Bump to Buildah v1.11.5

Bump to Buildah v1.11.5.  Most notably changes to the
podman build `--pull` functionality.  `--pull=true` and `--pull=false` now
work as Docker does, `--pull-never` added to supply the functionality
of the old `--pull=false`.

Signed-off-by: TomSweeneyRedHat <tsweeney@redhat.com>

completions/bash/podman

@@ -1244,6 +1244,7 @@ _podman_build() {
 	  --no-cache
 	  --pull
 	  --pull-always
+	  --pull-never
 	  --quiet
 	  -q
 	  --rm

docs/source/markdown/podman-build.1.md

@@ -342,8 +342,8 @@ than the one in storage. Raise an error if the image is not in any listed
 registry and is not present locally.
 
 If the flag is disabled (with *--pull=false*), do not pull the image from the
-registry, use only the local version. Raise an error if the image is not
+registry, unless there is no local image. Raise an error if the image is not
-present locally.
+in any registry and is not present locally.
 
 Defaults to *true*.
 
@@ -352,6 +352,11 @@ Defaults to *true*.
 Pull the image from the first registry it is found in as listed in registries.conf.
 Raise an error if not found in the registries, even if the image is present locally.
 
+**--pull-never**
+
+Do not pull the image from the registry, use only the local version. Raise an error
+if the image is not present locally.
+
 **--quiet**, **-q**
 
 Suppress output messages which indicate which instruction is being processed,

go.mod

@@ -8,10 +8,9 @@ require (
 	github.com/buger/goterm v0.0.0-20181115115552-c206103e1f37
 	github.com/checkpoint-restore/go-criu v0.0.0-20190109184317-bdb7599cd87b
 	github.com/codahale/hdrhistogram v0.0.0-20161010025455-3a0bb77429bd // indirect
-	github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc // indirect
 	github.com/containernetworking/cni v0.7.2-0.20190904153231-83439463f784
 	github.com/containernetworking/plugins v0.8.2
-	github.com/containers/buildah v1.11.5-0.20191031204705-20e92ffe0982
+	github.com/containers/buildah v1.11.5
 	github.com/containers/conmon v2.0.2+incompatible // indirect
 	github.com/containers/image/v5 v5.0.0
 	github.com/containers/psgo v1.3.2
@@ -22,7 +21,7 @@ require (
 	github.com/cyphar/filepath-securejoin v0.2.2
 	github.com/davecgh/go-spew v1.1.1
 	github.com/docker/distribution v2.7.1+incompatible
-	github.com/docker/docker v1.4.2-0.20190927142053-ada3c14355ce
+	github.com/docker/docker v1.4.2-0.20191101170500-ac7306503d23
 	github.com/docker/docker-credential-helpers v0.6.3
 	github.com/docker/go-connections v0.4.0
 	github.com/docker/go-units v0.4.0
@@ -33,7 +32,7 @@ require (
 	github.com/fatih/camelcase v1.0.0
 	github.com/fsnotify/fsnotify v1.4.7
 	github.com/ghodss/yaml v1.0.0
-	github.com/godbus/dbus v0.0.0-20181101234600-2ff6f7ffd60f
+	github.com/godbus/dbus v0.0.0-20190422162347-ade71ed3457e
 	github.com/google/shlex v0.0.0-20181106134648-c34317bd91bf
 	github.com/hashicorp/go-multierror v1.0.0
 	github.com/hpcloud/tail v1.0.0
@@ -68,7 +67,7 @@ require (
 	golang.org/x/crypto v0.0.0-20190927123631-a832865fa7ad
 	golang.org/x/oauth2 v0.0.0-20190604053449-0f29369cfe45 // indirect
 	golang.org/x/sync v0.0.0-20190423024810-112230192c58
-	golang.org/x/sys v0.0.0-20190902133755-9109b7679e13
+	golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3
 	google.golang.org/appengine v1.6.1 // indirect
 	google.golang.org/genproto v0.0.0-20190620144150-6af8c5fc6601 // indirect
 	gopkg.in/inf.v0 v0.9.1 // indirect

go.sum

@@ -15,8 +15,12 @@ github.com/Microsoft/go-winio v0.4.12 h1:xAfWHN1IrQ0NJ9TBC0KBZoqLjzDTr1ML+4MywiU
 github.com/Microsoft/go-winio v0.4.12/go.mod h1:VhR8bwka0BXejwEJY73c50VrPtXAaKcyvVC4A4RozmA=
 github.com/Microsoft/go-winio v0.4.14 h1:+hMXMk01us9KgxGb7ftKQt2Xpf5hH/yky+TDA+qxleU=
 github.com/Microsoft/go-winio v0.4.14/go.mod h1:qXqCSQ3Xa7+6tgxaGTIe4Kpcdsi+P8jBhyzoq1bpyYA=
+github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5 h1:ygIc8M6trr62pF5DucadTWGdEB4mEyvzi0e2nbcmcyA=
+github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5/go.mod h1:tTuCMEN+UleMWgg9dVx4Hu52b1bJo+59jBh3ajtinzw=
 github.com/Microsoft/hcsshim v0.8.6 h1:ZfF0+zZeYdzMIVMZHKtDKJvLHj76XCuVae/jNkjj0IA=
 github.com/Microsoft/hcsshim v0.8.6/go.mod h1:Op3hHsoHPAvb6lceZHDtd9OkTew38wNoXnJs8iY7rUg=
+github.com/Microsoft/hcsshim v0.8.7-0.20191101173118-65519b62243c h1:YMP6olTU903X3gxQJckdmiP8/zkSMq4kN3uipsU9XjU=
+github.com/Microsoft/hcsshim v0.8.7-0.20191101173118-65519b62243c/go.mod h1:7xhjOwRV2+0HXGmM0jxaEu+ZiXJFoVZOTfL/dmqbrD8=
 github.com/NYTimes/gziphandler v0.0.0-20170623195520-56545f4a5d46/go.mod h1:3wb06e3pkSAbeQ52E9H9iFoQsEEwGN64994WTCIhntQ=
 github.com/PuerkitoBio/purell v1.0.0/go.mod h1:c11w/QuzBsJSee3cPx9rAFu61PvFxuPbtSwDGJws/X0=
 github.com/PuerkitoBio/urlesc v0.0.0-20160726150825-5bd2802263f2/go.mod h1:uGdkoq3SwY9Y+13GIhn11/XLaGBb4BfwItxLd5jeuXE=
@@ -31,6 +35,7 @@ github.com/beorn7/perks v1.0.0 h1:HWo1m869IqiPhD389kmkxeTalrjNbbJTC8LXupb+sl0=
 github.com/beorn7/perks v1.0.0/go.mod h1:KWe93zE9D1o94FZ5RNwFwVgaQK1VOXiVxmqh+CedLV8=
 github.com/beorn7/perks v1.0.1 h1:VlbKKnNfV8bJzeqoa4cOKqO6bYr3WgKZxO8Z16+hsOM=
 github.com/beorn7/perks v1.0.1/go.mod h1:G2ZrVWU2WbWT9wwq4/hrbKbnv/1ERSJQ0ibhJ6rlkpw=
+github.com/blang/semver v3.1.0+incompatible/go.mod h1:kRBLl5iJ+tD4TcOOxsy/0fnwebNt5EWlYSAyrTnjyyk=
 github.com/blang/semver v3.5.0+incompatible h1:CGxCgetQ64DKk7rdZ++Vfnb1+ogGNnB17OJKJXD2Cfs=
 github.com/blang/semver v3.5.0+incompatible/go.mod h1:kRBLl5iJ+tD4TcOOxsy/0fnwebNt5EWlYSAyrTnjyyk=
 github.com/blang/semver v3.5.1+incompatible h1:cQNTCjp13qL8KC3Nbxr/y2Bqb63oX6wdnnjpJbkM4JQ=
@@ -43,6 +48,10 @@ github.com/checkpoint-restore/go-criu v0.0.0-20190109184317-bdb7599cd87b/go.mod
 github.com/client9/misspell v0.3.4/go.mod h1:qj6jICC3Q7zFZvVWo7KLAzC3yx5G7kyvSDkc90ppPyw=
 github.com/codahale/hdrhistogram v0.0.0-20161010025455-3a0bb77429bd h1:qMd81Ts1T2OTKmB4acZcyKaMtRnY5Y44NuXGX2GFJ1w=
 github.com/codahale/hdrhistogram v0.0.0-20161010025455-3a0bb77429bd/go.mod h1:sE/e/2PUdi/liOCUjSTXgM1o87ZssimdTWN964YiIeI=
+github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f h1:tSNMc+rJDfmYntojat8lljbt1mgKNpTxUZJsSzJ9Y1s=
+github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f/go.mod h1:OApqhQ4XNSNC13gXIwDjhOQxjWa/NxkwZXJ1EvqT0ko=
+github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1/go.mod h1:Tj/on1eG8kiEhd0+fhSDzsPAFESxzBBvdyEgyryXffw=
+github.com/containerd/containerd v1.3.0-beta.2.0.20190828155532-0293cbd26c69/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA=
 github.com/containerd/containerd v1.3.0 h1:xjvXQWABwS2uiv3TWgQt5Uth60Gu86LTGZXMJkjc7rY=
 github.com/containerd/containerd v1.3.0/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA=
 github.com/containerd/continuity v0.0.0-20180216233310-d8fb8589b0e8/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y=
@@ -50,6 +59,10 @@ github.com/containerd/continuity v0.0.0-20181203112020-004b46473808 h1:4BX8f882b
 github.com/containerd/continuity v0.0.0-20181203112020-004b46473808/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y=
 github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc h1:TP+534wVlf61smEIq1nwLLAjQVEK2EADoW3CX9AuT+8=
 github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y=
+github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448/go.mod h1:ODA38xgv3Kuk8dQz2ZQXpnv/UZZUHUCL7pnLehbXgQI=
+github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3/go.mod h1:IV7qH3hrUgRmyYrtgEeGWJfWbgcHL9CSRruz2Vqcph0=
+github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de/go.mod h1:PvCDdDGpgqzQIzDW1TphrGLssLDZp2GuS+X5DkEJB8o=
+github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd/go.mod h1:Cm3kwCdlkCfMSHURc+r6fwoGH6/F1hH3S4sg0rLFWPc=
 github.com/containernetworking/cni v0.7.0/go.mod h1:LGwApLUm2FpoOfxTDEeq8T9ipbpZ61X79hmU3w8FmsY=
 github.com/containernetworking/cni v0.7.1 h1:fE3r16wpSEyaqY4Z4oFrLMmIGfBYIKpPrHK31EJ9FzE=
 github.com/containernetworking/cni v0.7.1/go.mod h1:LGwApLUm2FpoOfxTDEeq8T9ipbpZ61X79hmU3w8FmsY=
@@ -61,6 +74,8 @@ github.com/containers/buildah v1.11.4-0.20191028173731-21b4778b359e h1:iDavHEx5Y
 github.com/containers/buildah v1.11.4-0.20191028173731-21b4778b359e/go.mod h1:Igrk75FAxLnzDaHUbtpWB8pwL+Bv+cnakWMvqAXW2v8=
 github.com/containers/buildah v1.11.5-0.20191031204705-20e92ffe0982 h1:5WUe09k2sJSbmxwLHZLHc41TrIPrP0GlbhX+WDJBqvs=
 github.com/containers/buildah v1.11.5-0.20191031204705-20e92ffe0982/go.mod h1:eGWB4tLoo0hIBuytQpvgUC0hk2mvl2ofaYBeDsU/qoc=
+github.com/containers/buildah v1.11.5 h1:bVpkaVlvA7G+1mBDAcX6yf7jNZJ/ZrrAHDt4WCx2i8E=
+github.com/containers/buildah v1.11.5/go.mod h1:bfNPqLO8GnI0qMPmI6MHSpQNK+a3TH9syYsRg+iqhRw=
 github.com/containers/conmon v2.0.2+incompatible h1:h2HCdd/EBpwFn7RT82Y2GyXnVUHWxk1Jm4cESSZG4P8=
 github.com/containers/conmon v2.0.2+incompatible/go.mod h1:hgwZ2mtuDrppv78a/cOBNiCm6O0UMWGx1mu7P00nu5I=
 github.com/containers/image/v5 v5.0.0 h1:arnXgbt1ucsC/ndtSpiQY87rA0UjhF+/xQnPzqdBDn4=
@@ -80,6 +95,7 @@ github.com/coreos/go-iptables v0.4.2/go.mod h1:/mVI274lEDI2ns62jHCDnCyBF9Iwsmeka
 github.com/coreos/go-semver v0.2.0/go.mod h1:nnelYz7RCh+5ahJtPPxZlU+153eP4D4r3EedlOD2RNk=
 github.com/coreos/go-systemd v0.0.0-20180511133405-39ca1b05acc7 h1:u9SHYsPQNyt5tgDm3YN7+9dYrpK96E5wFilTFWIDZOM=
 github.com/coreos/go-systemd v0.0.0-20180511133405-39ca1b05acc7/go.mod h1:F5haX7vjVVG0kc13fIWeqUViNPyEJxv/OmvnBo0Yme4=
+github.com/coreos/go-systemd v0.0.0-20190321100706-95778dfbb74e/go.mod h1:F5haX7vjVVG0kc13fIWeqUViNPyEJxv/OmvnBo0Yme4=
 github.com/coreos/go-systemd v0.0.0-20190719114852-fd7a80b32e1f h1:JOrtw2xFKzlg+cbHpyrpLDmnN1HqhBfnX7WDiW7eG2c=
 github.com/coreos/go-systemd v0.0.0-20190719114852-fd7a80b32e1f/go.mod h1:F5haX7vjVVG0kc13fIWeqUViNPyEJxv/OmvnBo0Yme4=
 github.com/coreos/pkg v0.0.0-20180928190104-399ea9e2e55f h1:lBNOc5arjvs8E5mO2tbpBpLoyyu8B6e44T7hJy6potg=
@@ -108,6 +124,8 @@ github.com/docker/docker v0.0.0-20171019062838-86f080cff091/go.mod h1:eEKB0N0r5N
 github.com/docker/docker v0.0.0-20180522102801-da99009bbb11/go.mod h1:eEKB0N0r5NX/I1kEveEz05bcu8tLC/8azJZsviup8Sk=
 github.com/docker/docker v1.4.2-0.20190927142053-ada3c14355ce h1:H3csZuxZESJeeEiOxq4YXPNmLFbjl7u2qVBrAAGX/sA=
 github.com/docker/docker v1.4.2-0.20190927142053-ada3c14355ce/go.mod h1:eEKB0N0r5NX/I1kEveEz05bcu8tLC/8azJZsviup8Sk=
+github.com/docker/docker v1.4.2-0.20191101170500-ac7306503d23 h1:oqgGT9O61YAYvI41EBsLePOr+LE6roB0xY4gpkZuFSE=
+github.com/docker/docker v1.4.2-0.20191101170500-ac7306503d23/go.mod h1:eEKB0N0r5NX/I1kEveEz05bcu8tLC/8azJZsviup8Sk=
 github.com/docker/docker-credential-helpers v0.6.0/go.mod h1:WRaJzqw3CTB9bk10avuGsjVBZsD05qeibJ1/TYlvc0Y=
 github.com/docker/docker-credential-helpers v0.6.1 h1:Dq4iIfcM7cNtddhLVWe9h4QDjsi4OER3Z8voPu/I52g=
 github.com/docker/docker-credential-helpers v0.6.1/go.mod h1:WRaJzqw3CTB9bk10avuGsjVBZsD05qeibJ1/TYlvc0Y=
@@ -143,6 +161,8 @@ github.com/fsnotify/fsnotify v1.4.7 h1:IXs+QLmnXW2CcXuY+8Mzv/fWEsPGWxqefPtCP5CnV
 github.com/fsnotify/fsnotify v1.4.7/go.mod h1:jwhsz4b93w/PPRr/qN1Yymfu8t87LnFCMoQvtojpjFo=
 github.com/fsouza/go-dockerclient v1.5.0 h1:7OtayOe5HnoG+KWMHgyyPymwaodnB2IDYuVfseKyxbA=
 github.com/fsouza/go-dockerclient v1.5.0/go.mod h1:AqZZK/zFO3phxYxlTsAaeAMSdQ9mgHuhy+bjN034Qds=
+github.com/fsouza/go-dockerclient v1.6.0 h1:f7j+AX94143JL1H3TiqSMkM4EcLDI0De1qD4GGn3Hig=
+github.com/fsouza/go-dockerclient v1.6.0/go.mod h1:YWwtNPuL4XTX1SKJQk86cWPmmqwx+4np9qfPbb+znGc=
 github.com/ghodss/yaml v0.0.0-20150909031657-73d445a93680/go.mod h1:4dBDuWmgqj2HViK6kFavaiC9ZROes6MMH2rRYeMEF04=
 github.com/ghodss/yaml v0.0.0-20161207003320-04f313413ffd/go.mod h1:4dBDuWmgqj2HViK6kFavaiC9ZROes6MMH2rRYeMEF04=
 github.com/ghodss/yaml v1.0.0 h1:wQHKEahhL6wmXdzwWG11gIVCkOv05bNOh+Rxn0yngAk=
@@ -158,6 +178,8 @@ github.com/go-stack/stack v1.8.0/go.mod h1:v0f6uXyyMGvRgIKkXu+yp6POWl0qKG85gN/me
 github.com/godbus/dbus v0.0.0-20180201030542-885f9cc04c9c/go.mod h1:/YcGZj5zSblfDWMMoOzV4fas9FZnQYTkDnsGvmh2Grw=
 github.com/godbus/dbus v0.0.0-20181101234600-2ff6f7ffd60f h1:zlOR3rOlPAVvtfuxGKoghCmop5B0TRyu/ZieziZuGiM=
 github.com/godbus/dbus v0.0.0-20181101234600-2ff6f7ffd60f/go.mod h1:/YcGZj5zSblfDWMMoOzV4fas9FZnQYTkDnsGvmh2Grw=
+github.com/godbus/dbus v0.0.0-20190422162347-ade71ed3457e h1:BWhy2j3IXJhjCbC68FptL43tDKIq8FladmaTs3Xs7Z8=
+github.com/godbus/dbus v0.0.0-20190422162347-ade71ed3457e/go.mod h1:bBOAhwG1umN6/6ZUMtDFBMQR8jRg9O75tm9K00oMsK4=
 github.com/gogo/protobuf v0.0.0-20170815085658-fcdc5011193f/go.mod h1:r8qH/GZQm5c6nD/R0oafs1akxWv10x8SbQlK7atdtwQ=
 github.com/gogo/protobuf v0.0.0-20171007142547-342cbe0a0415/go.mod h1:r8qH/GZQm5c6nD/R0oafs1akxWv10x8SbQlK7atdtwQ=
 github.com/gogo/protobuf v1.1.1/go.mod h1:r8qH/GZQm5c6nD/R0oafs1akxWv10x8SbQlK7atdtwQ=
@@ -202,11 +224,15 @@ github.com/gorilla/mux v1.7.3 h1:gnP5JzjVOuiZD07fKKToCAOjS0yOpj/qPETTXCCS6hw=
 github.com/gorilla/mux v1.7.3/go.mod h1:1lud6UwP+6orDFRuTfBEV8e9/aOM/c4fVVCaMa2zaAs=
 github.com/gotestyourself/gotestyourself v2.2.0+incompatible/go.mod h1:zZKM6oeNM8k+FRljX1mnzVYeS8wiGgQyvST1/GafPbY=
 github.com/gregjones/httpcache v0.0.0-20170728041850-787624de3eb7/go.mod h1:FecbI9+v66THATjSRHfNgh1IVFe/9kFxbXtjV0ctIMA=
+github.com/hashicorp/errwrap v0.0.0-20141028054710-7554cd9344ce/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4=
 github.com/hashicorp/errwrap v1.0.0 h1:hLrqtEDnRye3+sgx6z4qVLNuviH3MR5aQ0ykNJa/UYA=
 github.com/hashicorp/errwrap v1.0.0/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4=
+github.com/hashicorp/go-multierror v0.0.0-20161216184304-ed905158d874/go.mod h1:JMRHfdO9jKNzS/+BTlxCjKNQHg/jZAft8U7LloJvN7I=
 github.com/hashicorp/go-multierror v1.0.0 h1:iVjPR7a6H0tWELX5NxNe7bYopibicUzc7uPribsnS6o=
 github.com/hashicorp/go-multierror v1.0.0/go.mod h1:dHtQlpGsu+cZNNAkkCN/P3hoUDHhCYQXV3UM06sGGrk=
 github.com/hashicorp/golang-lru v0.5.0/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8=
+github.com/hashicorp/golang-lru v0.5.1 h1:0hERBMJE1eitiLkihrMvRVBYAkpHzc/J3QdDN+dAcgU=
+github.com/hashicorp/golang-lru v0.5.1/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8=
 github.com/hashicorp/hcl v1.0.0/go.mod h1:E5yfLk+7swimpb2L/Alb/PJmXilQ/rhwaUYs4T20WEQ=
 github.com/hpcloud/tail v1.0.0 h1:nfCOvKYfkgYP8hkirhJocXT2+zOD8yUNjXaWfTlyFKI=
 github.com/hpcloud/tail v1.0.0/go.mod h1:ab1qPbhIpdTxEkNHXyeSf5vhxWSCs/tWer42PpOxQnU=
@@ -305,20 +331,24 @@ github.com/onsi/gomega v1.7.0 h1:XPnZz8VVBHjVsy1vzJmRwIcSwiUO+JFfrv/xGiigmME=
 github.com/onsi/gomega v1.7.0/go.mod h1:ex+gbHU/CVuBBDIJjb2X0qEXbFg53c61hWP/1CpauHY=
 github.com/onsi/gomega v1.7.1 h1:K0jcRCwNQM3vFGh1ppMtDh/+7ApJrjldlX8fA0jDTLQ=
 github.com/onsi/gomega v1.7.1/go.mod h1:XdKZgCCFLUoM/7CFJVPcG8C1xQ1AJ0vpAezJrB7JYyY=
+github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s=
 github.com/opencontainers/go-digest v1.0.0-rc1 h1:WzifXhOVOEOuFYOJAW6aQqW0TooG2iki3E3Ii+WN7gQ=
 github.com/opencontainers/go-digest v1.0.0-rc1/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s=
 github.com/opencontainers/image-spec v1.0.1 h1:JMemWkRwHx4Zj+fVxWoMCFm/8sYGGrUVojFA6h/TRcI=
 github.com/opencontainers/image-spec v1.0.1/go.mod h1:BtxoFyWECRxE4U/7sNtV5W15zMzWCbyJoFRP3s7yZA0=
 github.com/opencontainers/image-spec v1.0.2-0.20190823105129-775207bd45b6 h1:yN8BPXVwMBAm3Cuvh1L5XE8XpvYRMdsVLd82ILprhUU=
 github.com/opencontainers/image-spec v1.0.2-0.20190823105129-775207bd45b6/go.mod h1:BtxoFyWECRxE4U/7sNtV5W15zMzWCbyJoFRP3s7yZA0=
+github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U=
 github.com/opencontainers/runc v0.0.0-20190425234816-dae70e8efea4/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U=
 github.com/opencontainers/runc v0.1.1/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U=
 github.com/opencontainers/runc v1.0.0-rc8 h1:dDCFes8Hj1r/i5qnypONo5jdOme/8HWZC/aNDyhECt0=
 github.com/opencontainers/runc v1.0.0-rc8/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U=
 github.com/opencontainers/runc v1.0.0-rc8.0.20190827142921-dd075602f158 h1:/A6bAdnSZoTQmKml3MdHAnSEPnBAQeigNBl4sxnfaaQ=
 github.com/opencontainers/runc v1.0.0-rc8.0.20190827142921-dd075602f158/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U=
+github.com/opencontainers/runtime-spec v0.1.2-0.20190507144316-5b71a03e2700/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0=
 github.com/opencontainers/runtime-spec v0.1.2-0.20190618234442-a950415649c7 h1:Dliu5QO+4JYWu/yMshaMU7G3JN2POGpwjJN7gjy10Go=
 github.com/opencontainers/runtime-spec v0.1.2-0.20190618234442-a950415649c7/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0=
+github.com/opencontainers/runtime-tools v0.0.0-20181011054405-1d69bd0f9c39/go.mod h1:r3f7wjNzSs2extwzU3Y+6pKfobzPh+kKFJ3ofN+3nfs=
 github.com/opencontainers/runtime-tools v0.9.0 h1:FYgwVsKRI/H9hU32MJ/4MLOzXWodKK5zsQavY8NPMkU=
 github.com/opencontainers/runtime-tools v0.9.0/go.mod h1:r3f7wjNzSs2extwzU3Y+6pKfobzPh+kKFJ3ofN+3nfs=
 github.com/opencontainers/selinux v1.2.2 h1:Kx9J6eDG5/24A6DtUquGSpJQ+m2MUTahn4FtGEe8bFg=
@@ -364,6 +394,8 @@ github.com/prometheus/procfs v0.0.2 h1:6LJUbpNm42llc4HRCuvApCSWB/WfhuNo9K98Q9sNG
 github.com/prometheus/procfs v0.0.2/go.mod h1:TjEm7ze935MbeOT/UhFTIMYKhuLP4wbCsTZCD3I8kEA=
 github.com/prometheus/procfs v0.0.3 h1:CTwfnzjQ+8dS6MhHHu4YswVAD99sL2wjPqP+VkURmKE=
 github.com/prometheus/procfs v0.0.3/go.mod h1:4A/X28fw3Fc593LaREMrKMqOKvUAntwMDaekg4FpcdQ=
+github.com/prometheus/procfs v0.0.5 h1:3+auTFlqw+ZaQYJARz6ArODtkaIwtvBTx3N2NehQlL8=
+github.com/prometheus/procfs v0.0.5/go.mod h1:4A/X28fw3Fc593LaREMrKMqOKvUAntwMDaekg4FpcdQ=
 github.com/rogpeppe/go-charset v0.0.0-20180617210344-2471d30d28b4/go.mod h1:qgYeAmZ5ZIpBWTGllZSQnw97Dj+woV0toclVaRGI8pc=
 github.com/russross/blackfriday v1.5.2/go.mod h1:JO/DiYxRf+HjHt06OyowR9PTA263kcR/rfWxYHBV53g=
 github.com/safchain/ethtool v0.0.0-20190326074333-42ed695e3de8 h1:2c1EFnZHIPCW8qKWgHMH/fX2PkSabFc5mrVzfUNdg5U=
@@ -401,6 +433,7 @@ github.com/stretchr/testify v1.3.0 h1:TivCn/peBQ7UY8ooIcPgZFpTNSz0Q2U6UrFlUfqbe0
 github.com/stretchr/testify v1.3.0/go.mod h1:M5WIy9Dh21IEIfnGCwXGc5bZfKNJtfHm1UVUgZn+9EI=
 github.com/stretchr/testify v1.4.0 h1:2E4SXV/wtOkTonXsotYi4li6zVWxYlZuYNCXe9XRJyk=
 github.com/stretchr/testify v1.4.0/go.mod h1:j7eGeouHqKxXV5pUuKE4zz7dFj8WfuZ+81PSLYec5m4=
+github.com/syndtr/gocapability v0.0.0-20170704070218-db04d3cc01c8/go.mod h1:hkRG7XYTFWNJGYcbNJQlaLq0fg1yr4J4t/NcTQtrfww=
 github.com/syndtr/gocapability v0.0.0-20180916011248-d98352740cb2 h1:b6uOv7YOFK0TYG7HtkIgExQo+2RdLuwRft63jn2HWj8=
 github.com/syndtr/gocapability v0.0.0-20180916011248-d98352740cb2/go.mod h1:hkRG7XYTFWNJGYcbNJQlaLq0fg1yr4J4t/NcTQtrfww=
 github.com/tchap/go-patricia v2.3.0+incompatible h1:GkY4dP3cEfEASBPPkWd+AmjYxhmDkqO9/zg7R0lSQRs=
@@ -416,6 +449,7 @@ github.com/uber/jaeger-lib v0.0.0-20190122222657-d036253de8f5/go.mod h1:ComeNDZl
 github.com/ugorji/go/codec v0.0.0-20181204163529-d75b2dcb6bc8/go.mod h1:VFNgLljTbGfSG7qAOspJ7OScBnGdDN/yBr0sguwnwf0=
 github.com/ulikunitz/xz v0.5.6 h1:jGHAfXawEGZQ3blwU5wnWKQJvAraT7Ftq9EXjnXYgt8=
 github.com/ulikunitz/xz v0.5.6/go.mod h1:2bypXElzHzzJZwzH67Y6wb67pO62Rzfn7BSiF4ABRW8=
+github.com/urfave/cli v0.0.0-20171014202726-7bc6a0acffa5/go.mod h1:70zkFmudgCuE/ngEzBv17Jvp/497gISqfk5gWijbERA=
 github.com/varlink/go v0.0.0-20190502142041-0f1d566d194b h1:hdDRrn9OP/roL8a/e/5Zu85ldrcdndu9IeBj2OEvQm0=
 github.com/varlink/go v0.0.0-20190502142041-0f1d566d194b/go.mod h1:YHaw8N660ESgMgLOZfLQqT1htFItynAUxMesFBho52s=
 github.com/vbatts/tar-split v0.11.1 h1:0Odu65rhcZ3JZaPHxl7tCI3V/C/Q9Zf82UFravl02dE=
@@ -435,12 +469,15 @@ github.com/xeipuuv/gojsonpointer v0.0.0-20190809123943-df4f5c81cb3b h1:6cLsL+2FW
 github.com/xeipuuv/gojsonpointer v0.0.0-20190809123943-df4f5c81cb3b/go.mod h1:N2zxlSyiKSe5eX1tZViRH5QA0qijqEDrYZiPEAiq3wU=
 github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415 h1:EzJWgHovont7NscjpAxXsDA8S8BMYve8Y5+7cuRE7R0=
 github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415/go.mod h1:GwrjFmJcFw6At/Gs6z4yjiIwzuJ1/+UwLxMQDVQXShQ=
+github.com/xeipuuv/gojsonschema v0.0.0-20180618132009-1d523034197f/go.mod h1:5yf86TLmAcydyeJq5YvxkGPE2fm/u4myDekKRoLuqhs=
 github.com/xeipuuv/gojsonschema v0.0.0-20190816131739-be0936907f66/go.mod h1:anYRn/JVcOK2ZgGU+IjEV4nwlhoK5sQluxsYJ78Id3Y=
 github.com/xeipuuv/gojsonschema v1.1.0 h1:ngVtJC9TY/lg0AA/1k48FYhBrhRoFlEmWzsehpNAaZg=
 github.com/xeipuuv/gojsonschema v1.1.0/go.mod h1:5yf86TLmAcydyeJq5YvxkGPE2fm/u4myDekKRoLuqhs=
 github.com/xordataexchange/crypt v0.0.3-0.20170626215501-b2862e3d0a77/go.mod h1:aYKd//L2LvnjZzWKhF00oedf4jCCReLcmhLdhm1A27Q=
 go.etcd.io/bbolt v1.3.3 h1:MUGmc65QhB3pIlaQ5bB4LwqSj6GIonVJXpZiaKNyaKk=
 go.etcd.io/bbolt v1.3.3/go.mod h1:IbVyRI1SCnLcuJnV2u8VeU0CEYM7e686BmAb1XKL+uU=
+go.opencensus.io v0.22.0 h1:C9hSCOW830chIVkdja34wa6Ky+IzWllkUinR+BtRZd4=
+go.opencensus.io v0.22.0/go.mod h1:+kGneAE2xo2IficOXnaByMWTGM9T73dGwxeWcUqIpI8=
 go.uber.org/atomic v1.4.0 h1:cxzIVoETapQEqDhQu3QfnvXAV4AlzcvUCxkVUFw3+EU=
 go.uber.org/atomic v1.4.0/go.mod h1:gD2HeocX3+yG+ygLZcrzQJaqmWj9AIm7n08wl/qW/PE=
 golang.org/x/crypto v0.0.0-20180904163835-0709b304e793/go.mod h1:6SG95UA2DQfeDnfUPMdvaQW0Q7yPrPDi9nlGo2tz2b4=
@@ -466,6 +503,7 @@ golang.org/x/net v0.0.0-20190206173232-65e2d4e15006/go.mod h1:mL1N/T3taQHkDXs73r
 golang.org/x/net v0.0.0-20190213061140-3a22650c66bd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
 golang.org/x/net v0.0.0-20190311183353-d8887717615a/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg=
 golang.org/x/net v0.0.0-20190404232315-eb5bcb51f2a3/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg=
+golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg=
 golang.org/x/net v0.0.0-20190603091049-60506f45cf65/go.mod h1:HSz+uSET+XFnRR8LxR5pz3Of3rY3CfYBVs4xY44aLks=
 golang.org/x/net v0.0.0-20190613194153-d28f0bde5980/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
 golang.org/x/net v0.0.0-20190628185345-da137c7871d7 h1:rTIdg5QFRR7XCaK4LCjBiPbx8j4DQRpdYMnGn/bJUEU=
@@ -478,6 +516,7 @@ golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJ
 golang.org/x/sync v0.0.0-20181108010431-42b317875d0f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
 golang.org/x/sync v0.0.0-20181221193216-37e7f081c4d4 h1:YUO/7uOKsKeq9UokNS62b8FYywz3ker1l1vDZRCRefw=
 golang.org/x/sync v0.0.0-20181221193216-37e7f081c4d4/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
+golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
 golang.org/x/sync v0.0.0-20190423024810-112230192c58 h1:8gQV6CLnAEikrhgkHFbMAEhagSSnXWGV915qUMm9mrU=
 golang.org/x/sync v0.0.0-20190423024810-112230192c58/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
 golang.org/x/sys v0.0.0-20170830134202-bb24a47a89ea/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
@@ -493,7 +532,9 @@ golang.org/x/sys v0.0.0-20190412213103-97732733099d/go.mod h1:h1NjWce9XRLGQEsW7w
 golang.org/x/sys v0.0.0-20190422165155-953cdadca894/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
 golang.org/x/sys v0.0.0-20190425145619-16072639606e h1:4ktJgTV34+N3qOZUc5fAaG3Pb11qzMm3PkAoTAgUZ2I=
 golang.org/x/sys v0.0.0-20190425145619-16072639606e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
 golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20190514135907-3a4b5fb9f71f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
 golang.org/x/sys v0.0.0-20190606165138-5da285871e9c/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
 golang.org/x/sys v0.0.0-20190616124812-15dcb6c0061f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
 golang.org/x/sys v0.0.0-20190626221950-04f50cda93cb h1:fgwFCsaw9buMuxNd6+DQfAuSFqbNiQZpcgJQAgJsK6k=
@@ -501,6 +542,8 @@ golang.org/x/sys v0.0.0-20190626221950-04f50cda93cb/go.mod h1:h1NjWce9XRLGQEsW7w
 golang.org/x/sys v0.0.0-20190801041406-cbf593c0f2f3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
 golang.org/x/sys v0.0.0-20190902133755-9109b7679e13 h1:tdsQdquKbTNMsSZLqnLELJGzCANp9oXhu6zFBW6ODx4=
 golang.org/x/sys v0.0.0-20190902133755-9109b7679e13/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 h1:7TYNF4UdlohbFwpNH04CoPMp1cHUZgO1Ebq5r2hIjfo=
+golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
 golang.org/x/text v0.0.0-20160726164857-2910a502d2bf/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ=
 golang.org/x/text v0.3.0 h1:g61tztE5qeGQ89tm6NTjjM9VPIm088od1l6aSorWRWg=
 golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ=
@@ -527,9 +570,11 @@ google.golang.org/appengine v1.6.1 h1:QzqyMA1tlu6CgqCDUtU9V+ZKhLFT2dkJuANu5QaxI3
 google.golang.org/appengine v1.6.1/go.mod h1:i06prIuMbXzDqacNJfV5OdTW448YApPu5ww/cMBSeb0=
 google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc=
 google.golang.org/genproto v0.0.0-20180831171423-11092d34479b/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc=
+google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE=
 google.golang.org/genproto v0.0.0-20190620144150-6af8c5fc6601 h1:9VBRTdmgQxbs6HE0sUnMrSWNePppAJU07NYvX5dIB04=
 google.golang.org/genproto v0.0.0-20190620144150-6af8c5fc6601/go.mod h1:z3L6/3dTEVtUr6QSP8miRzeRqwQOioJ9I66odjN4I7s=
 google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c=
+google.golang.org/grpc v1.20.1/go.mod h1:10oTOabMzJvdu6/UiuZezV6QK5dSlG84ov/aaiqXj38=
 google.golang.org/grpc v1.22.0/go.mod h1:Y5yQAOtifL1yxbo5wqy6BxZv8vAUGQwXBOALyacEbxg=
 google.golang.org/grpc v1.24.0 h1:vb/1TCsVn3DcJlQ0Gs1yB1pKI6Do2/QNwxdKqmc/b0s=
 google.golang.org/grpc v1.24.0/go.mod h1:XDChyiUovWa60DnaeDeZmSW86xtLtjtZbwvSiRnRtcA=
@@ -580,6 +625,7 @@ k8s.io/klog v0.3.3 h1:niceAagH1tzskmaie/icWd7ci1wbG7Bf2c6YGcQv+3c=
 k8s.io/klog v0.3.3/go.mod h1:Gq+BEi5rUBO/HRz0bTSXDUcqjScdoY3a9IHpCEIOOfk=
 k8s.io/kube-openapi v0.0.0-20190228160746-b3a7cee44a30/go.mod h1:BXM9ceUBTj2QnfH2MK1odQs778ajze1RxcmP6S8RVVc=
 k8s.io/kube-openapi v0.0.0-20190709113604-33be087ad058/go.mod h1:nfDlWeOsu3pUf4yWGL+ERqohP4YsZcBJXWMK+gkzOA4=
+k8s.io/kubernetes v1.13.0/go.mod h1:ocZa8+6APFNC2tX1DZASIbocyYT5jHzqFVsY5aoB7Jk=
 k8s.io/utils v0.0.0-20190221042446-c2654d5206da/go.mod h1:8k8uAuAQ0rXslZKaEWd0c3oVhZz7sSzSiPnVZayjIX0=
 k8s.io/utils v0.0.0-20190607212802-c55fbcfc754a h1:2jUDc9gJja832Ftp+QbDV0tVhQHMISFn01els+2ZAcw=
 k8s.io/utils v0.0.0-20190607212802-c55fbcfc754a/go.mod h1:sZAwmy6armz5eXlNoLmJcl4F1QuKu7sr+mFQ0byX7Ew=

vendor/github.com/Microsoft/go-winio/go.mod

@@ -5,5 +5,5 @@ go 1.12
 require (
 	github.com/pkg/errors v0.8.1
 	github.com/sirupsen/logrus v1.4.1
-	golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b
+	golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3
 )

vendor/github.com/Microsoft/go-winio/go.sum

@@ -14,3 +14,5 @@ github.com/stretchr/testify v1.2.2/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXf
 golang.org/x/sys v0.0.0-20180905080454-ebe1bf3edb33/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
 golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b h1:ag/x1USPSsqHud38I9BAC88qdNLDHHtQ4mlgQIZPPNA=
 golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 h1:7TYNF4UdlohbFwpNH04CoPMp1cHUZgO1Ebq5r2hIjfo=
+golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=

vendor/github.com/Microsoft/hcsshim/Protobuild.toml

@@ -0,0 +1,54 @@
+version = "unstable"
+generator = "gogoctrd"
+plugins = ["grpc", "fieldpath"]
+
+# Control protoc include paths. Below are usually some good defaults, but feel
+# free to try it without them if it works for your project.
+[includes]
+  # Include paths that will be added before all others. Typically, you want to
+  # treat the root of the project as an include, but this may not be necessary.
+  before = ["./protobuf"]
+
+  # Paths that should be treated as include roots in relation to the vendor
+  # directory. These will be calculated with the vendor directory nearest the
+  # target package.
+  packages = ["github.com/gogo/protobuf"]
+
+  # Paths that will be added untouched to the end of the includes. We use
+  # `/usr/local/include` to pickup the common install location of protobuf.
+  # This is the default.
+  after = ["/usr/local/include"]
+
+# This section maps protobuf imports to Go packages. These will become
+# `-M` directives in the call to the go protobuf generator.
+[packages]
+  "gogoproto/gogo.proto" = "github.com/gogo/protobuf/gogoproto"
+  "google/protobuf/any.proto" = "github.com/gogo/protobuf/types"
+  "google/protobuf/empty.proto" = "github.com/gogo/protobuf/types"
+  "google/protobuf/descriptor.proto" = "github.com/gogo/protobuf/protoc-gen-gogo/descriptor"
+  "google/protobuf/field_mask.proto" = "github.com/gogo/protobuf/types"
+  "google/protobuf/timestamp.proto" = "github.com/gogo/protobuf/types"
+  "google/protobuf/duration.proto" = "github.com/gogo/protobuf/types"
+  "github/containerd/cgroups/stats/v1/metrics.proto" = "github.com/containerd/cgroups/stats/v1"
+
+[[overrides]]
+prefixes = ["github.com/Microsoft/hcsshim/internal/shimdiag"]
+plugins = ["ttrpc"]
+
+# Lock down runhcs config
+
+[[descriptors]]
+prefix = "github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options"
+target = "cmd/containerd-shim-runhcs-v1/options/next.pb.txt"
+ignore_files = [
+	"google/protobuf/descriptor.proto",
+	"gogoproto/gogo.proto"
+]
+
+[[descriptors]]
+prefix = "github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/stats"
+target = "cmd/containerd-shim-runhcs-v1/stats/next.pb.txt"
+ignore_files = [
+	"google/protobuf/descriptor.proto",
+	"gogoproto/gogo.proto"
+]

vendor/github.com/Microsoft/hcsshim/appveyor.yml

@@ -8,22 +8,34 @@ environment:
   GOPATH: c:\gopath
   PATH: C:\mingw-w64\x86_64-7.2.0-posix-seh-rt_v5-rev1\mingw64\bin;%GOPATH%\bin;C:\gometalinter-2.0.12-windows-amd64;%PATH%
 
-stack: go 1.11
+stack: go 1.12.9
 
 build_script:
   - appveyor DownloadFile https://github.com/alecthomas/gometalinter/releases/download/v2.0.12/gometalinter-2.0.12-windows-amd64.zip
   - 7z x gometalinter-2.0.12-windows-amd64.zip -y -oC:\ > NUL
   - gometalinter.exe --config .gometalinter.json ./...
-  - go build ./cmd/wclayer
+  - go build ./cmd/containerd-shim-runhcs-v1
   - go build ./cmd/runhcs
   - go build ./cmd/tar2ext4
+  - go build ./cmd/wclayer
+  - go build ./internal/tools/grantvmgroupaccess 
+  - go build ./internal/tools/uvmboot
+  - go build ./internal/tools/zapdir
   - go test -v ./... -tags admin
+  - go test -c ./test/containerd-shim-runhcs-v1/ -tags functional
+  - go test -c ./test/cri-containerd/ -tags functional
   - go test -c ./test/functional/ -tags functional
-  - go test -c ./test/runhcs/ -tags integration
+  - go test -c ./test/runhcs/ -tags functional
 
 artifacts:
-  - path: 'wclayer.exe'
+  - path: 'containerd-shim-runhcs-v1.exe'
   - path: 'runhcs.exe'
   - path: 'tar2ext4.exe'
+  - path: 'wclayer.exe'
+  - path: 'grantvmgroupaccess.exe'  
+  - path: 'uvmboot.exe'
+  - path: 'zapdir.exe'
+  - path: 'containerd-shim-runhcs-v1.test.exe'
+  - path: 'cri-containerd.test.exe'
   - path: 'functional.test.exe'
   - path: 'runhcs.test.exe'

vendor/github.com/Microsoft/hcsshim/container.go

@@ -1,8 +1,10 @@
 package hcsshim
 
 import (
+	"context"
 	"fmt"
 	"os"
+	"sync"
 	"time"
 
 	"github.com/Microsoft/hcsshim/internal/hcs"
@@ -52,7 +54,10 @@ const (
 type ResourceModificationRequestResponse = schema1.ResourceModificationRequestResponse
 
 type container struct {
-	system *hcs.System
+	system   *hcs.System
+	waitOnce sync.Once
+	waitErr  error
+	waitCh   chan struct{}
 }
 
 // createComputeSystemAdditionalJSON is read from the environment at initialisation
@@ -71,61 +76,87 @@ func CreateContainer(id string, c *ContainerConfig) (Container, error) {
 		return nil, fmt.Errorf("failed to merge additional JSON '%s': %s", createContainerAdditionalJSON, err)
 	}
 
-	system, err := hcs.CreateComputeSystem(id, fullConfig)
+	system, err := hcs.CreateComputeSystem(context.Background(), id, fullConfig)
 	if err != nil {
 		return nil, err
 	}
-	return &container{system}, err
+	return &container{system: system}, err
 }
 
 // OpenContainer opens an existing container by ID.
 func OpenContainer(id string) (Container, error) {
-	system, err := hcs.OpenComputeSystem(id)
+	system, err := hcs.OpenComputeSystem(context.Background(), id)
 	if err != nil {
 		return nil, err
 	}
-	return &container{system}, err
+	return &container{system: system}, err
 }
 
 // GetContainers gets a list of the containers on the system that match the query
 func GetContainers(q ComputeSystemQuery) ([]ContainerProperties, error) {
-	return hcs.GetComputeSystems(q)
+	return hcs.GetComputeSystems(context.Background(), q)
 }
 
 // Start synchronously starts the container.
 func (container *container) Start() error {
-	return convertSystemError(container.system.Start(), container)
+	return convertSystemError(container.system.Start(context.Background()), container)
 }
 
 // Shutdown requests a container shutdown, but it may not actually be shutdown until Wait() succeeds.
 func (container *container) Shutdown() error {
-	return convertSystemError(container.system.Shutdown(), container)
+	err := container.system.Shutdown(context.Background())
+	if err != nil {
+		return convertSystemError(err, container)
+	}
+	return &ContainerError{Container: container, Err: ErrVmcomputeOperationPending, Operation: "hcsshim::ComputeSystem::Shutdown"}
 }
 
 // Terminate requests a container terminate, but it may not actually be terminated until Wait() succeeds.
 func (container *container) Terminate() error {
-	return convertSystemError(container.system.Terminate(), container)
+	err := container.system.Terminate(context.Background())
+	if err != nil {
+		return convertSystemError(err, container)
+	}
+	return &ContainerError{Container: container, Err: ErrVmcomputeOperationPending, Operation: "hcsshim::ComputeSystem::Terminate"}
 }
 
 // Waits synchronously waits for the container to shutdown or terminate.
 func (container *container) Wait() error {
-	return convertSystemError(container.system.Wait(), container)
+	err := container.system.Wait()
+	if err == nil {
+		err = container.system.ExitError()
+	}
+	return convertSystemError(err, container)
 }
 
 // WaitTimeout synchronously waits for the container to terminate or the duration to elapse. It
 // returns false if timeout occurs.
-func (container *container) WaitTimeout(t time.Duration) error {
+func (container *container) WaitTimeout(timeout time.Duration) error {
-	return convertSystemError(container.system.WaitTimeout(t), container)
+	container.waitOnce.Do(func() {
+		container.waitCh = make(chan struct{})
+		go func() {
+			container.waitErr = container.Wait()
+			close(container.waitCh)
+		}()
+	})
+	t := time.NewTimer(timeout)
+	defer t.Stop()
+	select {
+	case <-t.C:
+		return &ContainerError{Container: container, Err: ErrTimeout, Operation: "hcsshim::ComputeSystem::Wait"}
+	case <-container.waitCh:
+		return container.waitErr
+	}
 }
 
 // Pause pauses the execution of a container.
 func (container *container) Pause() error {
-	return convertSystemError(container.system.Pause(), container)
+	return convertSystemError(container.system.Pause(context.Background()), container)
 }
 
 // Resume resumes the execution of a container.
 func (container *container) Resume() error {
-	return convertSystemError(container.system.Resume(), container)
+	return convertSystemError(container.system.Resume(context.Background()), container)
 }
 
 // HasPendingUpdates returns true if the container has updates pending to install
@@ -135,7 +166,7 @@ func (container *container) HasPendingUpdates() (bool, error) {
 
 // Statistics returns statistics for the container. This is a legacy v1 call
 func (container *container) Statistics() (Statistics, error) {
-	properties, err := container.system.Properties(schema1.PropertyTypeStatistics)
+	properties, err := container.system.Properties(context.Background(), schema1.PropertyTypeStatistics)
 	if err != nil {
 		return Statistics{}, convertSystemError(err, container)
 	}
@@ -145,7 +176,7 @@ func (container *container) Statistics() (Statistics, error) {
 
 // ProcessList returns an array of ProcessListItems for the container. This is a legacy v1 call
 func (container *container) ProcessList() ([]ProcessListItem, error) {
-	properties, err := container.system.Properties(schema1.PropertyTypeProcessList)
+	properties, err := container.system.Properties(context.Background(), schema1.PropertyTypeProcessList)
 	if err != nil {
 		return nil, convertSystemError(err, container)
 	}
@@ -155,7 +186,7 @@ func (container *container) ProcessList() ([]ProcessListItem, error) {
 
 // This is a legacy v1 call
 func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskController, error) {
-	properties, err := container.system.Properties(schema1.PropertyTypeMappedVirtualDisk)
+	properties, err := container.system.Properties(context.Background(), schema1.PropertyTypeMappedVirtualDisk)
 	if err != nil {
 		return nil, convertSystemError(err, container)
 	}
@@ -165,20 +196,20 @@ func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskContr
 
 // CreateProcess launches a new process within the container.
 func (container *container) CreateProcess(c *ProcessConfig) (Process, error) {
-	p, err := container.system.CreateProcess(c)
+	p, err := container.system.CreateProcessNoStdio(c)
 	if err != nil {
 		return nil, convertSystemError(err, container)
 	}
-	return &process{p}, nil
+	return &process{p: p.(*hcs.Process)}, nil
 }
 
 // OpenProcess gets an interface to an existing process within the container.
 func (container *container) OpenProcess(pid int) (Process, error) {
-	p, err := container.system.OpenProcess(pid)
+	p, err := container.system.OpenProcess(context.Background(), pid)
 	if err != nil {
 		return nil, convertSystemError(err, container)
 	}
-	return &process{p}, nil
+	return &process{p: p}, nil
 }
 
 // Close cleans up any state associated with the container but does not terminate or wait for it.
@@ -188,5 +219,5 @@ func (container *container) Close() error {
 
 // Modify the System
 func (container *container) Modify(config *ResourceModificationRequestResponse) error {
-	return convertSystemError(container.system.Modify(config), container)
+	return convertSystemError(container.system.Modify(context.Background(), config), container)
 }

vendor/github.com/Microsoft/hcsshim/go.mod

@@ -0,0 +1,37 @@
+module github.com/Microsoft/hcsshim
+
+go 1.12
+
+require (
+	github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5
+	github.com/blang/semver v3.1.0+incompatible // indirect
+	github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f
+	github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1
+	github.com/containerd/containerd v1.3.0-beta.2.0.20190828155532-0293cbd26c69
+	github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc // indirect
+	github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448 // indirect
+	github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3
+	github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de
+	github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd
+	github.com/gogo/protobuf v1.2.1
+	github.com/hashicorp/errwrap v0.0.0-20141028054710-7554cd9344ce // indirect
+	github.com/hashicorp/go-multierror v0.0.0-20161216184304-ed905158d874 // indirect
+	github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2 // indirect
+	github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f // indirect
+	github.com/opencontainers/runtime-spec v0.1.2-0.20190507144316-5b71a03e2700
+	github.com/opencontainers/runtime-tools v0.0.0-20181011054405-1d69bd0f9c39
+	github.com/pkg/errors v0.8.1
+	github.com/prometheus/procfs v0.0.5 // indirect
+	github.com/sirupsen/logrus v1.4.1
+	github.com/syndtr/gocapability v0.0.0-20170704070218-db04d3cc01c8 // indirect
+	github.com/urfave/cli v0.0.0-20171014202726-7bc6a0acffa5
+	github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f // indirect
+	github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415 // indirect
+	github.com/xeipuuv/gojsonschema v0.0.0-20180618132009-1d523034197f // indirect
+	go.opencensus.io v0.22.0
+	golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6
+	golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3
+	google.golang.org/grpc v1.20.1
+	gotest.tools v2.2.0+incompatible // indirect
+	k8s.io/kubernetes v1.13.0
+)

vendor/github.com/Microsoft/hcsshim/go.sum

@@ -0,0 +1,131 @@
+cloud.google.com/go v0.26.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMTw=
+github.com/BurntSushi/toml v0.3.1/go.mod h1:xHWCNGjB5oqiDr8zfno3MHue2Ht5sIBksp03qcyfWMU=
+github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5 h1:ygIc8M6trr62pF5DucadTWGdEB4mEyvzi0e2nbcmcyA=
+github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5/go.mod h1:tTuCMEN+UleMWgg9dVx4Hu52b1bJo+59jBh3ajtinzw=
+github.com/blang/semver v3.1.0+incompatible h1:7hqmJYuaEK3qwVjWubYiht3j93YI0WQBuysxHIfUriU=
+github.com/blang/semver v3.1.0+incompatible/go.mod h1:kRBLl5iJ+tD4TcOOxsy/0fnwebNt5EWlYSAyrTnjyyk=
+github.com/client9/misspell v0.3.4/go.mod h1:qj6jICC3Q7zFZvVWo7KLAzC3yx5G7kyvSDkc90ppPyw=
+github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f h1:tSNMc+rJDfmYntojat8lljbt1mgKNpTxUZJsSzJ9Y1s=
+github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f/go.mod h1:OApqhQ4XNSNC13gXIwDjhOQxjWa/NxkwZXJ1EvqT0ko=
+github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1 h1:uict5mhHFTzKLUCufdSLym7z/J0CbBJT59lYbP9wtbg=
+github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1/go.mod h1:Tj/on1eG8kiEhd0+fhSDzsPAFESxzBBvdyEgyryXffw=
+github.com/containerd/containerd v1.3.0-beta.2.0.20190828155532-0293cbd26c69 h1:rG1clvJbgsUcmb50J82YUJhUMopWNtZvyMZjb+4fqGw=
+github.com/containerd/containerd v1.3.0-beta.2.0.20190828155532-0293cbd26c69/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA=
+github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc h1:TP+534wVlf61smEIq1nwLLAjQVEK2EADoW3CX9AuT+8=
+github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y=
+github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448 h1:PUD50EuOMkXVcpBIA/R95d56duJR9VxhwncsFbNnxW4=
+github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448/go.mod h1:ODA38xgv3Kuk8dQz2ZQXpnv/UZZUHUCL7pnLehbXgQI=
+github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3 h1:esQOJREg8nw8aXj6uCN5dfW5cKUBiEJ/+nni1Q/D/sw=
+github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3/go.mod h1:IV7qH3hrUgRmyYrtgEeGWJfWbgcHL9CSRruz2Vqcph0=
+github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de h1:dlfGmNcE3jDAecLqwKPMNX6nk2qh1c1Vg1/YTzpOOF4=
+github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de/go.mod h1:PvCDdDGpgqzQIzDW1TphrGLssLDZp2GuS+X5DkEJB8o=
+github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd h1:JNn81o/xG+8NEo3bC/vx9pbi/g2WI8mtP2/nXzu297Y=
+github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd/go.mod h1:Cm3kwCdlkCfMSHURc+r6fwoGH6/F1hH3S4sg0rLFWPc=
+github.com/coreos/go-systemd v0.0.0-20190321100706-95778dfbb74e h1:Wf6HqHfScWJN9/ZjdUKyjop4mf3Qdd+1TvvltAvM3m8=
+github.com/coreos/go-systemd v0.0.0-20190321100706-95778dfbb74e/go.mod h1:F5haX7vjVVG0kc13fIWeqUViNPyEJxv/OmvnBo0Yme4=
+github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c=
+github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
+github.com/docker/go-units v0.4.0 h1:3uh0PgVws3nIA0Q+MwDC8yjEPf9zjRfZZWXZYDct3Tw=
+github.com/docker/go-units v0.4.0/go.mod h1:fgPhTUdO+D/Jk86RDLlptpiXQzgHJF7gydDDbaIK4Dk=
+github.com/godbus/dbus v0.0.0-20190422162347-ade71ed3457e h1:BWhy2j3IXJhjCbC68FptL43tDKIq8FladmaTs3Xs7Z8=
+github.com/godbus/dbus v0.0.0-20190422162347-ade71ed3457e/go.mod h1:bBOAhwG1umN6/6ZUMtDFBMQR8jRg9O75tm9K00oMsK4=
+github.com/gogo/protobuf v1.2.1 h1:/s5zKNz0uPFCZ5hddgPdo2TK2TVrUNMn0OOX8/aZMTE=
+github.com/gogo/protobuf v1.2.1/go.mod h1:hp+jE20tsWTFYpLwKvXlhS1hjn+gTNwPg2I6zVXpSg4=
+github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b h1:VKtxabqXZkF25pY9ekfRL6a582T4P37/31XEstQ5p58=
+github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b/go.mod h1:SBH7ygxi8pfUlaOkMMuAQtPIUF8ecWP5IEl/CR7VP2Q=
+github.com/golang/mock v1.1.1/go.mod h1:oTYuIxOrZwtPieC+H1uAHpcLFnEyAGVDL/k47Jfbm0A=
+github.com/golang/protobuf v1.2.0 h1:P3YflyNX/ehuJFLhxviNdFxQPkGK5cDcApsge1SqnvM=
+github.com/golang/protobuf v1.2.0/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U=
+github.com/golang/protobuf v1.3.1 h1:YF8+flBXS5eO826T4nzqPrxfhQThhXl0YzfuUPu4SBg=
+github.com/golang/protobuf v1.3.1/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U=
+github.com/google/go-cmp v0.3.0 h1:crn/baboCvb5fXaQ0IJ1SGTsTVrWpDsCWC8EGETZijY=
+github.com/google/go-cmp v0.3.0/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU=
+github.com/hashicorp/errwrap v0.0.0-20141028054710-7554cd9344ce h1:prjrVgOk2Yg6w+PflHoszQNLTUh4kaByUcEWM/9uin4=
+github.com/hashicorp/errwrap v0.0.0-20141028054710-7554cd9344ce/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4=
+github.com/hashicorp/go-multierror v0.0.0-20161216184304-ed905158d874 h1:cAv7ZbSmyb1wjn6T4TIiyFCkpcfgpbcNNC3bM2srLaI=
+github.com/hashicorp/go-multierror v0.0.0-20161216184304-ed905158d874/go.mod h1:JMRHfdO9jKNzS/+BTlxCjKNQHg/jZAft8U7LloJvN7I=
+github.com/hashicorp/golang-lru v0.5.1 h1:0hERBMJE1eitiLkihrMvRVBYAkpHzc/J3QdDN+dAcgU=
+github.com/hashicorp/golang-lru v0.5.1/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8=
+github.com/kisielk/errcheck v1.1.0/go.mod h1:EZBBE59ingxPouuu3KfxchcWSUPOHkagtvWXihfKN4Q=
+github.com/kisielk/gotool v1.0.0/go.mod h1:XhKaO+MFFWcvkIS/tQcRk01m1F5IRFswLeQ+oQHNcck=
+github.com/konsorten/go-windows-terminal-sequences v1.0.1 h1:mweAR1A6xJ3oS2pRaGiHgQ4OO8tzTaLawm8vnODuwDk=
+github.com/konsorten/go-windows-terminal-sequences v1.0.1/go.mod h1:T0+1ngSBFLxvqU3pZ+m/2kptfBszLMUkC4ZK/EgS/cQ=
+github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2 h1:QhPf3A2AZW3tTGvHPg0TA+CR3oHbVLlXUhlghqISp1I=
+github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s=
+github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f h1:a969LJ4IQFwRHYqonHtUDMSh9i54WcKggeEkQ3fZMl4=
+github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U=
+github.com/opencontainers/runtime-spec v0.1.2-0.20190507144316-5b71a03e2700 h1:eNUVfm/RFLIi1G7flU5/ZRTHvd4kcVuzfRnL6OFlzCI=
+github.com/opencontainers/runtime-spec v0.1.2-0.20190507144316-5b71a03e2700/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0=
+github.com/opencontainers/runtime-tools v0.0.0-20181011054405-1d69bd0f9c39 h1:H7DMc6FAjgwZZi8BRqjrAAHWoqEr5e5L6pS4V0ezet4=
+github.com/opencontainers/runtime-tools v0.0.0-20181011054405-1d69bd0f9c39/go.mod h1:r3f7wjNzSs2extwzU3Y+6pKfobzPh+kKFJ3ofN+3nfs=
+github.com/pkg/errors v0.8.1 h1:iURUrRGxPUNPdy5/HRSm+Yj6okJ6UtLINN0Q9M4+h3I=
+github.com/pkg/errors v0.8.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0=
+github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM=
+github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4=
+github.com/prometheus/procfs v0.0.5 h1:3+auTFlqw+ZaQYJARz6ArODtkaIwtvBTx3N2NehQlL8=
+github.com/prometheus/procfs v0.0.5/go.mod h1:4A/X28fw3Fc593LaREMrKMqOKvUAntwMDaekg4FpcdQ=
+github.com/sirupsen/logrus v1.4.1 h1:GL2rEmy6nsikmW0r8opw9JIRScdMF5hA8cOYLH7In1k=
+github.com/sirupsen/logrus v1.4.1/go.mod h1:ni0Sbl8bgC9z8RoU9G6nDWqqs/fq4eDPysMBDgk/93Q=
+github.com/stretchr/objx v0.1.1/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME=
+github.com/stretchr/testify v1.2.2 h1:bSDNvY7ZPG5RlJ8otE/7V6gMiyenm9RtJ7IUVIAoJ1w=
+github.com/stretchr/testify v1.2.2/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXfy6kDkUVs=
+github.com/syndtr/gocapability v0.0.0-20170704070218-db04d3cc01c8 h1:zLV6q4e8Jv9EHjNg/iHfzwDkCve6Ua5jCygptrtXHvI=
+github.com/syndtr/gocapability v0.0.0-20170704070218-db04d3cc01c8/go.mod h1:hkRG7XYTFWNJGYcbNJQlaLq0fg1yr4J4t/NcTQtrfww=
+github.com/urfave/cli v0.0.0-20171014202726-7bc6a0acffa5 h1:MCfT24H3f//U5+UCrZp1/riVO3B50BovxtDiNn0XKkk=
+github.com/urfave/cli v0.0.0-20171014202726-7bc6a0acffa5/go.mod h1:70zkFmudgCuE/ngEzBv17Jvp/497gISqfk5gWijbERA=
+github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f h1:J9EGpcZtP0E/raorCMxlFGSTBrsSlaDGf3jU/qvAE2c=
+github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f/go.mod h1:N2zxlSyiKSe5eX1tZViRH5QA0qijqEDrYZiPEAiq3wU=
+github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415 h1:EzJWgHovont7NscjpAxXsDA8S8BMYve8Y5+7cuRE7R0=
+github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415/go.mod h1:GwrjFmJcFw6At/Gs6z4yjiIwzuJ1/+UwLxMQDVQXShQ=
+github.com/xeipuuv/gojsonschema v0.0.0-20180618132009-1d523034197f h1:mvXjJIHRZyhNuGassLTcXTwjiWq7NmjdavZsUnmFybQ=
+github.com/xeipuuv/gojsonschema v0.0.0-20180618132009-1d523034197f/go.mod h1:5yf86TLmAcydyeJq5YvxkGPE2fm/u4myDekKRoLuqhs=
+go.opencensus.io v0.22.0 h1:C9hSCOW830chIVkdja34wa6Ky+IzWllkUinR+BtRZd4=
+go.opencensus.io v0.22.0/go.mod h1:+kGneAE2xo2IficOXnaByMWTGM9T73dGwxeWcUqIpI8=
+golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACkg1iLfiJU5Ep61QUkGW8qpdssI0+w=
+golang.org/x/exp v0.0.0-20190121172915-509febef88a4/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA=
+golang.org/x/lint v0.0.0-20181026193005-c67002cb31c3/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE=
+golang.org/x/lint v0.0.0-20190227174305-5b3e6a55c961/go.mod h1:wehouNa3lNwaWXcvxsM5YxQ5yQlVC4a0KAMCusXpPoU=
+golang.org/x/lint v0.0.0-20190313153728-d0100b6bd8b3/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc=
+golang.org/x/net v0.0.0-20180724234803-3673e40ba225/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
+golang.org/x/net v0.0.0-20180826012351-8a410e7b638d/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
+golang.org/x/net v0.0.0-20190213061140-3a22650c66bd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
+golang.org/x/net v0.0.0-20190311183353-d8887717615a h1:oWX7TPOiFAMXLq8o0ikBYfCJVlRHBcsciT5bXOrH628=
+golang.org/x/net v0.0.0-20190311183353-d8887717615a/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg=
+golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09 h1:KaQtG+aDELoNmXYas3TVkGNYRuq8JQ1aa7LJt8EXVyo=
+golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg=
+golang.org/x/oauth2 v0.0.0-20180821212333-d2e6202438be/go.mod h1:N/0e6XlmueqKjAGxoOufVs8QHGRruUQn6yWY3a++T0U=
+golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
+golang.org/x/sync v0.0.0-20181108010431-42b317875d0f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
+golang.org/x/sync v0.0.0-20181221193216-37e7f081c4d4/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
+golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6 h1:bjcUS9ztw9kFmmIxJInhon/0Is3p+EHBKNgquIzo1OI=
+golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
+golang.org/x/sys v0.0.0-20180830151530-49385e6e1522/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
+golang.org/x/sys v0.0.0-20180905080454-ebe1bf3edb33/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
+golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
+golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20190514135907-3a4b5fb9f71f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 h1:7TYNF4UdlohbFwpNH04CoPMp1cHUZgO1Ebq5r2hIjfo=
+golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/text v0.3.0 h1:g61tztE5qeGQ89tm6NTjjM9VPIm088od1l6aSorWRWg=
+golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ=
+golang.org/x/text v0.3.2 h1:tW2bmiBqwgJj/UpqtC8EpXEZVYOwU0yG4iWbprSVAcs=
+golang.org/x/text v0.3.2/go.mod h1:bEr9sfX3Q8Zfm5fL9x+3itogRgK3+ptLWKqgva+5dAk=
+golang.org/x/tools v0.0.0-20180221164845-07fd8470d635/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
+golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
+golang.org/x/tools v0.0.0-20190114222345-bf090417da8b/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
+golang.org/x/tools v0.0.0-20190226205152-f727befe758c/go.mod h1:9Yl7xja0Znq3iFh3HoIrodX9oNMXvdceNzlUR8zjMvY=
+golang.org/x/tools v0.0.0-20190311212946-11955173bddd/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs=
+google.golang.org/appengine v1.1.0/go.mod h1:EbEs0AVv82hx2wNQdGPgUI5lhzA/G0D9YwlJXL52JkM=
+google.golang.org/appengine v1.4.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4=
+google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8 h1:Nw54tB0rB7hY/N0NQvRW8DG4Yk3Q6T9cu9RcFQDu1tc=
+google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc=
+google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb h1:i1Ppqkc3WQXikh8bXiwHqAN5Rv3/qDCcRk0/Otx73BY=
+google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE=
+google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c=
+google.golang.org/grpc v1.20.1 h1:Hz2g2wirWK7H0qIIhGIqRGTuMwTE8HEKFnDZZ7lm9NU=
+google.golang.org/grpc v1.20.1/go.mod h1:10oTOabMzJvdu6/UiuZezV6QK5dSlG84ov/aaiqXj38=
+gotest.tools v2.2.0+incompatible h1:VsBPFP1AI068pPrMxtb/S8Zkgf9xEmTLJjfM+P5UIEo=
+gotest.tools v2.2.0+incompatible/go.mod h1:DsYFclhRJ6vuDpmuTbkuFWG+y2sxOXAzmJt81HFBacw=
+honnef.co/go/tools v0.0.0-20190102054323-c2f93a96b099/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4=
+k8s.io/kubernetes v1.13.0 h1:qTfB+u5M92k2fCCCVP2iuhgwwSOv1EkAkvQY1tQODD8=
+k8s.io/kubernetes v1.13.0/go.mod h1:ocZa8+6APFNC2tX1DZASIbocyYT5jHzqFVsY5aoB7Jk=

vendor/github.com/Microsoft/hcsshim/hnsendpoint.go

@@ -39,11 +39,21 @@ func HNSListEndpointRequest() ([]HNSEndpoint, error) {
 
 // HotAttachEndpoint makes a HCS Call to attach the endpoint to the container
 func HotAttachEndpoint(containerID string, endpointID string) error {
+	endpoint, err := GetHNSEndpointByID(endpointID)
+	isAttached, err := endpoint.IsAttached(containerID)
+	if isAttached {
+		return err
+	}
 	return modifyNetworkEndpoint(containerID, endpointID, Add)
 }
 
 // HotDetachEndpoint makes a HCS Call to detach the endpoint from the container
 func HotDetachEndpoint(containerID string, endpointID string) error {
+	endpoint, err := GetHNSEndpointByID(endpointID)
+	isAttached, err := endpoint.IsAttached(containerID)
+	if !isAttached {
+		return err
+	}
 	return modifyNetworkEndpoint(containerID, endpointID, Remove)
 }
 

vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go

@@ -0,0 +1,83 @@
+package cow
+
+import (
+	"context"
+	"io"
+
+	"github.com/Microsoft/hcsshim/internal/schema1"
+	hcsschema "github.com/Microsoft/hcsshim/internal/schema2"
+)
+
+// Process is the interface for an OS process running in a container or utility VM.
+type Process interface {
+	// Close releases resources associated with the process and closes the
+	// writer and readers returned by Stdio. Depending on the implementation,
+	// this may also terminate the process.
+	Close() error
+	// CloseStdin causes the process's stdin handle to receive EOF/EPIPE/whatever
+	// is appropriate to indicate that no more data is available.
+	CloseStdin(ctx context.Context) error
+	// Pid returns the process ID.
+	Pid() int
+	// Stdio returns the stdio streams for a process. These may be nil if a stream
+	// was not requested during CreateProcess.
+	Stdio() (_ io.Writer, _ io.Reader, _ io.Reader)
+	// ResizeConsole resizes the virtual terminal associated with the process.
+	ResizeConsole(ctx context.Context, width, height uint16) error
+	// Kill sends a SIGKILL or equivalent signal to the process and returns whether
+	// the signal was delivered. It does not wait for the process to terminate.
+	Kill(ctx context.Context) (bool, error)
+	// Signal sends a signal to the process and returns whether the signal was
+	// delivered. The input is OS specific (either
+	// guestrequest.SignalProcessOptionsWCOW or
+	// guestrequest.SignalProcessOptionsLCOW). It does not wait for the process
+	// to terminate.
+	Signal(ctx context.Context, options interface{}) (bool, error)
+	// Wait waits for the process to complete, or for a connection to the process to be
+	// terminated by some error condition (including calling Close).
+	Wait() error
+	// ExitCode returns the exit code of the process. Returns an error if the process is
+	// not running.
+	ExitCode() (int, error)
+}
+
+// ProcessHost is the interface for creating processes.
+type ProcessHost interface {
+	// CreateProcess creates a process. The configuration is host specific
+	// (either hcsschema.ProcessParameters or lcow.ProcessParameters).
+	CreateProcess(ctx context.Context, config interface{}) (Process, error)
+	// OS returns the host's operating system, "linux" or "windows".
+	OS() string
+	// IsOCI specifies whether this is an OCI-compliant process host. If true,
+	// then the configuration passed to CreateProcess should have an OCI process
+	// spec (or nil if this is the initial process in an OCI container).
+	// Otherwise, it should have the HCS-specific process parameters.
+	IsOCI() bool
+}
+
+// Container is the interface for container objects, either running on the host or
+// in a utility VM.
+type Container interface {
+	ProcessHost
+	// Close releases the resources associated with the container. Depending on
+	// the implementation, this may also terminate the container.
+	Close() error
+	// ID returns the container ID.
+	ID() string
+	// Properties returns the requested container properties targeting a V1 schema container.
+	Properties(ctx context.Context, types ...schema1.PropertyType) (*schema1.ContainerProperties, error)
+	// PropertiesV2 returns the requested container properties targeting a V2 schema container.
+	PropertiesV2(ctx context.Context, types ...hcsschema.PropertyType) (*hcsschema.Properties, error)
+	// Start starts a container.
+	Start(ctx context.Context) error
+	// Shutdown sends a shutdown request to the container (but does not wait for
+	// the shutdown to complete).
+	Shutdown(ctx context.Context) error
+	// Terminate sends a terminate request to the container (but does not wait
+	// for the terminate to complete).
+	Terminate(ctx context.Context) error
+	// Wait waits for the container to terminate, or for the connection to the
+	// container to be terminated by some error condition (including calling
+	// Close).
+	Wait() error
+}

vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go

@@ -1,100 +0,0 @@
-package guestrequest
-
-import (
-	"github.com/Microsoft/hcsshim/internal/schema2"
-)
-
-// Arguably, many of these (at least CombinedLayers) should have been generated
-// by swagger.
-//
-// This will also change package name due to an inbound breaking change.
-
-// This class is used by a modify request to add or remove a combined layers
-// structure in the guest. For windows, the GCS applies a filter in ContainerRootPath
-// using the specified layers as the parent content. Ignores property ScratchPath
-// since the container path is already the scratch path. For linux, the GCS unions
-// the specified layers and ScratchPath together, placing the resulting union
-// filesystem at ContainerRootPath.
-type CombinedLayers struct {
-	ContainerRootPath string            `json:"ContainerRootPath,omitempty"`
-	Layers            []hcsschema.Layer `json:"Layers,omitempty"`
-	ScratchPath       string            `json:"ScratchPath,omitempty"`
-}
-
-// Defines the schema for hosted settings passed to GCS and/or OpenGCS
-
-// SCSI. Scratch space for remote file-system commands, or R/W layer for containers
-type LCOWMappedVirtualDisk struct {
-	MountPath  string `json:"MountPath,omitempty"` // /tmp/scratch for an LCOW utility VM being used as a service VM
-	Lun        uint8  `json:"Lun,omitempty"`
-	Controller uint8  `json:"Controller,omitempty"`
-	ReadOnly   bool   `json:"ReadOnly,omitempty"`
-}
-
-type WCOWMappedVirtualDisk struct {
-	ContainerPath string `json:"ContainerPath,omitempty"`
-	Lun           int32  `json:"Lun,omitempty"`
-}
-
-type LCOWMappedDirectory struct {
-	MountPath string `json:"MountPath,omitempty"`
-	Port      int32  `json:"Port,omitempty"`
-	ShareName string `json:"ShareName,omitempty"` // If empty not using ANames (not currently supported)
-	ReadOnly  bool   `json:"ReadOnly,omitempty"`
-}
-
-// Read-only layers over VPMem
-type LCOWMappedVPMemDevice struct {
-	DeviceNumber uint32 `json:"DeviceNumber,omitempty"`
-	MountPath    string `json:"MountPath,omitempty"` // /tmp/pN
-}
-
-type LCOWNetworkAdapter struct {
-	NamespaceID     string `json:",omitempty"`
-	ID              string `json:",omitempty"`
-	MacAddress      string `json:",omitempty"`
-	IPAddress       string `json:",omitempty"`
-	PrefixLength    uint8  `json:",omitempty"`
-	GatewayAddress  string `json:",omitempty"`
-	DNSSuffix       string `json:",omitempty"`
-	DNSServerList   string `json:",omitempty"`
-	EnableLowMetric bool   `json:",omitempty"`
-	EncapOverhead   uint16 `json:",omitempty"`
-}
-
-type ResourceType string
-
-const (
-	// These are constants for v2 schema modify guest requests.
-	ResourceTypeMappedDirectory   ResourceType = "MappedDirectory"
-	ResourceTypeMappedVirtualDisk ResourceType = "MappedVirtualDisk"
-	ResourceTypeNetwork           ResourceType = "Network"
-	ResourceTypeNetworkNamespace  ResourceType = "NetworkNamespace"
-	ResourceTypeCombinedLayers    ResourceType = "CombinedLayers"
-	ResourceTypeVPMemDevice       ResourceType = "VPMemDevice"
-)
-
-// GuestRequest is for modify commands passed to the guest.
-type GuestRequest struct {
-	RequestType  string       `json:"RequestType,omitempty"`
-	ResourceType ResourceType `json:"ResourceType,omitempty"`
-	Settings     interface{}  `json:"Settings,omitempty"`
-}
-
-type NetworkModifyRequest struct {
-	AdapterId   string      `json:"AdapterId,omitempty"`
-	RequestType string      `json:"RequestType,omitempty"`
-	Settings    interface{} `json:"Settings,omitempty"`
-}
-
-type RS4NetworkModifyRequest struct {
-	AdapterInstanceId string      `json:"AdapterInstanceId,omitempty"`
-	RequestType       string      `json:"RequestType,omitempty"`
-	Settings          interface{} `json:"Settings,omitempty"`
-}
-
-// SignalProcessOptions is the options passed to either WCOW or LCOW
-// to signal a given process.
-type SignalProcessOptions struct {
-	Signal int `json:,omitempty`
-}

vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go

@@ -1,69 +0,0 @@
-package guid
-
-import (
-	"crypto/rand"
-	"encoding/json"
-	"fmt"
-	"io"
-	"strconv"
-	"strings"
-)
-
-var _ = (json.Marshaler)(&GUID{})
-var _ = (json.Unmarshaler)(&GUID{})
-
-type GUID [16]byte
-
-func New() GUID {
-	g := GUID{}
-	_, err := io.ReadFull(rand.Reader, g[:])
-	if err != nil {
-		panic(err)
-	}
-	return g
-}
-
-func (g GUID) String() string {
-	return fmt.Sprintf("%02x%02x%02x%02x-%02x%02x-%02x%02x-%02x-%02x", g[3], g[2], g[1], g[0], g[5], g[4], g[7], g[6], g[8:10], g[10:])
-}
-
-func FromString(s string) GUID {
-	if len(s) != 36 {
-		panic(fmt.Sprintf("invalid GUID length: %d", len(s)))
-	}
-	if s[8] != '-' || s[13] != '-' || s[18] != '-' || s[23] != '-' {
-		panic("invalid GUID format")
-	}
-	indexOrder := [16]int{
-		0, 2, 4, 6,
-		9, 11,
-		14, 16,
-		19, 21,
-		24, 26, 28, 30, 32, 34,
-	}
-	byteOrder := [16]int{
-		3, 2, 1, 0,
-		5, 4,
-		7, 6,
-		8, 9,
-		10, 11, 12, 13, 14, 15,
-	}
-	var g GUID
-	for i, x := range indexOrder {
-		b, err := strconv.ParseInt(s[x:x+2], 16, 16)
-		if err != nil {
-			panic(err)
-		}
-		g[byteOrder[i]] = byte(b)
-	}
-	return g
-}
-
-func (g GUID) MarshalJSON() ([]byte, error) {
-	return json.Marshal(g.String())
-}
-
-func (g *GUID) UnmarshalJSON(data []byte) error {
-	*g = FromString(strings.Trim(string(data), "\""))
-	return nil
-}

vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go

@@ -1,10 +1,13 @@
 package hcs
 
 import (
+	"fmt"
 	"sync"
 	"syscall"
 
 	"github.com/Microsoft/hcsshim/internal/interop"
+	"github.com/Microsoft/hcsshim/internal/logfields"
+	"github.com/Microsoft/hcsshim/internal/vmcompute"
 	"github.com/sirupsen/logrus"
 )
 
@@ -40,35 +43,83 @@ var (
 )
 
 type hcsNotification uint32
+
+func (hn hcsNotification) String() string {
+	switch hn {
+	case hcsNotificationSystemExited:
+		return "SystemExited"
+	case hcsNotificationSystemCreateCompleted:
+		return "SystemCreateCompleted"
+	case hcsNotificationSystemStartCompleted:
+		return "SystemStartCompleted"
+	case hcsNotificationSystemPauseCompleted:
+		return "SystemPauseCompleted"
+	case hcsNotificationSystemResumeCompleted:
+		return "SystemResumeCompleted"
+	case hcsNotificationSystemCrashReport:
+		return "SystemCrashReport"
+	case hcsNotificationSystemSiloJobCreated:
+		return "SystemSiloJobCreated"
+	case hcsNotificationSystemSaveCompleted:
+		return "SystemSaveCompleted"
+	case hcsNotificationSystemRdpEnhancedModeStateChanged:
+		return "SystemRdpEnhancedModeStateChanged"
+	case hcsNotificationSystemShutdownFailed:
+		return "SystemShutdownFailed"
+	case hcsNotificationSystemGetPropertiesCompleted:
+		return "SystemGetPropertiesCompleted"
+	case hcsNotificationSystemModifyCompleted:
+		return "SystemModifyCompleted"
+	case hcsNotificationSystemCrashInitiated:
+		return "SystemCrashInitiated"
+	case hcsNotificationSystemGuestConnectionClosed:
+		return "SystemGuestConnectionClosed"
+	case hcsNotificationProcessExited:
+		return "ProcessExited"
+	case hcsNotificationInvalid:
+		return "Invalid"
+	case hcsNotificationServiceDisconnect:
+		return "ServiceDisconnect"
+	default:
+		return fmt.Sprintf("Unknown: %d", hn)
+	}
+}
+
 type notificationChannel chan error
 
 type notifcationWatcherContext struct {
 	channels notificationChannels
-	handle   hcsCallback
+	handle   vmcompute.HcsCallback
+
+	systemID  string
+	processID int
 }
 
 type notificationChannels map[hcsNotification]notificationChannel
 
-func newChannels() notificationChannels {
+func newSystemChannels() notificationChannels {
 	channels := make(notificationChannels)
+	for _, notif := range []hcsNotification{
+		hcsNotificationServiceDisconnect,
+		hcsNotificationSystemExited,
+		hcsNotificationSystemCreateCompleted,
+		hcsNotificationSystemStartCompleted,
+		hcsNotificationSystemPauseCompleted,
+		hcsNotificationSystemResumeCompleted,
+	} {
+		channels[notif] = make(notificationChannel, 1)
+	}
+	return channels
+}
 
-	channels[hcsNotificationSystemExited] = make(notificationChannel, 1)
+func newProcessChannels() notificationChannels {
-	channels[hcsNotificationSystemCreateCompleted] = make(notificationChannel, 1)
+	channels := make(notificationChannels)
-	channels[hcsNotificationSystemStartCompleted] = make(notificationChannel, 1)
+	for _, notif := range []hcsNotification{
-	channels[hcsNotificationSystemPauseCompleted] = make(notificationChannel, 1)
+		hcsNotificationServiceDisconnect,
-	channels[hcsNotificationSystemResumeCompleted] = make(notificationChannel, 1)
+		hcsNotificationProcessExited,
-	channels[hcsNotificationProcessExited] = make(notificationChannel, 1)
+	} {
-	channels[hcsNotificationServiceDisconnect] = make(notificationChannel, 1)
+		channels[notif] = make(notificationChannel, 1)
-	channels[hcsNotificationSystemCrashReport] = make(notificationChannel, 1)
+	}
-	channels[hcsNotificationSystemSiloJobCreated] = make(notificationChannel, 1)
-	channels[hcsNotificationSystemSaveCompleted] = make(notificationChannel, 1)
-	channels[hcsNotificationSystemRdpEnhancedModeStateChanged] = make(notificationChannel, 1)
-	channels[hcsNotificationSystemShutdownFailed] = make(notificationChannel, 1)
-	channels[hcsNotificationSystemGetPropertiesCompleted] = make(notificationChannel, 1)
-	channels[hcsNotificationSystemModifyCompleted] = make(notificationChannel, 1)
-	channels[hcsNotificationSystemCrashInitiated] = make(notificationChannel, 1)
-	channels[hcsNotificationSystemGuestConnectionClosed] = make(notificationChannel, 1)
-
 	return channels
 }
 
@@ -92,12 +143,17 @@ func notificationWatcher(notificationType hcsNotification, callbackNumber uintpt
 		return 0
 	}
 
+	log := logrus.WithFields(logrus.Fields{
+		"notification-type": notificationType.String(),
+		"system-id":         context.systemID,
+	})
+	if context.processID != 0 {
+		log.Data[logfields.ProcessID] = context.processID
+	}
+	log.Debug("HCS notification")
+
 	if channel, ok := context.channels[notificationType]; ok {
 		channel <- result
-	} else {
-		logrus.WithFields(logrus.Fields{
-			"notification-type": notificationType,
-		}).Warn("Received a callback of an unsupported type")
 	}
 
 	return 0

vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go

@@ -1,14 +1,14 @@
 package hcs
 
 import (
+	"context"
 	"encoding/json"
 	"errors"
 	"fmt"
+	"net"
 	"syscall"
 
-	"github.com/Microsoft/hcsshim/internal/interop"
+	"github.com/Microsoft/hcsshim/internal/log"
-	"github.com/Microsoft/hcsshim/internal/logfields"
-	"github.com/sirupsen/logrus"
 )
 
 var (
@@ -117,17 +117,11 @@ func (ev *ErrorEvent) String() string {
 	return evs
 }
 
-func processHcsResult(resultp *uint16) []ErrorEvent {
+func processHcsResult(ctx context.Context, resultJSON string) []ErrorEvent {
-	if resultp != nil {
+	if resultJSON != "" {
-		resultj := interop.ConvertAndFreeCoTaskMemString(resultp)
-		logrus.WithField(logfields.JSON, resultj).
-			Debug("HCS Result")
 		result := &hcsResult{}
-		if err := json.Unmarshal([]byte(resultj), result); err != nil {
+		if err := json.Unmarshal([]byte(resultJSON), result); err != nil {
-			logrus.WithFields(logrus.Fields{
+			log.G(ctx).WithError(err).Warning("Could not unmarshal HCS result")
-				logfields.JSON:  resultj,
-				logrus.ErrorKey: err,
-			}).Warning("Could not unmarshal HCS result")
 			return nil
 		}
 		return result.ErrorEvents
@@ -141,6 +135,8 @@ type HcsError struct {
 	Events []ErrorEvent
 }
 
+var _ net.Error = &HcsError{}
+
 func (e *HcsError) Error() string {
 	s := e.Op + ": " + e.Err.Error()
 	for _, ev := range e.Events {
@@ -149,6 +145,16 @@ func (e *HcsError) Error() string {
 	return s
 }
 
+func (e *HcsError) Temporary() bool {
+	err, ok := e.Err.(net.Error)
+	return ok && err.Temporary()
+}
+
+func (e *HcsError) Timeout() bool {
+	err, ok := e.Err.(net.Error)
+	return ok && err.Timeout()
+}
+
 // ProcessError is an error encountered in HCS during an operation on a Process object
 type ProcessError struct {
 	SystemID string
@@ -158,6 +164,8 @@ type ProcessError struct {
 	Events   []ErrorEvent
 }
 
+var _ net.Error = &ProcessError{}
+
 // SystemError is an error encountered in HCS during an operation on a Container object
 type SystemError struct {
 	ID     string
@@ -167,6 +175,8 @@ type SystemError struct {
 	Events []ErrorEvent
 }
 
+var _ net.Error = &SystemError{}
+
 func (e *SystemError) Error() string {
 	s := e.Op + " " + e.ID + ": " + e.Err.Error()
 	for _, ev := range e.Events {
@@ -178,6 +188,16 @@ func (e *SystemError) Error() string {
 	return s
 }
 
+func (e *SystemError) Temporary() bool {
+	err, ok := e.Err.(net.Error)
+	return ok && err.Temporary()
+}
+
+func (e *SystemError) Timeout() bool {
+	err, ok := e.Err.(net.Error)
+	return ok && err.Timeout()
+}
+
 func makeSystemError(system *System, op string, extra string, err error, events []ErrorEvent) error {
 	// Don't double wrap errors
 	if _, ok := err.(*SystemError); ok {
@@ -200,6 +220,16 @@ func (e *ProcessError) Error() string {
 	return s
 }
 
+func (e *ProcessError) Temporary() bool {
+	err, ok := e.Err.(net.Error)
+	return ok && err.Temporary()
+}
+
+func (e *ProcessError) Timeout() bool {
+	err, ok := e.Err.(net.Error)
+	return ok && err.Timeout()
+}
+
 func makeProcessError(process *Process, op string, err error, events []ErrorEvent) error {
 	// Don't double wrap errors
 	if _, ok := err.(*ProcessError); ok {
@@ -242,6 +272,9 @@ func IsPending(err error) bool {
 // IsTimeout returns a boolean indicating whether the error is caused by
 // a timeout waiting for the operation to complete.
 func IsTimeout(err error) bool {
+	if err, ok := err.(net.Error); ok && err.Timeout() {
+		return true
+	}
 	err = getInnerError(err)
 	return err == ErrTimeout
 }
@@ -272,6 +305,13 @@ func IsNotSupported(err error) bool {
 		err == ErrVmcomputeUnknownMessage
 }
 
+// IsOperationInvalidState returns true when err is caused by
+// `ErrVmcomputeOperationInvalidState`.
+func IsOperationInvalidState(err error) bool {
+	err = getInnerError(err)
+	return err == ErrVmcomputeOperationInvalidState
+}
+
 func getInnerError(err error) error {
 	switch pe := err.(type) {
 	case nil:
@@ -285,3 +325,12 @@ func getInnerError(err error) error {
 	}
 	return err
 }
+
+func getOperationLogResult(err error) (string, error) {
+	switch err {
+	case nil:
+		return "Success", nil
+	default:
+		return "Error", err
+	}
+}

vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go

@@ -1,48 +0,0 @@
-// Shim for the Host Compute Service (HCS) to manage Windows Server
-// containers and Hyper-V containers.
-
-package hcs
-
-import (
-	"syscall"
-)
-
-//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hcs.go
-
-//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems?
-//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem?
-//sys hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem?
-//sys hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem?
-//sys hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem?
-//sys hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem?
-//sys hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem?
-//sys hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem?
-//sys hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem?
-//sys hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties?
-//sys hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem?
-//sys hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback?
-//sys hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback?
-
-//sys hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess?
-//sys hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess?
-//sys hcsCloseProcess(process hcsProcess) (hr error) = vmcompute.HcsCloseProcess?
-//sys hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess?
-//sys hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) = vmcompute.HcsTerminateProcess?
-//sys hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo?
-//sys hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties?
-//sys hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess?
-//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties?
-//sys hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback?
-//sys hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback?
-
-type hcsSystem syscall.Handle
-type hcsProcess syscall.Handle
-type hcsCallback syscall.Handle
-
-type hcsProcessInformation struct {
-	ProcessId uint32
-	Reserved  uint32
-	StdInput  syscall.Handle
-	StdOutput syscall.Handle
-	StdError  syscall.Handle
-}

vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go

@@ -1,20 +0,0 @@
-package hcs
-
-import "github.com/sirupsen/logrus"
-
-func logOperationBegin(ctx logrus.Fields, msg string) {
-	logrus.WithFields(ctx).Debug(msg)
-}
-
-func logOperationEnd(ctx logrus.Fields, msg string, err error) {
-	// Copy the log and fields first.
-	log := logrus.WithFields(ctx)
-	if err == nil {
-		log.Debug(msg)
-	} else {
-		// Edit only the copied field data to avoid race conditions on the
-		// write.
-		log.Data[logrus.ErrorKey] = err
-		log.Error(msg)
-	}
-}

vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go

@@ -1,48 +1,45 @@
 package hcs
 
 import (
+	"context"
 	"encoding/json"
 	"io"
 	"sync"
 	"syscall"
 	"time"
 
-	"github.com/Microsoft/hcsshim/internal/guestrequest"
+	"github.com/Microsoft/hcsshim/internal/log"
-	"github.com/Microsoft/hcsshim/internal/interop"
+	"github.com/Microsoft/hcsshim/internal/oc"
-	"github.com/Microsoft/hcsshim/internal/logfields"
+	"github.com/Microsoft/hcsshim/internal/vmcompute"
-	"github.com/sirupsen/logrus"
+	"go.opencensus.io/trace"
 )
 
 // ContainerError is an error encountered in HCS
 type Process struct {
 	handleLock     sync.RWMutex
-	handle         hcsProcess
+	handle         vmcompute.HcsProcess
 	processID      int
 	system         *System
-	cachedPipes    *cachedPipes
+	stdin          io.WriteCloser
+	stdout         io.ReadCloser
+	stderr         io.ReadCloser
 	callbackNumber uintptr
 
-	logctx logrus.Fields
+	closedWaitOnce sync.Once
+	waitBlock      chan struct{}
+	exitCode       int
+	waitError      error
 }
 
-func newProcess(process hcsProcess, processID int, computeSystem *System) *Process {
+func newProcess(process vmcompute.HcsProcess, processID int, computeSystem *System) *Process {
 	return &Process{
 		handle:    process,
 		processID: processID,
 		system:    computeSystem,
-		logctx: logrus.Fields{
+		waitBlock: make(chan struct{}),
-			logfields.ContainerID: computeSystem.ID(),
-			logfields.ProcessID:   processID,
-		},
 	}
 }
 
-type cachedPipes struct {
-	stdIn  syscall.Handle
-	stdOut syscall.Handle
-	stdErr syscall.Handle
-}
-
 type processModifyRequest struct {
 	Operation   string
 	ConsoleSize *consoleSize `json:",omitempty"`
@@ -58,7 +55,7 @@ type closeHandle struct {
 	Handle string
 }
 
-type ProcessStatus struct {
+type processStatus struct {
 	ProcessID      uint32
 	Exited         bool
 	ExitCode       uint32
@@ -86,120 +83,153 @@ func (process *Process) SystemID() string {
 	return process.system.ID()
 }
 
-func (process *Process) logOperationBegin(operation string) {
+func (process *Process) processSignalResult(ctx context.Context, err error) (bool, error) {
-	logOperationBegin(
+	switch err {
-		process.logctx,
+	case nil:
-		operation+" - Begin Operation")
+		return true, nil
-}
+	case ErrVmcomputeOperationInvalidState, ErrComputeSystemDoesNotExist, ErrElementNotFound:
-
+		select {
-func (process *Process) logOperationEnd(operation string, err error) {
+		case <-process.waitBlock:
-	var result string
+			// The process exit notification has already arrived.
-	if err == nil {
+		default:
-		result = "Success"
+			// The process should be gone, but we have not received the notification.
-	} else {
+			// After a second, force unblock the process wait to work around a possible
-		result = "Error"
+			// deadlock in the HCS.
+			go func() {
+				time.Sleep(time.Second)
+				process.closedWaitOnce.Do(func() {
+					log.G(ctx).WithError(err).Warn("force unblocking process waits")
+					process.exitCode = -1
+					process.waitError = err
+					close(process.waitBlock)
+				})
+			}()
+		}
+		return false, nil
+	default:
+		return false, err
 	}
-
-	logOperationEnd(
-		process.logctx,
-		operation+" - End Operation - "+result,
-		err)
 }
 
 // Signal signals the process with `options`.
-func (process *Process) Signal(options guestrequest.SignalProcessOptions) (err error) {
+//
+// For LCOW `guestrequest.SignalProcessOptionsLCOW`.
+//
+// For WCOW `guestrequest.SignalProcessOptionsWCOW`.
+func (process *Process) Signal(ctx context.Context, options interface{}) (bool, error) {
 	process.handleLock.RLock()
 	defer process.handleLock.RUnlock()
 
 	operation := "hcsshim::Process::Signal"
-	process.logOperationBegin(operation)
-	defer func() { process.logOperationEnd(operation, err) }()
 
 	if process.handle == 0 {
-		return makeProcessError(process, operation, ErrAlreadyClosed, nil)
+		return false, makeProcessError(process, operation, ErrAlreadyClosed, nil)
 	}
 
 	optionsb, err := json.Marshal(options)
 	if err != nil {
-		return err
+		return false, err
 	}
 
-	optionsStr := string(optionsb)
+	resultJSON, err := vmcompute.HcsSignalProcess(ctx, process.handle, string(optionsb))
-
+	events := processHcsResult(ctx, resultJSON)
-	var resultp *uint16
+	delivered, err := process.processSignalResult(ctx, err)
-	syscallWatcher(process.logctx, func() {
-		err = hcsSignalProcess(process.handle, optionsStr, &resultp)
-	})
-	events := processHcsResult(resultp)
 	if err != nil {
-		return makeProcessError(process, operation, err, events)
+		err = makeProcessError(process, operation, err, events)
 	}
-
+	return delivered, err
-	return nil
 }
 
 // Kill signals the process to terminate but does not wait for it to finish terminating.
-func (process *Process) Kill() (err error) {
+func (process *Process) Kill(ctx context.Context) (bool, error) {
 	process.handleLock.RLock()
 	defer process.handleLock.RUnlock()
 
 	operation := "hcsshim::Process::Kill"
-	process.logOperationBegin(operation)
-	defer func() { process.logOperationEnd(operation, err) }()
 
 	if process.handle == 0 {
-		return makeProcessError(process, operation, ErrAlreadyClosed, nil)
+		return false, makeProcessError(process, operation, ErrAlreadyClosed, nil)
 	}
 
-	var resultp *uint16
+	resultJSON, err := vmcompute.HcsTerminateProcess(ctx, process.handle)
-	syscallWatcher(process.logctx, func() {
+	events := processHcsResult(ctx, resultJSON)
-		err = hcsTerminateProcess(process.handle, &resultp)
+	delivered, err := process.processSignalResult(ctx, err)
+	if err != nil {
+		err = makeProcessError(process, operation, err, events)
+	}
+	return delivered, err
+}
+
+// waitBackground waits for the process exit notification. Once received sets
+// `process.waitError` (if any) and unblocks all `Wait` calls.
+//
+// This MUST be called exactly once per `process.handle` but `Wait` is safe to
+// call multiple times.
+func (process *Process) waitBackground() {
+	operation := "hcsshim::Process::waitBackground"
+	ctx, span := trace.StartSpan(context.Background(), operation)
+	defer span.End()
+	span.AddAttributes(
+		trace.StringAttribute("cid", process.SystemID()),
+		trace.Int64Attribute("pid", int64(process.processID)))
+
+	var (
+		err      error
+		exitCode = -1
+	)
+
+	err = waitForNotification(ctx, process.callbackNumber, hcsNotificationProcessExited, nil)
+	if err != nil {
+		err = makeProcessError(process, operation, err, nil)
+		log.G(ctx).WithError(err).Error("failed wait")
+	} else {
+		process.handleLock.RLock()
+		defer process.handleLock.RUnlock()
+
+		// Make sure we didnt race with Close() here
+		if process.handle != 0 {
+			propertiesJSON, resultJSON, err := vmcompute.HcsGetProcessProperties(ctx, process.handle)
+			events := processHcsResult(ctx, resultJSON)
+			if err != nil {
+				err = makeProcessError(process, operation, err, events)
+			} else {
+				properties := &processStatus{}
+				err = json.Unmarshal([]byte(propertiesJSON), properties)
+				if err != nil {
+					err = makeProcessError(process, operation, err, nil)
+				} else {
+					if properties.LastWaitResult != 0 {
+						log.G(ctx).WithField("wait-result", properties.LastWaitResult).Warning("non-zero last wait result")
+					} else {
+						exitCode = int(properties.ExitCode)
+					}
+				}
+			}
+		}
+	}
+	log.G(ctx).WithField("exitCode", exitCode).Debug("process exited")
+
+	process.closedWaitOnce.Do(func() {
+		process.exitCode = exitCode
+		process.waitError = err
+		close(process.waitBlock)
 	})
-	events := processHcsResult(resultp)
+	oc.SetSpanStatus(span, err)
-	if err != nil {
-		return makeProcessError(process, operation, err, events)
-	}
-
-	return nil
 }
 
-// Wait waits for the process to exit.
+// Wait waits for the process to exit. If the process has already exited returns
-func (process *Process) Wait() (err error) {
+// the pervious error (if any).
-	operation := "hcsshim::Process::Wait"
+func (process *Process) Wait() error {
-	process.logOperationBegin(operation)
+	<-process.waitBlock
-	defer func() { process.logOperationEnd(operation, err) }()
+	return process.waitError
-
-	err = waitForNotification(process.callbackNumber, hcsNotificationProcessExited, nil)
-	if err != nil {
-		return makeProcessError(process, operation, err, nil)
-	}
-
-	return nil
-}
-
-// WaitTimeout waits for the process to exit or the duration to elapse. It returns
-// false if timeout occurs.
-func (process *Process) WaitTimeout(timeout time.Duration) (err error) {
-	operation := "hcssshim::Process::WaitTimeout"
-	process.logOperationBegin(operation)
-	defer func() { process.logOperationEnd(operation, err) }()
-
-	err = waitForNotification(process.callbackNumber, hcsNotificationProcessExited, &timeout)
-	if err != nil {
-		return makeProcessError(process, operation, err, nil)
-	}
-
-	return nil
 }
 
 // ResizeConsole resizes the console of the process.
-func (process *Process) ResizeConsole(width, height uint16) (err error) {
+func (process *Process) ResizeConsole(ctx context.Context, width, height uint16) error {
 	process.handleLock.RLock()
 	defer process.handleLock.RUnlock()
 
 	operation := "hcsshim::Process::ResizeConsole"
-	process.logOperationBegin(operation)
-	defer func() { process.logOperationEnd(operation, err) }()
 
 	if process.handle == 0 {
 		return makeProcessError(process, operation, ErrAlreadyClosed, nil)
@@ -218,11 +248,8 @@ func (process *Process) ResizeConsole(width, height uint16) (err error) {
 		return err
 	}
 
-	modifyRequestStr := string(modifyRequestb)
+	resultJSON, err := vmcompute.HcsModifyProcess(ctx, process.handle, string(modifyRequestb))
-
+	events := processHcsResult(ctx, resultJSON)
-	var resultp *uint16
-	err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp)
-	events := processHcsResult(resultp)
 	if err != nil {
 		return makeProcessError(process, operation, err, events)
 	}
@@ -230,104 +257,46 @@ func (process *Process) ResizeConsole(width, height uint16) (err error) {
 	return nil
 }
 
-func (process *Process) Properties() (_ *ProcessStatus, err error) {
-	process.handleLock.RLock()
-	defer process.handleLock.RUnlock()
-
-	operation := "hcsshim::Process::Properties"
-	process.logOperationBegin(operation)
-	defer func() { process.logOperationEnd(operation, err) }()
-
-	if process.handle == 0 {
-		return nil, makeProcessError(process, operation, ErrAlreadyClosed, nil)
-	}
-
-	var (
-		resultp     *uint16
-		propertiesp *uint16
-	)
-	syscallWatcher(process.logctx, func() {
-		err = hcsGetProcessProperties(process.handle, &propertiesp, &resultp)
-	})
-	events := processHcsResult(resultp)
-	if err != nil {
-		return nil, makeProcessError(process, operation, err, events)
-	}
-
-	if propertiesp == nil {
-		return nil, ErrUnexpectedValue
-	}
-	propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp)
-
-	properties := &ProcessStatus{}
-	if err := json.Unmarshal(propertiesRaw, properties); err != nil {
-		return nil, makeProcessError(process, operation, err, nil)
-	}
-
-	return properties, nil
-}
-
 // ExitCode returns the exit code of the process. The process must have
 // already terminated.
-func (process *Process) ExitCode() (_ int, err error) {
+func (process *Process) ExitCode() (int, error) {
-	operation := "hcsshim::Process::ExitCode"
+	select {
-	process.logOperationBegin(operation)
+	case <-process.waitBlock:
-	defer func() { process.logOperationEnd(operation, err) }()
+		if process.waitError != nil {
-
+			return -1, process.waitError
-	properties, err := process.Properties()
+		}
-	if err != nil {
+		return process.exitCode, nil
-		return 0, makeProcessError(process, operation, err, nil)
+	default:
+		return -1, makeProcessError(process, "hcsshim::Process::ExitCode", ErrInvalidProcessState, nil)
 	}
-
-	if properties.Exited == false {
-		return 0, makeProcessError(process, operation, ErrInvalidProcessState, nil)
-	}
-
-	if properties.LastWaitResult != 0 {
-		return 0, makeProcessError(process, operation, syscall.Errno(properties.LastWaitResult), nil)
-	}
-
-	return int(properties.ExitCode), nil
 }
 
-// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing
+// StdioLegacy returns the stdin, stdout, and stderr pipes, respectively. Closing
-// these pipes does not close the underlying pipes; it should be possible to
+// these pipes does not close the underlying pipes; but this function can only
-// call this multiple times to get multiple interfaces.
+// be called once on each Process.
-func (process *Process) Stdio() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadCloser, err error) {
+func (process *Process) StdioLegacy() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadCloser, err error) {
+	operation := "hcsshim::Process::StdioLegacy"
+	ctx, span := trace.StartSpan(context.Background(), operation)
+	defer span.End()
+	defer func() { oc.SetSpanStatus(span, err) }()
+	span.AddAttributes(
+		trace.StringAttribute("cid", process.SystemID()),
+		trace.Int64Attribute("pid", int64(process.processID)))
+
 	process.handleLock.RLock()
 	defer process.handleLock.RUnlock()
 
-	operation := "hcsshim::Process::Stdio"
-	process.logOperationBegin(operation)
-	defer func() { process.logOperationEnd(operation, err) }()
-
 	if process.handle == 0 {
 		return nil, nil, nil, makeProcessError(process, operation, ErrAlreadyClosed, nil)
 	}
 
-	var stdIn, stdOut, stdErr syscall.Handle
+	processInfo, resultJSON, err := vmcompute.HcsGetProcessInfo(ctx, process.handle)
-
+	events := processHcsResult(ctx, resultJSON)
-	if process.cachedPipes == nil {
+	if err != nil {
-		var (
+		return nil, nil, nil, makeProcessError(process, operation, err, events)
-			processInfo hcsProcessInformation
-			resultp     *uint16
-		)
-		err = hcsGetProcessInfo(process.handle, &processInfo, &resultp)
-		events := processHcsResult(resultp)
-		if err != nil {
-			return nil, nil, nil, makeProcessError(process, operation, err, events)
-		}
-
-		stdIn, stdOut, stdErr = processInfo.StdInput, processInfo.StdOutput, processInfo.StdError
-	} else {
-		// Use cached pipes
-		stdIn, stdOut, stdErr = process.cachedPipes.stdIn, process.cachedPipes.stdOut, process.cachedPipes.stdErr
-
-		// Invalidate the cache
-		process.cachedPipes = nil
 	}
 
-	pipes, err := makeOpenFiles([]syscall.Handle{stdIn, stdOut, stdErr})
+	pipes, err := makeOpenFiles([]syscall.Handle{processInfo.StdInput, processInfo.StdOutput, processInfo.StdError})
 	if err != nil {
 		return nil, nil, nil, makeProcessError(process, operation, err, nil)
 	}
@@ -335,15 +304,19 @@ func (process *Process) Stdio() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadClo
 	return pipes[0], pipes[1], pipes[2], nil
 }
 
+// Stdio returns the stdin, stdout, and stderr pipes, respectively.
+// To close them, close the process handle.
+func (process *Process) Stdio() (stdin io.Writer, stdout, stderr io.Reader) {
+	return process.stdin, process.stdout, process.stderr
+}
+
 // CloseStdin closes the write side of the stdin pipe so that the process is
 // notified on the read side that there is no more data in stdin.
-func (process *Process) CloseStdin() (err error) {
+func (process *Process) CloseStdin(ctx context.Context) error {
 	process.handleLock.RLock()
 	defer process.handleLock.RUnlock()
 
 	operation := "hcsshim::Process::CloseStdin"
-	process.logOperationBegin(operation)
-	defer func() { process.logOperationEnd(operation, err) }()
 
 	if process.handle == 0 {
 		return makeProcessError(process, operation, ErrAlreadyClosed, nil)
@@ -361,96 +334,116 @@ func (process *Process) CloseStdin() (err error) {
 		return err
 	}
 
-	modifyRequestStr := string(modifyRequestb)
+	resultJSON, err := vmcompute.HcsModifyProcess(ctx, process.handle, string(modifyRequestb))
-
+	events := processHcsResult(ctx, resultJSON)
-	var resultp *uint16
-	err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp)
-	events := processHcsResult(resultp)
 	if err != nil {
 		return makeProcessError(process, operation, err, events)
 	}
 
+	if process.stdin != nil {
+		process.stdin.Close()
+	}
 	return nil
 }
 
 // Close cleans up any state associated with the process but does not kill
 // or wait on it.
 func (process *Process) Close() (err error) {
+	operation := "hcsshim::Process::Close"
+	ctx, span := trace.StartSpan(context.Background(), operation)
+	defer span.End()
+	defer func() { oc.SetSpanStatus(span, err) }()
+	span.AddAttributes(
+		trace.StringAttribute("cid", process.SystemID()),
+		trace.Int64Attribute("pid", int64(process.processID)))
+
 	process.handleLock.Lock()
 	defer process.handleLock.Unlock()
 
-	operation := "hcsshim::Process::Close"
-	process.logOperationBegin(operation)
-	defer func() { process.logOperationEnd(operation, err) }()
-
 	// Don't double free this
 	if process.handle == 0 {
 		return nil
 	}
 
-	if err = process.unregisterCallback(); err != nil {
+	if process.stdin != nil {
+		process.stdin.Close()
+	}
+	if process.stdout != nil {
+		process.stdout.Close()
+	}
+	if process.stderr != nil {
+		process.stderr.Close()
+	}
+
+	if err = process.unregisterCallback(ctx); err != nil {
 		return makeProcessError(process, operation, err, nil)
 	}
 
-	if err = hcsCloseProcess(process.handle); err != nil {
+	if err = vmcompute.HcsCloseProcess(ctx, process.handle); err != nil {
 		return makeProcessError(process, operation, err, nil)
 	}
 
 	process.handle = 0
+	process.closedWaitOnce.Do(func() {
+		process.exitCode = -1
+		process.waitError = ErrAlreadyClosed
+		close(process.waitBlock)
+	})
 
 	return nil
 }
 
-func (process *Process) registerCallback() error {
+func (process *Process) registerCallback(ctx context.Context) error {
-	context := &notifcationWatcherContext{
+	callbackContext := &notifcationWatcherContext{
-		channels: newChannels(),
+		channels:  newProcessChannels(),
+		systemID:  process.SystemID(),
+		processID: process.processID,
 	}
 
 	callbackMapLock.Lock()
 	callbackNumber := nextCallback
 	nextCallback++
-	callbackMap[callbackNumber] = context
+	callbackMap[callbackNumber] = callbackContext
 	callbackMapLock.Unlock()
 
-	var callbackHandle hcsCallback
+	callbackHandle, err := vmcompute.HcsRegisterProcessCallback(ctx, process.handle, notificationWatcherCallback, callbackNumber)
-	err := hcsRegisterProcessCallback(process.handle, notificationWatcherCallback, callbackNumber, &callbackHandle)
 	if err != nil {
 		return err
 	}
-	context.handle = callbackHandle
+	callbackContext.handle = callbackHandle
 	process.callbackNumber = callbackNumber
 
 	return nil
 }
 
-func (process *Process) unregisterCallback() error {
+func (process *Process) unregisterCallback(ctx context.Context) error {
 	callbackNumber := process.callbackNumber
 
 	callbackMapLock.RLock()
-	context := callbackMap[callbackNumber]
+	callbackContext := callbackMap[callbackNumber]
 	callbackMapLock.RUnlock()
 
-	if context == nil {
+	if callbackContext == nil {
 		return nil
 	}
 
-	handle := context.handle
+	handle := callbackContext.handle
 
 	if handle == 0 {
 		return nil
 	}
 
-	// hcsUnregisterProcessCallback has its own syncronization
+	// vmcompute.HcsUnregisterProcessCallback has its own synchronization to
-	// to wait for all callbacks to complete. We must NOT hold the callbackMapLock.
+	// wait for all callbacks to complete. We must NOT hold the callbackMapLock.
-	err := hcsUnregisterProcessCallback(handle)
+	err := vmcompute.HcsUnregisterProcessCallback(ctx, handle)
 	if err != nil {
 		return err
 	}
 
-	closeChannels(context.channels)
+	closeChannels(callbackContext.channels)
 
 	callbackMapLock.Lock()
-	callbackMap[callbackNumber] = nil
+	delete(callbackMap, callbackNumber)
 	callbackMapLock.Unlock()
 
 	handle = 0

vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go

@@ -1,18 +1,24 @@
 package hcs
 
 import (
+	"context"
 	"encoding/json"
+	"errors"
 	"os"
 	"strconv"
+	"strings"
 	"sync"
 	"syscall"
 	"time"
 
-	"github.com/Microsoft/hcsshim/internal/interop"
+	"github.com/Microsoft/hcsshim/internal/cow"
-	"github.com/Microsoft/hcsshim/internal/logfields"
+	"github.com/Microsoft/hcsshim/internal/log"
+	"github.com/Microsoft/hcsshim/internal/oc"
 	"github.com/Microsoft/hcsshim/internal/schema1"
+	hcsschema "github.com/Microsoft/hcsshim/internal/schema2"
 	"github.com/Microsoft/hcsshim/internal/timeout"
-	"github.com/sirupsen/logrus"
+	"github.com/Microsoft/hcsshim/internal/vmcompute"
+	"go.opencensus.io/trace"
 )
 
 // currentContainerStarts is used to limit the number of concurrent container
@@ -38,49 +44,37 @@ func init() {
 
 type System struct {
 	handleLock     sync.RWMutex
-	handle         hcsSystem
+	handle         vmcompute.HcsSystem
 	id             string
 	callbackNumber uintptr
 
-	logctx logrus.Fields
+	closedWaitOnce sync.Once
+	waitBlock      chan struct{}
+	waitError      error
+	exitError      error
+
+	os, typ string
 }
 
 func newSystem(id string) *System {
 	return &System{
-		id: id,
+		id:        id,
-		logctx: logrus.Fields{
+		waitBlock: make(chan struct{}),
-			logfields.ContainerID: id,
-		},
 	}
 }
 
-func (computeSystem *System) logOperationBegin(operation string) {
-	logOperationBegin(
-		computeSystem.logctx,
-		operation+" - Begin Operation")
-}
-
-func (computeSystem *System) logOperationEnd(operation string, err error) {
-	var result string
-	if err == nil {
-		result = "Success"
-	} else {
-		result = "Error"
-	}
-
-	logOperationEnd(
-		computeSystem.logctx,
-		operation+" - End Operation - "+result,
-		err)
-}
-
 // CreateComputeSystem creates a new compute system with the given configuration but does not start it.
-func CreateComputeSystem(id string, hcsDocumentInterface interface{}) (_ *System, err error) {
+func CreateComputeSystem(ctx context.Context, id string, hcsDocumentInterface interface{}) (_ *System, err error) {
 	operation := "hcsshim::CreateComputeSystem"
 
+	// hcsCreateComputeSystemContext is an async operation. Start the outer span
+	// here to measure the full create time.
+	ctx, span := trace.StartSpan(ctx, operation)
+	defer span.End()
+	defer func() { oc.SetSpanStatus(span, err) }()
+	span.AddAttributes(trace.StringAttribute("cid", id))
+
 	computeSystem := newSystem(id)
-	computeSystem.logOperationBegin(operation)
-	defer func() { computeSystem.logOperationEnd(operation, err) }()
 
 	hcsDocumentB, err := json.Marshal(hcsDocumentInterface)
 	if err != nil {
@@ -89,126 +83,114 @@ func CreateComputeSystem(id string, hcsDocumentInterface interface{}) (_ *System
 
 	hcsDocument := string(hcsDocumentB)
 
-	logrus.WithFields(computeSystem.logctx).
-		WithField(logfields.JSON, hcsDocument).
-		Debug("HCS ComputeSystem Document")
-
 	var (
-		resultp     *uint16
 		identity    syscall.Handle
+		resultJSON  string
 		createError error
 	)
-	syscallWatcher(computeSystem.logctx, func() {
+	computeSystem.handle, resultJSON, createError = vmcompute.HcsCreateComputeSystem(ctx, id, hcsDocument, identity)
-		createError = hcsCreateComputeSystem(id, hcsDocument, identity, &computeSystem.handle, &resultp)
-	})
-
 	if createError == nil || IsPending(createError) {
-		if err = computeSystem.registerCallback(); err != nil {
+		defer func() {
+			if err != nil {
+				computeSystem.Close()
+			}
+		}()
+		if err = computeSystem.registerCallback(ctx); err != nil {
 			// Terminate the compute system if it still exists. We're okay to
 			// ignore a failure here.
-			computeSystem.Terminate()
+			computeSystem.Terminate(ctx)
 			return nil, makeSystemError(computeSystem, operation, "", err, nil)
 		}
 	}
 
-	events, err := processAsyncHcsResult(createError, resultp, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.SystemCreate)
+	events, err := processAsyncHcsResult(ctx, createError, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.SystemCreate)
 	if err != nil {
 		if err == ErrTimeout {
 			// Terminate the compute system if it still exists. We're okay to
 			// ignore a failure here.
-			computeSystem.Terminate()
+			computeSystem.Terminate(ctx)
 		}
 		return nil, makeSystemError(computeSystem, operation, hcsDocument, err, events)
 	}
-
+	go computeSystem.waitBackground()
+	if err = computeSystem.getCachedProperties(ctx); err != nil {
+		return nil, err
+	}
 	return computeSystem, nil
 }
 
 // OpenComputeSystem opens an existing compute system by ID.
-func OpenComputeSystem(id string) (_ *System, err error) {
+func OpenComputeSystem(ctx context.Context, id string) (*System, error) {
 	operation := "hcsshim::OpenComputeSystem"
 
 	computeSystem := newSystem(id)
-	computeSystem.logOperationBegin(operation)
+	handle, resultJSON, err := vmcompute.HcsOpenComputeSystem(ctx, id)
-	defer func() {
+	events := processHcsResult(ctx, resultJSON)
-		if IsNotExist(err) {
-			computeSystem.logOperationEnd(operation, nil)
-		} else {
-			computeSystem.logOperationEnd(operation, err)
-		}
-	}()
-
-	var (
-		handle  hcsSystem
-		resultp *uint16
-	)
-	err = hcsOpenComputeSystem(id, &handle, &resultp)
-	events := processHcsResult(resultp)
 	if err != nil {
 		return nil, makeSystemError(computeSystem, operation, "", err, events)
 	}
-
 	computeSystem.handle = handle
-
+	defer func() {
-	if err = computeSystem.registerCallback(); err != nil {
+		if err != nil {
+			computeSystem.Close()
+		}
+	}()
+	if err = computeSystem.registerCallback(ctx); err != nil {
 		return nil, makeSystemError(computeSystem, operation, "", err, nil)
 	}
-
+	go computeSystem.waitBackground()
+	if err = computeSystem.getCachedProperties(ctx); err != nil {
+		return nil, err
+	}
 	return computeSystem, nil
 }
 
+func (computeSystem *System) getCachedProperties(ctx context.Context) error {
+	props, err := computeSystem.Properties(ctx)
+	if err != nil {
+		return err
+	}
+	computeSystem.typ = strings.ToLower(props.SystemType)
+	computeSystem.os = strings.ToLower(props.RuntimeOSType)
+	if computeSystem.os == "" && computeSystem.typ == "container" {
+		// Pre-RS5 HCS did not return the OS, but it only supported containers
+		// that ran Windows.
+		computeSystem.os = "windows"
+	}
+	return nil
+}
+
+// OS returns the operating system of the compute system, "linux" or "windows".
+func (computeSystem *System) OS() string {
+	return computeSystem.os
+}
+
+// IsOCI returns whether processes in the compute system should be created via
+// OCI.
+func (computeSystem *System) IsOCI() bool {
+	return computeSystem.os == "linux" && computeSystem.typ == "container"
+}
+
 // GetComputeSystems gets a list of the compute systems on the system that match the query
-func GetComputeSystems(q schema1.ComputeSystemQuery) (_ []schema1.ContainerProperties, err error) {
+func GetComputeSystems(ctx context.Context, q schema1.ComputeSystemQuery) ([]schema1.ContainerProperties, error) {
 	operation := "hcsshim::GetComputeSystems"
-	fields := logrus.Fields{}
-	logOperationBegin(
-		fields,
-		operation+" - Begin Operation")
-
-	defer func() {
-		var result string
-		if err == nil {
-			result = "Success"
-		} else {
-			result = "Error"
-		}
-
-		logOperationEnd(
-			fields,
-			operation+" - End Operation - "+result,
-			err)
-	}()
 
 	queryb, err := json.Marshal(q)
 	if err != nil {
 		return nil, err
 	}
 
-	query := string(queryb)
+	computeSystemsJSON, resultJSON, err := vmcompute.HcsEnumerateComputeSystems(ctx, string(queryb))
-
+	events := processHcsResult(ctx, resultJSON)
-	logrus.WithFields(fields).
-		WithField(logfields.JSON, query).
-		Debug("HCS ComputeSystem Query")
-
-	var (
-		resultp         *uint16
-		computeSystemsp *uint16
-	)
-
-	syscallWatcher(fields, func() {
-		err = hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp)
-	})
-	events := processHcsResult(resultp)
 	if err != nil {
 		return nil, &HcsError{Op: operation, Err: err, Events: events}
 	}
 
-	if computeSystemsp == nil {
+	if computeSystemsJSON == "" {
 		return nil, ErrUnexpectedValue
 	}
-	computeSystemsRaw := interop.ConvertAndFreeCoTaskMemBytes(computeSystemsp)
 	computeSystems := []schema1.ContainerProperties{}
-	if err = json.Unmarshal(computeSystemsRaw, &computeSystems); err != nil {
+	if err = json.Unmarshal([]byte(computeSystemsJSON), &computeSystems); err != nil {
 		return nil, err
 	}
 
@@ -216,16 +198,21 @@ func GetComputeSystems(q schema1.ComputeSystemQuery) (_ []schema1.ContainerPrope
 }
 
 // Start synchronously starts the computeSystem.
-func (computeSystem *System) Start() (err error) {
+func (computeSystem *System) Start(ctx context.Context) (err error) {
+	operation := "hcsshim::System::Start"
+
+	// hcsStartComputeSystemContext is an async operation. Start the outer span
+	// here to measure the full start time.
+	ctx, span := trace.StartSpan(ctx, operation)
+	defer span.End()
+	defer func() { oc.SetSpanStatus(span, err) }()
+	span.AddAttributes(trace.StringAttribute("cid", computeSystem.id))
+
 	computeSystem.handleLock.RLock()
 	defer computeSystem.handleLock.RUnlock()
 
-	operation := "hcsshim::ComputeSystem::Start"
-	computeSystem.logOperationBegin(operation)
-	defer func() { computeSystem.logOperationEnd(operation, err) }()
-
 	if computeSystem.handle == 0 {
-		return makeSystemError(computeSystem, "Start", "", ErrAlreadyClosed, nil)
+		return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil)
 	}
 
 	// This is a very simple backoff-retry loop to limit the number
@@ -254,13 +241,10 @@ func (computeSystem *System) Start() (err error) {
 		}()
 	}
 
-	var resultp *uint16
+	resultJSON, err := vmcompute.HcsStartComputeSystem(ctx, computeSystem.handle, "")
-	syscallWatcher(computeSystem.logctx, func() {
+	events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.SystemStart)
-		err = hcsStartComputeSystem(computeSystem.handle, "", &resultp)
-	})
-	events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.SystemStart)
 	if err != nil {
-		return makeSystemError(computeSystem, "Start", "", err, events)
+		return makeSystemError(computeSystem, operation, "", err, events)
 	}
 
 	return nil
@@ -271,360 +255,388 @@ func (computeSystem *System) ID() string {
 	return computeSystem.id
 }
 
-// Shutdown requests a compute system shutdown, if IsPending() on the error returned is true,
+// Shutdown requests a compute system shutdown.
-// it may not actually be shut down until Wait() succeeds.
+func (computeSystem *System) Shutdown(ctx context.Context) error {
-func (computeSystem *System) Shutdown() (err error) {
 	computeSystem.handleLock.RLock()
 	defer computeSystem.handleLock.RUnlock()
 
-	operation := "hcsshim::ComputeSystem::Shutdown"
+	operation := "hcsshim::System::Shutdown"
-	computeSystem.logOperationBegin(operation)
-	defer func() {
-		if IsAlreadyStopped(err) {
-			computeSystem.logOperationEnd(operation, nil)
-		} else {
-			computeSystem.logOperationEnd(operation, err)
-		}
-	}()
 
 	if computeSystem.handle == 0 {
-		return makeSystemError(computeSystem, "Shutdown", "", ErrAlreadyClosed, nil)
+		return nil
 	}
 
-	var resultp *uint16
+	resultJSON, err := vmcompute.HcsShutdownComputeSystem(ctx, computeSystem.handle, "")
-	syscallWatcher(computeSystem.logctx, func() {
+	events := processHcsResult(ctx, resultJSON)
-		err = hcsShutdownComputeSystem(computeSystem.handle, "", &resultp)
+	switch err {
-	})
+	case nil, ErrVmcomputeAlreadyStopped, ErrComputeSystemDoesNotExist, ErrVmcomputeOperationPending:
-	events := processHcsResult(resultp)
+	default:
-	if err != nil {
+		return makeSystemError(computeSystem, operation, "", err, events)
-		return makeSystemError(computeSystem, "Shutdown", "", err, events)
 	}
-
 	return nil
 }
 
-// Terminate requests a compute system terminate, if IsPending() on the error returned is true,
+// Terminate requests a compute system terminate.
-// it may not actually be shut down until Wait() succeeds.
+func (computeSystem *System) Terminate(ctx context.Context) error {
-func (computeSystem *System) Terminate() (err error) {
 	computeSystem.handleLock.RLock()
 	defer computeSystem.handleLock.RUnlock()
 
-	operation := "hcsshim::ComputeSystem::Terminate"
+	operation := "hcsshim::System::Terminate"
-	computeSystem.logOperationBegin(operation)
-	defer func() {
-		if IsPending(err) {
-			computeSystem.logOperationEnd(operation, nil)
-		} else {
-			computeSystem.logOperationEnd(operation, err)
-		}
-	}()
 
 	if computeSystem.handle == 0 {
-		return makeSystemError(computeSystem, "Terminate", "", ErrAlreadyClosed, nil)
+		return nil
 	}
 
-	var resultp *uint16
+	resultJSON, err := vmcompute.HcsTerminateComputeSystem(ctx, computeSystem.handle, "")
-	syscallWatcher(computeSystem.logctx, func() {
+	events := processHcsResult(ctx, resultJSON)
-		err = hcsTerminateComputeSystem(computeSystem.handle, "", &resultp)
+	switch err {
+	case nil, ErrVmcomputeAlreadyStopped, ErrComputeSystemDoesNotExist, ErrVmcomputeOperationPending:
+	default:
+		return makeSystemError(computeSystem, operation, "", err, events)
+	}
+	return nil
+}
+
+// waitBackground waits for the compute system exit notification. Once received
+// sets `computeSystem.waitError` (if any) and unblocks all `Wait` calls.
+//
+// This MUST be called exactly once per `computeSystem.handle` but `Wait` is
+// safe to call multiple times.
+func (computeSystem *System) waitBackground() {
+	operation := "hcsshim::System::waitBackground"
+	ctx, span := trace.StartSpan(context.Background(), operation)
+	defer span.End()
+	span.AddAttributes(trace.StringAttribute("cid", computeSystem.id))
+
+	err := waitForNotification(ctx, computeSystem.callbackNumber, hcsNotificationSystemExited, nil)
+	switch err {
+	case nil:
+		log.G(ctx).Debug("system exited")
+	case ErrVmcomputeUnexpectedExit:
+		log.G(ctx).Debug("unexpected system exit")
+		computeSystem.exitError = makeSystemError(computeSystem, operation, "", err, nil)
+		err = nil
+	default:
+		err = makeSystemError(computeSystem, operation, "", err, nil)
+	}
+	computeSystem.closedWaitOnce.Do(func() {
+		computeSystem.waitError = err
+		close(computeSystem.waitBlock)
 	})
-	events := processHcsResult(resultp)
+	oc.SetSpanStatus(span, err)
-	if err != nil && err != ErrVmcomputeAlreadyStopped {
-		return makeSystemError(computeSystem, "Terminate", "", err, events)
-	}
-
-	return nil
 }
 
-// Wait synchronously waits for the compute system to shutdown or terminate.
+// Wait synchronously waits for the compute system to shutdown or terminate. If
-func (computeSystem *System) Wait() (err error) {
+// the compute system has already exited returns the previous error (if any).
-	operation := "hcsshim::ComputeSystem::Wait"
+func (computeSystem *System) Wait() error {
-	computeSystem.logOperationBegin(operation)
+	<-computeSystem.waitBlock
-	defer func() { computeSystem.logOperationEnd(operation, err) }()
+	return computeSystem.waitError
-
-	err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil)
-	if err != nil {
-		return makeSystemError(computeSystem, "Wait", "", err, nil)
-	}
-
-	return nil
 }
 
-// WaitExpectedError synchronously waits for the compute system to shutdown or
+// ExitError returns an error describing the reason the compute system terminated.
-// terminate, and ignores the passed error if it occurs.
+func (computeSystem *System) ExitError() error {
-func (computeSystem *System) WaitExpectedError(expected error) (err error) {
+	select {
-	operation := "hcsshim::ComputeSystem::WaitExpectedError"
+	case <-computeSystem.waitBlock:
-	computeSystem.logOperationBegin(operation)
+		if computeSystem.waitError != nil {
-	defer func() { computeSystem.logOperationEnd(operation, err) }()
+			return computeSystem.waitError
-
+		}
-	err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil)
+		return computeSystem.exitError
-	if err != nil && getInnerError(err) != expected {
+	default:
-		return makeSystemError(computeSystem, "WaitExpectedError", "", err, nil)
+		return errors.New("container not exited")
 	}
-
-	return nil
 }
 
-// WaitTimeout synchronously waits for the compute system to terminate or the duration to elapse.
+// Properties returns the requested container properties targeting a V1 schema container.
-// If the timeout expires, IsTimeout(err) == true
+func (computeSystem *System) Properties(ctx context.Context, types ...schema1.PropertyType) (*schema1.ContainerProperties, error) {
-func (computeSystem *System) WaitTimeout(timeout time.Duration) (err error) {
-	operation := "hcsshim::ComputeSystem::WaitTimeout"
-	computeSystem.logOperationBegin(operation)
-	defer func() { computeSystem.logOperationEnd(operation, err) }()
-
-	err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, &timeout)
-	if err != nil {
-		return makeSystemError(computeSystem, "WaitTimeout", "", err, nil)
-	}
-
-	return nil
-}
-
-func (computeSystem *System) Properties(types ...schema1.PropertyType) (_ *schema1.ContainerProperties, err error) {
 	computeSystem.handleLock.RLock()
 	defer computeSystem.handleLock.RUnlock()
 
-	operation := "hcsshim::ComputeSystem::Properties"
+	operation := "hcsshim::System::Properties"
-	computeSystem.logOperationBegin(operation)
-	defer func() { computeSystem.logOperationEnd(operation, err) }()
 
-	queryj, err := json.Marshal(schema1.PropertyQuery{types})
+	queryBytes, err := json.Marshal(schema1.PropertyQuery{PropertyTypes: types})
 	if err != nil {
-		return nil, makeSystemError(computeSystem, "Properties", "", err, nil)
+		return nil, makeSystemError(computeSystem, operation, "", err, nil)
 	}
 
-	logrus.WithFields(computeSystem.logctx).
+	propertiesJSON, resultJSON, err := vmcompute.HcsGetComputeSystemProperties(ctx, computeSystem.handle, string(queryBytes))
-		WithField(logfields.JSON, queryj).
+	events := processHcsResult(ctx, resultJSON)
-		Debug("HCS ComputeSystem Properties Query")
-
-	var resultp, propertiesp *uint16
-	syscallWatcher(computeSystem.logctx, func() {
-		err = hcsGetComputeSystemProperties(computeSystem.handle, string(queryj), &propertiesp, &resultp)
-	})
-	events := processHcsResult(resultp)
 	if err != nil {
-		return nil, makeSystemError(computeSystem, "Properties", "", err, events)
+		return nil, makeSystemError(computeSystem, operation, "", err, events)
 	}
 
-	if propertiesp == nil {
+	if propertiesJSON == "" {
 		return nil, ErrUnexpectedValue
 	}
-	propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp)
 	properties := &schema1.ContainerProperties{}
-	if err := json.Unmarshal(propertiesRaw, properties); err != nil {
+	if err := json.Unmarshal([]byte(propertiesJSON), properties); err != nil {
-		return nil, makeSystemError(computeSystem, "Properties", "", err, nil)
+		return nil, makeSystemError(computeSystem, operation, "", err, nil)
+	}
+
+	return properties, nil
+}
+
+// PropertiesV2 returns the requested container properties targeting a V2 schema container.
+func (computeSystem *System) PropertiesV2(ctx context.Context, types ...hcsschema.PropertyType) (*hcsschema.Properties, error) {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+
+	operation := "hcsshim::System::PropertiesV2"
+
+	queryBytes, err := json.Marshal(hcsschema.PropertyQuery{PropertyTypes: types})
+	if err != nil {
+		return nil, makeSystemError(computeSystem, operation, "", err, nil)
+	}
+
+	propertiesJSON, resultJSON, err := vmcompute.HcsGetComputeSystemProperties(ctx, computeSystem.handle, string(queryBytes))
+	events := processHcsResult(ctx, resultJSON)
+	if err != nil {
+		return nil, makeSystemError(computeSystem, operation, "", err, events)
+	}
+
+	if propertiesJSON == "" {
+		return nil, ErrUnexpectedValue
+	}
+	properties := &hcsschema.Properties{}
+	if err := json.Unmarshal([]byte(propertiesJSON), properties); err != nil {
+		return nil, makeSystemError(computeSystem, operation, "", err, nil)
 	}
 
 	return properties, nil
 }
 
 // Pause pauses the execution of the computeSystem. This feature is not enabled in TP5.
-func (computeSystem *System) Pause() (err error) {
+func (computeSystem *System) Pause(ctx context.Context) (err error) {
+	operation := "hcsshim::System::Pause"
+
+	// hcsPauseComputeSystemContext is an async peration. Start the outer span
+	// here to measure the full pause time.
+	ctx, span := trace.StartSpan(ctx, operation)
+	defer span.End()
+	defer func() { oc.SetSpanStatus(span, err) }()
+	span.AddAttributes(trace.StringAttribute("cid", computeSystem.id))
+
 	computeSystem.handleLock.RLock()
 	defer computeSystem.handleLock.RUnlock()
 
-	operation := "hcsshim::ComputeSystem::Pause"
-	computeSystem.logOperationBegin(operation)
-	defer func() { computeSystem.logOperationEnd(operation, err) }()
-
 	if computeSystem.handle == 0 {
-		return makeSystemError(computeSystem, "Pause", "", ErrAlreadyClosed, nil)
+		return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil)
 	}
 
-	var resultp *uint16
+	resultJSON, err := vmcompute.HcsPauseComputeSystem(ctx, computeSystem.handle, "")
-	syscallWatcher(computeSystem.logctx, func() {
+	events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.SystemPause)
-		err = hcsPauseComputeSystem(computeSystem.handle, "", &resultp)
-	})
-	events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.SystemPause)
 	if err != nil {
-		return makeSystemError(computeSystem, "Pause", "", err, events)
+		return makeSystemError(computeSystem, operation, "", err, events)
 	}
 
 	return nil
 }
 
 // Resume resumes the execution of the computeSystem. This feature is not enabled in TP5.
-func (computeSystem *System) Resume() (err error) {
+func (computeSystem *System) Resume(ctx context.Context) (err error) {
+	operation := "hcsshim::System::Resume"
+
+	// hcsResumeComputeSystemContext is an async operation. Start the outer span
+	// here to measure the full restore time.
+	ctx, span := trace.StartSpan(ctx, operation)
+	defer span.End()
+	defer func() { oc.SetSpanStatus(span, err) }()
+	span.AddAttributes(trace.StringAttribute("cid", computeSystem.id))
+
 	computeSystem.handleLock.RLock()
 	defer computeSystem.handleLock.RUnlock()
 
-	operation := "hcsshim::ComputeSystem::Resume"
-	computeSystem.logOperationBegin(operation)
-	defer func() { computeSystem.logOperationEnd(operation, err) }()
-
 	if computeSystem.handle == 0 {
-		return makeSystemError(computeSystem, "Resume", "", ErrAlreadyClosed, nil)
+		return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil)
 	}
 
-	var resultp *uint16
+	resultJSON, err := vmcompute.HcsResumeComputeSystem(ctx, computeSystem.handle, "")
-	syscallWatcher(computeSystem.logctx, func() {
+	events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.SystemResume)
-		err = hcsResumeComputeSystem(computeSystem.handle, "", &resultp)
-	})
-	events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.SystemResume)
 	if err != nil {
-		return makeSystemError(computeSystem, "Resume", "", err, events)
+		return makeSystemError(computeSystem, operation, "", err, events)
 	}
 
 	return nil
 }
 
-// CreateProcess launches a new process within the computeSystem.
+func (computeSystem *System) createProcess(ctx context.Context, operation string, c interface{}) (*Process, *vmcompute.HcsProcessInformation, error) {
-func (computeSystem *System) CreateProcess(c interface{}) (_ *Process, err error) {
 	computeSystem.handleLock.RLock()
 	defer computeSystem.handleLock.RUnlock()
 
-	operation := "hcsshim::ComputeSystem::CreateProcess"
-	computeSystem.logOperationBegin(operation)
-	defer func() { computeSystem.logOperationEnd(operation, err) }()
-
-	var (
-		processInfo   hcsProcessInformation
-		processHandle hcsProcess
-		resultp       *uint16
-	)
-
 	if computeSystem.handle == 0 {
-		return nil, makeSystemError(computeSystem, "CreateProcess", "", ErrAlreadyClosed, nil)
+		return nil, nil, makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil)
 	}
 
 	configurationb, err := json.Marshal(c)
 	if err != nil {
-		return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil)
+		return nil, nil, makeSystemError(computeSystem, operation, "", err, nil)
 	}
 
 	configuration := string(configurationb)
-
+	processInfo, processHandle, resultJSON, err := vmcompute.HcsCreateProcess(ctx, computeSystem.handle, configuration)
-	logrus.WithFields(computeSystem.logctx).
+	events := processHcsResult(ctx, resultJSON)
-		WithField(logfields.JSON, configuration).
-		Debug("HCS ComputeSystem Process Document")
-
-	syscallWatcher(computeSystem.logctx, func() {
-		err = hcsCreateProcess(computeSystem.handle, configuration, &processInfo, &processHandle, &resultp)
-	})
-	events := processHcsResult(resultp)
 	if err != nil {
-		return nil, makeSystemError(computeSystem, "CreateProcess", configuration, err, events)
+		return nil, nil, makeSystemError(computeSystem, operation, configuration, err, events)
 	}
 
-	logrus.WithFields(computeSystem.logctx).
+	log.G(ctx).WithField("pid", processInfo.ProcessId).Debug("created process pid")
-		WithField(logfields.ProcessID, processInfo.ProcessId).
+	return newProcess(processHandle, int(processInfo.ProcessId), computeSystem), &processInfo, nil
-		Debug("HCS ComputeSystem CreateProcess PID")
+}
 
-	process := newProcess(processHandle, int(processInfo.ProcessId), computeSystem)
+// CreateProcessNoStdio launches a new process within the computeSystem. The
-	process.cachedPipes = &cachedPipes{
+// Stdio handles are not cached on the process struct.
-		stdIn:  processInfo.StdInput,
+func (computeSystem *System) CreateProcessNoStdio(c interface{}) (_ cow.Process, err error) {
-		stdOut: processInfo.StdOutput,
+	operation := "hcsshim::System::CreateProcessNoStdio"
-		stdErr: processInfo.StdError,
+	ctx, span := trace.StartSpan(context.Background(), operation)
-	}
+	defer span.End()
+	defer func() { oc.SetSpanStatus(span, err) }()
+	span.AddAttributes(trace.StringAttribute("cid", computeSystem.id))
 
-	if err = process.registerCallback(); err != nil {
+	process, processInfo, err := computeSystem.createProcess(ctx, operation, c)
-		return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil)
+	if err != nil {
+		return nil, err
 	}
+	defer func() {
+		if err != nil {
+			process.Close()
+		}
+	}()
+
+	// We don't do anything with these handles. Close them so they don't leak.
+	syscall.Close(processInfo.StdInput)
+	syscall.Close(processInfo.StdOutput)
+	syscall.Close(processInfo.StdError)
+
+	if err = process.registerCallback(ctx); err != nil {
+		return nil, makeSystemError(computeSystem, operation, "", err, nil)
+	}
+	go process.waitBackground()
+
+	return process, nil
+}
+
+// CreateProcess launches a new process within the computeSystem.
+func (computeSystem *System) CreateProcess(ctx context.Context, c interface{}) (cow.Process, error) {
+	operation := "hcsshim::System::CreateProcess"
+	process, processInfo, err := computeSystem.createProcess(ctx, operation, c)
+	if err != nil {
+		return nil, err
+	}
+	defer func() {
+		if err != nil {
+			process.Close()
+		}
+	}()
+
+	pipes, err := makeOpenFiles([]syscall.Handle{processInfo.StdInput, processInfo.StdOutput, processInfo.StdError})
+	if err != nil {
+		return nil, makeSystemError(computeSystem, operation, "", err, nil)
+	}
+	process.stdin = pipes[0]
+	process.stdout = pipes[1]
+	process.stderr = pipes[2]
+
+	if err = process.registerCallback(ctx); err != nil {
+		return nil, makeSystemError(computeSystem, operation, "", err, nil)
+	}
+	go process.waitBackground()
 
 	return process, nil
 }
 
 // OpenProcess gets an interface to an existing process within the computeSystem.
-func (computeSystem *System) OpenProcess(pid int) (_ *Process, err error) {
+func (computeSystem *System) OpenProcess(ctx context.Context, pid int) (*Process, error) {
 	computeSystem.handleLock.RLock()
 	defer computeSystem.handleLock.RUnlock()
 
-	// Add PID for the context of this operation
+	operation := "hcsshim::System::OpenProcess"
-	computeSystem.logctx[logfields.ProcessID] = pid
-	defer delete(computeSystem.logctx, logfields.ProcessID)
-
-	operation := "hcsshim::ComputeSystem::OpenProcess"
-	computeSystem.logOperationBegin(operation)
-	defer func() { computeSystem.logOperationEnd(operation, err) }()
-
-	var (
-		processHandle hcsProcess
-		resultp       *uint16
-	)
 
 	if computeSystem.handle == 0 {
-		return nil, makeSystemError(computeSystem, "OpenProcess", "", ErrAlreadyClosed, nil)
+		return nil, makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil)
 	}
 
-	syscallWatcher(computeSystem.logctx, func() {
+	processHandle, resultJSON, err := vmcompute.HcsOpenProcess(ctx, computeSystem.handle, uint32(pid))
-		err = hcsOpenProcess(computeSystem.handle, uint32(pid), &processHandle, &resultp)
+	events := processHcsResult(ctx, resultJSON)
-	})
-	events := processHcsResult(resultp)
 	if err != nil {
-		return nil, makeSystemError(computeSystem, "OpenProcess", "", err, events)
+		return nil, makeSystemError(computeSystem, operation, "", err, events)
 	}
 
 	process := newProcess(processHandle, pid, computeSystem)
-	if err = process.registerCallback(); err != nil {
+	if err = process.registerCallback(ctx); err != nil {
-		return nil, makeSystemError(computeSystem, "OpenProcess", "", err, nil)
+		return nil, makeSystemError(computeSystem, operation, "", err, nil)
 	}
+	go process.waitBackground()
 
 	return process, nil
 }
 
 // Close cleans up any state associated with the compute system but does not terminate or wait for it.
 func (computeSystem *System) Close() (err error) {
+	operation := "hcsshim::System::Close"
+	ctx, span := trace.StartSpan(context.Background(), operation)
+	defer span.End()
+	defer func() { oc.SetSpanStatus(span, err) }()
+	span.AddAttributes(trace.StringAttribute("cid", computeSystem.id))
+
 	computeSystem.handleLock.Lock()
 	defer computeSystem.handleLock.Unlock()
 
-	operation := "hcsshim::ComputeSystem::Close"
-	computeSystem.logOperationBegin(operation)
-	defer func() { computeSystem.logOperationEnd(operation, err) }()
-
 	// Don't double free this
 	if computeSystem.handle == 0 {
 		return nil
 	}
 
-	if err = computeSystem.unregisterCallback(); err != nil {
+	if err = computeSystem.unregisterCallback(ctx); err != nil {
-		return makeSystemError(computeSystem, "Close", "", err, nil)
+		return makeSystemError(computeSystem, operation, "", err, nil)
 	}
 
-	syscallWatcher(computeSystem.logctx, func() {
+	err = vmcompute.HcsCloseComputeSystem(ctx, computeSystem.handle)
-		err = hcsCloseComputeSystem(computeSystem.handle)
-	})
 	if err != nil {
-		return makeSystemError(computeSystem, "Close", "", err, nil)
+		return makeSystemError(computeSystem, operation, "", err, nil)
 	}
 
 	computeSystem.handle = 0
+	computeSystem.closedWaitOnce.Do(func() {
+		computeSystem.waitError = ErrAlreadyClosed
+		close(computeSystem.waitBlock)
+	})
 
 	return nil
 }
 
-func (computeSystem *System) registerCallback() error {
+func (computeSystem *System) registerCallback(ctx context.Context) error {
-	context := &notifcationWatcherContext{
+	callbackContext := &notifcationWatcherContext{
-		channels: newChannels(),
+		channels: newSystemChannels(),
+		systemID: computeSystem.id,
 	}
 
 	callbackMapLock.Lock()
 	callbackNumber := nextCallback
 	nextCallback++
-	callbackMap[callbackNumber] = context
+	callbackMap[callbackNumber] = callbackContext
 	callbackMapLock.Unlock()
 
-	var callbackHandle hcsCallback
+	callbackHandle, err := vmcompute.HcsRegisterComputeSystemCallback(ctx, computeSystem.handle, notificationWatcherCallback, callbackNumber)
-	err := hcsRegisterComputeSystemCallback(computeSystem.handle, notificationWatcherCallback, callbackNumber, &callbackHandle)
 	if err != nil {
 		return err
 	}
-	context.handle = callbackHandle
+	callbackContext.handle = callbackHandle
 	computeSystem.callbackNumber = callbackNumber
 
 	return nil
 }
 
-func (computeSystem *System) unregisterCallback() error {
+func (computeSystem *System) unregisterCallback(ctx context.Context) error {
 	callbackNumber := computeSystem.callbackNumber
 
 	callbackMapLock.RLock()
-	context := callbackMap[callbackNumber]
+	callbackContext := callbackMap[callbackNumber]
 	callbackMapLock.RUnlock()
 
-	if context == nil {
+	if callbackContext == nil {
 		return nil
 	}
 
-	handle := context.handle
+	handle := callbackContext.handle
 
 	if handle == 0 {
 		return nil
@@ -632,15 +644,15 @@ func (computeSystem *System) unregisterCallback() error {
 
 	// hcsUnregisterComputeSystemCallback has its own syncronization
 	// to wait for all callbacks to complete. We must NOT hold the callbackMapLock.
-	err := hcsUnregisterComputeSystemCallback(handle)
+	err := vmcompute.HcsUnregisterComputeSystemCallback(ctx, handle)
 	if err != nil {
 		return err
 	}
 
-	closeChannels(context.channels)
+	closeChannels(callbackContext.channels)
 
 	callbackMapLock.Lock()
-	callbackMap[callbackNumber] = nil
+	delete(callbackMap, callbackNumber)
 	callbackMapLock.Unlock()
 
 	handle = 0
@@ -649,36 +661,26 @@ func (computeSystem *System) unregisterCallback() error {
 }
 
 // Modify the System by sending a request to HCS
-func (computeSystem *System) Modify(config interface{}) (err error) {
+func (computeSystem *System) Modify(ctx context.Context, config interface{}) error {
 	computeSystem.handleLock.RLock()
 	defer computeSystem.handleLock.RUnlock()
 
-	operation := "hcsshim::ComputeSystem::Modify"
+	operation := "hcsshim::System::Modify"
-	computeSystem.logOperationBegin(operation)
-	defer func() { computeSystem.logOperationEnd(operation, err) }()
 
 	if computeSystem.handle == 0 {
-		return makeSystemError(computeSystem, "Modify", "", ErrAlreadyClosed, nil)
+		return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil)
 	}
 
-	requestJSON, err := json.Marshal(config)
+	requestBytes, err := json.Marshal(config)
 	if err != nil {
 		return err
 	}
 
-	requestString := string(requestJSON)
+	requestJSON := string(requestBytes)
-
+	resultJSON, err := vmcompute.HcsModifyComputeSystem(ctx, computeSystem.handle, requestJSON)
-	logrus.WithFields(computeSystem.logctx).
+	events := processHcsResult(ctx, resultJSON)
-		WithField(logfields.JSON, requestString).
-		Debug("HCS ComputeSystem Modify Document")
-
-	var resultp *uint16
-	syscallWatcher(computeSystem.logctx, func() {
-		err = hcsModifyComputeSystem(computeSystem.handle, requestString, &resultp)
-	})
-	events := processHcsResult(resultp)
 	if err != nil {
-		return makeSystemError(computeSystem, "Modify", requestString, err, events)
+		return makeSystemError(computeSystem, operation, requestJSON, err, events)
 	}
 
 	return nil

vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go

@@ -1,28 +1,34 @@
 package hcs
 
 import (
+	"context"
 	"time"
 
-	"github.com/sirupsen/logrus"
+	"github.com/Microsoft/hcsshim/internal/log"
 )
 
-func processAsyncHcsResult(err error, resultp *uint16, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) {
+func processAsyncHcsResult(ctx context.Context, err error, resultJSON string, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) {
-	events := processHcsResult(resultp)
+	events := processHcsResult(ctx, resultJSON)
 	if IsPending(err) {
-		return nil, waitForNotification(callbackNumber, expectedNotification, timeout)
+		return nil, waitForNotification(ctx, callbackNumber, expectedNotification, timeout)
 	}
 
 	return events, err
 }
 
-func waitForNotification(callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error {
+func waitForNotification(ctx context.Context, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error {
 	callbackMapLock.RLock()
+	if _, ok := callbackMap[callbackNumber]; !ok {
+		callbackMapLock.RUnlock()
+		log.G(ctx).WithField("callbackNumber", callbackNumber).Error("failed to waitForNotification: callbackNumber does not exist in callbackMap")
+		return ErrHandleClose
+	}
 	channels := callbackMap[callbackNumber].channels
 	callbackMapLock.RUnlock()
 
 	expectedChannel := channels[expectedNotification]
 	if expectedChannel == nil {
-		logrus.Errorf("unknown notification type in waitForNotification %x", expectedNotification)
+		log.G(ctx).WithField("type", expectedNotification).Error("unknown notification type in waitForNotification")
 		return ErrInvalidNotificationType
 	}
 

vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go

@@ -1,41 +0,0 @@
-package hcs
-
-import (
-	"context"
-
-	"github.com/Microsoft/hcsshim/internal/logfields"
-	"github.com/Microsoft/hcsshim/internal/timeout"
-	"github.com/sirupsen/logrus"
-)
-
-// syscallWatcher is used as a very simple goroutine around calls into
-// the platform. In some cases, we have seen HCS APIs not returning due to
-// various bugs, and the goroutine making the syscall ends up not returning,
-// prior to its async callback. By spinning up a syscallWatcher, it allows
-// us to at least log a warning if a syscall doesn't complete in a reasonable
-// amount of time.
-//
-// Usage is:
-//
-// syscallWatcher(logContext, func() {
-//    err = <syscall>(args...)
-// })
-//
-
-func syscallWatcher(logContext logrus.Fields, syscallLambda func()) {
-	ctx, cancel := context.WithTimeout(context.Background(), timeout.SyscallWatcher)
-	defer cancel()
-	go watchFunc(ctx, logContext)
-	syscallLambda()
-}
-
-func watchFunc(ctx context.Context, logContext logrus.Fields) {
-	select {
-	case <-ctx.Done():
-		if ctx.Err() != context.Canceled {
-			logrus.WithFields(logContext).
-				WithField(logfields.Timeout, timeout.SyscallWatcher).
-				Warning("Syscall did not complete within operation timeout. This may indicate a platform issue. If it appears to be making no forward progress, obtain the stacks and see if there is a syscall stuck in the platform API for a significant length of time.")
-		}
-	}
-}

vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go

@@ -3,6 +3,7 @@ package hns
 import (
 	"encoding/json"
 	"net"
+	"strings"
 
 	"github.com/sirupsen/logrus"
 )
@@ -94,6 +95,27 @@ func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) {
 	return nil, EndpointNotFoundError{EndpointName: endpointName}
 }
 
+type endpointAttachInfo struct {
+	SharedContainers json.RawMessage `json:",omitempty"`
+}
+
+func (endpoint *HNSEndpoint) IsAttached(vID string) (bool, error) {
+	attachInfo := endpointAttachInfo{}
+	err := hnsCall("GET", "/endpoints/"+endpoint.Id, "", &attachInfo)
+
+	// Return false allows us to just return the err
+	if err != nil {
+		return false, err
+	}
+
+	if strings.Contains(strings.ToLower(string(attachInfo.SharedContainers)), strings.ToLower(vID)) {
+		return true, nil
+	}
+
+	return false, nil
+
+}
+
 // Create Endpoint by sending EndpointRequest to HNS. TODO: Create a separate HNS interface to place all these methods
 func (endpoint *HNSEndpoint) Create() (*HNSEndpoint, error) {
 	operation := "Create"

vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go

@@ -9,23 +9,30 @@ import (
 	"github.com/sirupsen/logrus"
 )
 
-func hnsCall(method, path, request string, returnResponse interface{}) error {
+func hnsCallRawResponse(method, path, request string) (*hnsResponse, error) {
 	var responseBuffer *uint16
 	logrus.Debugf("[%s]=>[%s] Request : %s", method, path, request)
 
 	err := _hnsCall(method, path, request, &responseBuffer)
 	if err != nil {
-		return hcserror.New(err, "hnsCall ", "")
+		return nil, hcserror.New(err, "hnsCall ", "")
 	}
 	response := interop.ConvertAndFreeCoTaskMemString(responseBuffer)
 
 	hnsresponse := &hnsResponse{}
 	if err = json.Unmarshal([]byte(response), &hnsresponse); err != nil {
-		return err
+		return nil, err
 	}
+	return hnsresponse, nil
+}
 
+func hnsCall(method, path, request string, returnResponse interface{}) error {
+	hnsresponse, err := hnsCallRawResponse(method, path, request)
+	if err != nil {
+		return fmt.Errorf("failed during hnsCallRawResponse: %v", err)
+	}
 	if !hnsresponse.Success {
-		return fmt.Errorf("HNS failed with error : %s", hnsresponse.Error)
+		return fmt.Errorf("hns failed with error : %s", hnsresponse.Error)
 	}
 
 	if len(hnsresponse.Output) == 0 {

vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go

@@ -2,9 +2,9 @@ package hns
 
 import (
 	"encoding/json"
-	"net"
+	"errors"
-
 	"github.com/sirupsen/logrus"
+	"net"
 )
 
 // Subnet is assoicated with a network and represents a list
@@ -98,6 +98,12 @@ func (network *HNSNetwork) Create() (*HNSNetwork, error) {
 	title := "hcsshim::HNSNetwork::" + operation
 	logrus.Debugf(title+" id=%s", network.Id)
 
+	for _, subnet := range network.Subnets {
+		if (subnet.AddressPrefix != "") && (subnet.GatewayAddress == "") {
+			return nil, errors.New("network create error, subnet has address prefix but no gateway specified")
+		}
+	}
+
 	jsonString, err := json.Marshal(network)
 	if err != nil {
 		return nil, err

vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go

@@ -55,8 +55,9 @@ type PaPolicy struct {
 
 type OutboundNatPolicy struct {
 	Policy
-	VIP        string   `json:"VIP,omitempty"`
+	VIP          string   `json:"VIP,omitempty"`
-	Exceptions []string `json:"ExceptionList,omitempty"`
+	Exceptions   []string `json:"ExceptionList,omitempty"`
+	Destinations []string `json:",omitempty"`
 }
 
 type ActionType string

vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go

@@ -15,10 +15,6 @@ func ConvertAndFreeCoTaskMemString(buffer *uint16) string {
 	return str
 }
 
-func ConvertAndFreeCoTaskMemBytes(buffer *uint16) []byte {
-	return []byte(ConvertAndFreeCoTaskMemString(buffer))
-}
-
 func Win32FromHresult(hr uintptr) syscall.Errno {
 	if hr&0x1fff0000 == 0x00070000 {
 		return syscall.Errno(hr & 0xffff)

vendor/github.com/Microsoft/hcsshim/internal/log/g.go

@@ -0,0 +1,23 @@
+package log
+
+import (
+	"context"
+
+	"github.com/sirupsen/logrus"
+	"go.opencensus.io/trace"
+)
+
+// G returns a `logrus.Entry` with the `TraceID, SpanID` from `ctx` if `ctx`
+// contains an OpenCensus `trace.Span`.
+func G(ctx context.Context) *logrus.Entry {
+	span := trace.FromContext(ctx)
+	if span != nil {
+		sctx := span.SpanContext()
+		return logrus.WithFields(logrus.Fields{
+			"traceID": sctx.TraceID.String(),
+			"spanID":  sctx.SpanID.String(),
+			// "parentSpanID": TODO: JTERRY75 - Try to convince OC to export this?
+		})
+	}
+	return logrus.NewEntry(logrus.StandardLogger())
+}

vendor/github.com/Microsoft/hcsshim/internal/oc/exporter.go

@@ -0,0 +1,43 @@
+package oc
+
+import (
+	"github.com/sirupsen/logrus"
+	"go.opencensus.io/trace"
+)
+
+var _ = (trace.Exporter)(&LogrusExporter{})
+
+// LogrusExporter is an OpenCensus `trace.Exporter` that exports
+// `trace.SpanData` to logrus output.
+type LogrusExporter struct {
+}
+
+// ExportSpan exports `s` based on the the following rules:
+//
+// 1. All output will contain `s.Attributes`, `s.TraceID`, `s.SpanID`,
+// `s.ParentSpanID` for correlation
+//
+// 2. Any calls to .Annotate will not be supported.
+//
+// 3. The span itself will be written at `logrus.InfoLevel` unless
+// `s.Status.Code != 0` in which case it will be written at `logrus.ErrorLevel`
+// providing `s.Status.Message` as the error value.
+func (le *LogrusExporter) ExportSpan(s *trace.SpanData) {
+	// Combine all span annotations with traceID, spanID, parentSpanID
+	baseEntry := logrus.WithFields(logrus.Fields(s.Attributes))
+	baseEntry.Data["traceID"] = s.TraceID.String()
+	baseEntry.Data["spanID"] = s.SpanID.String()
+	baseEntry.Data["parentSpanID"] = s.ParentSpanID.String()
+	baseEntry.Data["startTime"] = s.StartTime
+	baseEntry.Data["endTime"] = s.EndTime
+	baseEntry.Data["duration"] = s.EndTime.Sub(s.StartTime).String()
+	baseEntry.Data["name"] = s.Name
+	baseEntry.Time = s.StartTime
+
+	level := logrus.InfoLevel
+	if s.Status.Code != 0 {
+		level = logrus.ErrorLevel
+		baseEntry.Data[logrus.ErrorKey] = s.Status.Message
+	}
+	baseEntry.Log(level, "Span")
+}

vendor/github.com/Microsoft/hcsshim/internal/oc/span.go

@@ -0,0 +1,17 @@
+package oc
+
+import (
+	"go.opencensus.io/trace"
+)
+
+// SetSpanStatus sets `span.SetStatus` to the proper status depending on `err`. If
+// `err` is `nil` assumes `trace.StatusCodeOk`.
+func SetSpanStatus(span *trace.Span, err error) {
+	status := trace.Status{}
+	if err != nil {
+		// TODO: JTERRY75 - Handle errors in a non-generic way
+		status.Code = trace.StatusCodeUnknown
+		status.Message = err.Error()
+	}
+	span.SetStatus(status)
+}

vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go

@@ -4,7 +4,8 @@ import (
 	"encoding/json"
 	"time"
 
-	"github.com/Microsoft/hcsshim/internal/schema2"
+	"github.com/Microsoft/go-winio/pkg/guid"
+	hcsschema "github.com/Microsoft/hcsshim/internal/schema2"
 )
 
 // ProcessConfig is used as both the input of Container.CreateProcess
@@ -62,7 +63,7 @@ type MappedVirtualDisk struct {
 	CreateInUtilityVM bool   `json:",omitempty"`
 	ReadOnly          bool   `json:",omitempty"`
 	Cache             string `json:",omitempty"` // "" (Unspecified); "Disabled"; "Enabled"; "Private"; "PrivateAllowSharing"
-	AttachOnly        bool   `json:",omitempty:`
+	AttachOnly        bool   `json:",omitempty"`
 }
 
 // AssignedDevice represents a device that has been directly assigned to a container
@@ -133,9 +134,10 @@ type ContainerProperties struct {
 	State                        string
 	Name                         string
 	SystemType                   string
+	RuntimeOSType                string `json:"RuntimeOsType,omitempty"`
 	Owner                        string
 	SiloGUID                     string                              `json:"SiloGuid,omitempty"`
-	RuntimeID                    string                              `json:"RuntimeId,omitempty"`
+	RuntimeID                    guid.GUID                           `json:"RuntimeId,omitempty"`
 	IsRuntimeTemplate            bool                                `json:",omitempty"`
 	RuntimeImagePath             string                              `json:",omitempty"`
 	Stopped                      bool                                `json:",omitempty"`
@@ -214,6 +216,7 @@ type MappedVirtualDiskController struct {
 type GuestDefinedCapabilities struct {
 	NamespaceAddRequestSupported bool `json:",omitempty"`
 	SignalProcessSupported       bool `json:",omitempty"`
+	DumpStacksSupported          bool `json:",omitempty"`
 }
 
 // GuestConnectionInfo is the structure of an iterm return by a GuestConnection call on a utility VM

vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go

@@ -10,7 +10,6 @@
 package hcsschema
 
 type Attachment struct {
-
 	Type_ string `json:"Type,omitempty"`
 
 	Path string `json:"Path,omitempty"`

vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go

@@ -10,7 +10,6 @@
 package hcsschema
 
 type CacheQueryStatsResponse struct {
-
 	L3OccupancyBytes int32 `json:"L3OccupancyBytes,omitempty"`
 
 	L3TotalBwBytes int32 `json:"L3TotalBwBytes,omitempty"`

vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go

@@ -10,6 +10,5 @@
 package hcsschema
 
 type CloseHandle struct {
-
 	Handle string `json:"Handle,omitempty"`
 }

vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go

@@ -11,7 +11,6 @@ package hcsschema
 
 //  ComPort specifies the named pipe that will be used for the port, with empty string indicating a disconnected port.
 type ComPort struct {
-
 	NamedPipe string `json:"NamedPipe,omitempty"`
 
 	OptimizeForDebugger bool `json:"OptimizeForDebugger,omitempty"`

vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go

@@ -10,14 +10,13 @@
 package hcsschema
 
 type ComputeSystem struct {
-
 	Owner string `json:"Owner,omitempty"`
 
 	SchemaVersion *Version `json:"SchemaVersion,omitempty"`
 
 	HostingSystemId string `json:"HostingSystemId,omitempty"`
 
-	HostedSystem *HostedSystem `json:"HostedSystem,omitempty"`
+	HostedSystem interface{} `json:"HostedSystem,omitempty"`
 
 	Container *Container `json:"Container,omitempty"`
 

vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go

@@ -25,37 +25,37 @@ func (c contextKey) String() string {
 
 var (
 	// ContextOAuth2 takes a oauth2.TokenSource as authentication for the request.
-	ContextOAuth2    	= contextKey("token")
+	ContextOAuth2 = contextKey("token")
 
 	// ContextBasicAuth takes BasicAuth as authentication for the request.
-	ContextBasicAuth 	= contextKey("basic")
+	ContextBasicAuth = contextKey("basic")
 
 	// ContextAccessToken takes a string oauth2 access token as authentication for the request.
-	ContextAccessToken 	= contextKey("accesstoken")
+	ContextAccessToken = contextKey("accesstoken")
 
 	// ContextAPIKey takes an APIKey as authentication for the request
- 	ContextAPIKey 		= contextKey("apikey")
+	ContextAPIKey = contextKey("apikey")
 )
 
-// BasicAuth provides basic http authentication to a request passed via context using ContextBasicAuth 
+// BasicAuth provides basic http authentication to a request passed via context using ContextBasicAuth
 type BasicAuth struct {
-	UserName      string            `json:"userName,omitempty"`
+	UserName string `json:"userName,omitempty"`
-	Password      string            `json:"password,omitempty"`	
+	Password string `json:"password,omitempty"`
 }
 
 // APIKey provides API key based authentication to a request passed via context using ContextAPIKey
 type APIKey struct {
-	Key 	string
+	Key    string
-	Prefix	string
+	Prefix string
 }
 
 type Configuration struct {
-	BasePath      string            	`json:"basePath,omitempty"`
+	BasePath      string            `json:"basePath,omitempty"`
-	Host          string            	`json:"host,omitempty"`
+	Host          string            `json:"host,omitempty"`
-	Scheme        string            	`json:"scheme,omitempty"`
+	Scheme        string            `json:"scheme,omitempty"`
-	DefaultHeader map[string]string 	`json:"defaultHeader,omitempty"`
+	DefaultHeader map[string]string `json:"defaultHeader,omitempty"`
-	UserAgent     string            	`json:"userAgent,omitempty"`
+	UserAgent     string            `json:"userAgent,omitempty"`
-	HTTPClient 	  *http.Client
+	HTTPClient    *http.Client
 }
 
 func NewConfiguration() *Configuration {
@@ -69,4 +69,4 @@ func NewConfiguration() *Configuration {
 
 func (c *Configuration) AddDefaultHeader(key string, value string) {
 	c.DefaultHeader[key] = value
-}
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go

@@ -10,7 +10,6 @@
 package hcsschema
 
 type ConsoleSize struct {
-
 	Height int32 `json:"Height,omitempty"`
 
 	Width int32 `json:"Width,omitempty"`

vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go

@@ -10,7 +10,6 @@
 package hcsschema
 
 type Container struct {
-
 	GuestOs *GuestOs `json:"GuestOs,omitempty"`
 
 	Storage *Storage `json:"Storage,omitempty"`

vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go

@@ -11,7 +11,6 @@ package hcsschema
 
 //  memory usage as viewed from within the container
 type ContainerMemoryInformation struct {
-
 	TotalPhysicalBytes int32 `json:"TotalPhysicalBytes,omitempty"`
 
 	TotalUsage int32 `json:"TotalUsage,omitempty"`

vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go

@@ -10,7 +10,6 @@
 package hcsschema
 
 type Devices struct {
-
 	ComPorts map[string]ComPort `json:"ComPorts,omitempty"`
 
 	Scsi map[string]Scsi `json:"Scsi,omitempty"`

vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go

@@ -10,6 +10,5 @@
 package hcsschema
 
 type EnhancedModeVideo struct {
-
 	ConnectionOptions *RdpConnectionOptions `json:"ConnectionOptions,omitempty"`
 }

vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go

@@ -10,7 +10,6 @@
 package hcsschema
 
 type FlexibleIoDevice struct {
-
 	EmulatorId string `json:"EmulatorId,omitempty"`
 
 	HostingModel string `json:"HostingModel,omitempty"`

vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go

@@ -10,6 +10,5 @@
 package hcsschema
 
 type GuestCrashReporting struct {
-
 	WindowsCrashSettings *WindowsCrashReporting `json:"WindowsCrashSettings,omitempty"`
 }

vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go

@@ -10,6 +10,5 @@
 package hcsschema
 
 type GuestOs struct {
-
 	HostName string `json:"HostName,omitempty"`
 }

vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go

@@ -10,7 +10,6 @@
 package hcsschema
 
 type HostedSystem struct {
-
 	SchemaVersion *Version `json:"SchemaVersion,omitempty"`
 
 	Container *Container `json:"Container,omitempty"`

vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go

@@ -10,7 +10,6 @@
 package hcsschema
 
 type HvSocket struct {
-
 	Config *HvSocketSystemConfig `json:"Config,omitempty"`
 
 	EnablePowerShellDirect bool `json:"EnablePowerShellDirect,omitempty"`

vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go

@@ -11,6 +11,5 @@ package hcsschema
 
 //  HvSocket configuration for a VM
 type HvSocket2 struct {
-
 	HvSocketConfig *HvSocketSystemConfig `json:"HvSocketConfig,omitempty"`
 }

vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go

@@ -10,7 +10,6 @@
 package hcsschema
 
 type Layer struct {
-
 	Id string `json:"Id,omitempty"`
 
 	Path string `json:"Path,omitempty"`

vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go

@@ -10,7 +10,6 @@
 package hcsschema
 
 type MappedDirectory struct {
-
 	HostPath string `json:"HostPath,omitempty"`
 
 	HostPathType string `json:"HostPathType,omitempty"`

vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go

@@ -10,7 +10,6 @@
 package hcsschema
 
 type MappedPipe struct {
-
 	ContainerPipeName string `json:"ContainerPipeName,omitempty"`
 
 	HostPath string `json:"HostPath,omitempty"`

vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go

@@ -10,6 +10,5 @@
 package hcsschema
 
 type Memory struct {
-
 	SizeInMB int32 `json:"SizeInMB,omitempty"`
 }

vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_2.go

@@ -22,4 +22,9 @@ type Memory2 struct {
 
 	// EnableDeferredCommit is private in the schema. If regenerated need to add back.
 	EnableDeferredCommit bool `json:"EnableDeferredCommit,omitempty"`
+
+	// EnableColdDiscardHint if enabled, then the memory cold discard hint feature is exposed
+	// to the VM, allowing it to trim non-zeroed pages from the working set (if supported by
+	// the guest operating system).
+	EnableColdDiscardHint bool `json:"EnableColdDiscardHint,omitempty"`
 }

vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go

@@ -10,8 +10,7 @@
 package hcsschema
 
 type MemoryInformationForVm struct {
-
+	VirtualNodeCount uint32 `json:"VirtualNodeCount,omitempty"`
-	VirtualNodeCount int32 `json:"VirtualNodeCount,omitempty"`
 
 	VirtualMachineMemory *VmMemory `json:"VirtualMachineMemory,omitempty"`
 

vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go

@@ -11,10 +11,9 @@ package hcsschema
 
 //  Memory runtime statistics
 type MemoryStats struct {
+	MemoryUsageCommitBytes uint64 `json:"MemoryUsageCommitBytes,omitempty"`
 
-	MemoryUsageCommitBytes int32 `json:"MemoryUsageCommitBytes,omitempty"`
+	MemoryUsageCommitPeakBytes uint64 `json:"MemoryUsageCommitPeakBytes,omitempty"`
 
-	MemoryUsageCommitPeakBytes int32 `json:"MemoryUsageCommitPeakBytes,omitempty"`
+	MemoryUsagePrivateWorkingSetBytes uint64 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"`
-
-	MemoryUsagePrivateWorkingSetBytes int32 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"`
 }

vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go

@@ -10,7 +10,6 @@
 package hcsschema
 
 type NetworkAdapter struct {
-
 	EndpointId string `json:"EndpointId,omitempty"`
 
 	MacAddress string `json:"MacAddress,omitempty"`

vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go

@@ -10,7 +10,6 @@
 package hcsschema
 
 type Networking struct {
-
 	AllowUnqualifiedDnsQuery bool `json:"AllowUnqualifiedDnsQuery,omitempty"`
 
 	DnsSearchList string `json:"DnsSearchList,omitempty"`

vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go

@@ -11,6 +11,5 @@ package hcsschema
 
 //  Notification data that is indicated to components running in the Virtual Machine.
 type PauseNotification struct {
-
 	Reason string `json:"Reason,omitempty"`
 }

vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go

@@ -11,7 +11,6 @@ package hcsschema
 
 //  Options for HcsPauseComputeSystem
 type PauseOptions struct {
-
 	SuspensionLevel string `json:"SuspensionLevel,omitempty"`
 
 	HostedNotification *PauseNotification `json:"HostedNotification,omitempty"`

vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go

@@ -10,6 +10,5 @@
 package hcsschema
 
 type Plan9 struct {
-
 	Shares []Plan9Share `json:"Shares,omitempty"`
 }

vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go

@@ -10,7 +10,6 @@
 package hcsschema
 
 type Plan9Share struct {
-
 	Name string `json:"Name,omitempty"`
 
 	//  The name by which the guest operation system can access this share, via  the aname parameter in the Plan9 protocol.
@@ -30,4 +29,6 @@ type Plan9Share struct {
 	ReadOnly bool `json:"ReadOnly,omitempty"`
 
 	UseShareRootIdentity bool `json:"UseShareRootIdentity,omitempty"`
+
+	AllowedFiles []string `json:"AllowedFiles,omitempty"`
 }

vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go

@@ -15,7 +15,6 @@ import (
 
 //  Information about a process running in a container
 type ProcessDetails struct {
-
 	ProcessId int32 `json:"ProcessId,omitempty"`
 
 	ImageName string `json:"ImageName,omitempty"`

vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go

@@ -11,7 +11,6 @@ package hcsschema
 
 //  Passed to HcsRpc_ModifyProcess
 type ProcessModifyRequest struct {
-
 	Operation string `json:"Operation,omitempty"`
 
 	ConsoleSize *ConsoleSize `json:"ConsoleSize,omitempty"`

vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go

@@ -10,7 +10,6 @@
 package hcsschema
 
 type ProcessParameters struct {
-
 	ApplicationName string `json:"ApplicationName,omitempty"`
 
 	CommandLine string `json:"CommandLine,omitempty"`

vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go

@@ -11,7 +11,6 @@ package hcsschema
 
 //  Status of a process running in a container
 type ProcessStatus struct {
-
 	ProcessId int32 `json:"ProcessId,omitempty"`
 
 	Exited bool `json:"Exited,omitempty"`

vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go

@@ -10,7 +10,6 @@
 package hcsschema
 
 type Processor struct {
-
 	Count int32 `json:"Count,omitempty"`
 
 	Maximum int32 `json:"Maximum,omitempty"`

vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go

@@ -10,7 +10,6 @@
 package hcsschema
 
 type Processor2 struct {
-
 	Count int32 `json:"Count,omitempty"`
 
 	Limit int32 `json:"Limit,omitempty"`

vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go

@@ -11,10 +11,9 @@ package hcsschema
 
 //  CPU runtime statistics
 type ProcessorStats struct {
+	TotalRuntime100ns uint64 `json:"TotalRuntime100ns,omitempty"`
 
-	TotalRuntime100ns int32 `json:"TotalRuntime100ns,omitempty"`
+	RuntimeUser100ns uint64 `json:"RuntimeUser100ns,omitempty"`
 
-	RuntimeUser100ns int32 `json:"RuntimeUser100ns,omitempty"`
+	RuntimeKernel100ns uint64 `json:"RuntimeKernel100ns,omitempty"`
-
-	RuntimeKernel100ns int32 `json:"RuntimeKernel100ns,omitempty"`
 }

vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go

@@ -9,8 +9,11 @@
 
 package hcsschema
 
-type Properties struct {
+import (
+	v1 "github.com/containerd/cgroups/stats/v1"
+)
 
+type Properties struct {
 	Id string `json:"Id,omitempty"`
 
 	SystemType string `json:"SystemType,omitempty"`
@@ -44,4 +47,8 @@ type Properties struct {
 	SharedMemoryRegionInfo []SharedMemoryRegionInfo `json:"SharedMemoryRegionInfo,omitempty"`
 
 	GuestConnectionInfo *GuestConnectionInfo `json:"GuestConnectionInfo,omitempty"`
+
+	// Metrics is not part of the API for HCS but this is used for LCOW v2 to
+	// return the full cgroup metrics from the guest.
+	Metrics *v1.Metrics `json:"LCOWMetrics,omitempty"`
 }

vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go

@@ -9,8 +9,7 @@
 
 package hcsschema
 
-//   By default the basic properties will be returned. This query provides a way to  request specific properties. 
+//   By default the basic properties will be returned. This query provides a way to  request specific properties.
 type PropertyQuery struct {
-
+	PropertyTypes []PropertyType `json:"PropertyTypes,omitempty"`
-	PropertyTypes []string `json:"PropertyTypes,omitempty"`
 }

vendor/github.com/Microsoft/hcsshim/internal/schema2/property_type.go

@@ -0,0 +1,23 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type PropertyType string
+
+const (
+	PTMemory                      PropertyType = "Memory"
+	PTGuestMemory                 PropertyType = "GuestMemory"
+	PTStatistics                  PropertyType = "Statistics"
+	PTProcessList                 PropertyType = "ProcessList"
+	PTTerminateOnLastHandleClosed PropertyType = "TerminateOnLastHandleClosed"
+	PTSharedMemoryRegion          PropertyType = "SharedMemoryRegion"
+	PTGuestConnection             PropertyType = "GuestConnection"
+	PTICHeartbeatStatus           PropertyType = "ICHeartbeatStatus"
+)

vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go

@@ -10,7 +10,6 @@
 package hcsschema
 
 type RdpConnectionOptions struct {
-
 	AccessSids []string `json:"AccessSids,omitempty"`
 
 	NamedPipe string `json:"NamedPipe,omitempty"`

vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go

@@ -10,7 +10,6 @@
 package hcsschema
 
 type RegistryChanges struct {
-
 	AddValues []RegistryValue `json:"AddValues,omitempty"`
 
 	DeleteKeys []RegistryKey `json:"DeleteKeys,omitempty"`

vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go

@@ -10,7 +10,6 @@
 package hcsschema
 
 type RegistryKey struct {
-
 	Hive string `json:"Hive,omitempty"`
 
 	Name string `json:"Name,omitempty"`

vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go

@@ -10,7 +10,6 @@
 package hcsschema
 
 type RegistryValue struct {
-
 	Key *RegistryKey `json:"Key,omitempty"`
 
 	Name string `json:"Name,omitempty"`

vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go

@@ -10,6 +10,5 @@
 package hcsschema
 
 type SharedMemoryConfiguration struct {
-
 	Regions []SharedMemoryRegion `json:"Regions,omitempty"`
 }

vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go

@@ -10,7 +10,6 @@
 package hcsschema
 
 type SharedMemoryRegion struct {
-
 	SectionName string `json:"SectionName,omitempty"`
 
 	StartOffset int32 `json:"StartOffset,omitempty"`

vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go

@@ -10,7 +10,6 @@
 package hcsschema
 
 type SharedMemoryRegionInfo struct {
-
 	SectionName string `json:"SectionName,omitempty"`
 
 	GuestPhysicalAddress int32 `json:"GuestPhysicalAddress,omitempty"`

vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go

@@ -11,7 +11,6 @@ package hcsschema
 
 //  Silo job information
 type SiloProperties struct {
-
 	Enabled bool `json:"Enabled,omitempty"`
 
 	JobName string `json:"JobName,omitempty"`

vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go

@@ -15,12 +15,11 @@ import (
 
 //  Runtime statistics for a container
 type Statistics struct {
-
 	Timestamp time.Time `json:"Timestamp,omitempty"`
 
 	ContainerStartTime time.Time `json:"ContainerStartTime,omitempty"`
 
-	Uptime100ns int32 `json:"Uptime100ns,omitempty"`
+	Uptime100ns uint64 `json:"Uptime100ns,omitempty"`
 
 	Processor *ProcessorStats `json:"Processor,omitempty"`
 

vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go

@@ -10,7 +10,6 @@
 package hcsschema
 
 type StorageQoS struct {
-
 	IopsMaximum int32 `json:"IopsMaximum,omitempty"`
 
 	BandwidthMaximum int32 `json:"BandwidthMaximum,omitempty"`

vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go

@@ -11,12 +11,11 @@ package hcsschema
 
 //  Storage runtime statistics
 type StorageStats struct {
+	ReadCountNormalized uint64 `json:"ReadCountNormalized,omitempty"`
 
-	ReadCountNormalized int32 `json:"ReadCountNormalized,omitempty"`
+	ReadSizeBytes uint64 `json:"ReadSizeBytes,omitempty"`
 
-	ReadSizeBytes int32 `json:"ReadSizeBytes,omitempty"`
+	WriteCountNormalized uint64 `json:"WriteCountNormalized,omitempty"`
 
-	WriteCountNormalized int32 `json:"WriteCountNormalized,omitempty"`
+	WriteSizeBytes uint64 `json:"WriteSizeBytes,omitempty"`
-
-	WriteSizeBytes int32 `json:"WriteSizeBytes,omitempty"`
 }

vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go

@@ -10,7 +10,6 @@
 package hcsschema
 
 type Topology struct {
-
 	Memory *Memory2 `json:"Memory,omitempty"`
 
 	Processor *Processor2 `json:"Processor,omitempty"`

vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go

@@ -10,7 +10,6 @@
 package hcsschema
 
 type Uefi struct {
-
 	EnableDebugger bool `json:"EnableDebugger,omitempty"`
 
 	SecureBootTemplateId string `json:"SecureBootTemplateId,omitempty"`

vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go

@@ -10,7 +10,6 @@
 package hcsschema
 
 type UefiBootEntry struct {
-
 	DeviceType string `json:"DeviceType,omitempty"`
 
 	DevicePath string `json:"DevicePath,omitempty"`

vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go

@@ -10,7 +10,6 @@
 package hcsschema
 
 type Version struct {
-
 	Major int32 `json:"Major,omitempty"`
 
 	Minor int32 `json:"Minor,omitempty"`

vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go

@@ -10,7 +10,6 @@
 package hcsschema
 
 type VideoMonitor struct {
-
 	HorizontalResolution int32 `json:"HorizontalResolution,omitempty"`
 
 	VerticalResolution int32 `json:"VerticalResolution,omitempty"`

vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go

@@ -10,7 +10,6 @@
 package hcsschema
 
 type VirtualNodeInfo struct {
-
 	VirtualNodeIndex int32 `json:"VirtualNodeIndex,omitempty"`
 
 	PhysicalNodeNumber int32 `json:"PhysicalNodeNumber,omitempty"`

vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go

@@ -10,7 +10,6 @@
 package hcsschema
 
 type VirtualPMemDevice struct {
-
 	HostPath string `json:"HostPath,omitempty"`
 
 	ReadOnly bool `json:"ReadOnly,omitempty"`

vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go

@@ -10,7 +10,6 @@
 package hcsschema
 
 type VirtualSmb struct {
-
 	Shares []VirtualSmbShare `json:"Shares,omitempty"`
 
 	DirectFileMappingInMB int64 `json:"DirectFileMappingInMB,omitempty"`

vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go

@@ -10,7 +10,6 @@
 package hcsschema
 
 type VirtualSmbShare struct {
-
 	Name string `json:"Name,omitempty"`
 
 	Path string `json:"Path,omitempty"`

vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go

@@ -10,7 +10,6 @@
 package hcsschema
 
 type VirtualSmbShareOptions struct {
-
 	ReadOnly bool `json:"ReadOnly,omitempty"`
 
 	//  convert exclusive access to shared read access

vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go

@@ -10,14 +10,13 @@
 package hcsschema
 
 type VmMemory struct {
-
 	AvailableMemory int32 `json:"AvailableMemory,omitempty"`
 
 	AvailableMemoryBuffer int32 `json:"AvailableMemoryBuffer,omitempty"`
 
-	ReservedMemory int32 `json:"ReservedMemory,omitempty"`
+	ReservedMemory uint64 `json:"ReservedMemory,omitempty"`
 
-	AssignedMemory int32 `json:"AssignedMemory,omitempty"`
+	AssignedMemory uint64 `json:"AssignedMemory,omitempty"`
 
 	SlpActive bool `json:"SlpActive,omitempty"`
 

vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go

@@ -10,7 +10,6 @@
 package hcsschema
 
 type WindowsCrashReporting struct {
-
 	DumpFileName string `json:"DumpFileName,omitempty"`
 
 	MaxDumpSize int64 `json:"MaxDumpSize,omitempty"`

vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go

@@ -0,0 +1,565 @@
+package vmcompute
+
+import (
+	gcontext "context"
+	"syscall"
+	"time"
+
+	"github.com/Microsoft/hcsshim/internal/interop"
+	"github.com/Microsoft/hcsshim/internal/log"
+	"github.com/Microsoft/hcsshim/internal/logfields"
+	"github.com/Microsoft/hcsshim/internal/oc"
+	"github.com/Microsoft/hcsshim/internal/timeout"
+	"go.opencensus.io/trace"
+)
+
+//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go vmcompute.go
+
+//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems?
+//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem?
+//sys hcsOpenComputeSystem(id string, computeSystem *HcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem?
+//sys hcsCloseComputeSystem(computeSystem HcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem?
+//sys hcsStartComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem?
+//sys hcsShutdownComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem?
+//sys hcsTerminateComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem?
+//sys hcsPauseComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem?
+//sys hcsResumeComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem?
+//sys hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties?
+//sys hcsModifyComputeSystem(computeSystem HcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem?
+//sys hcsRegisterComputeSystemCallback(computeSystem HcsSystem, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback?
+//sys hcsUnregisterComputeSystemCallback(callbackHandle HcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback?
+
+//sys hcsCreateProcess(computeSystem HcsSystem, processParameters string, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess?
+//sys hcsOpenProcess(computeSystem HcsSystem, pid uint32, process *HcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess?
+//sys hcsCloseProcess(process HcsProcess) (hr error) = vmcompute.HcsCloseProcess?
+//sys hcsTerminateProcess(process HcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess?
+//sys hcsSignalProcess(process HcsProcess, options string, result **uint16) (hr error) = vmcompute.HcsSignalProcess?
+//sys hcsGetProcessInfo(process HcsProcess, processInformation *HcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo?
+//sys hcsGetProcessProperties(process HcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties?
+//sys hcsModifyProcess(process HcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess?
+//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties?
+//sys hcsRegisterProcessCallback(process HcsProcess, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback?
+//sys hcsUnregisterProcessCallback(callbackHandle HcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback?
+
+// errVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously
+const errVmcomputeOperationPending = syscall.Errno(0xC0370103)
+
+// HcsSystem is the handle associated with a created compute system.
+type HcsSystem syscall.Handle
+
+// HcsProcess is the handle associated with a created process in a compute
+// system.
+type HcsProcess syscall.Handle
+
+// HcsCallback is the handle associated with the function to call when events
+// occur.
+type HcsCallback syscall.Handle
+
+// HcsProcessInformation is the structure used when creating or getting process
+// info.
+type HcsProcessInformation struct {
+	// ProcessId is the pid of the created process.
+	ProcessId uint32
+	reserved  uint32
+	// StdInput is the handle associated with the stdin of the process.
+	StdInput syscall.Handle
+	// StdOutput is the handle associated with the stdout of the process.
+	StdOutput syscall.Handle
+	// StdError is the handle associated with the stderr of the process.
+	StdError syscall.Handle
+}
+
+func execute(ctx gcontext.Context, timeout time.Duration, f func() error) error {
+	if timeout > 0 {
+		var cancel gcontext.CancelFunc
+		ctx, cancel = gcontext.WithTimeout(ctx, timeout)
+		defer cancel()
+	}
+
+	done := make(chan error, 1)
+	go func() {
+		done <- f()
+	}()
+	select {
+	case <-ctx.Done():
+		if ctx.Err() == gcontext.DeadlineExceeded {
+			log.G(ctx).WithField(logfields.Timeout, timeout).
+				Warning("Syscall did not complete within operation timeout. This may indicate a platform issue. If it appears to be making no forward progress, obtain the stacks and see if there is a syscall stuck in the platform API for a significant length of time.")
+		}
+		return ctx.Err()
+	case err := <-done:
+		return err
+	}
+}
+
+func HcsEnumerateComputeSystems(ctx gcontext.Context, query string) (computeSystems, result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsEnumerateComputeSystems")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		oc.SetSpanStatus(span, hr)
+	}()
+	span.AddAttributes(trace.StringAttribute("query", query))
+
+	return computeSystems, result, execute(ctx, timeout.SyscallWatcher, func() error {
+		var (
+			computeSystemsp *uint16
+			resultp         *uint16
+		)
+		err := hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp)
+		if computeSystemsp != nil {
+			computeSystems = interop.ConvertAndFreeCoTaskMemString(computeSystemsp)
+		}
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsCreateComputeSystem(ctx gcontext.Context, id string, configuration string, identity syscall.Handle) (computeSystem HcsSystem, result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsCreateComputeSystem")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		if hr != errVmcomputeOperationPending {
+			oc.SetSpanStatus(span, hr)
+		}
+	}()
+	span.AddAttributes(
+		trace.StringAttribute("id", id),
+		trace.StringAttribute("configuration", configuration))
+
+	return computeSystem, result, execute(ctx, timeout.SystemCreate, func() error {
+		var resultp *uint16
+		err := hcsCreateComputeSystem(id, configuration, identity, &computeSystem, &resultp)
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsOpenComputeSystem(ctx gcontext.Context, id string) (computeSystem HcsSystem, result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsOpenComputeSystem")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		oc.SetSpanStatus(span, hr)
+	}()
+
+	return computeSystem, result, execute(ctx, timeout.SyscallWatcher, func() error {
+		var resultp *uint16
+		err := hcsOpenComputeSystem(id, &computeSystem, &resultp)
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsCloseComputeSystem(ctx gcontext.Context, computeSystem HcsSystem) (hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsCloseComputeSystem")
+	defer span.End()
+	defer func() { oc.SetSpanStatus(span, hr) }()
+
+	return execute(ctx, timeout.SyscallWatcher, func() error {
+		return hcsCloseComputeSystem(computeSystem)
+	})
+}
+
+func HcsStartComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsStartComputeSystem")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		if hr != errVmcomputeOperationPending {
+			oc.SetSpanStatus(span, hr)
+		}
+	}()
+	span.AddAttributes(trace.StringAttribute("options", options))
+
+	return result, execute(ctx, timeout.SystemStart, func() error {
+		var resultp *uint16
+		err := hcsStartComputeSystem(computeSystem, options, &resultp)
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsShutdownComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsShutdownComputeSystem")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		if hr != errVmcomputeOperationPending {
+			oc.SetSpanStatus(span, hr)
+		}
+	}()
+	span.AddAttributes(trace.StringAttribute("options", options))
+
+	return result, execute(ctx, timeout.SyscallWatcher, func() error {
+		var resultp *uint16
+		err := hcsShutdownComputeSystem(computeSystem, options, &resultp)
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsTerminateComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsTerminateComputeSystem")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		if hr != errVmcomputeOperationPending {
+			oc.SetSpanStatus(span, hr)
+		}
+	}()
+	span.AddAttributes(trace.StringAttribute("options", options))
+
+	return result, execute(ctx, timeout.SyscallWatcher, func() error {
+		var resultp *uint16
+		err := hcsTerminateComputeSystem(computeSystem, options, &resultp)
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsPauseComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsPauseComputeSystem")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		if hr != errVmcomputeOperationPending {
+			oc.SetSpanStatus(span, hr)
+		}
+	}()
+	span.AddAttributes(trace.StringAttribute("options", options))
+
+	return result, execute(ctx, timeout.SystemPause, func() error {
+		var resultp *uint16
+		err := hcsPauseComputeSystem(computeSystem, options, &resultp)
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsResumeComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsResumeComputeSystem")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		if hr != errVmcomputeOperationPending {
+			oc.SetSpanStatus(span, hr)
+		}
+	}()
+	span.AddAttributes(trace.StringAttribute("options", options))
+
+	return result, execute(ctx, timeout.SystemResume, func() error {
+		var resultp *uint16
+		err := hcsResumeComputeSystem(computeSystem, options, &resultp)
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsGetComputeSystemProperties(ctx gcontext.Context, computeSystem HcsSystem, propertyQuery string) (properties, result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsGetComputeSystemProperties")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		oc.SetSpanStatus(span, hr)
+	}()
+	span.AddAttributes(trace.StringAttribute("propertyQuery", propertyQuery))
+
+	return properties, result, execute(ctx, timeout.SyscallWatcher, func() error {
+		var (
+			propertiesp *uint16
+			resultp     *uint16
+		)
+		err := hcsGetComputeSystemProperties(computeSystem, propertyQuery, &propertiesp, &resultp)
+		if propertiesp != nil {
+			properties = interop.ConvertAndFreeCoTaskMemString(propertiesp)
+		}
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsModifyComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, configuration string) (result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsModifyComputeSystem")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		oc.SetSpanStatus(span, hr)
+	}()
+	span.AddAttributes(trace.StringAttribute("configuration", configuration))
+
+	return result, execute(ctx, timeout.SyscallWatcher, func() error {
+		var resultp *uint16
+		err := hcsModifyComputeSystem(computeSystem, configuration, &resultp)
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsRegisterComputeSystemCallback(ctx gcontext.Context, computeSystem HcsSystem, callback uintptr, context uintptr) (callbackHandle HcsCallback, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsRegisterComputeSystemCallback")
+	defer span.End()
+	defer func() { oc.SetSpanStatus(span, hr) }()
+
+	return callbackHandle, execute(ctx, timeout.SyscallWatcher, func() error {
+		return hcsRegisterComputeSystemCallback(computeSystem, callback, context, &callbackHandle)
+	})
+}
+
+func HcsUnregisterComputeSystemCallback(ctx gcontext.Context, callbackHandle HcsCallback) (hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsUnregisterComputeSystemCallback")
+	defer span.End()
+	defer func() { oc.SetSpanStatus(span, hr) }()
+
+	return execute(ctx, timeout.SyscallWatcher, func() error {
+		return hcsUnregisterComputeSystemCallback(callbackHandle)
+	})
+}
+
+func HcsCreateProcess(ctx gcontext.Context, computeSystem HcsSystem, processParameters string) (processInformation HcsProcessInformation, process HcsProcess, result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsCreateProcess")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		oc.SetSpanStatus(span, hr)
+	}()
+	span.AddAttributes(trace.StringAttribute("processParameters", processParameters))
+
+	return processInformation, process, result, execute(ctx, timeout.SyscallWatcher, func() error {
+		var resultp *uint16
+		err := hcsCreateProcess(computeSystem, processParameters, &processInformation, &process, &resultp)
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsOpenProcess(ctx gcontext.Context, computeSystem HcsSystem, pid uint32) (process HcsProcess, result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsOpenProcess")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		oc.SetSpanStatus(span, hr)
+	}()
+	span.AddAttributes(trace.Int64Attribute("pid", int64(pid)))
+
+	return process, result, execute(ctx, timeout.SyscallWatcher, func() error {
+		var resultp *uint16
+		err := hcsOpenProcess(computeSystem, pid, &process, &resultp)
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsCloseProcess(ctx gcontext.Context, process HcsProcess) (hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsCloseProcess")
+	defer span.End()
+	defer func() { oc.SetSpanStatus(span, hr) }()
+
+	return execute(ctx, timeout.SyscallWatcher, func() error {
+		return hcsCloseProcess(process)
+	})
+}
+
+func HcsTerminateProcess(ctx gcontext.Context, process HcsProcess) (result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsTerminateProcess")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		oc.SetSpanStatus(span, hr)
+	}()
+
+	return result, execute(ctx, timeout.SyscallWatcher, func() error {
+		var resultp *uint16
+		err := hcsTerminateProcess(process, &resultp)
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsSignalProcess(ctx gcontext.Context, process HcsProcess, options string) (result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsSignalProcess")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		oc.SetSpanStatus(span, hr)
+	}()
+	span.AddAttributes(trace.StringAttribute("options", options))
+
+	return result, execute(ctx, timeout.SyscallWatcher, func() error {
+		var resultp *uint16
+		err := hcsSignalProcess(process, options, &resultp)
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsGetProcessInfo(ctx gcontext.Context, process HcsProcess) (processInformation HcsProcessInformation, result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsGetProcessInfo")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		oc.SetSpanStatus(span, hr)
+	}()
+
+	return processInformation, result, execute(ctx, timeout.SyscallWatcher, func() error {
+		var resultp *uint16
+		err := hcsGetProcessInfo(process, &processInformation, &resultp)
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsGetProcessProperties(ctx gcontext.Context, process HcsProcess) (processProperties, result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsGetProcessProperties")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		oc.SetSpanStatus(span, hr)
+	}()
+
+	return processProperties, result, execute(ctx, timeout.SyscallWatcher, func() error {
+		var (
+			processPropertiesp *uint16
+			resultp            *uint16
+		)
+		err := hcsGetProcessProperties(process, &processPropertiesp, &resultp)
+		if processPropertiesp != nil {
+			processProperties = interop.ConvertAndFreeCoTaskMemString(processPropertiesp)
+		}
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsModifyProcess(ctx gcontext.Context, process HcsProcess, settings string) (result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsModifyProcess")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		oc.SetSpanStatus(span, hr)
+	}()
+	span.AddAttributes(trace.StringAttribute("settings", settings))
+
+	return result, execute(ctx, timeout.SyscallWatcher, func() error {
+		var resultp *uint16
+		err := hcsModifyProcess(process, settings, &resultp)
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsGetServiceProperties(ctx gcontext.Context, propertyQuery string) (properties, result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsGetServiceProperties")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		oc.SetSpanStatus(span, hr)
+	}()
+	span.AddAttributes(trace.StringAttribute("propertyQuery", propertyQuery))
+
+	return properties, result, execute(ctx, timeout.SyscallWatcher, func() error {
+		var (
+			propertiesp *uint16
+			resultp     *uint16
+		)
+		err := hcsGetServiceProperties(propertyQuery, &propertiesp, &resultp)
+		if propertiesp != nil {
+			properties = interop.ConvertAndFreeCoTaskMemString(propertiesp)
+		}
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsRegisterProcessCallback(ctx gcontext.Context, process HcsProcess, callback uintptr, context uintptr) (callbackHandle HcsCallback, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsRegisterProcessCallback")
+	defer span.End()
+	defer func() { oc.SetSpanStatus(span, hr) }()
+
+	return callbackHandle, execute(ctx, timeout.SyscallWatcher, func() error {
+		return hcsRegisterProcessCallback(process, callback, context, &callbackHandle)
+	})
+}
+
+func HcsUnregisterProcessCallback(ctx gcontext.Context, callbackHandle HcsCallback) (hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsUnregisterProcessCallback")
+	defer span.End()
+	defer func() { oc.SetSpanStatus(span, hr) }()
+
+	return execute(ctx, timeout.SyscallWatcher, func() error {
+		return hcsUnregisterProcessCallback(callbackHandle)
+	})
+}

vendor/github.com/Microsoft/hcsshim/internal/vmcompute/zsyscall_windows.go

@@ -1,6 +1,6 @@
 // Code generated mksyscall_windows.exe DO NOT EDIT
 
-package hcs
+package vmcompute
 
 import (
 	"syscall"
@@ -56,13 +56,13 @@ var (
 	procHcsOpenProcess                     = modvmcompute.NewProc("HcsOpenProcess")
 	procHcsCloseProcess                    = modvmcompute.NewProc("HcsCloseProcess")
 	procHcsTerminateProcess                = modvmcompute.NewProc("HcsTerminateProcess")
-
+	procHcsSignalProcess                   = modvmcompute.NewProc("HcsSignalProcess")
-	procHcsGetProcessInfo            = modvmcompute.NewProc("HcsGetProcessInfo")
+	procHcsGetProcessInfo                  = modvmcompute.NewProc("HcsGetProcessInfo")
-	procHcsGetProcessProperties      = modvmcompute.NewProc("HcsGetProcessProperties")
+	procHcsGetProcessProperties            = modvmcompute.NewProc("HcsGetProcessProperties")
-	procHcsModifyProcess             = modvmcompute.NewProc("HcsModifyProcess")
+	procHcsModifyProcess                   = modvmcompute.NewProc("HcsModifyProcess")
-	procHcsGetServiceProperties      = modvmcompute.NewProc("HcsGetServiceProperties")
+	procHcsGetServiceProperties            = modvmcompute.NewProc("HcsGetServiceProperties")
-	procHcsRegisterProcessCallback   = modvmcompute.NewProc("HcsRegisterProcessCallback")
+	procHcsRegisterProcessCallback         = modvmcompute.NewProc("HcsRegisterProcessCallback")
-	procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback")
+	procHcsUnregisterProcessCallback       = modvmcompute.NewProc("HcsUnregisterProcessCallback")
 )
 
 func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) {
@@ -88,7 +88,7 @@ func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result
 	return
 }
 
-func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) {
+func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) {
 	var _p0 *uint16
 	_p0, hr = syscall.UTF16PtrFromString(id)
 	if hr != nil {
@@ -102,7 +102,7 @@ func hcsCreateComputeSystem(id string, configuration string, identity syscall.Ha
 	return _hcsCreateComputeSystem(_p0, _p1, identity, computeSystem, result)
 }
 
-func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) {
+func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) {
 	if hr = procHcsCreateComputeSystem.Find(); hr != nil {
 		return
 	}
@@ -116,7 +116,7 @@ func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall
 	return
 }
 
-func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) {
+func hcsOpenComputeSystem(id string, computeSystem *HcsSystem, result **uint16) (hr error) {
 	var _p0 *uint16
 	_p0, hr = syscall.UTF16PtrFromString(id)
 	if hr != nil {
@@ -125,7 +125,7 @@ func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16)
 	return _hcsOpenComputeSystem(_p0, computeSystem, result)
 }
 
-func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16) (hr error) {
+func _hcsOpenComputeSystem(id *uint16, computeSystem *HcsSystem, result **uint16) (hr error) {
 	if hr = procHcsOpenComputeSystem.Find(); hr != nil {
 		return
 	}
@@ -139,7 +139,7 @@ func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16
 	return
 }
 
-func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) {
+func hcsCloseComputeSystem(computeSystem HcsSystem) (hr error) {
 	if hr = procHcsCloseComputeSystem.Find(); hr != nil {
 		return
 	}
@@ -153,7 +153,7 @@ func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) {
 	return
 }
 
-func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
+func hcsStartComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) {
 	var _p0 *uint16
 	_p0, hr = syscall.UTF16PtrFromString(options)
 	if hr != nil {
@@ -162,7 +162,7 @@ func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uin
 	return _hcsStartComputeSystem(computeSystem, _p0, result)
 }
 
-func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
+func _hcsStartComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) {
 	if hr = procHcsStartComputeSystem.Find(); hr != nil {
 		return
 	}
@@ -176,7 +176,7 @@ func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **u
 	return
 }
 
-func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
+func hcsShutdownComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) {
 	var _p0 *uint16
 	_p0, hr = syscall.UTF16PtrFromString(options)
 	if hr != nil {
@@ -185,7 +185,7 @@ func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **
 	return _hcsShutdownComputeSystem(computeSystem, _p0, result)
 }
 
-func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
+func _hcsShutdownComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) {
 	if hr = procHcsShutdownComputeSystem.Find(); hr != nil {
 		return
 	}
@@ -199,7 +199,7 @@ func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result
 	return
 }
 
-func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
+func hcsTerminateComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) {
 	var _p0 *uint16
 	_p0, hr = syscall.UTF16PtrFromString(options)
 	if hr != nil {
@@ -208,7 +208,7 @@ func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result *
 	return _hcsTerminateComputeSystem(computeSystem, _p0, result)
 }
 
-func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
+func _hcsTerminateComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) {
 	if hr = procHcsTerminateComputeSystem.Find(); hr != nil {
 		return
 	}
@@ -222,7 +222,7 @@ func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result
 	return
 }
 
-func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
+func hcsPauseComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) {
 	var _p0 *uint16
 	_p0, hr = syscall.UTF16PtrFromString(options)
 	if hr != nil {
@@ -231,7 +231,7 @@ func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uin
 	return _hcsPauseComputeSystem(computeSystem, _p0, result)
 }
 
-func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
+func _hcsPauseComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) {
 	if hr = procHcsPauseComputeSystem.Find(); hr != nil {
 		return
 	}
@@ -245,7 +245,7 @@ func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **u
 	return
 }
 
-func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
+func hcsResumeComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) {
 	var _p0 *uint16
 	_p0, hr = syscall.UTF16PtrFromString(options)
 	if hr != nil {
@@ -254,7 +254,7 @@ func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **ui
 	return _hcsResumeComputeSystem(computeSystem, _p0, result)
 }
 
-func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
+func _hcsResumeComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) {
 	if hr = procHcsResumeComputeSystem.Find(); hr != nil {
 		return
 	}
@@ -268,7 +268,7 @@ func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result **
 	return
 }
 
-func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) {
+func hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) {
 	var _p0 *uint16
 	_p0, hr = syscall.UTF16PtrFromString(propertyQuery)
 	if hr != nil {
@@ -277,7 +277,7 @@ func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string
 	return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result)
 }
 
-func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) {
+func _hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) {
 	if hr = procHcsGetComputeSystemProperties.Find(); hr != nil {
 		return
 	}
@@ -291,7 +291,7 @@ func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint
 	return
 }
 
-func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) {
+func hcsModifyComputeSystem(computeSystem HcsSystem, configuration string, result **uint16) (hr error) {
 	var _p0 *uint16
 	_p0, hr = syscall.UTF16PtrFromString(configuration)
 	if hr != nil {
@@ -300,7 +300,7 @@ func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, resul
 	return _hcsModifyComputeSystem(computeSystem, _p0, result)
 }
 
-func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, result **uint16) (hr error) {
+func _hcsModifyComputeSystem(computeSystem HcsSystem, configuration *uint16, result **uint16) (hr error) {
 	if hr = procHcsModifyComputeSystem.Find(); hr != nil {
 		return
 	}
@@ -314,7 +314,7 @@ func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, res
 	return
 }
 
-func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) {
+func hcsRegisterComputeSystemCallback(computeSystem HcsSystem, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) {
 	if hr = procHcsRegisterComputeSystemCallback.Find(); hr != nil {
 		return
 	}
@@ -328,7 +328,7 @@ func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr,
 	return
 }
 
-func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) {
+func hcsUnregisterComputeSystemCallback(callbackHandle HcsCallback) (hr error) {
 	if hr = procHcsUnregisterComputeSystemCallback.Find(); hr != nil {
 		return
 	}
@@ -342,7 +342,7 @@ func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) {
 	return
 }
 
-func hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) {
+func hcsCreateProcess(computeSystem HcsSystem, processParameters string, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) {
 	var _p0 *uint16
 	_p0, hr = syscall.UTF16PtrFromString(processParameters)
 	if hr != nil {
@@ -351,7 +351,7 @@ func hcsCreateProcess(computeSystem hcsSystem, processParameters string, process
 	return _hcsCreateProcess(computeSystem, _p0, processInformation, process, result)
 }
 
-func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) {
+func _hcsCreateProcess(computeSystem HcsSystem, processParameters *uint16, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) {
 	if hr = procHcsCreateProcess.Find(); hr != nil {
 		return
 	}
@@ -365,7 +365,7 @@ func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, proce
 	return
 }
 
-func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) {
+func hcsOpenProcess(computeSystem HcsSystem, pid uint32, process *HcsProcess, result **uint16) (hr error) {
 	if hr = procHcsOpenProcess.Find(); hr != nil {
 		return
 	}
@@ -379,7 +379,7 @@ func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, re
 	return
 }
 
-func hcsCloseProcess(process hcsProcess) (hr error) {
+func hcsCloseProcess(process HcsProcess) (hr error) {
 	if hr = procHcsCloseProcess.Find(); hr != nil {
 		return
 	}
@@ -393,7 +393,7 @@ func hcsCloseProcess(process hcsProcess) (hr error) {
 	return
 }
 
-func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) {
+func hcsTerminateProcess(process HcsProcess, result **uint16) (hr error) {
 	if hr = procHcsTerminateProcess.Find(); hr != nil {
 		return
 	}
@@ -407,7 +407,7 @@ func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) {
 	return
 }
 
-func hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) {
+func hcsSignalProcess(process HcsProcess, options string, result **uint16) (hr error) {
 	var _p0 *uint16
 	_p0, hr = syscall.UTF16PtrFromString(options)
 	if hr != nil {
@@ -416,11 +416,11 @@ func hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr e
 	return _hcsSignalProcess(process, _p0, result)
 }
 
-func _hcsSignalProcess(process hcsProcess, options *uint16, result **uint16) (hr error) {
+func _hcsSignalProcess(process HcsProcess, options *uint16, result **uint16) (hr error) {
-	if hr = procHcsTerminateProcess.Find(); hr != nil {
+	if hr = procHcsSignalProcess.Find(); hr != nil {
 		return
 	}
-	r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
+	r0, _, _ := syscall.Syscall(procHcsSignalProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
 	if int32(r0) < 0 {
 		if r0&0x1fff0000 == 0x00070000 {
 			r0 &= 0xffff
@@ -430,7 +430,7 @@ func _hcsSignalProcess(process hcsProcess, options *uint16, result **uint16) (hr
 	return
 }
 
-func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) {
+func hcsGetProcessInfo(process HcsProcess, processInformation *HcsProcessInformation, result **uint16) (hr error) {
 	if hr = procHcsGetProcessInfo.Find(); hr != nil {
 		return
 	}
@@ -444,7 +444,7 @@ func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInforma
 	return
 }
 
-func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) {
+func hcsGetProcessProperties(process HcsProcess, processProperties **uint16, result **uint16) (hr error) {
 	if hr = procHcsGetProcessProperties.Find(); hr != nil {
 		return
 	}
@@ -458,7 +458,7 @@ func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, res
 	return
 }
 
-func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) {
+func hcsModifyProcess(process HcsProcess, settings string, result **uint16) (hr error) {
 	var _p0 *uint16
 	_p0, hr = syscall.UTF16PtrFromString(settings)
 	if hr != nil {
@@ -467,7 +467,7 @@ func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr
 	return _hcsModifyProcess(process, _p0, result)
 }
 
-func _hcsModifyProcess(process hcsProcess, settings *uint16, result **uint16) (hr error) {
+func _hcsModifyProcess(process HcsProcess, settings *uint16, result **uint16) (hr error) {
 	if hr = procHcsModifyProcess.Find(); hr != nil {
 		return
 	}
@@ -504,7 +504,7 @@ func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result
 	return
 }
 
-func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) {
+func hcsRegisterProcessCallback(process HcsProcess, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) {
 	if hr = procHcsRegisterProcessCallback.Find(); hr != nil {
 		return
 	}
@@ -518,7 +518,7 @@ func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context ui
 	return
 }
 
-func hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) {
+func hcsUnregisterProcessCallback(callbackHandle HcsCallback) (hr error) {
 	if hr = procHcsUnregisterProcessCallback.Find(); hr != nil {
 		return
 	}

vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go

@@ -1,7 +1,13 @@
 package wclayer
 
 import (
+	"os"
+	"path/filepath"
+	"syscall"
+	"unsafe"
+
 	"github.com/Microsoft/hcsshim/internal/hcserror"
+	"github.com/Microsoft/hcsshim/osversion"
 	"github.com/sirupsen/logrus"
 )
 
@@ -26,5 +32,114 @@ func ExpandScratchSize(path string, size uint64) (err error) {
 	if err != nil {
 		return hcserror.New(err, title+" - failed", "")
 	}
+
+	// Manually expand the volume now in order to work around bugs in 19H1 and
+	// prerelease versions of Vb. Remove once this is fixed in Windows.
+	if build := osversion.Get().Build; build >= osversion.V19H1 && build < 19020 {
+		err = expandSandboxVolume(path)
+		if err != nil {
+			return err
+		}
+	}
+	return nil
+}
+
+type virtualStorageType struct {
+	DeviceID uint32
+	VendorID [16]byte
+}
+
+type openVersion2 struct {
+	GetInfoOnly    int32    // bool but 4-byte aligned
+	ReadOnly       int32    // bool but 4-byte aligned
+	ResiliencyGUID [16]byte // GUID
+}
+
+type openVirtualDiskParameters struct {
+	Version  uint32 // Must always be set to 2
+	Version2 openVersion2
+}
+
+func attachVhd(path string) (syscall.Handle, error) {
+	var (
+		defaultType virtualStorageType
+		handle      syscall.Handle
+	)
+	parameters := openVirtualDiskParameters{Version: 2}
+	err := openVirtualDisk(
+		&defaultType,
+		path,
+		0,
+		0,
+		&parameters,
+		&handle)
+	if err != nil {
+		return 0, &os.PathError{Op: "OpenVirtualDisk", Path: path, Err: err}
+	}
+	err = attachVirtualDisk(handle, 0, 0, 0, 0, 0)
+	if err != nil {
+		syscall.Close(handle)
+		return 0, &os.PathError{Op: "AttachVirtualDisk", Path: path, Err: err}
+	}
+	return handle, nil
+}
+
+func expandSandboxVolume(path string) error {
+	// Mount the sandbox VHD temporarily.
+	vhdPath := filepath.Join(path, "sandbox.vhdx")
+	vhd, err := attachVhd(vhdPath)
+	if err != nil {
+		return &os.PathError{Op: "OpenVirtualDisk", Path: vhdPath, Err: err}
+	}
+	defer syscall.Close(vhd)
+
+	// Open the volume.
+	volumePath, err := GetLayerMountPath(path)
+	if err != nil {
+		return err
+	}
+	if volumePath[len(volumePath)-1] == '\\' {
+		volumePath = volumePath[:len(volumePath)-1]
+	}
+	volume, err := os.OpenFile(volumePath, os.O_RDWR, 0)
+	if err != nil {
+		return err
+	}
+	defer volume.Close()
+
+	// Get the volume's underlying partition size in NTFS clusters.
+	var (
+		partitionSize int64
+		bytes         uint32
+	)
+	const _IOCTL_DISK_GET_LENGTH_INFO = 0x0007405C
+	err = syscall.DeviceIoControl(syscall.Handle(volume.Fd()), _IOCTL_DISK_GET_LENGTH_INFO, nil, 0, (*byte)(unsafe.Pointer(&partitionSize)), 8, &bytes, nil)
+	if err != nil {
+		return &os.PathError{Op: "IOCTL_DISK_GET_LENGTH_INFO", Path: volume.Name(), Err: err}
+	}
+	const (
+		clusterSize = 4096
+		sectorSize  = 512
+	)
+	targetClusters := partitionSize / clusterSize
+
+	// Get the volume's current size in NTFS clusters.
+	var volumeSize int64
+	err = getDiskFreeSpaceEx(volume.Name()+"\\", nil, &volumeSize, nil)
+	if err != nil {
+		return &os.PathError{Op: "GetDiskFreeSpaceEx", Path: volume.Name(), Err: err}
+	}
+	volumeClusters := volumeSize / clusterSize
+
+	// Only resize the volume if there is space to grow, otherwise this will
+	// fail with invalid parameter. NTFS reserves one cluster.
+	if volumeClusters+1 < targetClusters {
+		targetSectors := targetClusters * (clusterSize / sectorSize)
+		const _FSCTL_EXTEND_VOLUME = 0x000900F0
+		err = syscall.DeviceIoControl(syscall.Handle(volume.Fd()), _FSCTL_EXTEND_VOLUME, (*byte)(unsafe.Pointer(&targetSectors)), 8, nil, 0, &bytes, nil)
+		if err != nil {
+			return &os.PathError{Op: "FSCTL_EXTEND_VOLUME", Path: volume.Name(), Err: err}
+		}
+	}
 	return nil
 }

vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go

@@ -3,7 +3,7 @@ package wclayer
 import (
 	"path/filepath"
 
-	"github.com/Microsoft/hcsshim/internal/guid"
+	"github.com/Microsoft/go-winio/pkg/guid"
 )
 
 // LayerID returns the layer ID of a layer on disk.

vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go

@@ -6,7 +6,7 @@ package wclayer
 import (
 	"syscall"
 
-	"github.com/Microsoft/hcsshim/internal/guid"
+	"github.com/Microsoft/go-winio/pkg/guid"
 	"github.com/sirupsen/logrus"
 )