/onsi/gomega/CHANGELOG.md index 237aac3302..e702e3c993 100644 --- a/vendor/github.com/onsi/gomega/CHANGELOG.md +++ b/vendor/github.com/onsi/gomega/CHANGELOG.md @@ -1,3 +1,21 @@ +## 1.27.4 + +### Fixes +- improve error formatting and remove duplication of error message in Eventually/Consistently [854f075] + +### Maintenance +- Bump github.com/onsi/ginkgo/v2 from 2.9.0 to 2.9.1 (#650) [ccebd9b] + +## 1.27.3 + +### Fixes +- format.Object now always includes err.Error() when passed an error [86d97ef] +- Fix HaveExactElements to work inside ContainElement or other collection matchers (#648) [636757e] + +### Maintenance +- Bump github.com/golang/protobuf from 1.5.2 to 1.5.3 (#649) [cc16689] +- Bump github.com/onsi/ginkgo/v2 from 2.8.4 to 2.9.0 (#646) [e783366] + ## 1.27.2 ### Fixes diff --git a/vendor/github.com/onsi/gomega/format/format.go b/vendor/github.com/onsi/gomega/format/format.go index 1a2ed877a9..56bdd053bb 100644 --- a/vendor/github.com/onsi/gomega/format/format.go +++ b/vendor/github.com/onsi/gomega/format/format.go @@ -52,7 +52,7 @@ var CharactersAroundMismatchToInclude uint = 5 var contextType = reflect.TypeOf((*context.Context)(nil)).Elem() var timeType = reflect.TypeOf(time.Time{}) -//The default indentation string emitted by the format package +// The default indentation string emitted by the format package var Indent = " " var longFormThreshold = 20 @@ -258,7 +258,11 @@ Set PrintContextObjects to true to print the content of objects implementing con func Object(object interface{}, indentation uint) string { indent := strings.Repeat(Indent, int(indentation)) value := reflect.ValueOf(object) - return fmt.Sprintf("%s<%s>: %s", indent, formatType(value), formatValue(value, indentation)) + commonRepresentation := "" + if err, ok := object.(error); ok { + commonRepresentation += "\n" + IndentString(err.Error(), indentation) + "\n" + indent + } + return fmt.Sprintf("%s<%s>: %s%s", indent, formatType(value), commonRepresentation, formatValue(value, indentation)) } /* diff --git a/vendor/github.com/onsi/gomega/gomega_dsl.go b/vendor/github.com/onsi/gomega/gomega_dsl.go index 21dfa5c958..e37251d893 100644 --- a/vendor/github.com/onsi/gomega/gomega_dsl.go +++ b/vendor/github.com/onsi/gomega/gomega_dsl.go @@ -22,7 +22,7 @@ import ( "github.com/onsi/gomega/types" ) -const GOMEGA_VERSION = "1.27.2" +const GOMEGA_VERSION = "1.27.4" const nilGomegaPanic = `You are trying to make an assertion, but haven't registered Gomega's fail handler. If you're using Ginkgo then you probably forgot to put your assertion in an It(). diff --git a/vendor/github.com/onsi/gomega/internal/async_assertion.go b/vendor/github.com/onsi/gomega/internal/async_assertion.go index baa28d4adf..1188b0bce3 100644 --- a/vendor/github.com/onsi/gomega/internal/async_assertion.go +++ b/vendor/github.com/onsi/gomega/internal/async_assertion.go @@ -412,7 +412,7 @@ func (assertion *AsyncAssertion) match(matcher types.GomegaMatcher, desiredMatch message += format.Object(attachment.Object, 1) } } else { - message = preamble + "\n" + err.Error() + "\n" + format.Object(err, 1) + message = preamble + "\n" + format.Object(err, 1) } return message } diff --git a/vendor/github.com/onsi/gomega/matchers/have_exact_elements.go b/vendor/github.com/onsi/gomega/matchers/have_exact_elements.go index 19d8f3d1d3..7cce776c18 100644 --- a/vendor/github.com/onsi/gomega/matchers/have_exact_elements.go +++ b/vendor/github.com/onsi/gomega/matchers/have_exact_elements.go @@ -19,6 +19,8 @@ type HaveExactElementsMatcher struct { } func (matcher *HaveExactElementsMatcher) Match(actual interface{}) (success bool, err error) { + matcher.resetState() + if isMap(actual) { return false, fmt.Errorf("error") } @@ -73,3 +75,9 @@ func (matcher *HaveExactElementsMatcher) FailureMessage(actual interface{}) (mes func (matcher *HaveExactElementsMatcher) NegatedFailureMessage(actual interface{}) (message string) { return format.Message(actual, "not to contain elements", presentable(matcher.Elements)) } + +func (matcher *HaveExactElementsMatcher) resetState() { + matcher.mismatchFailures = nil + matcher.missingIndex = 0 + matcher.extraIndex = 0 +} diff --git a/vendor/github.com/onsi/gomega/matchers/have_occurred_matcher.go b/vendor/github.com/onsi/gomega/matchers/have_occurred_matcher.go index 5bcfdd2ade..22a1b67306 100644 --- a/vendor/github.com/onsi/gomega/matchers/have_occurred_matcher.go +++ b/vendor/github.com/onsi/gomega/matchers/have_occurred_matcher.go @@ -31,5 +31,5 @@ func (matcher *HaveOccurredMatcher) FailureMessage(actual interface{}) (message } func (matcher *HaveOccurredMatcher) NegatedFailureMessage(actual interface{}) (message string) { - return fmt.Sprintf("Unexpected error:\n%s\n%s\n%s", format.Object(actual, 1), format.IndentString(actual.(error).Error(), 1), "occurred") + return fmt.Sprintf("Unexpected error:\n%s\n%s", format.Object(actual, 1), "occurred") } diff --git a/vendor/github.com/onsi/gomega/matchers/succeed_matcher.go b/vendor/github.com/onsi/gomega/matchers/succeed_matcher.go index da5a395944..327350f7b7 100644 --- a/vendor/github.com/onsi/gomega/matchers/succeed_matcher.go +++ b/vendor/github.com/onsi/gomega/matchers/succeed_matcher.go @@ -34,7 +34,7 @@ func (matcher *SucceedMatcher) FailureMessage(actual interface{}) (message strin if errors.As(actual.(error), &fgErr) { return fgErr.FormattedGomegaError() } - return fmt.Sprintf("Expected success, but got an error:\n%s\n%s", format.Object(actual, 1), format.IndentString(actual.(error).Error(), 1)) + return fmt.Sprintf("Expected success, but got an error:\n%s", format.Object(actual, 1)) } func (matcher *SucceedMatcher) NegatedFailureMessage(actual interface{}) (message string) { diff --git a/vendor/github.com/opencontainers/image-spec/specs-go/v1/config.go b/vendor/github.com/opencontainers/image-spec/specs-go/v1/config.go index ffff4b6d18..e6aa113f07 100644 --- a/vendor/github.com/opencontainers/image-spec/specs-go/v1/config.go +++ b/vendor/github.com/opencontainers/image-spec/specs-go/v1/config.go @@ -48,6 +48,15 @@ type ImageConfig struct { // StopSignal contains the system call signal that will be sent to the container to exit. StopSignal string `json:"StopSignal,omitempty"` + + // ArgsEscaped `[Deprecated]` - This field is present only for legacy + // compatibility with Docker and should not be used by new image builders. + // It is used by Docker for Windows images to indicate that the `Entrypoint` + // or `Cmd` or both, contains only a single element array, that is a + // pre-escaped, and combined into a single string `CommandLine`. If `true` + // the value in `Entrypoint` or `Cmd` should be used as-is to avoid double + // escaping. + ArgsEscaped bool `json:"ArgsEscaped,omitempty"` } // RootFS describes a layer content addresses diff --git a/vendor/github.com/opencontainers/image-spec/specs-go/version.go b/vendor/github.com/opencontainers/image-spec/specs-go/version.go index d279035796..1afd590fe0 100644 --- a/vendor/github.com/opencontainers/image-spec/specs-go/version.go +++ b/vendor/github.com/opencontainers/image-spec/specs-go/version.go @@ -25,7 +25,7 @@ const ( VersionPatch = 0 // VersionDev indicates development branch. Releases will be empty string. - VersionDev = "-rc2" + VersionDev = "-dev" ) // Version is the specification version that the package types support. diff --git a/vendor/github.com/sylabs/sif/v2/LICENSE.md b/vendor/github.com/sylabs/sif/v2/LICENSE.md index dea3e409e1..9e825f695e 100644 --- a/vendor/github.com/sylabs/sif/v2/LICENSE.md +++ b/vendor/github.com/sylabs/sif/v2/LICENSE.md @@ -1,6 +1,6 @@ # LICENSE -Copyright (c) 2018-2022, Sylabs Inc. All rights reserved. +Copyright (c) 2018-2023, Sylabs Inc. All rights reserved. Redistribution and use in source and binary forms, with or without modification, are permitted provided that the following conditions are met: diff --git a/vendor/github.com/sylabs/sif/v2/pkg/sif/create.go b/vendor/github.com/sylabs/sif/v2/pkg/sif/create.go index 104e9ea1af..4d6cbb64d7 100644 --- a/vendor/github.com/sylabs/sif/v2/pkg/sif/create.go +++ b/vendor/github.com/sylabs/sif/v2/pkg/sif/create.go @@ -1,4 +1,4 @@ -// Copyright (c) 2018-2022, Sylabs Inc. All rights reserved. +// Copyright (c) 2018-2023, Sylabs Inc. All rights reserved. // Copyright (c) 2017, SingularityWare, LLC. All rights reserved. // Copyright (c) 2017, Yannick Cote All rights reserved. // This software is licensed under a 3-clause BSD license. Please consult the @@ -69,7 +69,7 @@ func (f *FileImage) writeDataObject(i int, di DescriptorInput, t time.Time) erro // If this is a primary partition, verify there isn't another primary partition, and update the // architecture in the global header. - if p, ok := di.opts.extra.(partition); ok && p.Parttype == PartPrimSys { + if p, ok := di.opts.md.(partition); ok && p.Parttype == PartPrimSys { if ds, err := f.GetDescriptors(WithPartitionType(PartPrimSys)); err == nil && len(ds) > 0 { return errPrimaryPartition } @@ -636,9 +636,6 @@ func (f *FileImage) SetPrimPart(id uint32, opts ...SetOpt) error { if err != nil && !errors.Is(err, ErrObjectNotFound) { return fmt.Errorf("%w", err) } - - f.h.Arch = getSIFArch(arch) - extra := partition{ Fstype: fs, Parttype: PartPrimSys, @@ -649,6 +646,8 @@ func (f *FileImage) SetPrimPart(id uint32, opts ...SetOpt) error { return fmt.Errorf("%w", err) } + descr.ModifiedAt = so.t.Unix() + if olddescr != nil { oldfs, _, oldarch, err := olddescr.getPartitionMetadata() if err != nil { @@ -664,12 +663,15 @@ func (f *FileImage) SetPrimPart(id uint32, opts ...SetOpt) error { if err := olddescr.setExtra(oldextra); err != nil { return fmt.Errorf("%w", err) } + + olddescr.ModifiedAt = so.t.Unix() } if err := f.writeDescriptors(); err != nil { return fmt.Errorf("%w", err) } + f.h.Arch = getSIFArch(arch) f.h.ModifiedAt = so.t.Unix() if err := f.writeHeader(); err != nil { diff --git a/vendor/github.com/sylabs/sif/v2/pkg/sif/descriptor.go b/vendor/github.com/sylabs/sif/v2/pkg/sif/descriptor.go index 8fa926a469..1927282471 100644 --- a/vendor/github.com/sylabs/sif/v2/pkg/sif/descriptor.go +++ b/vendor/github.com/sylabs/sif/v2/pkg/sif/descriptor.go @@ -1,4 +1,4 @@ -// Copyright (c) 2018-2022, Sylabs Inc. All rights reserved. +// Copyright (c) 2018-2023, Sylabs Inc. All rights reserved. // Copyright (c) 2017, SingularityWare, LLC. All rights reserved. // Copyright (c) 2017, Yannick Cote All rights reserved. // This software is licensed under a 3-clause BSD license. Please consult the @@ -10,6 +10,7 @@ package sif import ( "bytes" "crypto" + "encoding" "encoding/binary" "errors" "fmt" @@ -44,6 +45,11 @@ type partition struct { Arch archType } +// MarshalBinary encodes p into binary format. +func (p partition) MarshalBinary() ([]byte, error) { + return binaryMarshaler{p}.MarshalBinary() +} + // signature represents the SIF signature data object descriptor. type signature struct { Hashtype hashType @@ -61,6 +67,26 @@ type sbom struct { Format SBOMFormat } +// The binaryMarshaler type is an adapter that allows a type suitable for use with the +// encoding/binary package to be used as an encoding.BinaryMarshaler. +type binaryMarshaler struct{ any } + +// MarshalBinary encodes m into binary format. +func (m binaryMarshaler) MarshalBinary() ([]byte, error) { + var b bytes.Buffer + err := binary.Write(&b, binary.LittleEndian, m.any) + return b.Bytes(), err +} + +// The binaryUnmarshaler type is an adapter that allows a type suitable for use with the +// encoding/binary package to be used as an encoding.BinaryUnmarshaler. +type binaryUnmarshaler struct{ any } + +// UnmarshalBinary decodes b into u. +func (u binaryUnmarshaler) UnmarshalBinary(b []byte) error { + return binary.Read(bytes.NewReader(b), binary.LittleEndian, u.any) +} + var errNameTooLarge = errors.New("name value too large") // setName encodes name into the name field of d. @@ -78,28 +104,33 @@ func (d *rawDescriptor) setName(name string) error { var errExtraTooLarge = errors.New("extra value too large") -// setExtra encodes v into the extra field of d. -func (d *rawDescriptor) setExtra(v interface{}) error { - if v == nil { +// setExtra marshals metadata from md into the "extra" field of d. +func (d *rawDescriptor) setExtra(md encoding.BinaryMarshaler) error { + if md == nil { return nil } - if binary.Size(v) > len(d.Extra) { - return errExtraTooLarge - } - - b := new(bytes.Buffer) - if err := binary.Write(b, binary.LittleEndian, v); err != nil { + extra, err := md.MarshalBinary() + if err != nil { return err } - for i := copy(d.Extra[:], b.Bytes()); i < len(d.Extra); i++ { + if len(extra) > len(d.Extra) { + return errExtraTooLarge + } + + for i := copy(d.Extra[:], extra); i < len(d.Extra); i++ { d.Extra[i] = 0 } return nil } +// getExtra unmarshals metadata from the "extra" field of d into md. +func (d *rawDescriptor) getExtra(md encoding.BinaryUnmarshaler) error { + return md.UnmarshalBinary(d.Extra[:]) +} + // getPartitionMetadata gets metadata for a partition data object. func (d rawDescriptor) getPartitionMetadata() (FSType, PartType, string, error) { if got, want := d.DataType, DataPartition; got != want { @@ -108,9 +139,8 @@ func (d rawDescriptor) getPartitionMetadata() (FSType, PartType, string, error) var p partition - b := bytes.NewReader(d.Extra[:]) - if err := binary.Read(b, binary.LittleEndian, &p); err != nil { - return 0, 0, "", fmt.Errorf("%w", err) + if err := d.getExtra(binaryUnmarshaler{&p}); err != nil { + return 0, 0, "", err } return p.Fstype, p.Parttype, p.Arch.GoArch(), nil @@ -168,11 +198,23 @@ func (d Descriptor) ModifiedAt() time.Time { return time.Unix(d.raw.ModifiedAt, // Name returns the name of the data object. func (d Descriptor) Name() string { return strings.TrimRight(string(d.raw.Name[:]), "\000") } +// GetMetadata unmarshals metadata from the "extra" field of d into md. +func (d Descriptor) GetMetadata(md encoding.BinaryUnmarshaler) error { + if err := d.raw.getExtra(md); err != nil { + return fmt.Errorf("%w", err) + } + return nil +} + // PartitionMetadata gets metadata for a partition data object. // //nolint:nonamedreturns // Named returns effective as documentation. func (d Descriptor) PartitionMetadata() (fs FSType, pt PartType, arch string, err error) { - return d.raw.getPartitionMetadata() + fs, pt, arch, err = d.raw.getPartitionMetadata() + if err != nil { + return 0, 0, "", fmt.Errorf("%w", err) + } + return fs, pt, arch, err } var errHashUnsupported = errors.New("hash algorithm unsupported") @@ -204,8 +246,7 @@ func (d Descriptor) SignatureMetadata() (ht crypto.Hash, fp []byte, err error) { var s signature - b := bytes.NewReader(d.raw.Extra[:]) - if err := binary.Read(b, binary.LittleEndian, &s); err != nil { + if err := d.raw.getExtra(binaryUnmarshaler{&s}); err != nil { return ht, fp, fmt.Errorf("%w", err) } @@ -232,8 +273,7 @@ func (d Descriptor) CryptoMessageMetadata() (FormatType, MessageType, error) { var m cryptoMessage - b := bytes.NewReader(d.raw.Extra[:]) - if err := binary.Read(b, binary.LittleEndian, &m); err != nil { + if err := d.raw.getExtra(binaryUnmarshaler{&m}); err != nil { return 0, 0, fmt.Errorf("%w", err) } @@ -248,8 +288,7 @@ func (d Descriptor) SBOMMetadata() (SBOMFormat, error) { var s sbom - b := bytes.NewReader(d.raw.Extra[:]) - if err := binary.Read(b, binary.LittleEndian, &s); err != nil { + if err := d.raw.getExtra(binaryUnmarshaler{&s}); err != nil { return 0, fmt.Errorf("%w", err) } diff --git a/vendor/github.com/sylabs/sif/v2/pkg/sif/descriptor_input.go b/vendor/github.com/sylabs/sif/v2/pkg/sif/descriptor_input.go index 3e81c394fc..3cfe5c65e9 100644 --- a/vendor/github.com/sylabs/sif/v2/pkg/sif/descriptor_input.go +++ b/vendor/github.com/sylabs/sif/v2/pkg/sif/descriptor_input.go @@ -1,4 +1,4 @@ -// Copyright (c) 2021-2022, Sylabs Inc. All rights reserved. +// Copyright (c) 2021-2023, Sylabs Inc. All rights reserved. // This software is licensed under a 3-clause BSD license. Please consult the // LICENSE file distributed with the sources of this project regarding your // rights to use or distribute this software. @@ -7,6 +7,7 @@ package sif import ( "crypto" + "encoding" "errors" "fmt" "io" @@ -19,7 +20,7 @@ type descriptorOpts struct { linkID uint32 alignment int name string - extra interface{} + md encoding.BinaryMarshaler t time.Time } @@ -92,6 +93,14 @@ func OptObjectTime(t time.Time) DescriptorInputOpt { } } +// OptMetadata marshals metadata from md into the "extra" field of d. +func OptMetadata(md encoding.BinaryMarshaler) DescriptorInputOpt { + return func(t DataType, opts *descriptorOpts) error { + opts.md = md + return nil + } +} + type unexpectedDataTypeError struct { got DataType want []DataType @@ -155,7 +164,7 @@ func OptCryptoMessageMetadata(ft FormatType, mt MessageType) DescriptorInputOpt Messagetype: mt, } - opts.extra = m + opts.md = binaryMarshaler{m} return nil } } @@ -184,7 +193,7 @@ func OptPartitionMetadata(fs FSType, pt PartType, arch string) DescriptorInputOp Arch: sifarch, } - opts.extra = p + opts.md = p return nil } } @@ -221,7 +230,7 @@ func OptSignatureMetadata(ht crypto.Hash, fp []byte) DescriptorInputOpt { } copy(s.Entity[:], fp) - opts.extra = s + opts.md = binaryMarshaler{s} return nil } } @@ -239,7 +248,7 @@ func OptSBOMMetadata(f SBOMFormat) DescriptorInputOpt { Format: f, } - opts.extra = s + opts.md = binaryMarshaler{s} return nil } } @@ -259,7 +268,8 @@ const DefaultObjectGroup = 1 // // It is possible (and often necessary) to store additional metadata related to certain types of // data objects. Consider supplying options such as OptCryptoMessageMetadata, OptPartitionMetadata, -// OptSignatureMetadata, and OptSBOMMetadata for this purpose. +// OptSignatureMetadata, and OptSBOMMetadata for this purpose. To set custom metadata, use +// OptMetadata. // // By default, the data object will be placed in the default data object groupĀ (1). To override // this behavior, use OptNoGroup or OptGroupID. To link this data object, use OptLinkedID or @@ -317,5 +327,5 @@ func (di DescriptorInput) fillDescriptor(t time.Time, d *rawDescriptor) error { return err } - return d.setExtra(di.opts.extra) + return d.setExtra(di.opts.md) } diff --git a/vendor/golang.org/x/crypto/ssh/cipher.go b/vendor/golang.org/x/crypto/ssh/cipher.go index 87f48552ce..741e984f33 100644 --- a/vendor/golang.org/x/crypto/ssh/cipher.go +++ b/vendor/golang.org/x/crypto/ssh/cipher.go @@ -114,7 +114,8 @@ var cipherModes = map[string]*cipherMode{ "arcfour": {16, 0, streamCipherMode(0, newRC4)}, // AEAD ciphers - gcmCipherID: {16, 12, newGCMCipher}, + gcm128CipherID: {16, 12, newGCMCipher}, + gcm256CipherID: {32, 12, newGCMCipher}, chacha20Poly1305ID: {64, 0, newChaCha20Cipher}, // CBC mode is insecure and so is not included in the default config. diff --git a/vendor/golang.org/x/crypto/ssh/common.go b/vendor/golang.org/x/crypto/ssh/common.go index c7964275de..e6a77f26a0 100644 --- a/vendor/golang.org/x/crypto/ssh/common.go +++ b/vendor/golang.org/x/crypto/ssh/common.go @@ -28,7 +28,7 @@ const ( // supportedCiphers lists ciphers we support but might not recommend. var supportedCiphers = []string{ "aes128-ctr", "aes192-ctr", "aes256-ctr", - "aes128-gcm@openssh.com", + "aes128-gcm@openssh.com", gcm256CipherID, chacha20Poly1305ID, "arcfour256", "arcfour128", "arcfour", aes128cbcID, @@ -37,7 +37,7 @@ var supportedCiphers = []string{ // preferredCiphers specifies the default preference for ciphers. var preferredCiphers = []string{ - "aes128-gcm@openssh.com", + "aes128-gcm@openssh.com", gcm256CipherID, chacha20Poly1305ID, "aes128-ctr", "aes192-ctr", "aes256-ctr", } @@ -168,7 +168,7 @@ func (a *directionAlgorithms) rekeyBytes() int64 { // 2^(BLOCKSIZE/4) blocks. For all AES flavors BLOCKSIZE is // 128. switch a.Cipher { - case "aes128-ctr", "aes192-ctr", "aes256-ctr", gcmCipherID, aes128cbcID: + case "aes128-ctr", "aes192-ctr", "aes256-ctr", gcm128CipherID, gcm256CipherID, aes128cbcID: return 16 * (1 << 32) } @@ -178,7 +178,8 @@ func (a *directionAlgorithms) rekeyBytes() int64 { } var aeadCiphers = map[string]bool{ - gcmCipherID: true, + gcm128CipherID: true, + gcm256CipherID: true, chacha20Poly1305ID: true, } diff --git a/vendor/golang.org/x/crypto/ssh/transport.go b/vendor/golang.org/x/crypto/ssh/transport.go index acf5a21bbb..da015801ea 100644 --- a/vendor/golang.org/x/crypto/ssh/transport.go +++ b/vendor/golang.org/x/crypto/ssh/transport.go @@ -17,7 +17,8 @@ import ( const debugTransport = false const ( - gcmCipherID = "aes128-gcm@openssh.com" + gcm128CipherID = "aes128-gcm@openssh.com" + gcm256CipherID = "aes256-gcm@openssh.com" aes128cbcID = "aes128-cbc" tripledescbcID = "3des-cbc" ) diff --git a/vendor/golang.org/x/tools/go/types/objectpath/objectpath.go b/vendor/golang.org/x/tools/go/types/objectpath/objectpath.go new file mode 100644 index 0000000000..be8f5a867e --- /dev/null +++ b/vendor/golang.org/x/tools/go/types/objectpath/objectpath.go @@ -0,0 +1,762 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Package objectpath defines a naming scheme for types.Objects +// (that is, named entities in Go programs) relative to their enclosing +// package. +// +// Type-checker objects are canonical, so they are usually identified by +// their address in memory (a pointer), but a pointer has meaning only +// within one address space. By contrast, objectpath names allow the +// identity of an object to be sent from one program to another, +// establishing a correspondence between types.Object variables that are +// distinct but logically equivalent. +// +// A single object may have multiple paths. In this example, +// +// type A struct{ X int } +// type B A +// +// the field X has two paths due to its membership of both A and B. +// The For(obj) function always returns one of these paths, arbitrarily +// but consistently. +package objectpath + +import ( + "fmt" + "go/types" + "sort" + "strconv" + "strings" + + "golang.org/x/tools/internal/typeparams" + + _ "unsafe" // for go:linkname +) + +// A Path is an opaque name that identifies a types.Object +// relative to its package. Conceptually, the name consists of a +// sequence of destructuring operations applied to the package scope +// to obtain the original object. +// The name does not include the package itself. +type Path string + +// Encoding +// +// An object path is a textual and (with training) human-readable encoding +// of a sequence of destructuring operators, starting from a types.Package. +// The sequences represent a path through the package/object/type graph. +// We classify these operators by their type: +// +// PO package->object Package.Scope.Lookup +// OT object->type Object.Type +// TT type->type Type.{Elem,Key,Params,Results,Underlying} [EKPRU] +// TO type->object Type.{At,Field,Method,Obj} [AFMO] +// +// All valid paths start with a package and end at an object +// and thus may be defined by the regular language: +// +// objectpath = PO (OT TT* TO)* +// +// The concrete encoding follows directly: +// - The only PO operator is Package.Scope.Lookup, which requires an identifier. +// - The only OT operator is Object.Type, +// which we encode as '.' because dot cannot appear in an identifier. +// - The TT operators are encoded as [EKPRUTC]; +// one of these (TypeParam) requires an integer operand, +// which is encoded as a string of decimal digits. +// - The TO operators are encoded as [AFMO]; +// three of these (At,Field,Method) require an integer operand, +// which is encoded as a string of decimal digits. +// These indices are stable across different representations +// of the same package, even source and export data. +// The indices used are implementation specific and may not correspond to +// the argument to the go/types function. +// +// In the example below, +// +// package p +// +// type T interface { +// f() (a string, b struct{ X int }) +// } +// +// field X has the path "T.UM0.RA1.F0", +// representing the following sequence of operations: +// +// p.Lookup("T") T +// .Type().Underlying().Method(0). f +// .Type().Results().At(1) b +// .Type().Field(0) X +// +// The encoding is not maximally compact---every R or P is +// followed by an A, for example---but this simplifies the +// encoder and decoder. +const ( + // object->type operators + opType = '.' // .Type() (Object) + + // type->type operators + opElem = 'E' // .Elem() (Pointer, Slice, Array, Chan, Map) + opKey = 'K' // .Key() (Map) + opParams = 'P' // .Params() (Signature) + opResults = 'R' // .Results() (Signature) + opUnderlying = 'U' // .Underlying() (Named) + opTypeParam = 'T' // .TypeParams.At(i) (Named, Signature) + opConstraint = 'C' // .Constraint() (TypeParam) + + // type->object operators + opAt = 'A' // .At(i) (Tuple) + opField = 'F' // .Field(i) (Struct) + opMethod = 'M' // .Method(i) (Named or Interface; not Struct: "promoted" names are ignored) + opObj = 'O' // .Obj() (Named, TypeParam) +) + +// For returns the path to an object relative to its package, +// or an error if the object is not accessible from the package's Scope. +// +// The For function guarantees to return a path only for the following objects: +// - package-level types +// - exported package-level non-types +// - methods +// - parameter and result variables +// - struct fields +// These objects are sufficient to define the API of their package. +// The objects described by a package's export data are drawn from this set. +// +// For does not return a path for predeclared names, imported package +// names, local names, and unexported package-level names (except +// types). +// +// Example: given this definition, +// +// package p +// +// type T interface { +// f() (a string, b struct{ X int }) +// } +// +// For(X) would return a path that denotes the following sequence of operations: +// +// p.Scope().Lookup("T") (TypeName T) +// .Type().Underlying().Method(0). (method Func f) +// .Type().Results().At(1) (field Var b) +// .Type().Field(0) (field Var X) +// +// where p is the package (*types.Package) to which X belongs. +func For(obj types.Object) (Path, error) { + return newEncoderFor()(obj) +} + +// An encoder amortizes the cost of encoding the paths of multiple objects. +// Nonexported pending approval of proposal 58668. +type encoder struct { + scopeNamesMemo map[*types.Scope][]string // memoization of Scope.Names() + namedMethodsMemo map[*types.Named][]*types.Func // memoization of namedMethods() +} + +// Exposed to gopls via golang.org/x/tools/internal/typesinternal +// pending approval of proposal 58668. +// +//go:linkname newEncoderFor +func newEncoderFor() func(types.Object) (Path, error) { return new(encoder).For } + +func (enc *encoder) For(obj types.Object) (Path, error) { + pkg := obj.Pkg() + + // This table lists the cases of interest. + // + // Object Action + // ------ ------ + // nil reject + // builtin reject + // pkgname reject + // label reject + // var + // package-level accept + // func param/result accept + // local reject + // struct field accept + // const + // package-level accept + // local reject + // func + // package-level accept + // init functions reject + // concrete method accept + // interface method accept + // type + // package-level accept + // local reject + // + // The only accessible package-level objects are members of pkg itself. + // + // The cases are handled in four steps: + // + // 1. reject nil and builtin + // 2. accept package-level objects + // 3. reject obviously invalid objects + // 4. search the API for the path to the param/result/field/method. + + // 1. reference to nil or builtin? + if pkg == nil { + return "", fmt.Errorf("predeclared %s has no path", obj) + } + scope := pkg.Scope() + + // 2. package-level object? + if scope.Lookup(obj.Name()) == obj { + // Only exported objects (and non-exported types) have a path. + // Non-exported types may be referenced by other objects. + if _, ok := obj.(*types.TypeName); !ok && !obj.Exported() { + return "", fmt.Errorf("no path for non-exported %v", obj) + } + return Path(obj.Name()), nil + } + + // 3. Not a package-level object. + // Reject obviously non-viable cases. + switch obj := obj.(type) { + case *types.TypeName: + if _, ok := obj.Type().(*typeparams.TypeParam); !ok { + // With the exception of type parameters, only package-level type names + // have a path. + return "", fmt.Errorf("no path for %v", obj) + } + case *types.Const, // Only package-level constants have a path. + *types.Label, // Labels are function-local. + *types.PkgName: // PkgNames are file-local. + return "", fmt.Errorf("no path for %v", obj) + + case *types.Var: + // Could be: + // - a field (obj.IsField()) + // - a func parameter or result + // - a local var. + // Sadly there is no way to distinguish + // a param/result from a local + // so we must proceed to the find. + + case *types.Func: + // A func, if not package-level, must be a method. + if recv := obj.Type().(*types.Signature).Recv(); recv == nil { + return "", fmt.Errorf("func is not a method: %v", obj) + } + + if path, ok := enc.concreteMethod(obj); ok { + // Fast path for concrete methods that avoids looping over scope. + return path, nil + } + + default: + panic(obj) + } + + // 4. Search the API for the path to the var (field/param/result) or method. + + // First inspect package-level named types. + // In the presence of path aliases, these give + // the best paths because non-types may + // refer to types, but not the reverse. + empty := make([]byte, 0, 48) // initial space + names := enc.scopeNames(scope) + for _, name := range names { + o := scope.Lookup(name) + tname, ok := o.(*types.TypeName) + if !ok { + continue // handle non-types in second pass + } + + path := append(empty, name...) + path = append(path, opType) + + T := o.Type() + + if tname.IsAlias() { + // type alias + if r := find(obj, T, path, nil); r != nil { + return Path(r), nil + } + } else { + if named, _ := T.(*types.Named); named != nil { + if r := findTypeParam(obj, typeparams.ForNamed(named), path, nil); r != nil { + // generic named type + return Path(r), nil + } + } + // defined (named) type + if r := find(obj, T.Underlying(), append(path, opUnderlying), nil); r != nil { + return Path(r), nil + } + } + } + + // Then inspect everything else: + // non-types, and declared methods of defined types. + for _, name := range names { + o := scope.Lookup(name) + path := append(empty, name...) + if _, ok := o.(*types.TypeName); !ok { + if o.Exported() { + // exported non-type (const, var, func) + if r := find(obj, o.Type(), append(path, opType), nil); r != nil { + return Path(r), nil + } + } + continue + } + + // Inspect declared methods of defined types. + if T, ok := o.Type().(*types.Named); ok { + path = append(path, opType) + // Note that method index here is always with respect + // to canonical ordering of methods, regardless of how + // they appear in the underlying type. + for i, m := range enc.namedMethods(T) { + path2 := appendOpArg(path, opMethod, i) + if m == obj { + return Path(path2), nil // found declared method + } + if r := find(obj, m.Type(), append(path2, opType), nil); r != nil { + return Path(r), nil + } + } + } + } + + return "", fmt.Errorf("can't find path for %v in %s", obj, pkg.Path()) +} + +func appendOpArg(path []byte, op byte, arg int) []byte { + path = append(path, op) + path = strconv.AppendInt(path, int64(arg), 10) + return path +} + +// concreteMethod returns the path for meth, which must have a non-nil receiver. +// The second return value indicates success and may be false if the method is +// an interface method or if it is an instantiated method. +// +// This function is just an optimization that avoids the general scope walking +// approach. You are expected to fall back to the general approach if this +// function fails. +func (enc *encoder) concreteMethod(meth *types.Func) (Path, bool) { + // Concrete methods can only be declared on package-scoped named types. For + // that reason we can skip the expensive walk over the package scope: the + // path will always be package -> named type -> method. We can trivially get + // the type name from the receiver, and only have to look over the type's + // methods to find the method index. + // + // Methods on generic types require special consideration, however. Consider + // the following package: + // + // L1: type S[T any] struct{} + // L2: func (recv S[A]) Foo() { recv.Bar() } + // L3: func (recv S[B]) Bar() { } + // L4: type Alias = S[int] + // L5: func _[T any]() { var s S[int]; s.Foo() } + // + // The receivers of methods on generic types are instantiations. L2 and L3 + // instantiate S with the type-parameters A and B, which are scoped to the + // respective methods. L4 and L5 each instantiate S with int. Each of these + // instantiations has its own method set, full of methods (and thus objects) + // with receivers whose types are the respective instantiations. In other + // words, we have + // + // S[A].Foo, S[A].Bar + // S[B].Foo, S[B].Bar + // S[int].Foo, S[int].Bar + // + // We may thus be trying to produce object paths for any of these objects. + // + // S[A].Foo and S[B].Bar are the origin methods, and their paths are S.Foo + // and S.Bar, which are the paths that this function naturally produces. + // + // S[A].Bar, S[B].Foo, and both methods on S[int] are instantiations that + // don't correspond to the origin methods. For S[int], this is significant. + // The most precise object path for S[int].Foo, for example, is Alias.Foo, + // not S.Foo. Our function, however, would produce S.Foo, which would + // resolve to a different object. + // + // For S[A].Bar and S[B].Foo it could be argued that S.Bar and S.Foo are + // still the correct paths, since only the origin methods have meaningful + // paths. But this is likely only true for trivial cases and has edge cases. + // Since this function is only an optimization, we err on the side of giving + // up, deferring to the slower but definitely correct algorithm. Most users + // of objectpath will only be giving us origin methods, anyway, as referring + // to instantiated methods is usually not useful. + + if typeparams.OriginMethod(meth) != meth { + return "", false + } + + recvT := meth.Type().(*types.Signature).Recv().Type() + if ptr, ok := recvT.(*types.Pointer); ok { + recvT = ptr.Elem() + } + + named, ok := recvT.(*types.Named) + if !ok { + return "", false + } + + if types.IsInterface(named) { + // Named interfaces don't have to be package-scoped + // + // TODO(dominikh): opt: if scope.Lookup(name) == named, then we can apply this optimization to interface + // methods, too, I think. + return "", false + } + + // Preallocate space for the name, opType, opMethod, and some digits. + name := named.Obj().Name() + path := make([]byte, 0, len(name)+8) + path = append(path, name...) + path = append(path, opType) + for i, m := range enc.namedMethods(named) { + if m == meth { + path = appendOpArg(path, opMethod, i) + return Path(path), true + } + } + + panic(fmt.Sprintf("couldn't find method %s on type %s", meth, named)) +} + +// find finds obj within type T, returning the path to it, or nil if not found. +// +// The seen map is used to short circuit cycles through type parameters. If +// nil, it will be allocated as necessary. +func find(obj types.Object, T types.Type, path []byte, seen map[*types.TypeName]bool) []byte { + switch T := T.(type) { + case *types.Basic, *types.Named: + // Named types belonging to pkg were handled already, + // so T must belong to another package. No path. + return nil + case *types.Pointer: + return find(obj, T.Elem(), append(path, opElem), seen) + case *types.Slice: + return find(obj, T.Elem(), append(path, opElem), seen) + case *types.Array: + return find(obj, T.Elem(), append(path, opElem), seen) + case *types.Chan: + return find(obj, T.Elem(), append(path, opElem), seen) + case *types.Map: + if r := find(obj, T.Key(), append(path, opKey), seen); r != nil { + return r + } + return find(obj, T.Elem(), append(path, opElem), seen) + case *types.Signature: + if r := findTypeParam(obj, typeparams.ForSignature(T), path, seen); r != nil { + return r + } + if r := find(obj, T.Params(), append(path, opParams), seen); r != nil { + return r + } + return find(obj, T.Results(), append(path, opResults), seen) + case *types.Struct: + for i := 0; i < T.NumFields(); i++ { + fld := T.Field(i) + path2 := appendOpArg(path, opField, i) + if fld == obj { + return path2 // found field var + } + if r := find(obj, fld.Type(), append(path2, opType), seen); r != nil { + return r + } + } + return nil + case *types.Tuple: + for i := 0; i < T.Len(); i++ { + v := T.At(i) + path2 := appendOpArg(path, opAt, i) + if v == obj { + return path2 // found param/result var + } + if r := find(obj, v.Type(), append(path2, opType), seen); r != nil { + return r + } + } + return nil + case *types.Interface: + for i := 0; i < T.NumMethods(); i++ { + m := T.Method(i) + path2 := appendOpArg(path, opMethod, i) + if m == obj { + return path2 // found interface method + } + if r := find(obj, m.Type(), append(path2, opType), seen); r != nil { + return r + } + } + return nil + case *typeparams.TypeParam: + name := T.Obj() + if name == obj { + return append(path, opObj) + } + if seen[name] { + return nil + } + if seen == nil { + seen = make(map[*types.TypeName]bool) + } + seen[name] = true + if r := find(obj, T.Constraint(), append(path, opConstraint), seen); r != nil { + return r + } + return nil + } + panic(T) +} + +func findTypeParam(obj types.Object, list *typeparams.TypeParamList, path []byte, seen map[*types.TypeName]bool) []byte { + for i := 0; i < list.Len(); i++ { + tparam := list.At(i) + path2 := appendOpArg(path, opTypeParam, i) + if r := find(obj, tparam, path2, seen); r != nil { + return r + } + } + return nil +} + +// Object returns the object denoted by path p within the package pkg. +func Object(pkg *types.Package, p Path) (types.Object, error) { + if p == "" { + return nil, fmt.Errorf("empty path") + } + + pathstr := string(p) + var pkgobj, suffix string + if dot := strings.IndexByte(pathstr, opType); dot < 0 { + pkgobj = pathstr + } else { + pkgobj = pathstr[:dot] + suffix = pathstr[dot:] // suffix starts with "." + } + + obj := pkg.Scope().Lookup(pkgobj) + if obj == nil { + return nil, fmt.Errorf("package %s does not contain %q", pkg.Path(), pkgobj) + } + + // abstraction of *types.{Pointer,Slice,Array,Chan,Map} + type hasElem interface { + Elem() types.Type + } + // abstraction of *types.{Named,Signature} + type hasTypeParams interface { + TypeParams() *typeparams.TypeParamList + } + // abstraction of *types.{Named,TypeParam} + type hasObj interface { + Obj() *types.TypeName + } + + // The loop state is the pair (t, obj), + // exactly one of which is non-nil, initially obj. + // All suffixes start with '.' (the only object->type operation), + // followed by optional type->type operations, + // then a type->object operation. + // The cycle then repeats. + var t types.Type + for suffix != "" { + code := suffix[0] + suffix = suffix[1:] + + // Codes [AFM] have an integer operand. + var index int + switch code { + case opAt, opField, opMethod, opTypeParam: + rest := strings.TrimLeft(suffix, "0123456789") + numerals := suffix[:len(suffix)-len(rest)] + suffix = rest + i, err := strconv.Atoi(numerals) + if err != nil { + return nil, fmt.Errorf("invalid path: bad numeric operand %q for code %q", numerals, code) + } + index = int(i) + case opObj: + // no operand + default: + // The suffix must end with a type->object operation. + if suffix == "" { + return nil, fmt.Errorf("invalid path: ends with %q, want [AFMO]", code) + } + } + + if code == opType { + if t != nil { + return nil, fmt.Errorf("invalid path: unexpected %q in type context", opType) + } + t = obj.Type() + obj = nil + continue + } + + if t == nil { + return nil, fmt.Errorf("invalid path: code %q in object context", code) + } + + // Inv: t != nil, obj == nil + + switch code { + case opElem: + hasElem, ok := t.(hasElem) // Pointer, Slice, Array, Chan, Map + if !ok { + return nil, fmt.Errorf("cannot apply %q to %s (got %T, want pointer, slice, array, chan or map)", code, t, t) + } + t = hasElem.Elem() + + case opKey: + mapType, ok := t.(*types.Map) + if !ok { + return nil, fmt.Errorf("cannot apply %q to %s (got %T, want map)", code, t, t) + } + t = mapType.Key() + + case opParams: + sig, ok := t.(*types.Signature) + if !ok { + return nil, fmt.Errorf("cannot apply %q to %s (got %T, want signature)", code, t, t) + } + t = sig.Params() + + case opResults: + sig, ok := t.(*types.Signature) + if !ok { + return nil, fmt.Errorf("cannot apply %q to %s (got %T, want signature)", code, t, t) + } + t = sig.Results() + + case opUnderlying: + named, ok := t.(*types.Named) + if !ok { + return nil, fmt.Errorf("cannot apply %q to %s (got %T, want named)", code, t, t) + } + t = named.Underlying() + + case opTypeParam: + hasTypeParams, ok := t.(hasTypeParams) // Named, Signature + if !ok { + return nil, fmt.Errorf("cannot apply %q to %s (got %T, want named or signature)", code, t, t) + } + tparams := hasTypeParams.TypeParams() + if n := tparams.Len(); index >= n { + return nil, fmt.Errorf("tuple index %d out of range [0-%d)", index, n) + } + t = tparams.At(index) + + case opConstraint: + tparam, ok := t.(*typeparams.TypeParam) + if !ok { + return nil, fmt.Errorf("cannot apply %q to %s (got %T, want type parameter)", code, t, t) + } + t = tparam.Constraint() + + case opAt: + tuple, ok := t.(*types.Tuple) + if !ok { + return nil, fmt.Errorf("cannot apply %q to %s (got %T, want tuple)", code, t, t) + } + if n := tuple.Len(); index >= n { + return nil, fmt.Errorf("tuple index %d out of range [0-%d)", index, n) + } + obj = tuple.At(index) + t = nil + + case opField: + structType, ok := t.(*types.Struct) + if !ok { + return nil, fmt.Errorf("cannot apply %q to %s (got %T, want struct)", code, t, t) + } + if n := structType.NumFields(); index >= n { + return nil, fmt.Errorf("field index %d out of range [0-%d)", index, n) + } + obj = structType.Field(index) + t = nil + + case opMethod: + switch t := t.(type) { + case *types.Interface: + if index >= t.NumMethods() { + return nil, fmt.Errorf("method index %d out of range [0-%d)", index, t.NumMethods()) + } + obj = t.Method(index) // Id-ordered + + case *types.Named: + methods := namedMethods(t) // (unmemoized) + if index >= len(methods) { + return nil, fmt.Errorf("method index %d out of range [0-%d)", index, len(methods)) + } + obj = methods[index] // Id-ordered + + default: + return nil, fmt.Errorf("cannot apply %q to %s (got %T, want interface or named)", code, t, t) + } + t = nil + + case opObj: + hasObj, ok := t.(hasObj) + if !ok { + return nil, fmt.Errorf("cannot apply %q to %s (got %T, want named or type param)", code, t, t) + } + obj = hasObj.Obj() + t = nil + + default: + return nil, fmt.Errorf("invalid path: unknown code %q", code) + } + } + + if obj.Pkg() != pkg { + return nil, fmt.Errorf("path denotes %s, which belongs to a different package", obj) + } + + return obj, nil // success +} + +// namedMethods returns the methods of a Named type in ascending Id order. +func namedMethods(named *types.Named) []*types.Func { + methods := make([]*types.Func, named.NumMethods()) + for i := range methods { + methods[i] = named.Method(i) + } + sort.Slice(methods, func(i, j int) bool { + return methods[i].Id() < methods[j].Id() + }) + return methods +} + +// scopeNames is a memoization of scope.Names. Callers must not modify the result. +func (enc *encoder) scopeNames(scope *types.Scope) []string { + m := enc.scopeNamesMemo + if m == nil { + m = make(map[*types.Scope][]string) + enc.scopeNamesMemo = m + } + names, ok := m[scope] + if !ok { + names = scope.Names() // allocates and sorts + m[scope] = names + } + return names +} + +// namedMethods is a memoization of the namedMethods function. Callers must not modify the result. +func (enc *encoder) namedMethods(named *types.Named) []*types.Func { + m := enc.namedMethodsMemo + if m == nil { + m = make(map[*types.Named][]*types.Func) + enc.namedMethodsMemo = m + } + methods, ok := m[named] + if !ok { + methods = namedMethods(named) // allocates and sorts + m[named] = methods + } + return methods + +} diff --git a/vendor/golang.org/x/tools/internal/gcimporter/gcimporter.go b/vendor/golang.org/x/tools/internal/gcimporter/gcimporter.go index 0372fb3a64..a973dece93 100644 --- a/vendor/golang.org/x/tools/internal/gcimporter/gcimporter.go +++ b/vendor/golang.org/x/tools/internal/gcimporter/gcimporter.go @@ -7,6 +7,18 @@ // Package gcimporter provides various functions for reading // gc-generated object files that can be used to implement the // Importer interface defined by the Go 1.5 standard library package. +// +// The encoding is deterministic: if the encoder is applied twice to +// the same types.Package data structure, both encodings are equal. +// This property may be important to avoid spurious changes in +// applications such as build systems. +// +// However, the encoder is not necessarily idempotent. Importing an +// exported package may yield a types.Package that, while it +// represents the same set of Go types as the original, may differ in +// the details of its internal representation. Because of these +// differences, re-encoding the imported package may yield a +// different, but equally valid, encoding of the package. package gcimporter // import "golang.org/x/tools/internal/gcimporter" import ( diff --git a/vendor/golang.org/x/tools/internal/gcimporter/ureader_yes.go b/vendor/golang.org/x/tools/internal/gcimporter/ureader_yes.go index b285a11ce2..34fc783f82 100644 --- a/vendor/golang.org/x/tools/internal/gcimporter/ureader_yes.go +++ b/vendor/golang.org/x/tools/internal/gcimporter/ureader_yes.go @@ -12,6 +12,7 @@ package gcimporter import ( "go/token" "go/types" + "sort" "strings" "golang.org/x/tools/internal/pkgbits" @@ -121,6 +122,16 @@ func readUnifiedPackage(fset *token.FileSet, ctxt *types.Context, imports map[st iface.Complete() } + // Imports() of pkg are all of the transitive packages that were loaded. + var imps []*types.Package + for _, imp := range pr.pkgs { + if imp != nil && imp != pkg { + imps = append(imps, imp) + } + } + sort.Sort(byPath(imps)) + pkg.SetImports(imps) + pkg.MarkComplete() return pkg } @@ -260,39 +271,9 @@ func (r *reader) doPkg() *types.Package { pkg := types.NewPackage(path, name) r.p.imports[path] = pkg - imports := make([]*types.Package, r.Len()) - for i := range imports { - imports[i] = r.pkg() - } - pkg.SetImports(flattenImports(imports)) - return pkg } -// flattenImports returns the transitive closure of all imported -// packages rooted from pkgs. -func flattenImports(pkgs []*types.Package) []*types.Package { - var res []*types.Package - seen := make(map[*types.Package]struct{}) - for _, pkg := range pkgs { - if _, ok := seen[pkg]; ok { - continue - } - seen[pkg] = struct{}{} - res = append(res, pkg) - - // pkg.Imports() is already flattened. - for _, pkg := range pkg.Imports() { - if _, ok := seen[pkg]; ok { - continue - } - seen[pkg] = struct{}{} - res = append(res, pkg) - } - } - return res -} - // @@@ Types func (r *reader) typ() types.Type { diff --git a/vendor/golang.org/x/tools/internal/typeparams/common.go b/vendor/golang.org/x/tools/internal/typeparams/common.go index 25a1426d30..cfba8189f1 100644 --- a/vendor/golang.org/x/tools/internal/typeparams/common.go +++ b/vendor/golang.org/x/tools/internal/typeparams/common.go @@ -87,7 +87,6 @@ func IsTypeParam(t types.Type) bool { func OriginMethod(fn *types.Func) *types.Func { recv := fn.Type().(*types.Signature).Recv() if recv == nil { - return fn } base := recv.Type() diff --git a/vendor/golang.org/x/tools/internal/typesinternal/types.go b/vendor/golang.org/x/tools/internal/typesinternal/types.go index ce7d4351b2..3c53fbc63b 100644 --- a/vendor/golang.org/x/tools/internal/typesinternal/types.go +++ b/vendor/golang.org/x/tools/internal/typesinternal/types.go @@ -11,6 +11,8 @@ import ( "go/types" "reflect" "unsafe" + + "golang.org/x/tools/go/types/objectpath" ) func SetUsesCgo(conf *types.Config) bool { @@ -50,3 +52,10 @@ func ReadGo116ErrorData(err types.Error) (code ErrorCode, start, end token.Pos, } var SetGoVersion = func(conf *types.Config, version string) bool { return false } + +// NewObjectpathEncoder returns a function closure equivalent to +// objectpath.For but amortized for multiple (sequential) calls. +// It is a temporary workaround, pending the approval of proposal 58668. +// +//go:linkname NewObjectpathFunc golang.org/x/tools/go/types/objectpath.newEncoderFor +func NewObjectpathFunc() func(types.Object) (objectpath.Path, error) diff --git a/vendor/modules.txt b/vendor/modules.txt index 93ddcce9ba..b51cf66733 100644 --- a/vendor/modules.txt +++ b/vendor/modules.txt @@ -12,10 +12,10 @@ github.com/Microsoft/go-winio github.com/Microsoft/go-winio/backuptar github.com/Microsoft/go-winio/internal/socket github.com/Microsoft/go-winio/pkg/guid -github.com/Microsoft/go-winio/pkg/security +github.com/Microsoft/go-winio/tools/mkwinsyscall github.com/Microsoft/go-winio/vhd -# github.com/Microsoft/hcsshim v0.9.7 -## explicit; go 1.13 +# github.com/Microsoft/hcsshim v0.10.0-rc.7 +## explicit; go 1.18 github.com/Microsoft/hcsshim github.com/Microsoft/hcsshim/computestorage github.com/Microsoft/hcsshim/internal/cow @@ -29,10 +29,13 @@ github.com/Microsoft/hcsshim/internal/jobobject github.com/Microsoft/hcsshim/internal/log github.com/Microsoft/hcsshim/internal/logfields github.com/Microsoft/hcsshim/internal/longpath +github.com/Microsoft/hcsshim/internal/memory github.com/Microsoft/hcsshim/internal/mergemaps github.com/Microsoft/hcsshim/internal/oc +github.com/Microsoft/hcsshim/internal/protocol/guestrequest github.com/Microsoft/hcsshim/internal/queue github.com/Microsoft/hcsshim/internal/safefile +github.com/Microsoft/hcsshim/internal/security github.com/Microsoft/hcsshim/internal/timeout github.com/Microsoft/hcsshim/internal/vmcompute github.com/Microsoft/hcsshim/internal/wclayer @@ -69,16 +72,16 @@ github.com/chzyer/readline github.com/container-orchestrated-devices/container-device-interface/internal/multierror github.com/container-orchestrated-devices/container-device-interface/pkg/cdi github.com/container-orchestrated-devices/container-device-interface/specs-go -# github.com/containerd/cgroups v1.0.4 +# github.com/containerd/cgroups v1.1.0 ## explicit; go 1.17 github.com/containerd/cgroups/stats/v1 -# github.com/containerd/containerd v1.6.19 -## explicit; go 1.17 +# github.com/containerd/containerd v1.7.0 +## explicit; go 1.19 github.com/containerd/containerd/errdefs github.com/containerd/containerd/log github.com/containerd/containerd/pkg/userns github.com/containerd/containerd/platforms -# github.com/containerd/stargz-snapshotter/estargz v0.14.1 +# github.com/containerd/stargz-snapshotter/estargz v0.14.3 ## explicit; go 1.19 github.com/containerd/stargz-snapshotter/estargz github.com/containerd/stargz-snapshotter/estargz/errorutil @@ -120,7 +123,7 @@ github.com/containers/buildah/pkg/rusage github.com/containers/buildah/pkg/sshagent github.com/containers/buildah/pkg/util github.com/containers/buildah/util -# github.com/containers/common v0.51.1-0.20230228180151-18c4568e8ee0 +# github.com/containers/common v0.51.1-0.20230316131336-0be880eaeb02 ## explicit; go 1.18 github.com/containers/common/libimage github.com/containers/common/libimage/define @@ -174,7 +177,7 @@ github.com/containers/common/version # github.com/containers/conmon v2.0.20+incompatible ## explicit github.com/containers/conmon/runner/config -# github.com/containers/image/v5 v5.24.3-0.20230228100948-357cacd18f3d +# github.com/containers/image/v5 v5.24.3-0.20230314083015-0c6d07e02a9a ## explicit; go 1.18 github.com/containers/image/v5/copy github.com/containers/image/v5/directory @@ -276,7 +279,7 @@ github.com/containers/psgo/internal/dev github.com/containers/psgo/internal/host github.com/containers/psgo/internal/proc github.com/containers/psgo/internal/process -# github.com/containers/storage v1.45.5-0.20230228091016-4f0adb63ba4a +# github.com/containers/storage v1.45.5-0.20230315220505-1c6287eea927 ## explicit; go 1.17 github.com/containers/storage github.com/containers/storage/drivers @@ -505,7 +508,7 @@ github.com/gogo/protobuf/protoc-gen-gogo/descriptor # github.com/golang/groupcache v0.0.0-20210331224755-41bb18bfe9da ## explicit github.com/golang/groupcache/lru -# github.com/golang/protobuf v1.5.2 +# github.com/golang/protobuf v1.5.3 ## explicit; go 1.9 github.com/golang/protobuf/jsonpb github.com/golang/protobuf/proto @@ -577,7 +580,7 @@ github.com/josharian/intern # github.com/json-iterator/go v1.1.12 ## explicit; go 1.12 github.com/json-iterator/go -# github.com/klauspost/compress v1.16.0 +# github.com/klauspost/compress v1.16.3 ## explicit; go 1.18 github.com/klauspost/compress github.com/klauspost/compress/flate @@ -687,7 +690,7 @@ github.com/onsi/ginkgo/reporters/stenographer github.com/onsi/ginkgo/reporters/stenographer/support/go-colorable github.com/onsi/ginkgo/reporters/stenographer/support/go-isatty github.com/onsi/ginkgo/types -# github.com/onsi/gomega v1.27.2 +# github.com/onsi/gomega v1.27.4 ## explicit; go 1.18 github.com/onsi/gomega github.com/onsi/gomega/format @@ -706,7 +709,7 @@ github.com/onsi/gomega/types # github.com/opencontainers/go-digest v1.0.0 ## explicit; go 1.13 github.com/opencontainers/go-digest -# github.com/opencontainers/image-spec v1.1.0-rc2 +# github.com/opencontainers/image-spec v1.1.0-rc2.0.20221005185240-3a7f492d3f1b ## explicit; go 1.17 github.com/opencontainers/image-spec/specs-go github.com/opencontainers/image-spec/specs-go/v1 @@ -802,7 +805,7 @@ github.com/sigstore/rekor/pkg/generated/client/pubkey github.com/sigstore/rekor/pkg/generated/client/tlog github.com/sigstore/rekor/pkg/generated/models github.com/sigstore/rekor/pkg/util -# github.com/sigstore/sigstore v1.5.2 +# github.com/sigstore/sigstore v1.6.0 ## explicit; go 1.18 github.com/sigstore/sigstore/pkg/cryptoutils github.com/sigstore/sigstore/pkg/oauth @@ -830,7 +833,7 @@ github.com/stefanberger/go-pkcs11uri ## explicit; go 1.13 github.com/stretchr/testify/assert github.com/stretchr/testify/require -# github.com/sylabs/sif/v2 v2.10.0 +# github.com/sylabs/sif/v2 v2.11.0 ## explicit; go 1.19 github.com/sylabs/sif/v2/pkg/sif # github.com/syndtr/gocapability v0.0.0-20200815063812-42c35b437635 @@ -899,7 +902,7 @@ go.opencensus.io/internal go.opencensus.io/trace go.opencensus.io/trace/internal go.opencensus.io/trace/tracestate -# golang.org/x/crypto v0.6.0 +# golang.org/x/crypto v0.7.0 ## explicit; go 1.17 golang.org/x/crypto/blowfish golang.org/x/crypto/cast5 @@ -925,12 +928,12 @@ golang.org/x/crypto/ssh golang.org/x/crypto/ssh/agent golang.org/x/crypto/ssh/internal/bcrypt_pbkdf golang.org/x/crypto/ssh/knownhosts -# golang.org/x/exp v0.0.0-20230206171751-46f607a40771 +# golang.org/x/exp v0.0.0-20230310171629-522b1b587ee0 ## explicit; go 1.18 golang.org/x/exp/constraints golang.org/x/exp/maps golang.org/x/exp/slices -# golang.org/x/mod v0.8.0 +# golang.org/x/mod v0.9.0 ## explicit; go 1.17 golang.org/x/mod/semver golang.org/x/mod/sumdb/note @@ -948,7 +951,7 @@ golang.org/x/net/internal/socks golang.org/x/net/internal/timeseries golang.org/x/net/proxy golang.org/x/net/trace -# golang.org/x/oauth2 v0.5.0 +# golang.org/x/oauth2 v0.6.0 ## explicit; go 1.17 golang.org/x/oauth2 golang.org/x/oauth2/internal @@ -991,12 +994,13 @@ golang.org/x/text/secure/bidirule golang.org/x/text/transform golang.org/x/text/unicode/bidi golang.org/x/text/unicode/norm -# golang.org/x/tools v0.6.0 +# golang.org/x/tools v0.7.0 ## explicit; go 1.18 golang.org/x/tools/cmd/stringer golang.org/x/tools/go/gcexportdata golang.org/x/tools/go/internal/packagesdriver golang.org/x/tools/go/packages +golang.org/x/tools/go/types/objectpath golang.org/x/tools/internal/event golang.org/x/tools/internal/event/core golang.org/x/tools/internal/event/keys @@ -1017,7 +1021,7 @@ google.golang.org/appengine/internal/log google.golang.org/appengine/internal/remote_api google.golang.org/appengine/internal/urlfetch google.golang.org/appengine/urlfetch -# google.golang.org/genproto v0.0.0-20230209215440-0dfe4f8abfcc +# google.golang.org/genproto v0.0.0-20230306155012-7f2fa6fef1f4 ## explicit; go 1.19 google.golang.org/genproto/googleapis/rpc/status # google.golang.org/grpc v1.53.0